summaryrefslogtreecommitdiffstats
path: root/src/core/hle (follow)
Commit message (Collapse)AuthorAgeFilesLines
* Merge pull request #5190 from Morph1984/validate_device_handlebunnei2020-12-162-0/+45
|\ | | | | controllers/npad: Validate device handles before use
| * controllers/npad: Validate device handles before useMorph2020-12-122-0/+45
| | | | | | | | Some games such as NEKOPARA Vol. 3 send invalid device handles when calling InitializeVibrationDevice. Introduce a check to validate the device handle before use.
* | Merge pull request #5119 from Morph1984/fs-opendatastoragewithprogramindexbunnei2020-12-155-8/+62
|\ \ | | | | | | fsp_srv: Implement OpenDataStorageWithProgramIndex
| * | fsp_srv: Implement OpenDataStorageWithProgramIndexMorph2020-12-084-1/+57
| | | | | | | | | | | | - Used by RollerCoaster Tycoon 3: Complete Edition
| * | file_sys: Consolidate common Title ID operationsMorph2020-12-081-7/+5
| | |
* | | Merge pull request #5168 from Morph1984/aoc-PurchaseEventManagerbunnei2020-12-152-2/+76
|\ \ \ | |_|/ |/| | aoc_u: Stub IPurchaseEventManager and its service commands
| * | IPurchaseEventManager: Implement GetPurchasedEventReadableHandleMorph2020-12-081-1/+14
| | | | | | | | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
| * | IPurchaseEventManager: Stub Set(Default)DeliveryTargetMorph2020-12-081-2/+27
| | | | | | | | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
| * | aoc_u: Stub Create(Permanent)EcPurchasedEventManagerMorph2020-12-082-2/+38
| |/ | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
* | Merge pull request #5172 from lioncash/svc-widebunnei2020-12-121-35/+25
|\ \ | | | | | | svc: Remove unnecessary casts
| * | svc: Remove unnecessary castsLioncash2020-12-081-35/+25
| |/ | | | | | | | | | | Simplifies and removes some casts. In all cases, these were generally widening from a 32-bit unsigned type to a 64-bit unsigned type, so no information would be lost from the conversion.
* | Merge pull request #5123 from Morph1984/nim-IsLargeResourceAvailablebunnei2020-12-101-1/+13
|\ \ | | | | | | nim: Stub IsLargeResourceAvailable
| * | nim: Stub IsLargeResourceAvailableMorph2020-12-041-1/+13
| | | | | | | | | | | | - Used by Immortals Fenyx Rising
* | | Merge pull request #5142 from comex/xx-poll-eventsRodrigo Locatti2020-12-094-40/+45
|\ \ \ | | | | | | | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`
| * | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`comex2020-12-074-40/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Actually, two enum classes, since for some reason there are two separate yet identical `PollFD` types used in the codebase. I get that one is ABI-compatible with the Switch while the other is an abstract type used for the host, but why not use `WSAPOLLFD` directly for the latter? Anyway, why make this change? Because on Apple platforms, `POLL_IN`, `POLL_OUT`, etc. (with an underscore) are defined as macros in <sys/signal.h>. (This is inherited from FreeBSD.) So defining a variable with the same name causes a compile error. I could just rename the variables, but while I was at it I thought I might as well switch to an enum for stronger typing. Also, change the type used for values copied directly to/from the `events` and `revents` fields of the host *native* `pollfd`/`WSASPOLLFD`, from `u32` to `short`, as `short` is the correct canonical type on both Unix and Windows.
* | | | Merge pull request #5166 from lioncash/log-castbunnei2020-12-0921-76/+67
|\ \ \ \ | | | | | | | | | | core: Remove unnecessary enum casts in log calls
| * | | | core: Remove unnecessary enum casts in log callsLioncash2020-12-0821-76/+67
| | | | | | | | | | | | | | | | | | | | | | | | | Follows the video core PR. fmt doesn't require casts for enum classes anymore, so we can remove quite a few casts.
* | | | | Merge pull request #5135 from Morph1984/applets-shadowbunnei2020-12-091-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | | applets: Resolve variable shadowing
| * | | | applets: Resolve variable shadowingMorph2020-12-051-1/+1
| | |_|/ | |/| |
* | | | controller: Use std::move within ConvertToFrontendParameters()Lioncash2020-12-081-3/+3
| | | | | | | | | | | | | | | | Avoids unnecessary copies.
* | | | controller: Avoid unnecessary copies in ConfigurationComplete()Lioncash2020-12-081-9/+8
| |/ / |/| | | | | | | | | | | Avoids unnecessary 1072 byte copies when querying info about controllers.
* | | Merge pull request #5148 from comex/xx-unused-fieldsbunnei2020-12-072-3/+3
|\ \ \ | | | | | | | | core: Mark unused fields as [[maybe_unused]]
| * | | core: Mark unused fields as [[maybe_unused]]comex2020-12-072-3/+3
| |/ /
* | | Merge pull request #5154 from comex/xx-ipcbunnei2020-12-072-34/+37
|\ \ \ | | | | | | | | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cpp
| * | | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cppcomex2020-12-072-34/+37
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Add a type check so that calling Push with an invalid type produces a compile error rather than a linker error. - vi.cpp was calling Push with a variable of type `std::size_t`. There's no explicit overload for `size_t`, but there is one for `u64`, which on most platforms is the same type as `size_t`. On macOS, however, it isn't: both types are 64 bits, but `size_t` is `unsigned long` and `u64` is `unsigned long long`. Regardless, it makes more sense to explicitly use `u64` here instead of `size_t`.
* | | Merge pull request #5147 from comex/xx-purevirtLC2020-12-071-33/+0
|\ \ \ | | | | | | | | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclass
| * | | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclasscomex2020-12-071-33/+0
| |/ /
* | | Merge pull request #5150 from comex/xx-boxcatLC2020-12-071-1/+1
|\ \ \ | | | | | | | | boxcat: Avoid unnecessary object copy
| * | | boxcat: Avoid unnecessary object copycomex2020-12-071-1/+1
| |/ /
* | | Merge pull request #5136 from lioncash/video-shadow3LC2020-12-071-3/+3
|\ \ \ | |_|/ |/| | video_core: Resolve more variable shadowing scenarios pt.3
| * | video_core: Resolve more variable shadowing scenarios pt.3Lioncash2020-12-051-3/+3
| |/ | | | | | | | | Cleans out the rest of the occurrences of variable shadowing and makes any further occurrences of shadowing compiler errors.
* / Fix "explicitly defaulted but implicitly deleted" warningcomex2020-12-071-1/+1
|/ | | | | | | | | | `PhysicalCore`'s move assignment operator was declared as `= default`, but was implicitly deleted because `PhysicalCore` has fields of reference type. Switch to explicitly deleting it to avoid a Clang warning. The move *constructor* is still defaulted, and is required to exist due to the use of `std::vector<PhysicalCore>`.
* Merge pull request #4996 from bunnei/use-4jitsbunnei2020-12-0416-120/+132
|\ | | | | Kernel: Refactor to use 4-instances of Dynarmic & various cleanups and improvements
| * kernel: scheduler: Minor cleanup to remove duplicated code.bunnei2020-11-292-46/+14
| |
| * kernel: time_manager: Protect access with a mutex.bunnei2020-11-292-1/+5
| |
| * hle: kernel: thread: Remove unused "Running" state.bunnei2020-11-292-6/+0
| |
| * core: arm: Implement InvalidateCacheRange for CPU cache invalidation.bunnei2020-11-295-10/+21
| |
| * hle: kernel: time_manager: Avoid a crash on process exit.bunnei2020-11-291-1/+4
| |
| * hle: kernel: AddressArbiter: Remove unused code.bunnei2020-11-292-9/+0
| |
| * hle: kernel: SynchronizationObject: Use atomic_bool for is_signaled.bunnei2020-11-291-1/+2
| |
| * common: fiber: Use boost::context instead of native fibers on Windows.bunnei2020-11-291-1/+1
| |
| * hle: kernel: multicore: Replace n-JITs impl. with 4 JITs.bunnei2020-11-298-57/+97
| |
* | Merge pull request #5000 from lioncash/audio-errorbunnei2020-12-031-1/+1
|\ \ | |/ |/| audio_core: Make shadowing and unused parameters errors
| * audio_core: Make shadowing and unused parameters errorsLioncash2020-12-031-1/+1
| | | | | | | | Moves the audio code closer to enabling warnings as errors in general.
* | Merge pull request #4998 from Morph1984/bioshock-patchbunnei2020-11-291-2/+4
|\ \ | | | | | | hid: Check if applet_resource exists in InitializeVibrationDevice
| * | hid: Check if applet_resource exists in InitializeVibrationDeviceMorph2020-11-251-2/+4
| |/
* | Add missing types to NpadCommunicationModegerman2020-11-291-0/+2
| |
* | Merge pull request #5021 from german77/StubCommunicationModebunnei2020-11-294-2/+50
|\ \ | | | | | | HID: Stub set and get NpadCommunicationMode
| * | Stub set and get NpadCommunicationModegerman2020-11-274-2/+50
| | |
* | | savedata_factory: Eliminate usage of the global system instanceLioncash2020-11-271-1/+2
| | | | | | | | | | | | Now there's only two meaningful instances left in core.
* | | service: Eliminate usages of the global system instanceLioncash2020-11-27219-897/+1207
|/ / | | | | | | | | Completely removes all usages of the global system instance within the services code by passing in the using system instance to the services.
* | Merge pull request #4975 from comex/invalid-syncpoint-idbunnei2020-11-261-2/+2
|\ \ | | | | | | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint ID
| * | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint IDcomex2020-11-241-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | - Use .at() instead of raw indexing when dealing with untrusted indices. - For the special case of WaitFence with syncpoint id UINT32_MAX, instead of crashing, log an error and ignore. This is what I get when running Super Mario Maker 2.
* | | Merge pull request #4981 from ogniK5377/ioctl-ctrlbunnei2020-11-2624-91/+214
|\ \ \ | |_|/ |/| | nvservices: Reintroducee IoctlCtrl
| * | nvservices: Reintroducee IoctlCtrlChloe Marcec2020-11-2424-91/+214
| |/ | | | | | | Fixes regression caused by #4907 which caused games like Breath of the Wild 1.0.0 not to boot.
* | service: am: Implement ExecuteProgram and required stubs.bunnei2020-11-252-3/+34
| | | | | | | | - This is used by Super Mario 3D All-Stars.
* | hle: services: Fix a crash with improper NVFlinger lifetime management. (#4977)bunnei2020-11-2416-97/+98
| | | | | | | | | | | | * hle: services: Fix a crash with improper NVFlinger lifetime management. - This crash would happen when attempting to shutdown yuzu early on in boot.
* | Merge pull request #4972 from lioncash/unused4Rodrigo Locatti2020-11-241-1/+1
|\ \ | |/ |/| svc: Remove unnecessary [[maybe_unused]] tag
| * svc: Remove unnecessary [[maybe_unused]] tagLioncash2020-11-231-1/+1
| | | | | | | | | | The parameter is used in this function, so this suppression isn't necessary.
* | Merge pull request #4944 from lioncash/system-rembunnei2020-11-228-31/+66
|\ \ | | | | | | patch_manager: Remove usages of the global system instance
| * | patch_manager: Remove usages of the global system instanceLioncash2020-11-188-31/+66
| |/ | | | | | | | | | | | | With this, only 19 usages of the global system instance remain within the core library. We're almost there.
* | Merge pull request #4907 from ogniK5377/nvdrv-cleanupbunnei2020-11-2126-898/+1220
|\ \ | | | | | | core: Make nvservices more standardized
| * | Addressed issuesChloe Marcec2020-11-1010-17/+86
| | |
| * | core: Make nvservices more standardizedChloe Marcec2020-11-1026-903/+1156
| | |
* | | olsc: Move member initialization to after member functions.bunnei2020-11-201-2/+2
| | |
* | | hle: service: Stub OLSC Initialize and SetSaveDataBackupSettingEnabled functions.bunnei2020-11-193-0/+87
| |/ |/| | | | | - Used by Animal Cross: New Horizons v1.6.0 update, minimal stub gets this update working.
* | hid: Reimplement Begin/EndPermitVibrationSessionMorph2020-11-163-5/+17
| | | | | | | | Upon further investigation, these commands allow temporary vibrations even when the "Controller Vibration" system setting is disabled. As a result, vibrations are allowed when either the system setting or this flag is set to true. Therefore, we can only block vibrations when both flags are set to false.
* | controllers/npad: Load input devices on initMorph2020-11-161-0/+2
| |
* | general: Fix compiler warnings on linux and miscellaneous changesMorph2020-11-162-8/+11
| |
* | controllers/npad: Remove the old vibration filterMorph2020-11-163-50/+64
| | | | | | | | Previously we used a vibration filter that filters out amplitudes close to each other. It turns out there are cases where this results into vibrations that are too inaccurate. Remove this and move the 100Hz vibration filter (Only allowing a maximum of 100 vibrations per second) from sdl_impl to npad when enable_accurate_vibrations is set to false.
* | hid: Implement InitializeVibrationDevice and IsVibrationDeviceMountedMorph2020-11-163-12/+66
| |
* | input_common: Add VibrationDevice and VibrationDeviceFactoryMorph2020-11-163-33/+27
| | | | | | | | | | | | A vibration device is an input device that returns an unsigned byte as status. It represents whether the vibration device supports vibration or not. If the status returns 1, it supports vibration. Otherwise, it does not support vibration.
* | configure_input: Add per-player vibrationMorph2020-11-161-2/+11
| | | | | | | | | | | | | | Allows for enabling and modifying vibration and vibration strength per player. Also adds a toggle for enabling/disabling accurate vibrations. Co-authored-by: Its-Rei <kupfel@gmail.com>
* | settings: Remove global vibration strength modifierMorph2020-11-161-3/+1
| | | | | | | | This will be replaced in favor of per-player vibration strength modifiers.
* | hid: Mark Begin/EndPermitVibrationSession as stubsMorph2020-11-163-18/+4
| | | | | | | | The implementation of these commands seem incomplete and causes rumble in Super Mario Party to stop working since only EndPermitVibrationSession is called. Thus, these are better off being marked as a stub until this can be investigated more thoroughly.
* | controllers/npad: Send an empty vibration on destruction/deactivationMorph2020-11-163-22/+38
| | | | | | | | This stops all controllers from continuously vibrating when emulation is stopped.
* | hid: Stub IsVibrationDeviceMountedMorph2020-11-162-1/+23
| | | | | | | | - Used in Super Mario Odyssey
* | controllers/npad: Add heuristics to reduce rumble state changesMorph2020-11-161-5/+46
| | | | | | | | | | Sending too many state changes in a short period of time can cause massive performance issues. As a result, we have to use several heuristics to reduce the number of state changes to minimize/eliminate this performance impact while maintaining the quality of these vibrations as much as possible.
* | configure_input: Hook up the vibration percentage spinboxMorph2020-11-161-1/+2
| | | | | | | | | | This allows setting the vibration strength percentage anywhere from 1% to 100%. Also hooks up the remaining motion button and checkbox in the Controller Applet.
* | controllers/npad: Stop games from vibrating incorrect controllersMorph2020-11-161-0/+10
| | | | | | | | Fixes vibration in 1-2 Switch and potentially other games where they would vibrate both players' joycons at the same time.
* | hid: Fix controller rumble based on new researchMorph2020-11-163-43/+69
| | | | | | | | | | This fixes the issue where rumble is only sent to the first controller. Now, individual controllers can receive their own rumble commands.
* | hid: Pop a struct of parameters instead of popping individual parametersMorph2020-11-161-103/+237
| | | | | | | | | | Some parameters need to be doubleword aligned due to the presence of the applet_resource_user_id. Previously, this value was invalid in many commands where it was not doubleword aligned when popped.
* | hid: Reorder all HID commandsMorph2020-11-164-215/+230
| | | | | | | | Reorders all HID commands in command id order.
* | hid: Implement GetVibrationDeviceInfoMorph2020-11-162-3/+39
| | | | | | | | | | | | | | | | | | | | The first u32 describes the vibration device type which is a Linear Resonant Actuator used in Nintendo Switch controller hardware. The second u32 describes the vibration device position, in this case distinguishing between left and right vibration actuators. Pro Controllers have 2 LRAs each that can vibrate independently of each other, which means they have 2 distinct vibration device handles to distinguish between the two actuators. Similarly for joycons, the left joycon can be distinguished from the right joycon through the vibration device handle since each joycon has 1 LRA.
* | hid: Stub InitializeVibrationDeviceMorph2020-11-161-3/+11
| |
* | controllers/npad: Rename NPadType to NpadStyleSetMorph2020-11-163-9/+9
| | | | | | | | This more accurately represents the underlying type and avoids confusion with NpadType
* | controllers/npad: Add DeviceHandle structMorph2020-11-161-27/+50
| | | | | | | | A DeviceHandle describes a vibration device or six-axis sensor based on the npad type, npad id, and device index/position
* | settings: Preparation for per-game input settingsMorph2020-11-166-25/+32
| |
* | controllers/npad: Connect a controller on init if none are connectedMorph2020-11-161-0/+13
| |
* | Merge pull request #4895 from Morph1984/cave-story-plus-applet-fixbunnei2020-11-132-26/+80
|\ \ | | | | | | applets/controller: Introduce additional checks for mode and caller
| * | applets: Rename LibraryAppletVersion to ControllerAppletVersionMorph2020-11-082-15/+15
| | |
| * | applets/controller: Pop normal data for StrapGuide and FirmwareUpdateMorph2020-11-082-6/+19
| | |
| * | applets/controller: Introduce additional checks for mode and callerMorph2020-11-082-5/+39
| | | | | | | | | | | | | | | Some games like Cave Story+ set invalid values in the ControllerPrivateArg's mode and caller fields. Use other fields to determine the appropriate mode and caller should either or both fields be invalid.
| * | applets/controller: Add ControllerUpdateFirmwareArg structMorph2020-11-081-0/+7
| | |
* | | Merge pull request #4901 from bunnei/caps-stubbunnei2020-11-102-9/+17
|\ \ \ | |_|/ |/| | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.
| * | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.bunnei2020-11-072-9/+17
| | | | | | | | | | | | | | | | | | - This works similiar to GetAlbumContentsFileListForApplication. - Since we do not implement the album, this should be safe to stub for now. - Used by Super Smash Bros. Ultimate (newer updates) in World of Light.
* | | ipc_helpers: Remove usage of the global system instanceLioncash2020-11-0816-7/+23
| |/ |/| | | | | | | | | | | | | | | Resolves numerous deprecation warnings throughout the codebase due to inclusion of this header. Now building core should be significantly less noisy (and also relying on less global state). This also uncovered quite a few modules that were relying on indirect includes, which have also been fixed.
* | video_core: dma_pusher: Remove integrity check on command lists.bunnei2020-11-071-1/+0
| | | | | | | | - This seems to cause softlocks in Breath of the Wild.
* | Merge pull request #4888 from lioncash/unicorn-removebunnei2020-11-072-28/+5
|\ \ | |/ |/| core: Remove usage of unicorn
| * core: Remove usage of unicornLioncash2020-11-042-28/+5
| | | | | | | | | | | | | | | | Unicorn long-since lost most of its use, due to dynarmic gaining support for handling most instructions. At this point any further issues encountered should be used to make dynarmic better. This also allows us to remove our dependency on Python.
* | Merge pull request #4858 from lioncash/initializerbunnei2020-11-041-0/+4
|\ \ | | | | | | General: Resolve a few missing initializer warnings
| * | General: Resolve a few missing initializer warningsLioncash2020-10-301-0/+4
| | | | | | | | | | | | Resolves a few -Wmissing-initializer warnings.
* | | Merge pull request #4869 from bunnei/improve-gpu-syncChloe2020-11-049-60/+291
|\ \ \ | |_|/ |/| | Improvements to GPU synchronization & various refactoring
| * | fixup! hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-012-3/+11
| | |
| * | hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-013-46/+106
| | | | | | | | | | | | | | | - Refactor so that SubmitGPFIFO and KickoffPB use shared functionality. - Implement add_wait and add_increment flags.
| * | service: hle: nvflinger: Fix potential shutdown crash when GPU is destroyed.bunnei2020-11-011-0/+4
| | |
| * | hle service: nvdrv: nvhost_ctrl: Update to use SyncpointManager.bunnei2020-11-013-9/+31
| | |
| * | hle service: nvdrv: Update to instantiate SyncpointManager.bunnei2020-11-012-5/+18
| | |
| * | hle: service: nvdrv: Implement SyncpointManager, to manage syncpoints.bunnei2020-11-013-1/+125
| | |
* | | Merge pull request #4878 from bunnei/unload-nrrbunnei2020-11-031-1/+15
|\ \ \ | |/ / |/| | hle: service: ldr: Implement UnloadNrr.
| * | hle: service: ldr: Implement UnloadNrr.bunnei2020-10-311-1/+15
| | | | | | | | | | | | - Used by Final Fantasy X/X-2 HD Remaster.
* | | Rename to align with switchbrew and remove gpu function (#4714)Levi Behunin2020-11-012-16/+10
|/ / | | | | | | | | * Rename to align with switchbrew * Rename to align with switchbrew and remove gpu function that checks if clearing should be done.
* | video_core: unbreak -Werror in NVDEC with ClangJan Beich2020-10-301-1/+1
| | | | | | | | | | | | src/core/hle/service/nvdrv/devices/nvhost_nvdec_common.cpp:41:15: error: unused variable 'OutOfMemory' [-Werror,-Wunused-const-variable] constexpr u32 OutOfMemory{static_cast<u32>(-12)}; ^
* | kernel/process: Add missing <ctime> includeMorph2020-10-291-0/+1
| | | | | | | | Fixes compilation on MSVC
* | Merge pull request #4835 from lat9nq/rng-default-timebunnei2020-10-291-1/+1
|\ \ | |/ |/| kernel: Use the current time as the default RNG seed
| * kernel: Use the current time as the default RNG seedlat9nq2020-10-271-1/+1
| | | | | | | | Use the current time, not zero, as the default RNG seed.
* | Merge pull request #4846 from lioncash/service-fnbunnei2020-10-285-1/+7
|\ \ | | | | | | service: Update function tables
| * | service: Update function tablesLioncash2020-10-285-1/+7
| | | | | | | | | | | | Updates function tables according to info on SwitchBrew.
* | | hle/kernel: Remove unused registered_core_threads to fix data racesReinUsesLisp2020-10-271-5/+0
|/ / | | | | | | | | This member was only used on asserts and it triggered data races. Remove it to fix them.
* | Merge pull request #4729 from ameerj/nvdec-prodbunnei2020-10-278-288/+468
|\ \ | | | | | | video_core: NVDEC Implementation
| * | video_core: NVDEC Implementationameerj2020-10-278-288/+468
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | This commit aims to implement the NVDEC (Nvidia Decoder) functionality, with video frame decoding being handled by the FFmpeg library. The process begins with Ioctl commands being sent to the NVDEC and VIC (Video Image Composer) emulated devices. These allocate the necessary GPU buffers for the frame data, along with providing information on the incoming video data. A Submit command then signals the GPU to process and decode the frame data. To decode the frame, the respective codec's header must be manually composed from the information provided by NVDEC, then sent with the raw frame data to the ffmpeg library. Currently, H264 and VP9 are supported, with VP9 having some minor artifacting issues related mainly to the reference frame composition in its uncompressed header. Async GPU is not properly implemented at the moment. Co-Authored-By: David <25727384+ogniK5377@users.noreply.github.com>
* / hle: services: TimeZoneContentManager: This can be made explicit.bunnei2020-10-271-1/+1
|/
* Merge pull request #4828 from lioncash/lockguardRodrigo Locatti2020-10-251-1/+1
|\ | | | | general: Use template deduction guides for lock_guard
| * general: Use template deduction guides for lock_guardLioncash2020-10-251-1/+1
| | | | | | | | Same behavior, less code.
* | Merge pull request #4792 from bunnei/rtc-fixbunnei2020-10-236-188/+302
|\ \ | |/ |/| service: time: Update current time with changes to RTC setting.
| * service: time: Update current time with changes to RTC setting.bunnei2020-10-136-188/+302
| | | | | | | | - This can be used to advance time, e.g. for Pokemon Sword/Shield pokejobs.
* | core: Fix clang build pt.3Lioncash2020-10-222-13/+3
| | | | | | | | Should finally resolve building with clang.
* | Revert "core: Fix clang build"bunnei2020-10-2154-433/+322
| |
* | kernel: Fix build with recent compiler flag changesLioncash2020-10-211-4/+8
| | | | | | | | | | This slipped through the cracks due to another change being merged before the compiler flag changes.
* | Merge pull request #4796 from lioncash/clangLC2020-10-2154-322/+433
|\ \ | | | | | | core: Fix clang build
| * | core: Fix clang buildLioncash2020-10-1854-322/+433
| | | | | | | | | | | | | | | | | | | | | Recent changes to the build system that made more warnings be flagged as errors caused building via clang to break. Fixes #4795
* | | Merge pull request #4390 from ogniK5377/get-applet-inf-stubbunnei2020-10-211-1/+11
|\ \ \ | | | | | | | | nifm: GetAppletInfo stub
| * | | Added remaining paramsDavid Marcec2020-10-201-1/+4
| | | |
| * | | nifm: GetAppletInfo stubDavid Marcec2020-10-201-1/+8
| | | | | | | | | | | | | | | | Fixes crash for Catherine Full Body
* | | | Merge pull request #4788 from ReinUsesLisp/lockfree-host-threadbunnei2020-10-201-28/+38
|\ \ \ \ | |/ / / |/| | | kernel: Implement host thread register methods without locking
| * | | kernel: Implement host thread register methods without lockingReinUsesLisp2020-10-131-28/+38
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Locks on GetCurrentHostThreadID were causing performance issues according to Visual Studio's profiler. It was consuming twice the time as arm_interface.Run(). The cost was not in the function itself but in the lockinig it required. Reimplement these functions using atomics and static storage instead of an unordered_map. This is a side effect to avoid locking and using linked lists for reads. Replace unordered_map with a linear search.
* | | Merge pull request #4785 from Morph1984/fs-hadesbunnei2020-10-201-2/+3
|\ \ \ | | | | | | | | filesystem: Fix CreateDirectory and DeleteFile
| * | | filesystem: Fix CreateDirectory and DeleteFileMorph2020-10-131-2/+3
| |/ / | | | | | | | | | | | | | | | Add a check if dir is nullptr (does not exist) Fixes save game creation in Hades
* | | Merge pull request #4783 from bunnei/nvdrv-freespacebunnei2020-10-182-0/+25
|\ \ \ | | | | | | | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.
| * | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.bunnei2020-10-132-0/+25
| |/ / | | | | | | | | | - This is used by Super Mario 3D All-Stars.
* | | Merge pull request #4801 from lioncash/missing-boundbunnei2020-10-181-1/+1
|\ \ \ | | | | | | | | mii/manager: Make use of unused lower bound in GetRandomValue()
| * | | mii/manager: Make use of unused lower bound in GetRandomValue()Lioncash2020-10-171-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the lower bound wasn't being used and zero was being used as the lower bound every time this function was called. This affects the outcome of some of the randomized entries a little bit, for example, the lower-bound for beard and mustache flags was supposed to be 1, not 0. Aside from these cases, the bug didn't affect anything else.
* | | | service: bcat: Check client connection before interacting with socket.bunnei2020-10-171-0/+10
|/ / / | | | | | | | | | - Fixes a crash when BCAT service is offline.
* | | Merge pull request #4784 from bunnei/cancelbufferbunnei2020-10-163-14/+53
|\ \ \ | | | | | | | | hle: service: vi: Implement BufferQueue::CancelBuffer.
| * | | hle: service: vi: Implement BufferQueue::CancelBuffer.bunnei2020-10-143-14/+53
| | |/ | |/| | | | | | | - This is used by Super Mario 3D All-Stars.
* / | service: acc: Stub IManagerForApplication::StoreOpenContext.bunnei2020-10-151-1/+7
|/ / | | | | | | - Used by Super Mario 3D All-Stars.
* / core/CMakeLists: Make some warnings errorsLioncash2020-10-1312-67/+52
|/ | | | | | | | | Makes our error coverage a little more consistent across the board by applying it to Linux side of things as well. This also makes it more consistent with the warning settings in other libraries in the project. This also updates httplib to 0.7.9, as there are several warning cleanups made that allow us to enable several warnings as errors.
* Merge pull request #4736 from Morph1984/home-button-input-protection-stubbunnei2020-10-074-2/+50
|\ | | | | hid: Stub HomeButtonInputProtection service commands
| * hid: Stub HomeButtonInputProtection service commandsMorph2020-09-304-2/+50
| | | | | | | | - Used in 1-2 Switch. Given that we do not emulate the functionality of the home button yet, we can stub this for now.
* | Merge pull request #4737 from Morph1984/setshimlibraryversion-stubbunnei2020-10-075-4/+38
|\ \ | | | | | | capsrv: Stub 3 variants of SetShimLibraryVersion
| * | caps_c: Stub SetShimLibraryVersionMorph2020-09-302-1/+18
| | | | | | | | | | | | - Used by caps_su SetShimLibraryVersion
| * | caps_u: Stub SetShimLibraryVersionMorph2020-09-302-2/+14
| | | | | | | | | | | | - Used in Super Smash Bros. Ultimate
| * | caps_su: Properly stub SetShimLibraryVersionMorph2020-09-301-1/+6
| |/
* | Merge pull request #4742 from german77/InputFilterbunnei2020-10-061-49/+58
|\ \ | | | | | | HID: Only use inputs corresponding to controller type
| * | Only use inputs corresponding to controller typegerman2020-10-021-49/+58
| | |
* | | Merge pull request #4734 from german77/motionfusionbunnei2020-10-022-1/+15
|\ \ \ | |/ / |/| | HID: Add Stub for EnableSixAxisSensorFusion
| * | Stubbed EnableSixAxisSensorFusiongerman2020-09-302-1/+15
| | |
* | | Merge pull request #4291 from german77/ImplementControllerRumbleDavid2020-09-303-13/+22
|\ \ \ | | | | | | | | input_common: First implementation of controller rumble
| * | | First implementation of controller rumblegerman2020-09-293-13/+22
| | | |
* | | | Merge pull request #4726 from lioncash/appletDavid2020-09-301-1/+2
|\ \ \ \ | |_|_|/ |/| | | frontend/controller: Eliminate dependency on the global system instance
| * | | frontend/controller: Eliminate dependency on the global system instanceLioncash2020-09-261-1/+2
| |/ /
* | | Merge pull request #4705 from german77/SplitMotionPollerbunnei2020-09-305-76/+157
|\ \ \ | |_|/ |/| | HID: Use different timing for motion
| * | Use different timing for motiongerman2020-09-245-76/+157
| | |
* | | Merge pull request #1703 from DarkLordZach/nvdec-ioctlbunnei2020-09-304-3/+256
|\ \ \ | |_|/ |/| | nvdrv: Stub nvdec/vic ioctls to bypass nvdec movies
| * | service: nvhost_vic: Ignore Submit commands.bunnei2020-06-052-1/+18
| | |
| * | nvdrv: Stub nvdec/vic ioctls to bypass nvdec moviesZach Hilman2020-06-054-3/+239
| | |
* | | Merge pull request #4717 from lioncash/debugLC2020-09-251-0/+17
|\ \ \ | | | | | | | | service: Restore "unused" function
| * | | service: Restore "unused" functionLioncash2020-09-251-0/+17
| | |/ | |/| | | | | | | Turns out this function is actually used, but within a trace log.
* | | Merge pull request #4678 from Morph1984/LoadOpenContext-partial-implbunnei2020-09-243-1/+13
|\ \ \ | |/ / |/| | acc: Partially implement LoadOpenContext
| * | acc: Stub LoadOpenContextMorph2020-09-213-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is used in multiple games such as: - Clubhouse Games: 51 Worldwide Classics - Grandia HD Collection - XCOM 2 Collection - Baldur's Gate 1/2 - Dr Kawashima's Brain Training - Super Mario 3D All-Stars
* | | General: Make use of std::nullopt where applicableLioncash2020-09-224-7/+7
|/ / | | | | | | | | | | | | | | Allows some implementations to avoid completely zeroing out the internal buffer of the optional, and instead only set the validity byte within the structure. This also makes it consistent how we return empty optionals.
* | Merge pull request #4683 from Morph1984/NpadHandheldActivationMode-implbunnei2020-09-203-5/+28
|\ \ | | | | | | hid: Implement Get/SetNpadHandheldActivationMode
| * | hid: Implement Get/SetNpadHandheldActivationModeMorph2020-09-183-5/+28
| | | | | | | | | | | | - Used in Clubhouse Games: 51 Worldwide Classics
* | | Merge pull request #4643 from FearlessTobi/decrease-pad-update-intervalbunnei2020-09-191-1/+1
|\ \ \ | | | | | | | | Test: Decrease pad_update_ns
| * | | Test: Decrease pad_update_nsFearlessTobi2020-09-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | There have been reports of quite heavy input lag in the past. Compared to Citra for example, our pad_update_ns value is very high. So let's decrease it and see if it helps with this problem.
* | | | am: Stub GetPreviousProgramIndexMorph2020-09-182-1/+11
| | | | | | | | | | | | | | | | - Used in Super Mario 3D All-Stars
* | | | Merge pull request #4665 from lioncash/sm-kernelRodrigo Locatti2020-09-172-8/+10
|\ \ \ \ | | | | | | | | | | service/sm: Eliminate dependency on the global system instance
| * | | | service/sm: Slightly more efficient string name validationLioncash2020-09-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | We can check the end of the string first for null-termination, rather than the beginning of the string.
| * | | | service/sm: Eliminate dependency on the global system instanceLioncash2020-09-172-6/+8
| | | | |
* | | | | Merge pull request #4666 from lioncash/unused-funcRodrigo Locatti2020-09-171-22/+0
|\ \ \ \ \ | | | | | | | | | | | | service: Remove unused funcation
| * | | | | service: Remove unused funcationLioncash2020-09-171-22/+0
| |/ / / / | | | | | | | | | | | | | | | This is now completely unused, so it can be removed.
* | | | | Merge pull request #4671 from lioncash/nfp-copyRodrigo Locatti2020-09-171-10/+13
|\ \ \ \ \ | | | | | | | | | | | | command_generator/nfp: Eliminate unnecessary copies
| * | | | | nfp: Eliminate two unnecessary copiesLioncash2020-09-171-10/+13
| |/ / / / | | | | | | | | | | | | | | | | | | | | GetAmiiboBuffer() returns by const reference, so we can use a reference instead of taking the returned buffer by value.
* | | | | Merge pull request #4594 from german77/MotionHIDbunnei2020-09-174-15/+184
|\ \ \ \ \ | |/ / / / |/| | | | hid/configuration: Implement motion controls to HID
| * | | | configure_input: Hook up the motion button and checkboxMorph2020-09-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | This allows toggling motion on or off, and allows access to the motion configuration. Also changes the [waiting] text for motion buttons to Shake! as this is how motion is connected to a player.
| * | | | Add cemu hook changes related to PR #4609german2020-09-051-2/+1
| | | | |
| * | | | Remove RealMotionDevicegerman2020-09-052-7/+8
| | | | |
| * | | | controllers/npad: Simplify motion entry assignmentMorph2020-09-051-29/+18
| | | | | | | | | | | | | | | | | | | | Simplifies the motion assignment in the Dual Joycon entry and assigns index 1 of the motion entry (Motion 2) for the right joycon.
| * | | | Include HID and configuration changes related to motiongerman2020-09-054-15/+195
| | | | |
* | | | | file_sys/bis_factory: Eliminate usage of the global system accessorLioncash2020-09-171-1/+1
| | | | |
* | | | | kernel: Remove all dependencies on the global system instanceLioncash2020-09-145-11/+20
| | | | | | | | | | | | | | | | | | | | | | | | | With this, the kernel finally doesn't depend directly on the global system instance anymore.
* | | | | Merge pull request #4636 from lioncash/kernel-hlebunnei2020-09-143-7/+5
|\ \ \ \ \ | |_|_|/ / |/| | | | service: Remove two usages of the global system accessor
| * | | | service: Remove two usages of the global system accessorLioncash2020-09-073-7/+5
| | |/ / | |/| | | | | | | | | | Removes more instances of reliance on global state.
* | | | Merge pull request #4323 from ReinUsesLisp/no-spinbunnei2020-09-121-1/+1
|\ \ \ \ | | | | | | | | | | kernel/scheduler: Use std::mutex instead of spin lock
| * | | | kernel/scheduler: Use std::mutex instead of spin lockReinUsesLisp2020-07-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Profiling shows that this is a highly contested mutex, causing dimishing results compared to a OS lock. std::mutex implementations can spin for a while before falling back to an OS lock. This avoids wasting precious CPU cycles in a no-op.
* | | | | Merge pull request #4634 from lioncash/blockingbunnei2020-09-123-19/+19
|\ \ \ \ \ | | | | | | | | | | | | bsd: Resolve a few warnings
| * | | | | bsd: Resolve unused value within SendToImplLioncash2020-09-071-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the address provided to SendToImpl would never be propagated to SendTo(). This fixes that.
| * | | | | bsd: Resolve sign comparison warningsLioncash2020-09-071-3/+3
| | | | | |
| * | | | | sockets_translate: Make use of designated initializersLioncash2020-09-071-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | Same behavior, less typing.
| * | | | | blocking_worker: Make use of templated lambdaLioncash2020-09-071-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can simplify this a little by explicitly specifying the typename for the lambda function.
| * | | | | blocking_worker: Resolve -Wdocumentation warningLioncash2020-09-071-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #4310 from ogniK5377/apollo-1-prodbunnei2020-09-111-72/+77
|\ \ \ \ \ | | | | | | | | | | | | audio_core: Apollo Part 1, AudioRenderer refactor
| * | | | | audio_core: Apollo Part 1, AudioRenderer refactorDavid Marcec2020-07-251-72/+77
| | | | | |
* | | | | | Merge pull request #4597 from Morph1984/mjolnir-p2bunnei2020-09-116-131/+415
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Project Mjölnir: Part 2 - Controller Applet
| * | | | | Address feedbackMorph2020-09-042-0/+7
| | | | | |
| * | | | | applets/controller: Set min_players to have a minimum value of 1.Morph2020-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | - Some games like Shipped have a minimum requirement of 0 connected players and is undesired behavior. We must require a minimum of 1 player connected regardless of what games may ask.
| * | | | | applets/controller: Implement fallback applet for the SDL frontendMorph2020-09-042-89/+0
| | | | | | | | | | | | | | | | | | | | | | | | Implement the fallback applet for the SDL frontend, connecting only the minimum amount of players required.
| * | | | | applets/controller: Implement "Explain Text"Morph2020-09-042-16/+26
| | | | | | | | | | | | | | | | | | | | | | | | "Explain Text" is additional text that is shown for each player in the controller applet.
| * | | | | Project Mjölnir: Part 2 - Controller AppletMorph2020-09-046-42/+398
| | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | | | | Merge pull request #4397 from ReinUsesLisp/bsdbunnei2020-09-069-56/+1384
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | services: Implement most of bsd:s and GetCurrentIpAddress from nifm
| * | | | | service/bsd: Handle Poll with no entries accuratelyReinUsesLisp2020-07-281-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Testing shows that Poll called with zero entries returns -1 and signals an errno of zero.
| * | | | | services/bsd: Implement most of bsd:sReinUsesLisp2020-07-285-55/+911
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implements: Socket, Poll, Accept, Bind, Connect, GetPeerName, GetSockName, Listen, Fcntl, SetSockOpt, Shutdown, Recv, RecvFrom, Send, SendTo, Write, and Close The implementation was done referencing: SwIPC, switchbrew, testing with libnx and inspecting its code, general information about bsd sockets online, and analysing official software. Not everything from these service calls is implemented, but everything that is not implemented will be logged in some way.
| * | | | | service/sockets: Add worker pool abstractionReinUsesLisp2020-07-281-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Manage worker threads with an easy to use abstraction. We can expand this to support thread deletion in the future.
| * | | | | service/sockets: Add worker abstraction to execute blocking calls asynchronouslyReinUsesLisp2020-07-281-0/+132
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This abstraction allows executing blocking functions (like recvfrom on a socket configured for blocking) without blocking the service thread. It is intended to be used with SleepClientThread.
| * | | | | service/sockets: Add translate functionsReinUsesLisp2020-07-282-0/+213
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions translate from Network enumerations/structures to guest enumerations/structures and viceversa.
| * | | | | service/sockets: Add enumerations and structuresReinUsesLisp2020-07-282-0/+81
| | | | | | | | | | | | | | | | | | | | | | | | Add guest enumerations and structures used in socket services
| * | | | | services/nifm: Implement GetCurrentIpAddressReinUsesLisp2020-07-281-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is trivially implemented using the Network abstraction - Used by ftpd
* | | | | | hid: Implement MergeSingleJoyasDualJoyMorph2020-09-043-5/+24
| |/ / / / |/| | | | | | | | | | | | | | - Used in multiple games such as Super Mario Odyssey.
* | | | | Merge pull request #4590 from ReinUsesLisp/tsan-schedbunnei2020-09-031-2/+6
|\ \ \ \ \ | | | | | | | | | | | | hle/scheduler: Fix data race in is_context_switch_pending
| * | | | | hle/scheduler: Fix data race in is_context_switch_pendingReinUsesLisp2020-08-261-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As reported by tsan, SelectThreads could write to is_context_switch_pending holding a mutex while SwitchToCurrent reads it without holding any. It is assumed that the author didn't want an atomic here, so the code is reordered so that whenever is_context_switch_pending is read inside SwitchToContext, the mutex is locked.
* | | | | | Merge pull request #4568 from lioncash/fspbunnei2020-09-031-3/+13
|\ \ \ \ \ \ | | | | | | | | | | | | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()
| * | | | | | fsp_srv: Resolve -Wunused-but-set-variable warningLioncash2020-08-231-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just log out the parameters in the meantime.
| * | | | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()Lioncash2020-08-231-2/+5
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Initialize id to a deterministic value and also mark the unreachable cases in the switch with UNREACHABLE().
* | | | | | Merge pull request #4564 from lioncash/file-includebunnei2020-09-031-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys: Replace inclusions with forward declarations where applicable
| * | | | | | file_sys: Replace inclusions with forward declarations where applicableLioncash2020-08-231-0/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Same behavior, minus unnecessary inclusions where not necessary.
* | | | | | Merge pull request #4382 from FearlessTobi/port-udp-configbunnei2020-09-012-1/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: Add motion and touch configuration from Citra
| * | | | | | yuzu: Add motion and touch configurationFearlessTobi2020-08-292-1/+12
| | | | | | |
* | | | | | | Merge pull request #4589 from ReinUsesLisp/tsan-hostbunnei2020-09-011-1/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | hle/kernel: Fix data race in GetCurrentHostThreadID
| * | | | | | hle/kernel: Fix data race in GetCurrentHostThreadIDReinUsesLisp2020-08-261-1/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As reported by tsan, host_thread_ids could be read while any of the RegisterHostThread variants were called. To fix this, lock the register mutex when yuzu is running in multicore mode and GetCurrentHostThreadID is called.
* | | | | | controllers/npad: Fix inconsistencies with controller connection statusesMorph2020-08-261-1/+7
| | | | | |
* | | | | | controllers/npad: Fix LibNX controller connection statusesMorph2020-08-261-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | This allows homebrew applications to be able to properly detect connected controllers.
* | | | | | controllers/npad: Fix LedPattern for P1-4Morph2020-08-261-3/+3
| | | | | |
* | | | | | Project Mjölnir: Part 1Morph2020-08-263-127/+111
|/ / / / / | | | | | | | | | | | | | | | | | | | | Co-authored-by: James Rowe <jroweboy@gmail.com> Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | | | common/fileutil: Convert namespace to Common::FSLioncash2020-08-165-73/+73
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Migrates a remaining common file over to the Common namespace, making it consistent with the rest of common files. This also allows for high-traffic FS related code to alias the filesystem function namespace as namespace FS = Common::FS; for more concise typing.
* | | | | Merge pull request #4526 from lioncash/core-semibunnei2020-08-153-7/+12
|\ \ \ \ \ | | | | | | | | | | | | core: Resolve several -Wextra-semi warnings
| * | | | | core: Resolve several -Wextra-semi warningsLioncash2020-08-143-7/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can amend one of the cascade macros to require semicolons in order to compile. In other cases, we can just remove the superfluous semicolons.
* | | | | | Merge pull request #4527 from lioncash/pessimizing2bunnei2020-08-151-2/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | software_keyboard: Resolve a pessimizing move warning
| * | | | | | software_keyboard: Resolve a pessimizing move warningLioncash2020-08-141-2/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | A std::vector created in place like this is already an rvalue and doesn't need to be moved.
* | | | | | Merge pull request #4492 from lioncash/linkagebunnei2020-08-152-15/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | system_control: Make functions internally linked where applicable
| * | | | | | system_control: Make functions internally linked where applicableLioncash2020-08-052-15/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions are only ever used internally as implementation details for GenerateRandomRange(), so these can be given internal linkage.
* | | | | | | Merge pull request #4463 from lioncash/lockdiscardbunnei2020-08-151-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/scheduler: Mark SchedulerLock constructor as nodiscard
| * | | | | | | kernel/scheduler: Mark SchedulerLock constructor as nodiscardLioncash2020-08-141-1/+1
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the compiler to warn about cases where the constructor is used but then immediately discarded, which is a potential cause of locking/unlocking bugs.
* / | | | | | time_zone_content_manager: Collapse auto and default caseLioncash2020-08-141-3/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | Prevents a useless self-assignment from occurring.
* | | | | | General: Tidy up clang-format warnings part 2Lioncash2020-08-136-40/+49
| | | | | |
* | | | | | Merge pull request #4491 from lioncash/unused-varsbunnei2020-08-102-18/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: Remove unused variables
| * | | | | | kernel: Remove unused variablesLioncash2020-08-052-18/+11
| |/ / / / / | | | | | | | | | | | | | | | | | | Resolves a few compiler warnings.
* | | | | | Merge pull request #4457 from ogniK5377/SetScreenShotPermissionbunnei2020-08-072-1/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | am: Unstub SetScreenShotPermission
| * | | | | | am: Unstub SetScreenShotPermissionDavid Marcec2020-07-312-1/+12
| | |/ / / / | |/| | | |
* | | | | | common/concepts: Rename IsBaseOf to DerivedFromLioncash2020-08-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes it more inline with its currently unavailable standardized analogue std::derived_from. While we're at it, we can also make the template match the requirements of the standardized variant as well.
* | | | | | Merge pull request #4490 from lioncash/arbiterbunnei2020-08-072-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | address_arbiter/scheduler: Resolve sign conversion warnings
| * | | | | | scheduler: Resolve sign conversion warningLioncash2020-08-051-1/+2
| | | | | | |
| * | | | | | address_arbiter: Resolve sign conversion warningLioncash2020-08-051-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | Makes our type conversion explicit.
* | | | | | Merge pull request #4489 from lioncash/typesafebunnei2020-08-061-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | ipc_helpers: Only allow trivially copyable objects with PushRaw() and PopRaw()
| * | | | | | ipc_helpers: Only allow trivially copyable objects with PushRaw() and PopRaw()Lioncash2020-08-051-0/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's undefined behavior to use non-trivially copyable objects with std::memcpy, so we can add asserts to catch usages of these at compile-time.
* | | | | | Merge pull request #4475 from lioncash/bqueuebunnei2020-08-051-10/+11
|\ \ \ \ \ \ | |/ / / / / |/| | | | | buffer_queue: Make use of designated initializers/std::nullopt where applicable
| * | | | | buffer_queue: Make use of std::nulloptLioncash2020-08-031-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows compilers to eliminate unnecessary zeroing out of the optional's buffer.
| * | | | | buffer_queue: Make use of designated initializersLioncash2020-08-031-5/+5
| |/ / / /
* | | | | Merge pull request #4401 from ogniK5377/GetIndirectLayerImageRequiredMemoryInfobunnei2020-08-051-1/+19
|\ \ \ \ \ | | | | | | | | | | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfo
| * | | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfoDavid Marcec2020-07-211-1/+19
| | |/ / / | |/| | | | | | | | | | | | | Needed for dark souls and monster hunter
* | | | | Merge pull request #4430 from bunnei/new-gpu-vmmbunnei2020-08-054-93/+227
|\ \ \ \ \ | | | | | | | | | | | | hle: nvdrv: Rewrite of GPU memory management.
| * | | | | Update src/core/hle/service/nvdrv/devices/nvmap.cppbunnei2020-07-281-1/+1
| | | | | | | | | | | | | | | | | | Co-authored-by: LC <mathew1800@gmail.com>
| * | | | | hle: nvdrv: Rewrite of GPU memory management.bunnei2020-07-264-93/+227
| | | | | |
* | | | | | Merge pull request #4481 from lioncash/cpp-depDavid2020-08-043-21/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: Resolve C++20 deprecation warnings related to lambda captures
| * | | | | | yuzu: Resolve C++20 deprecation warnings related to lambda capturesLioncash2020-08-033-21/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | C++20 deprecates capturing the this pointer via the '=' capture. Instead, we replace it or extend the capture specification.
* | | | | | | Merge pull request #4474 from lioncash/hle-profileDavid2020-08-041-17/+26
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | profile_manager: Make use of designated initializers
| * | | | | | | profile_manager: Make use of std::nulloptLioncash2020-08-031-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows some implementations to completely avoid unnecessarily zeroing out the internal buffer.
| * | | | | | | profile_manager: Make use of designated initializersLioncash2020-08-031-13/+22
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | More compact code.
* | | | | | | Merge pull request #4456 from Morph1984/stub-really-long-fs-funcbunnei2020-08-045-34/+69
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttribute
| * | | | | | | minor nitsMorph2020-07-311-1/+3
| | | | | | | |
| * | | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttributeMorph2020-07-302-23/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Stub these 2 service commands required for Animal Crossing: New Horizons Update 1.4.0
| * | | | | | | fs: Rename SaveDataDescriptor to SaveDataAttributeMorph2020-07-303-12/+12
| |/ / / / / /
* | | | | | | Merge pull request #4482 from lioncash/ldr-signbunnei2020-08-031-3/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/ldr: Resolve sign mismatch warnings
| * | | | | | | service/ldr: Resolve sign mismatch warningsLioncash2020-08-031-3/+2
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | We were performing an int < size_t comparison. We can just correct the type of the induction variable.
* / | | | | | sm: Make use of IsBaseOf for GetServiceDavid Marcec2020-08-031-3/+2
|/ / / / / /
* / / / / / ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer (#4465)David2020-08-039-30/+30
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer With the support of C++20, we can use concepts to deduce if a type is an STL container or not. * More agressive concept for stl containers * Add -fconcepts * Move to common namespace * Add Common::IsBaseOf
* | | | | core_timing: Make use of uintptr_t to represent user_dataLioncash2020-07-286-13/+17
| | | | | | | | | | | | | | | | | | | | Makes the interface future-proofed for supporting other platforms in the event we ever support platforms with differing pointer sizes. This way, we have a type in place that is always guaranteed to be able to represent a pointer exactly.
* | | | | remove unused variable;CrazyMax2020-07-271-1/+0
| | | | |
* | | | | nvflinger: Mark interface functions with return values as [[nodiscard]]Lioncash2020-07-261-16/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Not using the return value of these functions are undeniably the source of a bug. This way we allow compilers to loudly make any future misuses evident.
* | | | | nvflinger: Use return value of Lock()Lioncash2020-07-263-4/+4
|/ / / / | | | | | | | | | | | | | | | | comex reported in #4424 that we were incorrectly discarding the return value of Lock() which is correct.
* | | | Merge pull request #4350 from ogniK5377/hid-update-connectedbunnei2020-07-252-33/+37
|\ \ \ \ | | | | | | | | | | hid: Only update keyboard & debug pad inputs if enabled
| * | | | hid: Only update keyboard & debug pad inputs if enabledDavid Marcec2020-07-162-33/+37
| | | | | | | | | | | | | | | | | | | | Previously we would ignore this setting and would update the states regardless of the user setting
* | | | | Address issuesDavid Marcec2020-07-201-2/+2
| | | | |
* | | | | swkbd: Return result for Calc request for inlined swkbdDavid Marcec2020-07-192-13/+49
| |/ / / |/| | | | | | | | | | | Fixes random swkbd popups in monster hunter
* | | | Merge pull request #4348 from lioncash/nanobunnei2020-07-186-28/+34
|\ \ \ \ | | | | | | | | | | core_timing: Make usage of nanoseconds more consistent in the interface
| * | | | core_timing: Make TimedCallback take std::chrono::nanosecondsLioncash2020-07-166-15/+13
| | | | | | | | | | | | | | | | | | | | Enforces our desired time units directly with a concrete type.
| * | | | core_timing: Make use of std::chrono with ScheduleEventLioncash2020-07-165-16/+24
| | |/ / | |/| |
* | | | Merge pull request #4345 from Morph1984/fix-createfilebunnei2020-07-181-0/+4
|\ \ \ \ | | | | | | | | | | filesystem: Create subdirectories prior to creating a file
| * | | | Add comment to clarify the nullptr checkMorph2020-07-161-0/+1
| | | | |
| * | | | filesystem: Create subdirectories prior to creating a fileMorph2020-07-161-0/+3
| | |/ / | |/| | | | | | | | | | | | | | If subdirectories exist in the given path parameter and don't exist in the real filesystem create them prior to creating the files within. This fixes the softlocks upon save creation in The Legend of Zelda: Breath of the Wild
* | | | Merge pull request #4365 from lioncash/miibunnei2020-07-181-53/+54
|\ \ \ \ | | | | | | | | | | mii/manager: Make use of designated initializers
| * | | | mii/manager: Make use of designated initializersLioncash2020-07-171-53/+54
| | | | | | | | | | | | | | | | | | | | Allows returning the structure in a more concise manner.
* | | | | Merge pull request #4366 from lioncash/mii-signbunnei2020-07-181-3/+3
|\ \ \ \ \ | | | | | | | | | | | | mii/manager: Resolve sign mismatch warnings
| * | | | | mii/manager: Resolve sign mismatch warningsLioncash2020-07-171-3/+3
| |/ / / / | | | | | | | | | | | | | | | | | | | | Previously the loop termination condition was testing variables of different signedness.
* | | | | Merge pull request #4357 from lioncash/unused4David2020-07-173-7/+2
|\ \ \ \ \ | | | | | | | | | | | | kernel: Remove unused variables
| * | | | | kernel: Remove unused variablesLioncash2020-07-163-7/+2
| | | | | | | | | | | | | | | | | | | | | | | | Resolves some compiler warnings in the Linux build.
* | | | | | Merge pull request #4358 from lioncash/unused5David2020-07-171-2/+0
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | kernel/thread: Remove unimplemented function prototype
| * | | | | kernel/thread: Remove unimplemented function prototypeLioncash2020-07-161-2/+0
| |/ / / / | | | | | | | | | | | | | | | This isn't used, so it can be removed.
* | | | | Merge pull request #4292 from bunnei/mii-rewritebunnei2020-07-178-912/+3265
|\ \ \ \ \ | | | | | | | | | | | | hle: service: mii: Rewrite service to properly support creation of random and default miis.
| * | | | | hle: service: mii: Rewrite service to properly support creation of random and default miis.bunnei2020-07-128-912/+3265
| | | | | |
* | | | | | Merge pull request #4327 from lioncash/desig2Rodrigo Locatti2020-07-162-58/+38
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | address_space_info: Make use of designated initializers
| * | | | | address_space_info: Use type alias to simplify codeLioncash2020-07-131-14/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can define an alias for the index arrays and then just reuse it to make the code nicer to read.
| * | | | | address_space_info: Make use of designated initializersLioncash2020-07-132-46/+27
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | We can alter the structure so that we can use designated initializers in the array, eliminating the comments that indicate their field names.
* | | | | kernel: Add missing includeLioncash2020-07-161-0/+1
| | | | |
* | | | | cpu_manager: Mark function getters as staticLioncash2020-07-163-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | All these do are return std::function instances of static functions, so these can be used without an instance of the CPU manager.
* | | | | Merge pull request #4346 from lioncash/threadDavid2020-07-167-35/+26
|\ \ \ \ \ | |_|_|/ / |/| | | | kernel/handle_table: Remove usages of the global system instance
| * | | | kernel/process: Move name and system context to the bottom of the member listLioncash2020-07-151-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't directly important or commonly used within the process, so we can move these to the bottom to allow everything else to be more likely to be within a cache line.
| * | | | kernel/handle_table: Remove usages of the global system instanceLioncash2020-07-154-8/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes even more usages of the global system instance, trimming away more dependencies on global variables and making them explicit in the interface.
| * | | | kernel/thread: Remove global GetCurrentThread()Lioncash2020-07-153-23/+7
| |/ / / | | | | | | | | | | | | | | | | This is only used in one place, so we can fold it into the calling code, eliminating a place for the global system instance to be used.
* / / / memory_layout: Remove unused data memberLioncash2020-07-131-2/+0
|/ / / | | | | | | | | | | | | This isn't used, so it can be removed entirely, shrinking the structure size by 8 bytes.
* | | Merge pull request #4275 from CrazyMax/desired_languagebunnei2020-07-121-1/+13
|\ \ \ | | | | | | | | AM: fix GetDesiredLanguage:
| * | | AM: fix GetDesiredLanguage:CrazyMax2020-07-081-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | try to get a control metadata from application update when is failed to get from the basic version. Tested on Kirby Star Allies
* | | | Merge pull request #4203 from VolcaEM/servicesbunnei2020-07-1126-154/+282
|\ \ \ \ | |_|/ / |/| | | service: Update function tables
| * | | Rename two functions in NSVolcaEM2020-07-021-2/+2
| | | | | | | | | | | | | | | | - Rename "GetShellEvent" to "GetShellEventHandle" - Rename "LaunchApplicationFromHost" to "LaunchApplication"
| * | | Rename GetApplicationArea2 to GetApplicationAreaSizeVolcaEM2020-07-021-2/+2
| | | |
| * | | Remove duplicate functionsVolcaEM2020-06-291-2/+0
| | | |
| * | | Use decimal instead of hexadecimalVolcaEM2020-06-291-3/+5
| | | | | | | | | | | | Co-authored-by: David <25727384+ogniK5377@users.noreply.github.com>
| * | | Fix typoVolcaEM2020-06-291-1/+1
| | | |
| * | | Clang-formatVolcaEM2020-06-291-1/+1
| | | |
| * | | service: Update function tablesVolcaEM2020-06-2927-157/+285
| | | |
* | | | configuration: implement per-game configurations (#4098)lat9nq2020-07-106-22/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Switch game settings to use a pointer In order to add full per-game settings, we need to be able to tell yuzu to switch to using either the global or game configuration. Using a pointer makes it easier to switch. * configuration: add new UI without changing existing funcitonality The new UI also adds General, System, Graphics, Advanced Graphics, and Audio tabs, but as yet they do nothing. This commit keeps yuzu to the same functionality as originally branched. * configuration: Rename files These weren't included in the last commit. Now they are. * configuration: setup global configuration checkbox Global config checkbox now enables/disables the appropriate tabs in the game properties dialog. The use global configuration setting is now saved to the config, defaulting to true. This also addresses some changes requested in the PR. * configuration: swap to per-game config memory for properties dialog Does not set memory going in-game. Swaps to game values when opening the properties dialog, then swaps back when closing it. Uses a `memcpy` to swap. Also implements saving config files, limited to certain groups of configurations so as to not risk setting unsafe configurations. * configuration: change config interfaces to use config-specific pointers When a game is booted, we need to be able to open the configuration dialogs without changing the settings pointer in the game's emualtion. A new pointer specific to just the configuration dialogs can be used to separate changes to just those config dialogs without affecting the emulation. * configuration: boot a game using per-game settings Swaps values where needed to boot a game. * configuration: user correct config during emulation Creates a new pointer specifically for modifying the configuration while emulation is in progress. Both the regular configuration dialog and the game properties dialog now use the pointer Settings::config_values to focus edits to the correct struct. * settings: split Settings::values into two different structs By splitting the settings into two mutually exclusive structs, it becomes easier, as a developer, to determine how to use the Settings structs after per-game configurations is merged. Other benefits include only duplicating the required settings in memory. * settings: move use_docked_mode to Controls group `use_docked_mode` is set in the input settings and cannot be accessed from the system settings. Grouping it with system settings causes it to be saved with per-game settings, which may make transferring configs more difficult later on, especially since docked mode cannot be set from within the game properties dialog. * configuration: Fix the other yuzu executables and a regression In main.cpp, we have to get the title ID before the ROM is loaded, else the renderer will reflect only the global settings and now the user's game specific settings. * settings: use a template to duplicate memory for each setting Replaces the type of each variable in the Settings::Values struct with a new class that allows basic data reading and writing. The new struct Settings::Setting duplicates the data in memory and can manage global overrides per each setting. * configuration: correct add-ons config and swap settings when apropriate Any add-ons interaction happens directly through the global values struct. Swapping bewteen structs now also includes copying the necessary global configs that cannot be changed nor saved in per-game settings. General and System config menus now update based on whether it is viewing the global or per-game settings. * settings: restore old values struct No longer needed with the Settings::Setting class template. * configuration: implement hierarchical game properties dialog This sets the apropriate global or local data in each setting. * clang format * clang format take 2 can the docker container save this? * address comments and style issues * config: read and write settings with global awareness Adds new functions to read and write settings while keeping the global state in focus. Files now generated per-game are much smaller since often they only need address the global state. * settings: restore global state when necessary Upon closing a game or the game properties dialog, we need to restore all global settings to the original global state so that we can properly open the configuration dialog or boot a different game. * configuration: guard setting values incorrectly This disables setting values while a game is running if the setting is overwritten by a per game setting. * config: don't write local settings in the global config Simple guards to prevent writing the wrong settings in the wrong files. * configuration: add comments, assume less, and clang format No longer assumes that a disabled UI element means the global state is turned off, instead opting to directly answer that question. Still however assumes a game is running if it is in that state. * configuration: fix a logic error Should not be negated * restore settings' global state regardless of accept/cancel Fixes loading a properties dialog and causing the global config dialog to show local settings. * fix more logic errors Fixed the frame limit would set the global setting from the game properties dialog. Also strengthened the Settings::Setting member variables and simplified the logic in config reading (ReadSettingGlobal). * fix another logic error In my efforts to guard RestoreGlobalState, I accidentally negated the IsPowered condition. * configure_audio: set toggle_stretched_audio to tristate * fixed custom rtc and rng seed overwriting the global value * clang format * rebased * clang format take 4 * address my own review Basically revert unintended changes * settings: literal instead of casting "No need to cast, use 1U instead" Thanks, Morph! Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> * Revert "settings: literal instead of casting " This reverts commit 95e992a87c898f3e882ffdb415bb0ef9f80f613f. * main: fix status buttons reporting wrong settings after stop emulation * settings: Log UseDockedMode in the Controls group This should have happened when use_docked_mode was moved over to the controls group internally. This just reflects this in the log. * main: load settings if the file has a title id In other words, don't exit if the loader has trouble getting a title id. * use a zero * settings: initalize resolution factor with constructor instead of casting * Revert "settings: initalize resolution factor with constructor instead of casting" This reverts commit 54c35ecb46a29953842614620f9b7de1aa9d5dc8. * configure_graphics: guard device selector when Vulkan is global Prevents the user from editing the device selector if Vulkan is the global renderer backend. Also resets the vulkan_device variable when the users switches back-and-forth between global and Vulkan. * address reviewer concerns Changes function variables to const wherever they don't need to be changed. Sets Settings::Setting to final as it should not be inherited from. Sets ConfigurationShared::use_global_text to static. Co-Authored-By: VolcaEM <volcaem@users.noreply.github.com> * main: load per-game settings after LoadROM This prevents `Restart Emulation` from restoring the global settings *after* the per-game settings were applied. Thanks to BSoDGamingYT for finding this bug. * Revert "main: load per-game settings after LoadROM" This reverts commit 9d0d48c52d2dcf3bfb1806cc8fa7d5a271a8a804. * main: only restore global settings when necessary Loading the per-game settings cannot happen after the ROM is loaded, so we have to specify when to restore the global state. Again thanks to BSoD for finding the bug. * configuration_shared: address reviewer concerns except operator overrides Dropping operator override usage in next commit. Co-Authored-By: LC <lioncash@users.noreply.github.com> * settings: Drop operator overrides from Setting template Requires using GetValue and SetValue explicitly. Also reverts a change that broke title ID formatting in the game properties dialog. * complete rebase * configuration_shared: translate "Use global configuration" Uses ConfigurePerGame to do so, since its usage, at least as of now, corresponds with ConfigurationShared. * configure_per_game: address reviewer concern As far as I understand, it prevents the program from unnecessarily copying strings. Co-Authored-By: LC <lioncash@users.noreply.github.com> Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> Co-authored-by: VolcaEM <volcaem@users.noreply.github.com> Co-authored-by: LC <lioncash@users.noreply.github.com>
* | | | Merge pull request #4248 from Morph1984/CreateManagedDisplaySeparableLayerbunnei2020-07-102-1/+20
|\ \ \ \ | | | | | | | | | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayer
| * | | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayerMorph2020-07-052-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Stub this by sending 1 layer id instead of 2 as yuzu does not support multiple layers per display. No adverse side effects have been observed. - Used by Animal Crossing: New Horizons Update 1.3.0
* | | | | Merge pull request #4202 from ReinUsesLisp/scoped-lockbunnei2020-07-091-11/+10
|\ \ \ \ \ | |_|_|/ / |/| | | | core_timing,scheduler: Use std::scoped_lock when possible
| * | | | core_timing,scheduler: Use std::scoped_lock when possibleReinUsesLisp2020-06-291-11/+10
| | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the cognitive load of procedures using locks and makes locks safe against exceptions.
* | | | | GetDisplayVersion should return a null-terminated version string.CrazyMax2020-07-071-4/+16
| |/ / / |/| | | | | | | | | | | also, in case of failed to get of the basic version, we will try get it from application update.
* | | | Merge pull request #3924 from ogniK5377/GetKeyCodeMapbunnei2020-07-032-2/+72
|\ \ \ \ | | | | | | | | | | Implement GetKeyCodeMap & GetKeyCodeMap2
| * | | | Move GetKeyCodeMapImpl to an anonymous namespaceDavid Marcec2020-06-241-19/+19
| | | | |
| * | | | Fixed logging outputDavid Marcec2020-06-241-1/+1
| | | | |
| * | | | Implement GetKeyCodeMap & GetKeyCodeMap2David Marcec2020-06-242-2/+72
| | | | | | | | | | | | | | | | | | | | Closes #3919
* | | | | Merge pull request #4193 from ogniK5377/GetIndirectLayerConsumerHandle-stubbunnei2020-07-031-1/+13
|\ \ \ \ \ | | | | | | | | | | | | am: Stub GetIndirectLayerConsumerHandle
| * | | | | am: Stub GetIndirectLayerConsumerHandleDavid Marcec2020-06-281-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Needed by Monster Hunter Generations Ultimate
* | | | | | Merge pull request #4192 from ogniK5377/acc-ListOpenContextStoredUsers-stubbunnei2020-07-035-4/+14
|\ \ \ \ \ \ | | | | | | | | | | | | | | acc: ListOpenContextStoredUsers partial stub
| * | | | | | acc: ListOpenContextStoredUsers partial stubDavid Marcec2020-06-285-4/+14
| |/ / / / / | | | | | | | | | | | | | | | | | | Needed by Baldur's Gate 1/2
* | | | | | key_manager: Correct casing of instance()Lioncash2020-07-011-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Our codebase uppercases member function names.
* | | | | | Merge pull request #3967 from FearlessTobi/keys-singletonDavid2020-07-011-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | crypto: Make KeyManager a singleton class
| * | | | | | crypto: Make KeyManager a singleton classFearlessTobi2020-05-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we were reading the keys everytime a KeyManager object was created, causing yuzu to reread the keys file multiple hundreds of times when loading the game list. With this change, it is only loaded once. On my system, this decreased game list loading times by a factor of 20.
* | | | | | | Merge pull request #4153 from ogniK5377/prepo-multibufbunnei2020-07-011-1/+6
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | prepo: : Don't read extra buffer from report unless passed
| * | | | | | prepo: : Don't read extra buffer from report unless passedDavid Marcec2020-06-241-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prepo doesn't always pass a secondary buffer, we assume it always does which leads to a bad read.
* | | | | | | Merge pull request #3955 from FernandoS27/prometheus-2bbunnei2020-06-2844-1071/+2134
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Remake Kernel Scheduling, CPU Management & Boot Management (Prometheus)
| * | | | | | | Core/Common: Address Feedback.Fernando Sahmkow2020-06-285-16/+17
| | | | | | | |
| * | | | | | | NvFlinger: Clang Format.Fernando Sahmkow2020-06-271-1/+1
| | | | | | | |
| * | | | | | | SVC: Implement 32-bits wrappers and update Dynarmic.Fernando Sahmkow2020-06-272-30/+273
| | | | | | | |
| * | | | | | | SVC: Add GetCurrentProcessorNumber32, CreateTransferMemory32, SetMemoryAttribute32Fernando Sahmkow2020-06-272-6/+39
| | | | | | | |
| * | | | | | | SVC: Add GetThreadPriority32 & SetThreadPriority32Fernando Sahmkow2020-06-272-2/+30
| | | | | | | |
| * | | | | | | Common/Kernel: Corrections and small bug fixing.Fernando Sahmkow2020-06-271-2/+2
| | | | | | | |
| * | | | | | | Services/NvFlinger: Do vSync in a sepparate thread on Multicore.Fernando Sahmkow2020-06-272-3/+60
| | | | | | | |
| * | | | | | | Kernel: Correct Host Context on Threads and Scheduler.Fernando Sahmkow2020-06-274-11/+11
| | | | | | | |
| * | | | | | | Clang Format.Fernando Sahmkow2020-06-274-12/+11
| | | | | | | |
| * | | | | | | General: Cleanup legacy code.Fernando Sahmkow2020-06-279-254/+6
| | | | | | | |
| * | | | | | | Kernel/svcBreak: Implement CacheInvalidation for Singlecore and correct svcBreak.Fernando Sahmkow2020-06-272-3/+13
| | | | | | | |
| * | | | | | | HLE_IPC: Correct HLE Event behavior on timeout.Fernando Sahmkow2020-06-273-1/+19
| | | | | | | |
| * | | | | | | SingleCore: Improve Cycle timing Behavior and replace mutex in global scheduler for spinlock.Fernando Sahmkow2020-06-272-2/+3
| | | | | | | |
| * | | | | | | FrameLimiting: Enable frame limiting for single core.Fernando Sahmkow2020-06-271-0/+1
| | | | | | | |
| * | | | | | | SingleCore: Use Cycle Timing instead of Host Timing.Fernando Sahmkow2020-06-272-4/+13
| | | | | | | |
| * | | | | | | Scheduler: Correct Reload/UnloadFernando Sahmkow2020-06-272-3/+5
| | | | | | | |
| * | | | | | | Thread: Release the ARM Interface on exitting.Fernando Sahmkow2020-06-273-1/+8
| | | | | | | |
| * | | | | | | General: Move ARM_Interface into Threads.Fernando Sahmkow2020-06-278-119/+88
| | | | | | | |
| * | | | | | | Core: Refactor ARM Interface.Fernando Sahmkow2020-06-273-24/+43
| | | | | | | |
| * | | | | | | SVC/ARM: Correct svcSendSyncRequest and cache ticks on arm interface.Fernando Sahmkow2020-06-271-1/+1
| | | | | | | |
| * | | | | | | SingleCore: Move Host Timing from a sepparate thread to main cpu thread.Fernando Sahmkow2020-06-272-1/+10
| | | | | | | |
| * | | | | | | ARM: Addapt to new Exclusive Monitor Interface.Fernando Sahmkow2020-06-272-9/+4
| | | | | | | |
| * | | | | | | Scheduler: Correct yielding interaction with SetThreadActivity.Fernando Sahmkow2020-06-271-0/+15
| | | | | | | |
| * | | | | | | General: Fix microprofile on dynarmic/svc, fix wait tree showing which threads were running.Fernando Sahmkow2020-06-275-3/+51
| | | | | | | |
| * | | | | | | General: Fix Stop functionFernando Sahmkow2020-06-272-3/+20
| | | | | | | |
| * | | | | | | Kernel: Rewind on SVC change.Fernando Sahmkow2020-06-273-5/+16
| | | | | | | |
| * | | | | | | Kernel: Preempt Single core on redudant yields.Fernando Sahmkow2020-06-275-19/+40
| | | | | | | |
| * | | | | | | CPU_Manager: Unload/Reload threads on preemption on SingleCoreFernando Sahmkow2020-06-272-0/+52
| | | | | | | |
| * | | | | | | Synchronization: Correct wide Assertion.Fernando Sahmkow2020-06-271-2/+4
| | | | | | | |
| * | | | | | | General: Initial Setup for Single Core.Fernando Sahmkow2020-06-272-0/+22
| | | | | | | |
| * | | | | | | Scheduler: Set last running time on thread.Fernando Sahmkow2020-06-272-4/+2
| | | | | | | |
| * | | | | | | Kernel: Corrections to TimeManager, Scheduler and Mutex.Fernando Sahmkow2020-06-273-5/+5
| | | | | | | |
| * | | | | | | Kernel: Fixes, corrections and asserts to scheduler and different svcs.Fernando Sahmkow2020-06-278-38/+38
| | | | | | | |
| * | | | | | | Scheduler: Correct yields.Fernando Sahmkow2020-06-272-7/+25
| | | | | | | |
| * | | | | | | Mutex: Revert workaround due to poor exclusive memory.Fernando Sahmkow2020-06-271-9/+2
| | | | | | | |
| * | | | | | | ARM/Memory: Correct Exclusive Monitor and Implement Exclusive Memory Writes.Fernando Sahmkow2020-06-274-9/+10
| | | | | | | |
| * | | | | | | SVC: WaitSynchronization add Termination Pending Result.Fernando Sahmkow2020-06-272-1/+5
| | | | | | | |
| * | | | | | | Scheduler: Remove arm_interface lock and a few corrections.Fernando Sahmkow2020-06-271-7/+3
| | | | | | | |
| * | | | | | | SVC: Correct SetThreadActivity.Fernando Sahmkow2020-06-274-38/+59
| | | | | | | |
| * | | | | | | SCC: Small corrections to CancelSynchronizationFernando Sahmkow2020-06-273-2/+14
| | | | | | | |
| * | | | | | | Scheduler: Correct locking for hle threads.Fernando Sahmkow2020-06-271-1/+2
| | | | | | | |
| * | | | | | | Scheduler: Fix HLE Threads on guardFernando Sahmkow2020-06-271-4/+6
| | | | | | | |
| * | | | | | | Scheduler: Protect on closed threads.Fernando Sahmkow2020-06-271-7/+17
| | | | | | | |
| * | | | | | | Scheduler: Correct assert.Fernando Sahmkow2020-06-271-4/+2
| | | | | | | |
| * | | | | | | Core: Correct rebase.Fernando Sahmkow2020-06-271-6/+5
| | | | | | | |
| * | | | | | | Scheduler: Release old thread fiber before trying to switch to the next thread fiber.Fernando Sahmkow2020-06-272-11/+35
| | | | | | | |
| * | | | | | | NVDRV: Remove frame limiting as Host Timing already takes care.Fernando Sahmkow2020-06-271-1/+0
| | | | | | | |
| * | | | | | | Mutex: Correct Result writting to clear exclusivity.Fernando Sahmkow2020-06-271-3/+11
| | | | | | | |
| * | | | | | | SVC: Correct svcWaitForAddress and svcSignalToAddress.Fernando Sahmkow2020-06-274-68/+161
| | | | | | | |
| * | | | | | | Scheduler: Correct Select Threads Step 2.Fernando Sahmkow2020-06-271-0/+1
| | | | | | | |
| * | | | | | | Kernel: Corrections to Scheduling.Fernando Sahmkow2020-06-273-14/+15
| | | | | | | |
| * | | | | | | Kernel: Correct Signal on Thread Death and Setup Sync Objects on Thread for DebuggingFernando Sahmkow2020-06-273-15/+17
| | | | | | | |
| * | | | | | | Core: Correct HLE Event Callbacks and other issues.Fernando Sahmkow2020-06-275-37/+39
| | | | | | | |
| * | | | | | | Process: Protect TLS region and Modules.Fernando Sahmkow2020-06-271-0/+4
| | | | | | | |
| * | | | | | | General: Add AssertsFernando Sahmkow2020-06-273-0/+20
| | | | | | | |
| * | | | | | | General: Add better safety for JIT use.Fernando Sahmkow2020-06-272-1/+8
| | | | | | | |
| * | | | | | | SVC: Correct races on physical core switching.Fernando Sahmkow2020-06-271-5/+4
| | | | | | | |
| * | | | | | | NVFlinger: Lock race condition between CPU, Host Timing, VSync.Fernando Sahmkow2020-06-273-0/+11
| | | | | | | |
| * | | | | | | SVC: Add locks to the memory management.Fernando Sahmkow2020-06-271-0/+21
| | | | | | | |
| * | | | | | | SVC: Correct WaitSynchronization, WaitProcessWideKey, SignalProcessWideKey.Fernando Sahmkow2020-06-279-33/+84
| | | | | | | |
| * | | | | | | SVC: Cleanup old methods.Fernando Sahmkow2020-06-271-13/+9
| | | | | | | |
| * | | | | | | CPU_Manager: Reconfigre guest threads for dynamrmic downsidesFernando Sahmkow2020-06-272-0/+5
| | | | | | | |
| * | | | | | | SVC: Correct SendSyncRequest.Fernando Sahmkow2020-06-277-52/+115
| | | | | | | |
| * | | | | | | SVC: Correct ArbitrateUnlockFernando Sahmkow2020-06-273-33/+37
| | | | | | | |
| * | | | | | | SVC: Correct SignalEvent, ClearEvent, ResetSignal, WaitSynchronization, CancelSynchronization, ArbitrateLockFernando Sahmkow2020-06-278-90/+134
| | | | | | | |
| * | | | | | | SVC: Remove global HLE Lock.Fernando Sahmkow2020-06-271-3/+0
| | | | | | | |
| * | | | | | | SVC: Correct GetThreadPriority, SetThreadPriority, GetThreadCoreMask, SetThreadCoreMask, GetCurrentProcessorNumberFernando Sahmkow2020-06-273-15/+11
| | | | | | | |
| * | | | | | | SVC: Correct CreateThread, StartThread, ExitThread, SleepThread.Fernando Sahmkow2020-06-273-37/+31
| | | | | | | |
| * | | | | | | General: Recover Prometheus project from harddrive failure Fernando Sahmkow2020-06-2727-383/+710
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit: Implements CPU Interrupts, Replaces Cycle Timing for Host Timing, Reworks the Kernel's Scheduler, Introduce Idle State and Suspended State, Recreates the bootmanager, Initializes Multicore system.
* | | | | | | ldr: Cleanup NRO & NRR structsDavid Marcec2020-06-281-8/+8
| | | | | | |
* | | | | | | Merge pull request #4026 from VolcaEM/ldrDavid2020-06-281-38/+73
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ldr: Update NRR/NRO structs
| * | | | | | | Move SHA256Hash to its original positionVolcaEM2020-06-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | It's not needed to have it in its previous position anymore
| * | | | | | | Remove unnecessary pragmasVolcaEM2020-06-161-8/+0
| | | | | | | |
| * | | | | | | Revert IsValidNRO refactor but make it more readableVolcaEM2020-06-161-26/+13
| | | | | | | |
| * | | | | | | Update assert stringVolcaEM2020-06-161-1/+1
| | | | | | | |
| * | | | | | | Clang-format againVolcaEM2020-06-141-2/+2
| | | | | | | |
| * | | | | | | Use consistent variable namesVolcaEM2020-06-141-4/+4
| | | | | | | |
| * | | | | | | Clang-formatVolcaEM2020-06-141-1/+2
| | | | | | | |
| * | | | | | | Make assert strings consistentVolcaEM2020-06-141-3/+3
| | | | | | | |
| * | | | | | | Attempt to fix crashes in SSBU and refactor IsValidNROVolcaEM2020-06-141-36/+59
| | | | | | | |
| * | | | | | | Address review commentsVolcaEM2020-06-021-4/+4
| | | | | | | |
| * | | | | | | Add comment to nrr_kindVolcaEM2020-05-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | According to Atmosphére (https://github.com/Atmosphere-NX/Atmosphere/blob/c7026b90940a1d88f9c10a6d98263bf22e654fa5/libraries/libstratosphere/include/stratosphere/ro/ro_types.hpp), nrr_kind (Atmosphére calls it "type") is 7.0.0+
| * | | | | | | ldr: Update NRR/NRO structs VolcaEM2020-05-311-40/+72
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew pages: https://switchbrew.org/wiki/NRR https://switchbrew.org/wiki/NRO
* | | | | | | Merge pull request #4184 from VolcaEM/patch-9David2020-06-281-0/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | grc: Update function table
| * | | | | | | Oops (fix typo)VolcaEM2020-06-271-1/+1
| | | | | | | |
| * | | | | | | grc: Update function tableVolcaEM2020-06-271-0/+3
| | |/ / / / / | |/| | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/GRC_services
* | | | | | | Merge pull request #4185 from VolcaEM/patch-10David2020-06-281-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | lbl: Update function table
| * | | | | | | lbl: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Backlight_services
* | | | | | | Merge pull request #4186 from VolcaEM/patch-11David2020-06-281-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ldn: Update function table
| * | | | | | | ldn: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/LDN_services
* | | | | | | Merge pull request #4187 from VolcaEM/patch-12David2020-06-281-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | mig: Update function table
| * | | | | | | mig: Update function tableVolcaEM2020-06-271-0/+6
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Migration_services
* | | | | | | Merge pull request #4188 from VolcaEM/patch-13David2020-06-281-16/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | mm: Update function table
| * | | | | | | mm: Update function tableVolcaEM2020-06-271-16/+16
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Display_services
* | | | | | | Merge pull request #4189 from VolcaEM/patch-14David2020-06-281-10/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ncm: Update function table
| * | | | | | | ncm: Update function tableVolcaEM2020-06-271-10/+10
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/NCM_services ILocationResolver's 16, 17, 18 and 19 have unofficial names
* | | | | | | Merge pull request #4190 from VolcaEM/patch-15David2020-06-281-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nfc: Update function table
| * | | | | | | nfc: Update function tableVolcaEM2020-06-271-3/+3
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/NFC_services
* / / / / / / friend: Update function tableVolcaEM2020-06-271-0/+6
|/ / / / / /
* | | | | | Merge pull request #4158 from Morph1984/capsbunnei2020-06-2714-57/+69
|\ \ \ \ \ \ | | | | | | | | | | | | | | caps: Use enum classes and check struct sizes on compile time
| * | | | | | caps_u: Fix GetAlbumContentsFileListForApplication stubMorph2020-06-261-9/+15
| | | | | | |
| * | | | | | caps: Use enum classes and check struct sizes on compile timeMorph2020-06-261-34/+40
| | | | | | |
| * | | | | | caps: Update copyright headersMorph2020-06-2614-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated to "yuzu Emulator Project"
* | | | | | | Merge pull request #4152 from ogniK5377/ipc-errbunnei2020-06-271-25/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Mark invalid IPC buffers as ASSERT_OR_EXECUTE_MSG
| * | | | | | | Mark invalid IPC buffers as ASSERT_OR_EXECUTE_MSGDavid Marcec2020-06-241-25/+22
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | Previously if applications would send faulty buffers(example homebrew) it would lead to us returning uninitalized data. Switching from ASSERT_MSG to ASSERT_OR_EXECUTE_MSG allows us to have a fail safe to prevent crashes but also continue execution without introducing undefined behavior
* | | | | | | Merge pull request #4154 from ogniK5377/swkbd-nullptrbunnei2020-06-271-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Prevent nullptr dereference on swkbd error case
| * | | | | | | Prevent nullptr dereference on swkbd error caseDavid Marcec2020-06-241-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #4178 from VolcaEM/patch-6David2020-06-271-4/+43
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | es: Update function table
| * | | | | | | Use better names for "Unknown"sVolcaEM2020-06-271-39/+39
| | | | | | | |
| * | | | | | | Update function namesVolcaEM2020-06-271-4/+4
| | | | | | | |
| * | | | | | | es: Update function tableVolcaEM2020-06-271-2/+41
| | |/ / / / / | |/| | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/ETicket_services
* | | | | | | btm: Give better names for unknown functionsDavid Marcec2020-06-271-5/+5
| | | | | | |
* | | | | | | btdrv: Update function table (#4174)VolcaEM2020-06-271-83/+84
| | | | | | | | | | | | | | | | | | | | | * btdrv: Update function table
* | | | | | | bpc: Update function tables (#4173)VolcaEM2020-06-271-7/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bpc: Update function tables This was based on Switchbrew page: https://switchbrew.org/wiki/PCV_services
* | | | | | | bcat: Update function tables and add missing classes (#4172)VolcaEM2020-06-272-0/+5
| | | | | | | | | | | | | | | | | | | | | * bcat: Update function tables and add missing classes
* | | | | | | am: Update function tables and add missing classes (#4169)VolcaEM2020-06-273-17/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * am: Update function tables and add missing classes * Remove comments (1/5) * Remove comments (2/5) * Remove comments (3/5) * Remove comments (4/5) * Remove comments (5/5) * Remove unused classes (1/2) * Remove unused classes (2/2)
* | | | | | | aoc: Update function table (#4170)VolcaEM2020-06-271-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * aoc: Update function table * Remove comments
* | | | | | | Merge pull request #4177 from VolcaEM/patch-5LC2020-06-271-71/+76
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | btm: Update function tables
| * | | | | | | btm: Update function tablesVolcaEM2020-06-271-71/+76
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/BTM_services "No comment" edition
* / / / / / / eupld: Update function tableVolcaEM2020-06-271-0/+1
|/ / / / / / | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Error_Upload_services
* | | | | | Merge pull request #4159 from ogniK5377/mem-manager-dumb-assertbunnei2020-06-261-1/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | memory_manager: Remove useless assertion
| * | | | | | memory_manager: Remove useless assertionDavid Marcec2020-06-251-1/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | num_pages is an std::size_t. It will always be >= 0
* | | | | | Merge pull request #4141 from Morph1984/SevenSixAxisSensorDavid2020-06-252-21/+85
|\ \ \ \ \ \ | |/ / / / / |/| | | | | hid: Stub a series of "SevenSixAxisSensor" service commands
| * | | | | hid: Stub a series of "SevenSixAxisSensor" service commandsMorph2020-06-242-21/+85
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | - Used by Captain Toad: Treasure Tracker Update 1.3.0 While we're at it, fix the input parameters for SetIsPalmaAllConnectable and SetPalmaBoostMode
* | | | | Merge pull request #4138 from Morph1984/GyroscopeZeroDriftModebunnei2020-06-244-6/+56
|\ \ \ \ \ | | | | | | | | | | | | hid: Implement Get/ResetGyroscopeZeroDriftMode
| * | | | | hid: Implement Get/ResetGyroscopeZeroDriftModeMorph2020-06-214-6/+56
| |/ / / / | | | | | | | | | | | | | | | - Used by Captain Toad Treasure Tracker
* | | | | Merge pull request #4128 from lioncash/move2bunnei2020-06-241-2/+2
|\ \ \ \ \ | | | | | | | | | | | | software_keyboard: Eliminate trivial redundant copies
| * | | | | software_keyboard: Eliminate trivial redundant copiesLioncash2020-06-201-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | We can just make use of moves here to get rid of two redundant copies
* | | | | | lm: Silence no return value warningMorph2020-06-231-1/+2
| | | | | |
* | | | | | account: Update function tables and add missing classes (#4145)VolcaEM2020-06-225-42/+384
| |/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * account: Update function tables and add missing classes * clang-format * Add missing "public" * Add missing public again * Add missing final
* | | | | memory_manager: Explicitly specifcy std::min<size_t>MerryMage2020-06-181-2/+2
|/ / / /
* | | | Merge pull request #4070 from ogniK5377/GetTPCMasks-fixbunnei2020-06-152-21/+22
|\ \ \ \ | | | | | | | | | | nvdrv: Fix GetTPCMasks for ioctl3
| * | | | nvdrv: Fix GetTPCMasks for ioctl3David Marcec2020-06-102-21/+22
| | |_|/ | |/| | | | | | | | | | Fixes animal crossing svcBreak on launch
* | | | Merge pull request #4069 from ogniK5377/total-phys-membunnei2020-06-141-2/+4
|\ \ \ \ | | | | | | | | | | kernel: Account for system resource size for memory usage
| * | | | kernel: Account for system resource size for memory usageDavid Marcec2020-06-101-2/+4
| |/ / / | | | | | | | | | | | | GetTotalPhysicalMemoryAvailableWithoutSystemResource & GetTotalPhysicalMemoryUsedWithoutSystemResource seem to subtract the resource size from the usage.
* | | | Merge pull request #4010 from ogniK5377/reserve-always-breakbunnei2020-06-131-5/+1
|\ \ \ \ | |/ / / |/| | | kernel: ResourceLimit::Reserve remove useless while loop
| * | | kernel: ResourceLimit::Reserve remove useless while loopDavid Marcec2020-05-291-5/+1
| |/ / | | | | | | | | | Timeout is a u64, it will always be >= 0
* | | Downgrade "handle not signaled" error to traceDavid Marcec2020-06-041-1/+1
| | | | | | | | | | | | clogs logs quite a bit
* | | Clang-formatVolcaEM2020-06-011-2/+1
| | |
* | | hid: Stub GetXpadIDsVolcaEM2020-06-012-1/+14
|/ / | | | | Allows Minecraft: Nintendo Switch Edition (a.k.a. old Minecraft) to boot and go ingame
* | clang-formatVolcaEM2020-05-211-1/+2
| |
* | nifm: correct assert in CreateTemporaryNetworkProfileVolcaEM2020-05-211-1/+1
| | | | | | | | | | | | | | | | | | This has been wrong since https://github.com/yuzu-emu/yuzu/commit/0432af5ad1ec34f02071f6fdc5fc78149b059f18 I haven't found a game that called this function (and I haven't tried this on a real Switch), and because of this I haven't been able to check if the number in assert OR the string in the assert is wrong, but one of the two is wrong: NetworkProfileData is 0x18E, while SfNetworkProfileData is 0x17C, according to Switchbrew Switchbrew doesn't officially say that NetworkProfileData's size is 0x18E but it's possible to calculate its size since Switchbrew provides the size and the offset of all the components of NetworkProfileData (which isn't currently implemented in yuzu, alongside SfNetworkProfileData) NetworkProfileData documentation: https://switchbrew.org/wiki/Network_Interface_services#NetworkProfileData SfNetworkProfileData documentation: https://switchbrew.org/wiki/Network_Interface_services#SfNetworkProfileData Since I trust ogniK's work on reversing NIFM, I'd assume this was just a typo in the string
* | Merge pull request #3926 from ogniK5377/keyboard-statesbunnei2020-05-191-3/+4
|\ \ | | | | | | hid: Clear keyboard states & fix logic issue
| * | hid: Clear keyboard states & fix logic issueDavid Marcec2020-05-121-3/+4
| | | | | | | | | | | | Previously we never cleared the states of the entries and the key would stay held down, also looping over the key bytes for each key lead to setting every bit for the key state instead of the key we wanted
* | | Merge pull request #3665 from bunnei/device-savebunnei2020-05-162-1/+38
|\ \ \ | | | | | | | | FS: Improve emulation of device saves
| * | | service: fsp_srv: Stub implementation of OpenMultiCommitManager.bunnei2020-05-112-1/+38
| |/ /
* | | nv_flinger: Use enum for pixel format instead of u32David Marcec2020-05-162-3/+11
| | |
* | | time_zone: Use std::chrono::seconds for strong typing.bunnei2020-05-131-1/+1
| | |
* | | hle: service: time_zone_manager: Use current time zone setting.bunnei2020-05-112-3/+32
| | |
* | | Stub SendKeyboardLockKeyEventDavid Marcec2020-05-112-1/+11
|/ / | | | | | | Needed for Puchikon 4 SmileBASIC 1.0.0
* | Replace externals with Conan (#3735)James Rowe2020-05-081-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Remove git submodules that will be loaded through conan * Move custom Find modules to their own folder * Use conan for downloading missing external dependencies * CI: Change the yuzu source folder user to the user that the containers run on * Attempt to remove dirty mingw build hack * Install conan on the msvc build * Only set release build type when using not using multi config generator * Re-add qt bundled to workaround an issue with conan qt not downloading prebuilt binaries * Add workaround for submodules that use legacy CMAKE variables * Re-add USE_BUNDLED_QT on the msvc build bot
* | Merge pull request #3879 from lioncash/global2bunnei2020-05-083-10/+16
|\ \ | |/ |/| hle_ipc: Eliminate core memory globals
| * hle_ipc: Eliminate core memory globalsLioncash2020-05-033-10/+16
| | | | | | | | | | We can just pass the required instances into the constructor of the request, eliminating all usages of the global system accessor.
* | Merge pull request #3881 from lioncash/mem-warningbunnei2020-05-0511-23/+11
|\ \ | | | | | | kernel/memory: Resolve several compiler warnings
| * | kernel/memory: Remove #pragma once within cpp fileLioncash2020-05-031-2/+0
| | | | | | | | | | | | This isn't necessary in a cpp file and will cause warnings on clang.
| * | kernel/memory: Remove unused includesLioncash2020-05-037-8/+1
| | | | | | | | | | | | | | | Prevents header churn and needing to recompile these files if these headers are ever changed in the future.
| * | kernel/memory: Remove unused variables in memory_block_managerLioncash2020-05-031-3/+0
| | | | | | | | | | | | Prevents unused variable warnings.
| * | kernel/memory: Make use of std::array consistently in address_space_infoLioncash2020-05-031-6/+6
| | | | | | | | | | | | | | | This allows tuning standard library implementations to enable or disable range checks at runtime, which is nicer for debugging.
| * | kernel/memory: Resolve -Wshadow warningsLioncash2020-05-031-4/+4
| |/ | | | | | | Prevents variable name clashing.
* | Merge pull request #3880 from lioncash/encodingbunnei2020-05-056-12/+12
|\ \ | | | | | | kernel/memory: Amend potential encoding warnings
| * | kernel/memory: Amend potential encoding warningsLioncash2020-05-036-12/+12
| |/ | | | | | | | | | | | | While èis generally representable in some language encodings, in some it isn't and will result in compilation warnings occurring. To remain friendly with other language's codepages on Windows, we normalize it to an ASCII e.
* | Merge pull request #3843 from ogniK5377/GetPopFromGeneralChannelEventbunnei2020-05-043-4/+20
|\ \ | | | | | | am: IHomeMenuFunctions:GetPopFromGeneralChannelEvent
| * | am: IHomeMenuFunctions:GetPopFromGeneralChannelEventDavid Marcec2020-05-013-4/+20
| | | | | | | | | | | | QLaunch 1.0.0
* | | Merge pull request #3822 from ogniK5377/GetAccountIdbunnei2020-05-041-5/+8
|\ \ \ | |_|/ |/| | acc: Return a unique value per account for GetAccountId
| * | acc: Return a unique value per account for GetAccountIdDavid Marcec2020-04-291-5/+8
| | |
* | | Merge pull request #3871 from lioncash/semibunnei2020-05-031-4/+6
|\ \ \ | | | | | | | | readable_event: Remove unnecessary semicolon in Signal()
| * | | readable_event: Remove unnecessary semicolon in Signal()Lioncash2020-05-021-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wextra-semi warning. While we're at it, we can invert the branch to form a guard clause, unindenting all of the contained code.
* | | | Merge pull request #3824 from ogniK5377/GetDisplayVersionbunnei2020-05-031-3/+14
|\ \ \ \ | |/ / / |/| | | am: Properly implement GetDisplayVersion
| * | | Update src/core/hle/service/am/am.cppbunnei2020-05-031-1/+1
| | | | | | | | | | | | Co-authored-by: Mat M. <mathew1800@gmail.com>
| * | | am: Properly implement GetDisplayVersionDavid Marcec2020-04-291-3/+14
| |/ / | | | | | | | | | Properly implement IApplicationFunctions::GetDisplayVersion
* | | Merge pull request #3811 from ogniK5377/audin-initbunnei2020-05-022-5/+94
|\ \ \ | | | | | | | | audin:u: ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecified
| * | | marked stubsDavid Marcec2020-04-281-4/+5
| | | |
| * | | Audin:u ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecifiedDavid Marcec2020-04-282-5/+93
| | | | | | | | | | | | | | | | Closes #2874
* | | | Merge pull request #3819 from ogniK5377/err-log2bunnei2020-05-027-0/+51
|\ \ \ \ | | | | | | | | | | kernel: Don't fail silently
| * | | | kernel: Don't fail silentlyDavid Marcec2020-04-297-0/+51
| | |/ / | |/| |
* | | | Merge pull request #3833 from qwell/caps_su-32-stubbunnei2020-05-022-1/+13
|\ \ \ \ | | | | | | | | | | Add stub for caps:su SetShimLibraryVersion
| * | | | caps:su Stub out SetShimLibraryVersionJason Parker2020-04-302-1/+13
| | | | | | | | | | | | | | | | | | | | Used by Animal Crossing: New Horizons when trying to take a picture.
* | | | | Merge pull request #3821 from ogniK5377/InitializeApplicationInfo-fixbunnei2020-05-022-22/+15
|\ \ \ \ \ | | | | | | | | | | | | acc: Fix InitializeApplicationInfo
| * | | | | acc: Fix InitializeApplicationInfoDavid Marcec2020-04-292-22/+15
| | |/ / / | |/| | | | | | | | | | | | | We're not suppose to pop a u64, should just read the sent pid and check that
* | | | | Merge pull request #3812 from ogniK5377/lisst-qualified-usersbunnei2020-05-025-3/+15
|\ \ \ \ \ | | | | | | | | | | | | account: ListQualifiedUsers
| * | | | | Updated comment to reflect ListQualifiedUsers betterDavid Marcec2020-04-281-1/+3
| | | | | |
| * | | | | account: ListQualifiedUsersDavid Marcec2020-04-285-3/+13
| | |_|/ / | |/| | | | | | | | | | | | | Closes #2844
* | | | | nvdrv: Fix GetGpuTime stack corruptionDavid Marcec2020-05-011-2/+3
| |_|_|/ |/| | | | | | | | | | | IoctlGetGpuTime should be 16 bytes, not 8.
* | | | Merge pull request #3823 from ogniK5377/setvrmodeMat M2020-04-302-16/+6
|\ \ \ \ | | | | | | | | | | am: IsVrModeEnabled & SetVrModeEnabled fixes
| * | | | am: IsVrModeEnabled & SetVrModeEnabled fixesDavid Marcec2020-04-292-16/+6
| | |/ / | |/| | | | | | | | | | | | | | Return the proper state of vr mode for IsVrModeEnabled We should not return an error for SetVrModeEnabled. When VR Mode is turned on, it signals to lbl to turn vr mode on, not return an error code
* | | | Merge pull request #3830 from ogniK5377/GetFriendInvitationStorageChannelEventMat M2020-04-302-1/+14
|\ \ \ \ | | | | | | | | | | am: GetFriendInvitationStorageChannelEvent
| * | | | am: GetFriendInvitationStorageChannelEventDavid Marcec2020-04-302-1/+14
| |/ / / | | | | | | | | | | | | Closes #3829
* | | | Merge pull request #3835 from ogniK5377/GetFreeSpaceSize-GetTotalSpaceSizeMat M2020-04-301-2/+2
|\ \ \ \ | | | | | | | | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSize
| * | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSizeDavid Marcec2020-04-301-2/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | Closes #3533 Turns out the functions were already implemented but just never added
* | | | Merge pull request #3832 from ogniK5377/nim-eca-CreateServerInterfaceMat M2020-04-301-1/+69
|\ \ \ \ | | | | | | | | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterface
| * | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterfaceDavid Marcec2020-04-301-1/+69
| |/ / / | | | | | | | | | | | | Closes #3026
* | | | Merge pull request #3831 from ogniK5377/caps-su-namesMat M2020-04-301-0/+3
|\ \ \ \ | | |_|/ | |/| | caps: Add missing service names to caps:su
| * | | caps: Add missing service names to caps:suDavid Marcec2020-04-301-0/+3
| |/ / | | | | | | | | | SetShimLibraryVersion, SaveScreenShotEx1 & SaveScreenShotEx2 were missing
* / / psm: Mark as debug instead of warningDavid Marcec2020-04-291-7/+14
|/ / | | | | | | No point to emulate battery life. However options are broken out if we ever want to add a setting for it
* | Merge pull request #3818 from ogniK5377/err-logMat M2020-04-294-3/+27
|\ \ | | | | | | Don't fail silently for vi, sm, set and ns services
| * | Don't fail silently for vi, sm, set and ns servicesDavid Marcec2020-04-294-3/+27
| | |
* | | Merge pull request #3783 from lioncash/pointerMat M2020-04-291-1/+3
|\ \ \ | |/ / |/| | physical_core: Make use of std::make_unique instead of std::make_shared in ctor
| * | physical_core: Make use of std::make_unique instead of std::make_shared in ctorLioncash2020-04-241-1/+3
| | | | | | | | | | | | | | | | | | | | | We can also allow unicorn to be constructed in 32-bit mode or 64-bit mode to satisfy the need for both interpreter instances. Allows this code to compile successfully of non x86-64 architectures.
* | | kernel: Bad GetInfo ids should not be marked as stubsDavid Marcec2020-04-281-2/+2
| | | | | | | | | | | | As we currently match hardware and don't return a successful result, these should be marked as errors instead of warnings and as stubs.
* | | style: Change AMs & Glues error codes to be dec instead of hexDavid Marcec2020-04-282-7/+7
| |/ |/| | | | | Consistency for the rest of the error codes in the codebase
* | Merge pull request #3785 from ogniK5377/set-buffer-count-unitbunnei2020-04-271-1/+9
|\ \ | | | | | | vi: Don't let uninitialized data pass as a response for SetBufferCount
| * | vi: Don't let uninitialized data pass as a response for SetBufferCountDavid Marcec2020-04-241-1/+9
| | | | | | | | | | | | Currently SetBufferCount doesn't write to the out buffer which then contains uninitialized data. This leads to non-zero data which leads to responding with different error codes
* | | Merge pull request #3797 from slashiee/hid-stubMat M2020-04-272-1/+13
|\ \ \ | | | | | | | | services: hid: Stub StopSevenSixAxisSensor.
| * | | services: hid: Stub StopSevenSixAxisSensor.M&M2020-04-262-1/+13
| | | | | | | | | | | | | | | | - Used by The Legend of Zelda: Breath of the Wild v1.6.0
* | | | Merge pull request #3744 from lioncash/table2bunnei2020-04-2618-7/+107
|\ \ \ \ | |/ / / |/| | | service: Update function tables
| * | | service: Update function tablesLioncash2020-04-2018-7/+107
| | | | | | | | | | | | | | | | | | | | | | | | Keeps the service function tables up to date. Updated based off information on SwitchBrew.
* | | | Merge pull request #3780 from lioncash/processbunnei2020-04-251-2/+138
|\ \ \ \ | |_|/ / |/| | | svc: Re-add MapProcessCodeMemory/UnmapProcessCodeMemory
| * | | svc: Re-add MapProcessCodeMemory/UnmapProcessCodeMemoryLioncash2020-04-241-2/+138
| | |/ | |/| | | | | | | These were lost in the re-implementation of the virtual memory manager.
* | | Merge pull request #3777 from lioncash/warnRodrigo Locatti2020-04-241-2/+2
|\ \ \ | | | | | | | | page_table: Remove unused captures
| * | | page_table: Remove unused capturesLioncash2020-04-231-2/+2
| |/ / | | | | | | | | | | | | | | | Any time the lambda function is called, the permission being used in the capture would be passed in as an argument to the lambda, so the capture is unnecessary.
* | | Merge pull request #3778 from lioncash/unused-varRodrigo Locatti2020-04-241-3/+0
|\ \ \ | | | | | | | | svc: Remove unused variable
| * | | svc: Remove unused variableLioncash2020-04-231-3/+0
| |/ / | | | | | | | | | Since the VMM refactor, this is no longer used or needed.
* / / shared_memory: Amend doxygen referenceLioncash2020-04-242-5/+5
|/ / | | | | | | | | | | Amends the parameter to match the documentation reference. Resolves a -Wdocumentation warning with clang.
* | kernel: memory: Improve implementation of device shared memory. (#3707)bunnei2020-04-235-3/+105
| | | | | | | | | | | | | | * kernel: memory: Improve implementation of device shared memory. * fixup! kernel: memory: Improve implementation of device shared memory. * fixup! kernel: memory: Improve implementation of device shared memory.
* | Merge pull request #3730 from lioncash/timebunnei2020-04-231-24/+26
|\ \ | | | | | | service/time: Remove reliance on the global system accessor
| * | service/time: Remove reliance on the global system accessorLioncash2020-04-191-24/+26
| | | | | | | | | | | | | | | Eliminates usages of the global system accessor and instead passes the existing system instance into the interfaces.
* | | Merge pull request #3697 from lioncash/declarationsbunnei2020-04-232-6/+2
|\ \ \ | | | | | | | | CMakeLists: Enable -Wmissing-declarations on Linux builds
| * | | General: Resolve warnings related to missing declarationsLioncash2020-04-172-6/+2
| | | |
* | | | Merge pull request #3725 from MerryMage/fpcrbunnei2020-04-231-2/+1
|\ \ \ \ | | | | | | | | | | thread: FPCR.FZ is likely not 1 (and FPCR.RMode = TieAway and FPCR.DN = 0)
| * | | | thread: FPCR.FZ is likely not 1MerryMage2020-04-191-2/+1
| | | | |
* | | | | Merge pull request #3698 from lioncash/warningbunnei2020-04-211-2/+2
|\ \ \ \ \ | | | | | | | | | | | | General: Resolve minor assorted warnings
| * | | | | time_zone_manager: Resolve sign conversion warningsLioncash2020-04-171-2/+2
| | |/ / / | |/| | | | | | | | | | | | | | | | | | ttis and ats will never exceed the length of INT32_MAX in our case, so this is safe.
* | | | | audio_renderer: Preliminary BehaviorInfo (#3736)David2020-04-211-2/+7
| |_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * audio_renderer: Preliminary BehaviorInfo * clang format * Fixed IsRevisionSupported * fixed IsValidRevision * Fixed logic error & spelling errors & crash * Addressed issues
* | | | npad: Lower log level for VibrateController to DebugFearlessTobi2020-04-201-1/+1
| | | |
* | | | audren: Lower log level for RequestUpdateImpl to DebugFearlessTobi2020-04-201-1/+1
| | | |
* | | | Merge pull request #3712 from lioncash/removebunnei2020-04-202-3/+0
|\ \ \ \ | | | | | | | | | | service: Remove unused RequestParser instances
| * | | | service: Remove unused RequestParser instancesLioncash2020-04-182-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | These aren't used, so they should be removed to reduce compilation warnings.
* | | | | Merge pull request #3709 from lioncash/ambunnei2020-04-201-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | | am: Resolve ineffective moves
| * | | | am: Resolve ineffective movesLioncash2020-04-181-2/+2
| |/ / / | | | | | | | | | | | | | | | | Previously const objects were being std::moved, which results in no move actually occurring. This resolves that.
* | | | Merge pull request #3696 from lioncash/cast-sizebunnei2020-04-192-21/+23
|\ \ \ \ | | | | | | | | | | hle_ipc: Remove std::size_t casts where applicable
| * | | | hle_ipc: Remove std::size_t casts where applicableLioncash2020-04-172-21/+23
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These were added in the change that enabled -Wextra on linux builds so as not to introduce interface changes in the same change as a build-system flag addition. Now that the flags are enabled, we can freely change the interface to make these unnecessary.
* | | | Merge pull request #3715 from bunnei/fix-impl-fallthroughMat M2020-04-181-0/+2
|\ \ \ \ | | | | | | | | | | service: hid: npad: Fix implicit fallthrough errors.
| * | | | service: hid: npad: Fix implicit fallthrough errors.bunnei2020-04-181-0/+2
| | |/ / | |/| |
* | | | Merge pull request #3713 from lioncash/timebunnei2020-04-185-4/+5
|\ \ \ \ | | | | | | | | | | service/time: Minor changes
| * | | | time/system_clock_core: Remove unnecessary initializerLioncash2020-04-181-1/+1
| | | | | | | | | | | | | | | | | | | | This is already initialized within the class body.
| * | | | service/time: Mark IsStandardNetworkSystemClockAccuracySufficient as constLioncash2020-04-181-1/+1
| | | | | | | | | | | | | | | | | | | | This doesn't modify internal member state.
| * | | | service/time: Add virtual destructors where applicableLioncash2020-04-183-2/+3
| |/ / / | | | | | | | | | | | | | | | | | | | | Many of these implementations are used to implement a polymorphic interface. While not directly used polymorphically, this prevents virtual destruction from ever becoming an issue.
* / / / memory/slab_heap: Make use of static_cast over reinterpret_castLioncash2020-04-181-2/+2
|/ / / | | | | | | | | | | | | Casting from void* with static_cast is permitted by the standard, so we can just make use of that instead.
* | | core: hle: Address various feedback & code cleanup.bunnei2020-04-1710-244/+144
| | | | | | | | | | | | - Should be no functional changes.
* | | memory: Add copyright notice for Atmosphere where applicable.bunnei2020-04-176-0/+18
| | |
* | | kernel: Remove old VMManager class.bunnei2020-04-172-1971/+0
| | |
* | | service: ldr: Updates for new VMM.bunnei2020-04-171-150/+215
| | | | | | | | | | | | - Includes removing some service impls. that are untested.
* | | kernel: memory: page_table: Simplify GetPhysicalAddr impl.bunnei2020-04-172-5/+3
| | |
* | | kernel: svc: Updates for new VMM.bunnei2020-04-171-488/+116
| | | | | | | | | | | | - Includes removing some SVC impls. that are untested.
* | | kernel: process: Updates for new VMM.bunnei2020-04-172-79/+151
| | |
* | | service: pl_u: Update for new shared memory layout.bunnei2020-04-171-7/+5
| | |
* | | service: time: Update for new shared memory layout.bunnei2020-04-171-3/+2
| | |
* | | service: hid: Update for new shared memory layout.bunnei2020-04-171-3/+2
| | |
* | | service: irs: Update for new shared memory layout.bunnei2020-04-171-3/+3
| | |
* | | kernel: resource_limit: Reserve physical memory.bunnei2020-04-171-1/+6
| | |
* | | kernel: Initialize memory layout for new VMM.bunnei2020-04-172-0/+159
| | |
* | | core: system: Rename GetDeviceManager -> DeviceManager.bunnei2020-04-171-1/+1
| | | | | | | | | | | | - More consistent with other system components.
* | | kernel: transfer_memory: Refactor for new VMM.bunnei2020-04-172-130/+16
| | |
* | | kernel: shared_memory: Refactor for new VMM.bunnei2020-04-172-220/+58
| | |
* | | kernel: errors: Add ERR_OUT_OF_RESOURCES.bunnei2020-04-171-0/+1
| | |
* | | kernel: process_capability: Update to use Memory::PageTable.bunnei2020-04-172-23/+25
| | |
* | | kernel: memory: Add PageTable class, to manage process address space.bunnei2020-04-172-0/+1508
| | |
* | | kernel: memory: Add MemoryLayout class, to build physical memory layout.bunnei2020-04-171-0/+73
| | |
* | | kernel: memory: Add MemoryManager class, to manage page heaps.bunnei2020-04-172-0/+274
| | |
* | | kernel: memory: Add MemoryBlockManager class, to manage memory blocks.bunnei2020-04-172-0/+254
| | |
* | | kernel: memory: Add PageHeap class, to manage a heap of pages.bunnei2020-04-172-0/+481
| | |
* | | kernel: memory: Add PageLinkedList class, to manage a list of pages.bunnei2020-04-171-0/+93
| | |
* | | kernel: memory: Add system_control code, which will be used for ASLR support.bunnei2020-04-172-0/+59
| | |
* | | physical_memory: Add missing include for <vector>.bunnei2020-04-171-0/+2
| | |
* | | kernel: memory: Add MemoryBlock class, for managing memory blocks and their state.bunnei2020-04-171-0/+315
| | |
* | | kernel: memory: Add memory_types.h, for things that are commonly used in memory code.bunnei2020-04-171-0/+18
| | |
* | | kernel: memory: Add SlabHeap class, for managing memory heaps.bunnei2020-04-171-0/+161
| | | | | | | | | | | | - This will be used for TLS pages, among other things.
* | | kernel: memory: Add AddressSpaceInfo class, for managing the memory address space.bunnei2020-04-172-0/+164
| | |
* | | core: memory: Move to Core::Memory namespace.bunnei2020-04-1710-30/+34
| | | | | | | | | | | | - helpful to disambiguate Kernel::Memory namespace.
* | | core: kernel: Add svc_types header to include SVC-specific types.bunnei2020-04-172-0/+69
| | |
* | | core: kernel: Move SVC to its own namesapce.bunnei2020-04-172-6/+6
| | |
* | | kernel: resource_limit: Improvements to implementation.bunnei2020-04-172-12/+50
| | |
* | | process: SetupMainThread: Zero out argument on process start.bunnei2020-04-171-0/+2
| | |
* | | Merge pull request #3671 from lioncash/switchbunnei2020-04-171-0/+2
|\ \ \ | |/ / |/| | kernel/thread: Resolve -Wswitch warnings
| * | kernel/thread: Resolve -Wswitch warningsLioncash2020-04-151-0/+2
| | |
* | | Merge pull request #3673 from lioncash/extrabunnei2020-04-176-23/+27
|\ \ \ | | | | | | | | CMakeLists: Specify -Wextra on linux builds
| * | | CMakeLists: Specify -Wextra on linux buildsLioncash2020-04-166-23/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows reporting more cases where logic errors may exist, such as implicit fallthrough cases, etc. We currently ignore unused parameters, since we currently have many cases where this is intentional (virtual interfaces). While we're at it, we can also tidy up any existing code that causes warnings. This also uncovered a few bugs as well.
* | | | Merge pull request #3659 from bunnei/time-calc-standard-userRodrigo Locatti2020-04-163-1/+25
|\ \ \ \ | |/ / / |/| | | service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.
| * | | service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.bunnei2020-04-153-1/+25
| | |/ | |/| | | | | | | - Used by Animal Crossing: New Horizons.
* | | CMakeLists: Make -Wreorder a compile-time errorLioncash2020-04-151-1/+1
| |/ |/| | | | | | | | | This can result in silent logic bugs within code, and given the amount of times these kind of warnings are caused, they should be flagged at compile-time so no new code is submitted with them.
* | service: friend: Stub IFriendService::GetBlockedUserListIds.bunnei2020-04-141-1/+10
|/ | | | - This is safe to stub, as there should be no adverse consequences from reporting no blocked users.
* Merge pull request #3606 from ReinUsesLisp/nvflingerbunnei2020-04-123-10/+44
|\ | | | | service/vi: Partially implement BufferQueue disconnect
| * service/vi: Partially implement BufferQueue disconnectReinUsesLisp2020-04-103-10/+44
| |
* | Buffer queue: Correct behavior of free buffer.Fernando Sahmkow2020-04-102-9/+33
|/ | | | | | This corrects the behavior of free buffer after witnessing it in an unrelated hardware test. I haven't found any games affected by it but in name of better accuracy we'll correct such behavior.
* Merge pull request #3563 from bunnei/fix-ldr-memstateFernando Sahmkow2020-04-031-5/+15
|\ | | | | services: ldr: Fix MemoryState for read/write regions of NROs.
| * services: ldr: Fix MemoryState for read/write regions of NROs.bunnei2020-03-261-5/+15
| | | | | | | | - Fixes #3541, used by Final Fantasy VIII Remastered.
* | capsrv: Split Capture services into individual files and stub GetAlbumContentsFileListForApplication (#3571)Morph2020-04-0114-151/+524
| | | | | | | | | | | | | | * Organize capture services into individual files * Stub GetAlbumContentsFileListForApplication * Address feedback
* | Merge pull request #3568 from bunnei/time-calcspanbunnei2020-03-293-1/+31
|\ \ | | | | | | services: time: Implement CalculateSpanBetween.
| * | services: time: Implement CalculateSpanBetween.bunnei2020-03-273-1/+31
| |/ | | | | | | - Used by Super Smash Bros. Ultimate.
* | Merge pull request #3562 from perillamint/vrsvcbunnei2020-03-282-3/+42
|\ \ | | | | | | am: Implement VR related APIs
| * | am: Implement VR related APIsperillamint2020-03-272-3/+42
| |/ | | | | | | | | | | Implement (and stub) VR related APIs in AM sysmodule. This fixes issue #2938
* / services: hid: Stub InitializeSevenSixAxisSensor.bunnei2020-03-272-1/+9
|/ | | | - Used by Super Smash Bros. Ultimate v7.0.0.
* sm/controller: Increase PointerBufferSizeFearlessTobi2020-03-231-1/+1
| | | | | | | This increases the PointerBufferSize as a lager one is required by some services. This change is still not hw-accurate, but it is proven to work in Ryujinx. Instead of using a hardcoded size, we should figure out the specific values for each service in the future. Some of them can be taken from Atmosphere: https://github.com/Atmosphere-NX/Atmosphere/search?q=PointerBufferSize.
* Merge pull request #3477 from FearlessTobi/webapplet-shitbunnei2020-03-221-0/+6
|\ | | | | core/web_browser: Allow WebApplet to exit gracefully when an error occurs
| * core/web_browser: Allow WebApplet to exit gracefully when an error occursFearlessTobi2020-03-221-0/+6
| | | | | | | | | | | | | | | | Currently, yuzu just freezes when an error occurs while Initializing the WebApplet. From a user perspective, this obviously isn't great as the game just softlocks. With this change, yuzu will call the Finalize method, so to the game it seems like as the user just exited the WebApplet normally. This works around https://github.com/yuzu-emu/yuzu/issues/2852.
* | set: implement GetRegionCodeDan2020-03-192-1/+10
| |
* | time_zone_content_manager: Fix out of bounds readReinUsesLisp2020-03-181-1/+1
| | | | | | | | | | | | | | There were cases where raw_data didn't contain enough space to hold the zero terminator. This was caught with -fsanitize=address.
* | NVFlinger: Do the microprofile Flip after processing a valid frame.Fernando Sahmkow2020-03-121-2/+2
| |
* | core: hle: Implement separate A32/A64 SVC interfaces.bunnei2020-03-032-107/+380
| |
* | core: Implement separate A32/A64 ARM interfaces.bunnei2020-03-038-36/+73
|/
* AM/ICommonStateGetter: Stub SetLcdBacklighOffEnabled (#3454)Morph2020-02-272-2/+14
| | | | | | | | | * Stub SetLcdBacklighOffEnabled Used by Super Smash Bros. Ultimate We require backlight services to be implemented to turn on/off the backlight. * Address feedback
* Merge pull request #3431 from CJBok/npad-fixbunnei2020-02-261-5/+5
|\ | | | | InputCommon: analog_from_button get direction implementation
| * analog_from_button get direction implementationCJBok2020-02-181-5/+5
| |
* | Scheduler: Inline global scheduler in Scheduler Lock.Fernando Sahmkow2020-02-221-4/+2
| |
* | Kernel: Correct pending feedback.Fernando Sahmkow2020-02-221-3/+4
| |
* | Kernel: Address Feedback.Fernando Sahmkow2020-02-226-30/+47
| |
* | Kernel: Implement Scheduler locksFernando Sahmkow2020-02-222-0/+89
| |
* | Kernel: Implement Time Manager.Fernando Sahmkow2020-02-224-1/+96
| |
* | Kernel: Rename ThreadCallbackHandleTable and Setup Thread Ids on Kernel.Fernando Sahmkow2020-02-224-24/+105
| |
* | Kernel: Make global scheduler depend on KernelCoreFernando Sahmkow2020-02-224-8/+24
| |
* | httplib compatibilityBrian Clinkenbeard2020-02-191-3/+4
|/
* Merge pull request #3420 from namkazt/master2bunnei2020-02-172-0/+20
|\ | | | | nvhost_gpu: implement ChannelSetTimeslice
| * nvhost_gpu: implement ChannelSetTimeslicenamkazy2020-02-162-0/+20
| |
* | IUserLocalCommunicationService: add function Initialize2Nguyen Dac Nam2020-02-161-1/+9
| |
* | HLE: correct function name of IUserLocalCommunicationServiceNguyen Dac Nam2020-02-161-1/+1
|/ | | | 402: function name should be Initialize2 (7.0.0+) not SetOperationMode Follow by: https://switchbrew.org/wiki/LDN_services#IUserLocalCommunicationService
* Merge pull request #3401 from FernandoS27/synchronizationbunnei2020-02-1431-176/+330
|\ | | | | Set of refactors for Kernel Synchronization and Hardware Constants
| * Core: Address FeedbackFernando Sahmkow2020-02-145-16/+27
| |
| * Core: Set all hardware emulation constants in a single file.Fernando Sahmkow2020-02-129-29/+37
| |
| * Kernel: Refactor synchronization to better match REFernando Sahmkow2020-02-1122-80/+210
| |
| * Kernel: Change WaitObject to Synchronization object. In order to better reflect RE.Fernando Sahmkow2020-02-1119-71/+76
| |
* | Merge pull request #3400 from makigumo/patch-1bunnei2020-02-141-2/+4
|\ \ | | | | | | update hwopus DecodeInterleaved for FW 7.0.0+
| * | update hwopus DecodeInterleaved for FW 7.0.0+makigumo2020-02-111-2/+4
| |/ | | | | | | trivial change, see https://switchbrew.org/wiki/Audio_services#IHardwareOpusDecoder
* | address_arbiter: Collapse loops in InsertThread() and RemoveThread()Lioncash2020-02-121-19/+17
| | | | | | | | | | Same behavior, but without the need to explicitly loop through everything manually.
* | address_arbiter: Simplify GetThreadsWaitingOnAddress()Lioncash2020-02-122-10/+9
| | | | | | | | | | Simplifies the overall function and also allows for it to become a const-qualified member function.
* | Merge pull request #3403 from lioncash/debugbunnei2020-02-121-2/+2
|\ \ | | | | | | bcat/backend: Prevent fmt exception in debug log within NullBackend::Clear()
| * | bcat/backend: Make formatting of passphrase consistent in NullBackend::SetPassphrase()Lioncash2020-02-121-1/+1
| | | | | | | | | | | | | | | Aligns the '=' to be consistent with the rest of the logs within this source file.
| * | bcat/backend: Prevent fmt exception in debug log within NullBackend::Clear()Lioncash2020-02-121-1/+1
| |/ | | | | | | | | A formatting specifier within Clear wasn't being used, which will cause fmt to throw an exception. This fixes that.
* / kernel/thread: Remove trivial usages of the global system accessorLioncash2020-02-121-2/+2
|/ | | | | We can just use the kernel member variable directly instead of going through the system to obtain the same thing.
* hle: services: Use std::shared_ptr instead of copy by value.bunnei2020-02-089-50/+52
|
* Merge pull request #3381 from bunnei/ipc-fixbunnei2020-02-072-23/+57
|\ | | | | hle: services: Fix prepo IPC, and add better error checking.
| * services: prepo: Fix IPC interface with SaveReport/SaveReportWithUser.bunnei2020-02-061-15/+15
| |
| * hle_ipc: Add error checking to read/write buffer access.bunnei2020-02-061-8/+42
| |
* | kernel: transfer_memory: Properly reserve and reset memory region.bunnei2020-02-065-40/+116
| |
* | wait_object: Make wait behavior only require one object to signal.Zach Hilman2020-02-061-11/+2
| | | | | | | | - This was holdover from citra.
* | am: Correct IPC object count mismatch.bunnei2020-02-061-6/+4
| |
* | services: am: Clear events on PopOutData and PopInteractiveOutData.bunnei2020-02-061-0/+2
| |
* | am: Refactor IStorage interface.bunnei2020-02-067-43/+81
| |
* | applets: software_keyboard: Signal state change on end of interactive session.bunnei2020-02-061-0/+1
| |
* | applets: software_keyboard: Minor cleanup.bunnei2020-02-061-2/+2
|/
* Merge pull request #3284 from CJBok/hid-fixbunnei2020-02-011-13/+26
|\ | | | | hid: Fix analog sticks directional states
| * Moved analog direction logic to sdl_implCJBok2020-01-151-9/+22
| |
| * Corrected directional states sensitivityCJBok2020-01-141-9/+9
| |
| * hid: Fix analog sticks directional statesCJBok2020-01-091-12/+12
| |
* | kernel/physical_core: Make use of std::unique_ptrLioncash2020-01-312-4/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | shared_ptr was used in 2d1984c20c75e03ec79eeb3806b12efa1679b977 due to a misunderstanding of how the language generates move constructors and move assignment operators. If a destructor is user-provided, then the compiler won't generate the move constructor and move assignment operators by default--they must be explicitly opted into. The reason for the compilation errors is due to the fact that the language will fall back to attempting to use the copy constructor/copy assignment operators if the respective move constructor or move assignment operator is unavailable. Given that we explicitly opt into them now, the the move constructor and move assignment operators will be generated as expected.
* | kernel/physical_core: Remove unused kernel reference member variableLioncash2020-01-313-11/+7
| | | | | | | | | | | | | | This isn't used within the class, so it can be removed to simplify the overall interface. While we're in the same area, we can simplify a unique_ptr reset() call.
* | Merge pull request #3353 from FernandoS27/ariesbunnei2020-01-319-9/+198
|\ \ | | | | | | System: Refactor CPU Core management and move ARMInterface and Schedulers to Kernel
| * | System: Address FeedbackFernando Sahmkow2020-01-274-10/+20
| | |
| * | Kernel: Remove a few global instances from the kernel.Fernando Sahmkow2020-01-262-2/+2
| | |
| * | Core: Refactor CpuCoreManager to CpuManager and Cpu to Core Manager.Fernando Sahmkow2020-01-265-6/+2
| | | | | | | | | | | | This commit instends on better naming the new purpose of this classes.
| * | ArmInterface: Delegate Exclusive monitor factory to exclusive monitor interfasce.Fernando Sahmkow2020-01-261-15/+2
| | |
| * | Core: Refactor CPU Management.Fernando Sahmkow2020-01-254-12/+127
| | | | | | | | | | | | This commit moves ARM Interface and Scheduler handling into the kernel.
| * | Kernel: Implement Physical Core.Fernando Sahmkow2020-01-242-0/+81
| | |
* | | bsd: Stub several more functions.bunnei2020-01-252-4/+48
|/ / | | | | | | - Required for Little Town Hero to boot further.
* | service: time: Implement ToPosixTimeWithMyRule.bunnei2020-01-234-1/+34
| | | | | | | | - Used by Pokemon Mystery Dungeon.
* | time: Fix month off-by-one error.bunnei2020-01-201-2/+2
| | | | | | | | - Fixes timestamp in ZLA and Astral Chain saves.
* | Merge pull request #3271 from bunnei/time-rewritebunnei2020-01-2039-533/+2962
|\ \ | | | | | | service: time: Rewrite implementation of glue services.
| * | service: time: Implement GetStandardLocalSystemClock.bunnei2020-01-053-1/+9
| | |
| * | time: Remove overflow error checking (currently breaks ADO builds).bunnei2020-01-042-18/+2
| | |
| * | service: time: Implement GetClockSnapshotFromSystemClockContext.bunnei2020-01-043-3/+27
| | |
| * | service: time: Implement IsStandardNetworkSystemClockAccuracySufficient.bunnei2020-01-045-1/+51
| | |
| * | service: time: Rewrite implementation of glue services.bunnei2020-01-0434-444/+2806
| | |
| * | core: Initialize several structs that make use of Common::UUID.bunnei2020-01-045-100/+101
| | |
* | | core/memory: Create a special MapMemoryRegion for physical memory.Markus Wick2020-01-182-3/+5
| | | | | | | | | | | | This allows us to create a fastmem arena within the memory.cpp helpers.
* | | core/hle: Simplify PhysicalMemory usage in vm_manager.Markus Wick2020-01-181-23/+11
| | |
* | | core/kernel: Fix GetTotalPhysicalMemoryUsed.Markus Wick2020-01-111-2/+2
| |/ |/| | | | | | | | | | | | | | | module._memory was already moved over to a new shared_ptr. So code_memory_size was not increased at all. This lowers the heap space and so saves a bit of memory, usually between 50 to 100 MB. This fixes a regression of c0a01f3adc466d07fc27020048e82cca60988970
* | Merge pull request #3272 from bunnei/vi-close-layerbunnei2020-01-075-11/+48
|\ \ | | | | | | service: vi: Implement CloseLayer.
| * | service: vi: Implement CloseLayer.bunnei2020-01-045-11/+48
| |/ | | | | | | - Needed for Undertale.
* | Merge pull request #3257 from degasus/no_busy_loopsbunnei2020-01-061-1/+1
|\ \ | | | | | | video_core: Block in WaitFence.
| * | video_core: Block in WaitFence.Markus Wick2019-12-301-1/+1
| | | | | | | | | | | | | | | | | | | | | This function is called rarely and blocks quite often for a long time. So don't waste power and let the CPU sleep. This might also increase the performance as the other cores might be allowed to clock higher.
* | | Merge pull request #2945 from FernandoS27/fix-bcatbunnei2020-01-051-3/+17
|\ \ \ | |_|/ |/| | nifm: Only return that there's an internet connection when there's a BCATServer
| * | nifm: Only return that there's an internet connection when there's a BCATServerFernando Sahmkow2019-11-071-3/+17
| | | | | | | | | | | | | | | This helps games that need internet for other purposes boot as the rest of our internet infrastructure is incomplete.
* | | NvServices: Correct Ioctl Remap.Fernando Sahmkow2019-12-252-3/+5
| |/ |/| | | | | | | This commit corrects a padding value in Ioctl Remap that was actually an offset to the mapping address.
* | Merge pull request #3214 from lioncash/svc-funcbunnei2019-12-132-9/+6
|\ \ | | | | | | kernel/svc: Amend function signature of SignalProcessWideKey
| * | kernel/svc: Correct function signature of SignalProcessWideKeyLioncash2019-12-112-9/+6
| | | | | | | | | | | | | | | This function doesn't actually return a result code, so we can amend the signature of it to match.
* | | Kernel: Correct behavior of Address Arbiter threads. (#3165)Fernando Sahmkow2019-12-113-24/+67
|/ / | | | | | | | | | | | | | | | | | | | | * Kernel: Correct behavior of Address Arbiter threads. This corrects arbitration threads to behave just like in Horizon OS. They are added into a container and released according to what priority they had when added. Horizon OS does not reorder them if their priority changes. * Kernel: Address Feedback.
* | Merge pull request #3201 from lioncash/dumpbunnei2019-12-112-2/+24
|\ \ | | | | | | kernel/svc: Provide implementations for svcDumpInfo/svcDumpInfoNew
| * | kernel/svc: Provide implementations for svcDumpInfo/svcDumpInfoNewLioncash2019-12-082-2/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | These are fairly trivial to implement, we can just do nothing. This also provides a spot for us to potentially dump out any relevant info in the future (e.g. for debugging purposes with homebrew, etc). While we're at it, we can also correct the names of both of these supervisor calls.
* | | kernel: Remove unnecessary includesLioncash2019-12-0815-11/+17
|/ / | | | | | | | | | | Over the course of the changes to the kernel code, a few includes are no longer necessary, particularly with the change over to std::shared_ptr from Boost's intrusive_ptr.
* | CpuCore: Clear exclusive state after doing a run in dynarmic.Fernando Sahmkow2019-12-051-1/+0
| | | | | | | | | | | | This commit corrects an error in which a Core could remain with an exclusive state after running, leaving space for possible race conditions between changing cores.
* | kernel: Implement a more accurate IPC dispatch.bunnei2019-11-2818-167/+245
| |
* | Merge pull request #3169 from lioncash/memorybunnei2019-11-2817-89/+133
|\ \ | | | | | | core/memory: Deglobalize memory management code
| * | core/memory; Migrate over SetCurrentPageTable() to the Memory classLioncash2019-11-271-7/+11
| | | | | | | | | | | | | | | | | | | | | Now that literally every other API function is converted over to the Memory class, we can just move the file-local page table into the Memory implementation class, finally getting rid of global state within the memory code.
| * | core/memory: Migrate over Write{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-274-21/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | The Write functions are used slightly less than the Read functions, which make these a bit nicer to move over. The only adjustments we really need to make here are to Dynarmic's exclusive monitor instance. We need to keep a reference to the currently active memory instance to perform exclusive read/write operations.
| * | core/memory: Migrate over Read{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-278-33/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all of the trivial parts of the memory interface moved over, we can get right into moving over the bits that are used. Note that this does require the use of GetInstance from the global system instance to be used within hle_ipc.cpp and the gdbstub. This is fine for the time being, as they both already rely on the global system instance in other functions. These will be removed in a change directed at both of these respectively. For now, it's sufficient, as it still accomplishes the goal of de-globalizing the memory code.
| * | core/memory: Migrate over ReadCString() to the Memory classLioncash2019-11-271-2/+4
| | | | | | | | | | | | | | | This only had one usage spot, so this is fairly straightforward to convert over.
| * | core/memory: Migrate over GetPointer()Lioncash2019-11-271-1/+2
| | | | | | | | | | | | | | | With all of the interfaces ready for migration, it's trivial to migrate over GetPointer().
| * | core: Prepare various classes for memory read/write migrationLioncash2019-11-278-17/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends a few interfaces to be able to handle the migration over to the new Memory class by passing the class by reference as a function parameter where necessary. Notably, within the filesystem services, this eliminates two ReadBlock() calls by using the helper functions of HLERequestContext to do that for us.
| * | core/memory: Migrate over address checking functions to the new Memory classLioncash2019-11-273-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | A fairly straightforward migration. These member functions can just be mostly moved verbatim with minor changes. We already have the necessary plumbing in places that they're used. IsKernelVirtualAddress() can remain a non-member function, since it doesn't rely on class state in any form.
| * | core/memory: Migrate over memory mapping functions to the new Memory classLioncash2019-11-271-6/+7
| | | | | | | | | | | | | | | | | | Migrates all of the direct mapping facilities over to the new memory class. In the process, this also obsoletes the need for memory_setup.h, so we can remove it entirely from the project.
* | | Merge pull request #3170 from lioncash/enumbunnei2019-11-281-2/+2
|\ \ \ | |/ / |/| | file_sys/directory: Make EntryType an enum class
| * | file_sys/directory: Make EntryType an enum classLioncash2019-11-271-2/+2
| | | | | | | | | | | | | | | This can trivially be an enum class rather than a regular enum, making it more strongly typed.
* | | core_timing: Use better reference tracking for EventType. (#3159)bunnei2019-11-276-14/+14
|/ / | | | | | | | | | | | | * core_timing: Use better reference tracking for EventType. - Moves ownership of the event to the caller, ensuring we don't fire events for destroyed objects. - Removes need for unique names - we won't be using this for save states anyways.
* | kernel: Fix reference management for client/server session.bunnei2019-11-263-20/+18
| | | | | | | | - Fixes shutdown crash and crash in Pokemon SwSh.
* | Merge pull request #3094 from lioncash/tablesbunnei2019-11-2533-7/+192
|\ \ | | | | | | service: Update function tables
| * | service: Update function tablesLioncash2019-11-1233-7/+192
| |/ | | | | | | | | | | Keeps the function tables up to date. Updated based off information from Switchbrew.
* | kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. (#3154)bunnei2019-11-2569-364/+364
| | | | | | | | | | | | * kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. - See https://github.com/citra-emu/citra/pull/4710 for details.
* | Update svc.cppbunnei2019-11-231-0/+1
| |
* | svc: GetSystemTick should return cntpct_el0, not core ticks.bunnei2019-11-231-1/+3
| |
* | Merge pull request #3114 from FernandoS27/cond-varbunnei2019-11-235-22/+74
|\ \ | | | | | | Kernel: Correct behavior of Condition Variables to be more similar to real hardware.
| * | Kernel: Optimize condition variable threads management.Fernando Sahmkow2019-11-214-24/+21
| | |
| * | Kernel: Correct SignalProcessWideKeyFernando Sahmkow2019-11-211-6/+2
| | | | | | | | | | | | When the target is 0, all threads must be processed.
| * | Kernel: Correct behavior of Condition Variables to be more similar to real hardware.Fernando Sahmkow2019-11-215-15/+74
| | | | | | | | | | | | | | | | | | | | | This commit ensures cond var threads act exactly as they do in the real console. The original implementation uses an RBTree and the behavior of cond var threads is that at the same priority level they act like a FIFO.
* | | Merge pull request #3130 from FernandoS27/cancel-syncbunnei2019-11-233-2/+19
|\ \ \ | | | | | | | | Kernel: Correct Cancel Synchronization.
| * | | Kernel: Correct Cancel Synchronization.Fernando Sahmkow2019-11-163-2/+19
| | | | | | | | | | | | | | | | | | | | | | | | This commit corrects the behavior of cancel synchronization when the thread is running/ready and ensures the next wait is cancelled as it's suppose to.
* | | | Merge pull request #3112 from lioncash/skipbunnei2019-11-211-8/+16
|\ \ \ \ | | | | | | | | | | service/am: Remove unnecessary Skip calls
| * | | | service/am: Remove unnecessary Skip callsLioncash2019-11-141-8/+16
| |/ / / | | | | | | | | | | | | | | | | We can simplify these by wrapping the necessary members in structs and then simply reading out the whole struct.
* | | | Merge pull request #3111 from lioncash/querybunnei2019-11-212-5/+14
|\ \ \ \ | |_|/ / |/| | | am: Stub QueryApplicationPlayStatistics
| * | | am: Stub QueryApplicationPlayStatisticsLioncash2019-11-142-5/+14
| |/ / | | | | | | | | | | | | | | | | | | | | | Maintains implementation parity between QueryApplicationPlayStatistics and QueryApplicationPlayStatisticsByUid. These function the same behaviorally underneath the hood, with the only difference being that one allows specifying a UID.
* | | Merge pull request #3091 from lioncash/core-conversionbunnei2019-11-1520-131/+124
|\ \ \ | |/ / |/| | core: Make most implicit type conversion warnings errors on MSVC
| * | service: Resolve sign conversion errorsLioncash2019-11-1215-58/+55
| | | | | | | | | | | | | | | These are fairly trivial to resolve and most of the changes entail using RESULT_UNKNOWN over ResultCode(-1).
| * | kernel: Resolve sign conversion warningsLioncash2019-11-124-72/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | Uncovered a bug within Thread's SetCoreAndAffinityMask() where an unsigned variable (ideal_core) was being compared against "< 0", which would always be a false condition. We can also get rid of an unused function (GetNextProcessorId) which contained a sign mismatch warning.
| * | result: Add default error code for the ResultCode(-1) caseLioncash2019-11-121-1/+9
| | | | | | | | | | | | | | | Will be used to reduce the overall duplication of the same magic value all over the codebase in following changes.
| * | result: Resolve sign-coversion warningsLioncash2019-11-121-1/+1
| |/ | | | | | | | | The constructor was implicitly using signed->unsigned conversions to produce 0xFFFFFFFF. We can just specify this explicitly with UINT32_MAX.
* | Merge pull request #3089 from SciresM/play_statisticsbunnei2019-11-142-0/+10
|\ \ | | | | | | Implement stub for IApplicationFunctions::QueryApplicationPlayStatisticsByUid
| * | Implement stub for QueryApplicationPlayStatisticsByUidMichael Scire2019-11-112-0/+10
| |/
* / core: Migrate off deprecated mbedtls functionsLioncash2019-11-123-3/+3
|/ | | | | These functions are marked for deprecation and it's recommended that the *_ret variants be used instead.
* Merge pull request #3062 from bunnei/event-improvebunnei2019-11-0623-87/+53
|\ | | | | kernel: Improve events
| * kernel: readable_event: Signal only once.bunnei2019-11-031-2/+4
| |
| * kernel: events: Remove ResetType::Automatic.bunnei2019-11-0323-84/+48
| | | | | | | | | | | | | | | | - This does not actually seem to exist in the real kernel - games reset these automatically. # Conflicts: # src/core/hle/service/am/applets/applets.cpp # src/core/hle/service/filesystem/fsp_srv.cpp
| * kernel: readable_event: Initialize members.bunnei2019-11-031-1/+1
| |
* | Merge pull request #2859 from Morph1984/hidDavid2019-11-062-92/+126
|\ \ | | | | | | hid: Stub SetNpadJoyAssignmentModeSingle and GetNpadHandheldActivationMode
| * | hid: Stub SetNpadJoyAssignmentModeSingle and reorganize service commandsMorph2019-10-072-92/+126
| | |
* | | common_func: Use std::array for INSERT_PADDING_* macros.bunnei2019-11-043-8/+11
| | | | | | | | | | | | - Zero initialization here is useful for determinism.
* | | core/am: Stub InitializeApplicationCopyrightFrameBuffer, SetApplicationCopyrightImage and SetApplicationCopyrightVisibilityFearlessTobi2019-11-032-3/+31
| |/ |/| | | | | These commands require Screenshots to be implemented anyway, so they are safe to stub for now.
* | scheduler: Mark parameter of AskForReselectionOrMarkRedundant() as constLioncash2019-10-282-5/+5
| | | | | | | | This is only compared against, so it can be made const.
* | scheduler: Silence sign conversion warningsLioncash2019-10-281-5/+5
| |
* | scheduler: Initialize class members directly where applicableLioncash2019-10-282-6/+4
| | | | | | | | Reduces the overall amount of code.
* | scheduler: Amend documentation commentsLioncash2019-10-282-75/+59
| | | | | | | | | | Adjusts the formatting of a few of the comments an ensures they get recognized as proper Doxygen comments.
* | Merge pull request #2971 from FernandoS27/new-scheduler-v2David2019-10-2811-398/+955
|\ \ | | | | | | Kernel: Implement a New Thread Scheduler V2
| * | Kernel Thread: Cleanup THREADPROCESSORID_DONT_UPDATE.Fernando Sahmkow2019-10-152-4/+1
| | |
| * | Kernel: Address Feedback 2Fernando Sahmkow2019-10-152-9/+6
| | |
| * | Kernel: Clang FormatFernando Sahmkow2019-10-152-5/+5
| | |
| * | Kernel: Reverse global accessor removal.Fernando Sahmkow2019-10-154-23/+9
| | |
| * | Kernel: Address Feedback.Fernando Sahmkow2019-10-156-67/+98
| | |
| * | Kernel Scheduler: Make sure the global scheduler shutdowns correctly.Fernando Sahmkow2019-10-153-0/+17
| | |
| * | Kernel_Thread: Eliminate most global accessors.Fernando Sahmkow2019-10-151-11/+11
| | |
| * | KernelSVC: Assert that condition variable address is aligned to 4 bytes.Fernando Sahmkow2019-10-151-0/+4
| | |
| * | Kernel: Correct Paused schedulingFernando Sahmkow2019-10-151-3/+1
| | |
| * | Kernel: Corrections to Wait Objects clearing in which a thread could still be signalled after a timeout or a cancel.Fernando Sahmkow2019-10-153-3/+4
| | |
| * | Kernel: Correct redundant yields to only advance time forward.Fernando Sahmkow2019-10-151-3/+5
| | |
| * | Kernel: Corrections to ModifyByWaitingCountAndSignalToAddressIfEqualFernando Sahmkow2019-10-151-5/+13
| | |
| * | Kernel: Correct Results in Condition Variables and MutexesFernando Sahmkow2019-10-153-24/+17
| | |
| * | Kernel: Clang FormatFernando Sahmkow2019-10-152-2/+3
| | |
| * | Kernel: Remove global system accessor from WaitObjectFernando Sahmkow2019-10-154-2/+17
| | |
| * | Scheduler: Implement Yield Count and Core migration on Thread Preemption.Fernando Sahmkow2019-10-152-5/+85
| | |
| * | Scheduler: Corrections to YieldAndBalanceLoad and Yield bombing protection.Fernando Sahmkow2019-10-152-8/+8
| | |
| * | Kernel: Initial implementation of thread preemption.Fernando Sahmkow2019-10-153-0/+30
| | |
| * | Scheduler: Add protections for Yield bombingFernando Sahmkow2019-10-155-24/+31
| | | | | | | | | | | | | | | | | | In case of redundant yields, the scheduler will now idle the core for it's timeslice, in order to avoid continuously yielding the same thing over and over.
| * | Kernel: Style and CorrectionsFernando Sahmkow2019-10-158-90/+130
| | |
| * | Correct PrepareRescheduleFernando Sahmkow2019-10-153-37/+20
| | |
| * | Comment and reorganize the schedulerFernando Sahmkow2019-10-152-98/+104
| | |
| * | Add PrepareReschedule where required.Fernando Sahmkow2019-10-153-16/+18
| | |
| * | Correct compiling errors and addapt to the new interface.Fernando Sahmkow2019-10-151-4/+1
| | |
| * | Correct Supervisor Calls to work with the new scheduler,Fernando Sahmkow2019-10-151-26/+41
| | |
| * | Add interfacing to the Global SchedulerFernando Sahmkow2019-10-152-0/+17
| | |
| * | Addapt thread class to the new SchedulerFernando Sahmkow2019-10-152-60/+237
| | |
| * | Implement a new Core SchedulerFernando Sahmkow2019-10-152-258/+411
| | |
* | | Merge pull request #2991 from lioncash/npadbunnei2019-10-232-51/+23
|\ \ \ | | | | | | | | hid/npad: Minor cleanup
| * | | hid/npad: Fix incorrect connection boolean value in ConnectAllDisconnectedControllers()Lioncash2019-10-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | We should be setting the connection state to true, otherwise we aren't actually making the controllers connected like the function name indicates.
| * | | hid/npad: Add missing break in default caseLioncash2019-10-181-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | While not an issue, it does prevent fallthrough from occurring if anything is ever added after this case (unlikely to occur, but this turns a trivial "should not cause issues" into a definite "won't cause issues).
| * | | hid/npad: Replace std::for_each with ranged for loopsLioncash2019-10-181-13/+12
| | | | | | | | | | | | | | | | | | | | | | | | Performs the same behavior, but is built into the core language itself. No functional change.
| * | | hid/npad: Remove redundant non-const variant of IsControllerSupported()Lioncash2019-10-182-34/+5
| | | | | | | | | | | | | | | | | | | | | | | | The const qualified variant can also be called in non-const contexts, so we can remove the non-const variant to eliminate a bit of code duplication.
| * | | hid/npad: Move function declarationsLioncash2019-10-181-5/+6
| | | | | | | | | | | | | | | | | | | | Clearly separate these from the variable declarations to make them more visible.
* | | | apm/controller: Make SetPerformanceConfiguration() use an array of pairs over a mapLioncash2019-10-171-14/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While a map is an OK way to do lookups (and usually recommended in most cases), this is a map that lives for the entire duration of the program and only deallocates its contents when the program terminates. Given the total size of the map is quite small, we can simply use a std::array of pairs and utilize std::find_if to perform the same behavior without loss of performance. This eliminates a static constructor and places the data into the read-only segment. While we're at it, we can also handle malformed inputs instead of directly dereferencing the resulting iterator.
* | | | apm/controller: Make GetCurrentPerformanceMode() a const member functionLioncash2019-10-172-2/+2
|/ / / | | | | | | | | | This doesn't modify instance state, so it can be made const qualified.
* | | Merge pull request #2912 from FernandoS27/async-fixesbunnei2019-10-165-28/+27
|\ \ \ | | | | | | | | General fixes to Async GPU
| * | | NvFlinger: Remove leftover from corrections and clang format.Fernando Sahmkow2019-10-051-4/+0
| | | |
| * | | Nvdrv: Correct Event setup in NvdrvFernando Sahmkow2019-10-052-23/+14
| | | | | | | | | | | | | | | | Events are supposed to be cleared on quering. This fixes that issue.
| * | | NVFlinger: Reverse the change that only signaled events on buffer acquire.Fernando Sahmkow2019-10-052-20/+1
| | | | | | | | | | | | | | | | | | | | This has been hardware tested and it seems that NVFlinger will still signal even if there are no buffers to present.
| * | | Nvdrv: Do framelimiting only in the CPU ThreadFernando Sahmkow2019-10-051-0/+4
| | | |
| * | | NvFlinger: Don't swap buffers if a frame is missing and always trigger event in sync gpu.Fernando Sahmkow2019-10-051-1/+3
| | | |
| * | | GPU_Async: Correct fences, display events and more.Fernando Sahmkow2019-10-052-2/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit uses guest fences on vSync event instead of an articial fake fence we had. It also corrects to keep signaling display events while loading the game as the OS is suppose to send buffers to vSync during that time.
| * | | Nvdrv: Correct Async regression and avoid signaling empty buffer vsyncsFernando Sahmkow2019-10-052-3/+9
| | | |
* | | | Merge pull request #2972 from lioncash/systembunnei2019-10-159-33/+63
|\ \ \ \ | |_|/ / |/| | | {bcat, gpu, nvflinger}: Remove trivial usages of the global system accessor
| * | | bcat: Remove use of global system accessorsLioncash2019-10-156-29/+55
| | | | | | | | | | | | | | | | | | | | Removes all uses of the global system accessor within the BCAT interface.
| * | | nvflinger/buffer_queue: Remove use of a global system accessorLioncash2019-10-123-4/+8
| | | |
* | | | pl_u: Fix mismatched rebase size error in font encryptionZach Hilman2019-10-132-11/+11
| | | |
* | | | pl_u: Use kernel physical memoryZach Hilman2019-10-131-0/+1
| | | |
* | | | pl_u: Remove excess static qualifierZach Hilman2019-10-131-1/+1
| | | |
* | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-10-131-110/+47
|/ / /
* | | Merge pull request #2921 from FreddyFunk/compiler-warnings-corebunnei2019-10-091-6/+6
|\ \ \ | | | | | | | | Services::ES fix casting warnings
| * | | Services::ES fix casting warningsFreddyFunk2019-09-291-6/+6
| | | |
* | | | Merge pull request #2654 from DarkLordZach/lm-log-rewritebunnei2019-10-095-156/+278
|\ \ \ \ | | | | | | | | | | lm: Rewrite logger to use core reporting services
| * | | | lm: Flush manager output on core shutdownZach Hilman2019-09-222-5/+11
| | | | |
| * | | | lm: Rename Initialize to Log and implement with manager/reporterZach Hilman2019-09-221-140/+22
| | | | | | | | | | | | | | | Allows saving and clearer output of data.
| * | | | lm: Implement manager class to output to reporterZach Hilman2019-09-222-0/+233
| | | | |
| * | | | core: Add LM::Manager to systemZach Hilman2019-09-223-16/+17
| |/ / / | | | | | | | | Allows centralized control over logging mechanisms.
* | | / hid: Implement DeactivateNpadMorph2019-10-072-1/+13
| |_|/ |/| | | | | | | | Makes use of the already existing DeactivateController function.
* | | Merge pull request #2951 from lioncash/globalZach Hilman2019-10-0711-44/+66
|\ \ \ | | | | | | | | core: Remove Core::CurrentProcess()
| * | | core: Remove Core::CurrentProcess()Lioncash2019-10-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This only encourages the use of the global system instance (which will be phased out long-term). Instead, we use the direct system function call directly to remove the appealing but discouraged short-hand.
| * | | hle/service: Replace global system instance calls with instance-based onesLioncash2019-10-0610-43/+65
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Migrates the HLE service code off the use of directly accessing the global system instance where trivially able to do so. This removes all usages of Core::CurrentProcess from the service code, only 8 occurrences of this function exist elsewhere. There's still quite a bit of "System::GetInstance()" being used, however this was able to replace a few instances.
* | | | bcat/module: Silence truncation warningsLioncash2019-10-061-3/+3
| | | | | | | | | | | | | | | | | | | | We need to perform explicit casts here, otherwise we're implicitly truncating a 64-bit type to a 32-bit one.
* | | | bcat: Take std::function instance by value in NullBackend's constructorLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | | | | | Without this, the std::move within the constructor initializer list won't be able to actually perform a move.
* | | | bcat: In-class initialize ProgressServiceBackend's impl memberLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | Allows us to remove a constructor initializer list.
* | | | bcat: Make ProgressServiceBackend's constructor take a std::string_viewLioncash2019-10-062-3/+7
| | | | | | | | | | | | | | | | | | | | Given the string is appended to another, we can make it a view so a redundant full copy of the string isn't made.
* | | | bcat: Make ProgressServiceBackend's GetEvent() constLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | | | | | This member function doesn't modify internal member state, so it can be marked const.
* | | | boxcat: Silence an unused variable warningLioncash2019-10-061-1/+2
|/ / / | | | | | | | | | | | | | | | On parse errors, we can log out the explanatory string indicating what the parsing error was, rather than just ignoring the variable and returning an overly broad error code.
* | | audio/audout_u: Change formatting for old clang-format versionsReinUsesLisp2019-10-051-1/+1
| | |
* | | service/nvdrv: Silence -WswitchReinUsesLisp2019-10-054-4/+10
| | |
* | | service/nfp: Silence -Wunused and -WswitchReinUsesLisp2019-10-051-4/+5
| | |
* | | service/hid: Silence -Wunused and -WswitchReinUsesLisp2019-10-0515-23/+18
| | |
* | | service/am: Silence -WreorderReinUsesLisp2019-10-051-2/+1
| | |
* | | service/hid: Remove unused system referenceReinUsesLisp2019-10-052-2/+1
| | |
* | | service/friend: Remove unused fieldReinUsesLisp2019-10-051-1/+0
| | |
* | | service/filesystem: Silence -Wunused-variableReinUsesLisp2019-10-051-1/+1
| | |
* | | service/bcat: Silence -Wreorder and -WunusedReinUsesLisp2019-10-052-2/+2
| | |
* | | service/audio: Silence -WunusedReinUsesLisp2019-10-051-1/+1
| | |
* | | service/apm: Silence -Wunused and -WreorderReinUsesLisp2019-10-052-4/+5
| |/ |/|
* | Merge pull request #2539 from DarkLordZach/bcatDavid2019-10-0316-40/+1497
|\ \ | | | | | | bcat: Implement BCAT service and connect to yuzu Boxcat server
| * | qt: Add service dialogZach Hilman2019-10-021-6/+5
| | |
| * | boxcat: Use updated game-asset API URL and tagsZach Hilman2019-10-011-6/+6
| | |
| * | bcat: Add FSC accessors for BCAT dataZach Hilman2019-10-0110-31/+51
| | | | | | | | | Ports BCAT to use FSC interface
| * | boxcat: Implement events global fieldZach Hilman2019-09-303-12/+14
| | |
| * | bcat: Implement DeliveryCacheProgressImpl structureZach Hilman2019-09-305-84/+310
| | | | | | | | | Huge thanks to lioncash for re-ing this for me.
| * | boxcat: Use Etag header names for file digestZach Hilman2019-09-301-10/+11
| | |
| * | boxcat: Add downloading and client for launch parameter dataZach Hilman2019-09-302-16/+77
| | |
| * | bcat: Add backend function for BCAT Indirect (launch parameter)Zach Hilman2019-09-302-0/+11
| | | | | | | | | | | | Returns the data that should be returned by PopLaunchParameter kind=ApplicationSpecific.
| * | bcat: Expose CreateBackendFromSettings helper functionZach Hilman2019-09-302-2/+2
| | |
| * | am: Unstub PopLaunchParameter and add bcat connection for app-specific dataZach Hilman2019-09-302-16/+52
| | | | | | | | | | | | Previously we were simply returning the account-preselect structure all times but if passed with a different mode the game expects application-specific data. This also adds a hook for BCAT into this allowing us to send the launch parameter through bcat,
| * | bcat: Implement cmd 90201 ClearDeliveryCacheStorageZach Hilman2019-09-301-1/+23
| | | | | | | | | | | | Takes a title ID and simply deletes all the data for that title ID's bcat. Invokes the respective backend command.
| * | bcat: Implement cmd 30100 SetPassphraseZach Hilman2019-09-301-1/+33
| | | | | | | | | | | | Takes a title ID and passphrase (0x40 byte string) and passes it to the backend.
| * | bcat: Implement cmd RequestSyncDeliveryCache and variantZach Hilman2019-09-301-2/+70
| | | | | | | | | | | | Variant also supports only updating a single directory. These just both invoke backend commands.
| * | bcat: Implement IDeliveryCacheProgressService commandsZach Hilman2019-09-301-0/+131
| | | | | | | | | | | | Used to query completion status and events for the current delivery task.
| * | bcat: Implement IDeliveryCacheFileService commandsZach Hilman2019-09-301-0/+117
| | | | | | | | | | | | Used to read the contents of files and access their metadata.
| * | bcat: Implement IDeliveryCacheDirectoryService commandsZach Hilman2019-09-301-0/+99
| | | | | | | | | | | | Used to list and get directories at the root level.
| * | bcat: Implement IDeliveryCacheStorageService commandsZach Hilman2019-09-301-0/+58
| | | | | | | | | | | | Used to create subclasses to manage files and directories and to list directories.
| * | bcat: Add commands to create IDeliveryCacheStorageServiceZach Hilman2019-09-303-2/+32
| | | | | | | | | | | | Used to access contents of download.
| * | module: Create BCAT backend based upon Settings value on constructionZach Hilman2019-09-302-1/+16
| | |
| * | bcat: Add BCAT backend for Boxcat serviceZach Hilman2019-09-302-0/+407
| | | | | | | | | | | | Downloads content from yuzu servers and unpacks it into the temporary directory provided. Fully supports all Backend features except passphrase.
| * | bcat: Add backend class to generify the functions of BCATZach Hilman2019-09-302-0/+100
| | | | | | | | | | | | Provides the most abstract simplified functions of BCAT as functions. Also includes a NullBackend class which is just a no-op.
| * | nifm: Signal to applications that internet access is availableZach Hilman2019-09-301-3/+10
| | |
| * | applets: Add accessor for AppletFrontendSetZach Hilman2019-09-302-0/+6
| | | | | | | | | | | | Allows other services to call applets without using LLE.
| * | filesystem: Add getter for BCAT temporary directoryZach Hilman2019-09-301-0/+9
| |/
* / Signal styleset changes at a better timeDavid Marcec2019-09-241-8/+2
|/ | | | We should signal when a net controller is added and our event should be manual, not automatic.
* Merge pull request #2683 from DarkLordZach/lock-exitDavid2019-09-224-7/+33
|\ | | | | am: Implement exit locking and self exit commands
| * qt: Prompt user for confirmation if exit lock is activeZach Hilman2019-09-221-1/+1
| |
| * am: Implement ISelfController ExitLock commandsZach Hilman2019-09-221-2/+6
| |
| * am: Implement ISelfController ExitZach Hilman2019-09-224-4/+20
| | | | | | | | Closes the current application.
| * am: Add RequestExit event to AppletMessageQueueZach Hilman2019-09-222-0/+6
| | | | | | | | Tested against libnx, signals to games to begin cleanup.
* | Merge pull request #2876 from ogniK5377/AcquireNpadStyleSetUpdateEventHandle-fixZach Hilman2019-09-223-11/+18
|\ \ | | | | | | AcquireNpadStyleSetUpdateEventHandle should have a separate event for each controller type
| * | removed commentDavid Marcec2019-09-221-1/+0
| | |
| * | RebasedDavid Marcec2019-09-223-11/+19
| | |
* | | Merge pull request #2895 from FearlessTobi/debug-logsDavid2019-09-221-7/+7
|\ \ \ | | | | | | | | service/acc: Lower log severity from INFO to DEBUG
| * | | service/acc: Lower log severity from INFO to DEBUGFearlessTobi2019-09-221-7/+7
| | | | | | | | | | | | | | | | According to ogniK, this should have always been Debug and not Info.
* | | | Merge pull request #2873 from ogniK5377/new-ioctlsFernando Sahmkow2019-09-2224-73/+153
|\ \ \ \ | |_|/ / |/| | | Initial implementation of Ioctl2 & Ioctl3
| * | | server side clang format fix2David Marcec2019-09-221-18/+18
| | | |
| * | | Use clang-format provided by build serverDavid Marcec2019-09-221-20/+18
| | | |
| * | | disable clang-format tempDavid Marcec2019-09-201-0/+2
| | | |
| * | | Initial implementation of Ioctl2 & Ioctl3David Marcec2019-09-1924-63/+143
| | | | | | | | | | | | | | | | Purpose of Ioctl2 and Ioctl3 is to prevent the passing of raw pointers through ioctls
* | | | Merge pull request #2884 from ogniK5377/deglobal-sys-servicesFernando Sahmkow2019-09-2264-212/+291
|\ \ \ \ | | | | | | | | | | Remove usage of System::CurrentInterface() from most services
| * | | | removed unneeded semicolonDavid Marcec2019-09-221-1/+1
| | | | |
| * | | | Removed reference to core timing to nvflinger and used system insteadDavid Marcec2019-09-221-1/+1
| | | | |
| * | | | marked controller constructors as explicitDavid Marcec2019-09-228-8/+8
| | | | |
| * | | | RebaseDavid Marcec2019-09-2225-62/+75
| | | | |
| * | | | RebaseDavid Marcec2019-09-225-20/+21
| | | | |
| * | | | Deglobalize System: ViDavid Marcec2019-09-223-8/+8
| | | | |
| * | | | Deglobalize System: TimeDavid Marcec2019-09-224-14/+21
| | | | |
| * | | | RebaseDavid Marcec2019-09-222-8/+12
| | | | |
| * | | | Deglobalize System: NvFlingerDavid Marcec2019-09-222-6/+7
| | | | |
| * | | | RebaseDavid Marcec2019-09-224-8/+12
| | | | |
| * | | | Deglobalize System: NimDavid Marcec2019-09-222-7/+12
| | | | |
| * | | | Deglobalize System: NifmDavid Marcec2019-09-222-13/+23
| | | | |
| * | | | Deglobalize System: NFPDavid Marcec2019-09-224-14/+16
| | | | |
| * | | | Deglobalize System: LDRDavid Marcec2019-09-222-6/+7
| | | | |
| * | | | Deglobalize System: IRSDavid Marcec2019-09-223-5/+6
| | | | |
| * | | | Deglobalize System: HidDavid Marcec2019-09-2220-37/+44
| | | | |
| * | | | Deglobalize System: FriendDavid Marcec2019-09-224-22/+24
| | | | |
| * | | | Deglobalize System: FatalDavid Marcec2019-09-226-20/+29
| | | | |
| * | | | Deglobalize System: BtmDavid Marcec2019-09-222-7/+13
| | | | |
| * | | | Deglobalize System: BtdrvDavid Marcec2019-09-222-5/+9
| | | | |
| * | | | Deglobalize System: AocDavid Marcec2019-09-222-11/+13
| | | | |
| * | | | Deglobalize System: AmDavid Marcec2019-09-221-1/+1
| | | | |
* | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"David Marcec2019-09-222-50/+117
|/ / / / | | | | | | | | | | | | | | | | This reverts commit fa1c60c33ef88c6cd0b72da46842dc9098db712d, reversing changes made to e34899067b60a69bca02761bd1290c6824bb559a.
* | | | Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1David2019-09-222-117/+50
|\ \ \ \ | |_|_|/ |/| | | system_archive: Move shared font data to system_archive and fix extended font data
| * | | pl_u: Use kernel physical memoryZach Hilman2019-09-221-0/+1
| | | |
| * | | pl_u: Remove excess static qualifierZach Hilman2019-09-221-1/+1
| | | |
| * | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-09-222-109/+41
| | | |
| * | | pl_u: Expose method to encrypt TTF to BFTTFZach Hilman2019-09-222-14/+14
| | |/ | |/|
* | | Merge pull request #2612 from DarkLordZach/prepo-newDavid2019-09-223-25/+84
|\ \ \ | | | | | | | | prepo: Implement New, System, and Non-User variants of SaveReport
| * | | prepo: Remove system global accessorsZach Hilman2019-09-223-15/+18
| | | |
| * | | prepo: Implement SaveReport New and System variantsZach Hilman2019-09-221-15/+71
| |/ /
* | | configure_debug: Move reporting option to loggingZach Hilman2019-09-228-14/+15
| | |
* | | filesystem: Add const qualification to various accessorsZach Hilman2019-09-213-68/+76
| | |
* | | yuzu: Port old usages of Filesystem namespace to FilesystemControllerZach Hilman2019-09-214-15/+38
| | |
* | | services: Pass FileSystemController as reference to services that need itZach Hilman2019-09-2111-20/+47
| | |
* | | am: Unstub IApplicationFunctions EnsureSaveData (20)Zach Hilman2019-09-211-8/+14
| | | | | | | | | Creates a default save data for the application given a user ID.
* | | filesystem: Pass Size Getter functions to IFileSystem for sizesZach Hilman2019-09-213-20/+31
| | |
* | | filesystem: Add FileSystemController to deglobalize FS servicesZach Hilman2019-09-212-58/+359
|/ /
* / Mark KickOffPb & SubmitGPFIFO as traceDavid Marcec2019-09-211-4/+4
|/ | | | These functions are not stubbed and are called fairly often. Due to the nature of how often they're called, we should keep them marked as LOG_TRACE instead of LOG_DEBUG or LOG_WARNING
* Merge pull request #2667 from DarkLordZach/profile-editorbunnei2019-09-145-10/+130
|\ | | | | acc: Implement IProfileEditor interface and 'Store'/'StoreWithImage' commands
| * acc_su: Implement GetProfileEditor (205)Zach Hilman2019-07-033-1/+13
| | | | | | Takes a UUID of a user and provides and interface that allows RW access to user data/settings.
| * acc: Implement IProfileEditor-specific commands 'Store' and 'StoreWithImage'Zach Hilman2019-07-031-1/+73
| | | | | | Verified with IDA
| * profile_manager: Add setter for ProfileBase and ProfileDataZach Hilman2019-07-032-0/+13
| | | | | | Needed by IProfileEditor 'Store' and 'StoreWithImage'
| * acc: Add IProfileCommon for IProfile and IProfileEditorZach Hilman2019-07-031-8/+31
| | | | | | Since 2/3 of the commands are shared, this is likely how its done on HW.
* | Merge pull request #2716 from lioncash/hle-globalDavid2019-09-0916-96/+141
|\ \ | | | | | | service/am: Remove usages of global system accessors
| * | service/am: Remove usages of global system accessorsLioncash2019-09-0516-96/+141
| | | | | | | | | | | | | | | | | | Avoids the use of global accessors, removing the reliance on global state. This also makes dependencies explicit in the interface, as opposed to being hidden
* | | Merge pull request #2763 from lioncash/map-physDavid2019-09-092-39/+41
|\ \ \ | | | | | | | | kernel/vm_manager: Minor cleanup
| * | | kernel/vm_manager: Correct doxygen comment parameter tags for MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-4/+4
| | | | | | | | | | | | | | | | | | | | Corrects the parameter names within the doxygen comments so that they resolve properly.
| * | | kernel/vm_manager: Move variables closer to usage spots in MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-16/+10
| | | | | | | | | | | | | | | | Narrows the scope of variables down to where they're only necessary.
| * | | kernel/vm_manager: Correct behavior in failure case of UnmapPhysicalMemory()Lioncash2019-08-301-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | If an unmapping operation fails, we shouldn't be decrementing the amount of memory mapped and returning that the operation was successful. We should actually be returning the error code in this case.
| * | | kernel/vm_manager: Reserve memory ahead of time for slow path in MergeAdjacentVMALioncash2019-08-301-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially expensive (depending on the size of the memory block) allocations by reserving the necessary memory before performing both insertions. This avoids scenarios where the second insert may cause a reallocation to occur.
| * | | kernel/vm_manager: std::move shared_ptr instance in MergeAdjacentVMALioncash2019-08-301-1/+1
| | | | | | | | | | | | | | | | Avoids an unnecessary atomic reference count increment and decrement.
| * | | kernel/vm_manager: Deduplicate iterator creation in MergeAdjacentVMALioncash2019-08-301-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | Avoids needing to read the same long sequence of code in both code paths. Also makes it slightly nicer to read and debug, as the locals will be able to be shown in the debugger.
| * | | kernel/vm_manager: Simplify some std::vector constructor callsLioncash2019-08-301-2/+2
| | | | | | | | | | | | | | | | Same behavior, one less magic constant to read.
| * | | kernel/vm_manager: Simplify some assertion messagesLioncash2019-08-301-10/+10
| | | | | | | | | | | | | | | | | | | | Assertions already log out the function name, so there's no need to manually include the function name in the assertion strings.
* | | | Merge pull request #2418 from DarkLordZach/srv-esDavid2019-09-051-10/+220
|\ \ \ \ | |_|/ / |/| | | es: Implement various ticket accessor commands from IEticketService
| * | | key_manager: Convert Ticket union to std::variantZach Hilman2019-07-081-2/+2
| | | |
| * | | es: Populate/synthesize tickets on constructionZach Hilman2019-07-081-2/+3
| | | |
| * | | key_manager: Add structure for Ticket parsingZach Hilman2019-07-081-9/+9
| | | |
| * | | es: Implement ETicket GetPersonalizedTicketData (17)Zach Hilman2019-07-081-1/+21
| | | | | | | | | | | | Copies the raw personal ticket data into the buffer provided.
| * | | es: Implement ETicket GetCommonTicketData (16)Zach Hilman2019-07-081-1/+20
| | | | | | | | | | | | Copies the raw common ticket data for the specified rights ID into the buffer provided.
| * | | es: Implement ETicket GetPersonalizedTicketSize (15)Zach Hilman2019-07-081-1/+17
| | | | | | | | | | | | Returns the size of the buffer needed to hold the personal ticket associated with the rights ID.
| * | | es: Implement ETicket GetCommonTicketSize (14)Zach Hilman2019-07-081-1/+17
| | | | | | | | | | | | Returns the size of the buffer needed to hold the common ticket associated with the rights ID.
| * | | es: Implement ETicket ListPersonalizedTicket (12)Zach Hilman2019-07-081-1/+24
| | | | | | | | | | | | Returns an application-specific number of entries of personal tickets, starting at offset 0.
| * | | es: Implement ETicket ListCommonTicket (11)Zach Hilman2019-07-081-1/+24
| | | | | | | | | | | | Returns an application specified count of entries of common tickets, starting at offset 0.
| * | | es: Implement ETicket CountPersonalizedTicket (10)Zach Hilman2019-07-081-1/+12
| | | | | | | | | | | | Returns the number of personalized (console/user-unique) tickets in the KeyManager.
| * | | es: Implement ETicket CountCommonTicket (9)Zach Hilman2019-07-081-1/+12
| | | | | | | | | | | | Returns the number of common (non-console-unique) tickets in the KeyManager.
| * | | es: Implement ETicket GetTitleKey (8)Zach Hilman2019-07-081-1/+27
| | | | | | | | | | | | Takes a rights ID as input and returns the associated title key, if it exists.
| * | | es: Implement ETicket ImportTicket (1)Zach Hilman2019-07-081-1/+45
| | | | | | | | | | | | Takes a ticket and certificate and installs it to the KeyManager.
* | | | Merge pull request #2834 from Morph1984/audrenu_QueryAudioDeviceInputEventDavid2019-09-051-1/+15
|\ \ \ \ | | | | | | | | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEvent
| * | | | Add Kernel::EventPair audio_input_device_switch_event;Morph19842019-09-041-0/+1
| | | | |
| * | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEventMorph19842019-09-041-1/+14
| | |/ / | |/| |
* | | | Merge pull request #2836 from Morph1984/hid_vibrationDavid2019-09-054-2/+32
|\ \ \ \ | | | | | | | | | | hid: Implement PermitVibration and IsVibrationPermitted
| * | | | dittoMorph19842019-09-041-1/+1
| | | | | | | | | | | | | | | Co-Authored-By: David <25727384+ogniK5377@users.noreply.github.com>
| * | | | IsVibrationEnabled() as a const member funcMorph19842019-09-041-1/+1
| | | | |
| * | | | clang-formatMorph19842019-09-041-2/+2
| | | | |
| * | | | Update npad.hMorph19842019-09-041-0/+1
| | | | |
| * | | | Update npad.cppMorph19842019-09-041-0/+6
| | | | |
| * | | | Update hid.hMorph19842019-09-041-0/+2
| | | | |
| * | | | Update hid.cppMorph19842019-09-041-2/+23
| |/ / /
* | | | Merge pull request #2818 from MysticExile/fmtDavid2019-09-051-1/+1
|\ \ \ \ | | | | | | | | | | externals: update fmt to 6.0.0
| * | | | accommodate for fmt updateEthan2019-08-291-1/+1
| |/ / /
* | | | AM: Stub IApplicationFunctions::GetGpuErrorDetectedSystemEvent (#2827)mailwl2019-09-042-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * AM: Implement IApplicationFunctions::GetGpuErrorDetectedSystemEvent * Remove unneeded event clear * Fix event name
* | | | Merge pull request #2829 from Morph1984/audiobunnei2019-09-041-2/+15
|\ \ \ \ | | | | | | | | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolume
| * | | | remove <f32>Morph19842019-09-041-1/+1
| | | | | | | | | | | | | | | We can remove this since its already a f32 value
| * | | | explicitly represent 1 as a float (1.0f instead of 1)Morph19842019-09-041-1/+1
| | | | |
| * | | | Change u32 -> f32Morph19842019-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Volume is a f32 value. (SwIPC describes it as a u32, but it is actually f32 as corroborated by switchbrew docs and SetAudioDeviceOutputVolume) ```cpp const f32 volume = rp.Pop<f32>(); ```
| * | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolumeMorph19842019-09-031-2/+15
| |/ / /
* | | | Merge pull request #2708 from DarkLordZach/mii-db-source-crashDavid2019-09-041-0/+4
|\ \ \ \ | | | | | | | | | | mii: Handle logging of unknown database source
| * | | | mii: Handle logging of unknown database sourceZach Hilman2019-07-101-0/+4
| | | | |
* | | | | Merge pull request #2793 from ReinUsesLisp/bgr565bunnei2019-09-041-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | renderer_opengl: Implement RGB565 framebuffer format
| * | | | gpu: Change optional<reference_wrapper<T>> to T* for FramebufferConfigReinUsesLisp2019-08-211-1/+1
| | | | |
* | | | | Merge pull request #2748 from FernandoS27/align-memorybunnei2019-08-2110-33/+55
|\ \ \ \ \ | |/ / / / |/| | | | VM_Manager: Align allocated host physical memory to 256bytes
| * | | | Kernel: Address FeedbackFernando Sahmkow2019-07-192-3/+9
| | | | |
| * | | | VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-1910-32/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit ensures that all backing memory allocated for the Guest CPU is aligned to 256 bytes. This due to how gpu memory works and the heavy constraints it has in the alignment of physical memory.
* | | | | Merge pull request #2747 from lioncash/audiobunnei2019-08-187-108/+179
|\ \ \ \ \ | | | | | | | | | | | | service/audren_u: Unstub ListAudioDeviceName
| * | | | | service/audren_u: Handle audio USB output revision queries in ListAudioDeviceName()Lioncash2019-07-192-16/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Audio devices use the supplied revision information in order to determine if USB audio output is able to be supported. In this case, we can only really handle using this revision information in ListAudioDeviceName(), where it checks if USB audio output is supported before supplying it as a device name. A few other scenarios exist where the revision info is checked, such as: - Early exiting from SetAudioDeviceOutputVolume if USB audio is attempted to be set when that device is unsupported. - Early exiting and returning 0.0f in GetAudioDeviceOutputVolume when USB output volume is queried and it's an unsupported device. - Falling back to AHUB headphones in GetActiveAudioDeviceName when the device type is USB output, but is unsupported based off the revision info. In order for these changes to also be implemented, a few other changes to the interface need to be made. Given we now properly handle everything about ListAudioDeviceName(), we no longer need to describe it as a stubbed function.
| * | | | | service/audren_u: Move revision testing code out of AudRenULioncash2019-07-192-63/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The revision querying facilities are used by more than just audren. e.g. audio devices can use this to test whether or not USB audio output is supported. This will be used within the following change.
| * | | | | service/audio: Remove global system accessorsLioncash2019-07-197-34/+54
| | | | | | | | | | | | | | | | | | | | | | | | Trims out the lingering reliance on global state out of the audio code.
| * | | | | service/audren_u: Remove unnecessary return value from GetActiveAudioDeviceName()Lioncash2019-07-191-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | This service function only ever returns a result and nothing more.
| * | | | | service/audren_u: Report proper device namesLioncash2019-07-191-6/+29
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AudioDevice and AudioInterface aren't valid device names on the Switch. We should also be returning consistent names in GetActiveAudioDeviceName(). While we're at it, we can also handle proper name output in ListAudioDeviceName, by returning all the available devices on the Switch.
* | | | | Merge pull request #2592 from FernandoS27/sync1bunnei2019-07-2630-169/+542
|\ \ \ \ \ | |/ / / / |/| | | | Implement GPU Synchronization Mechanisms & Correct NVFlinger
| * | | | NVServices: Correct delayed responses.Fernando Sahmkow2019-07-051-24/+19
| | | | |
| * | | | Nv_Host_Ctrl: Correct difference calculationFernando Sahmkow2019-07-051-5/+7
| | | | |
| * | | | NVServices: Address FeedbackFernando Sahmkow2019-07-058-21/+38
| | | | |
| * | | | NVServices: Styling, define constructors as explicit and correctionsFernando Sahmkow2019-07-0518-36/+31
| | | | |
| * | | | NVFlinger: Correct GCC compile errorFernando Sahmkow2019-07-056-17/+16
| | | | |
| * | | | NVServices: Make NVEvents Automatic according to documentation.Fernando Sahmkow2019-07-052-4/+7
| | | | |
| * | | | NVServices: Correct CtrlEventWaitSync to block the ipc until timeout.Fernando Sahmkow2019-07-0523-31/+104
| | | | |
| * | | | GPU: Correct Interrupts to interrupt on syncpt/value instead of event, mirroring hardwareFernando Sahmkow2019-07-055-14/+14
| | | | |
| * | | | nvflinger: Make the force 30 fps still force 30 fpsFernando Sahmkow2019-07-051-1/+1
| | | | |
| * | | | nv_services: Fixes to event liberation.Fernando Sahmkow2019-07-051-6/+14
| | | | |
| * | | | nvflinger: Acquire buffers in the same order as they were queued.Fernando Sahmkow2019-07-052-3/+11
| | | | |
| * | | | nv_services: Deglobalize NvServicesFernando Sahmkow2019-07-0523-51/+65
| | | | |
| * | | | nv_host_ctrl: Make Sync GPU variant always return synced result.Fernando Sahmkow2019-07-051-0/+5
| | | | |
| * | | | nvhost_ctrl: Corrections to event handlingFernando Sahmkow2019-07-052-8/+12
| | | | |
| * | | | Gpu: Mark areas as protected.Fernando Sahmkow2019-07-051-0/+6
| | | | |
| * | | | nv_services: Stub CtrlEventSignalFernando Sahmkow2019-07-052-12/+34
| | | | |
| * | | | Gpu: Implement Hardware Interrupt Manager and manage GPU interruptsFernando Sahmkow2019-07-053-8/+1
| | | | |
| * | | | nv_services: Implement NvQueryEvent, NvCtrlEventWait, NvEventRegister, NvEventUnregisterFernando Sahmkow2019-07-057-17/+192
| | | | |
| * | | | nv_services: Create GPU channels correctlyFernando Sahmkow2019-07-052-2/+5
| | | | |
| * | | | video_core: Implement GPU side SyncpointsFernando Sahmkow2019-07-053-7/+33
| | | | |
| * | | | nv_services: Correct buffer queue fencing and GPFifo fencingFernando Sahmkow2019-07-057-57/+69
| | | | |
| * | | | nvflinger: Implement swap intervalsFernando Sahmkow2019-07-055-8/+21
| | | | |
* | | | | Merge pull request #2687 from lioncash/tls-processbunnei2019-07-183-14/+30
|\ \ \ \ \ | | | | | | | | | | | | kernel/process: Allocate the process' TLS region during initialization
| * | | | | kernel/process: Allocate the process' TLS region during initializationLioncash2019-07-073-3/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prior to execution within a process beginning, the process establishes its own TLS region for uses (as far as I can tell) related to exception handling. Now that TLS creation was decoupled from threads themselves, we can add this behavior to our Process class. This is also good, as it allows us to remove a stub within svcGetInfo, namely querying the address of that region.
| * | | | | kernel/process: Move main thread stack allocation to its own functionLioncash2019-07-072-12/+17
| | |_|/ / | |/| | | | | | | | | | | | | Keeps this particular set of behavior isolated to its own function.
* | | | | Kernel: Downgrade WaitForAddress and SignalToAddress messages to Trace.Fernando Sahmkow2019-07-181-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | This messages were originally set as warnning since few games used these svcs and it was needed for debugging. This is no longer the case.
* | | | | Merge pull request #2690 from SciresM/physmem_fixesFernando Sahmkow2019-07-146-40/+470
|\ \ \ \ \ | | | | | | | | | | | | Implement MapPhysicalMemory/UnmapPhysicalMemory
| * | | | | Remove unicorn mappings/unmappingsMichael Scire2019-07-121-19/+0
| | | | | |
| * | | | | Prevent merging of device mapped memory blocks.Michael Scire2019-07-091-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This sets the DeviceMapped attribute for GPU-mapped memory blocks, and prevents merging device mapped blocks. This prevents memory mapped from the gpu from having its backing address changed by block coalesce.
| * | | | | Remove unused member function declarationMichael Scire2019-07-071-9/+0
| | | | | |
| * | | | | physmem: add helpers, cleanup logic.Michael Scire2019-07-072-171/+170
| | | | | |
| * | | | | clang-format fixesMichael Scire2019-07-072-3/+3
| | | | | |
| * | | | | address review commentaryMichael Scire2019-07-075-36/+42
| | | | | |
| * | | | | Implement MapPhysicalMemory/UnmapPhysicalMemoryMichael Scire2019-07-076-20/+468
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implements svcMapPhysicalMemory/svcUnmapPhysicalMemory for Yuzu, which can be used to map memory at a desired address by games since 3.0.0. It also properly parses SystemResourceSize from NPDM, and makes information available via svcGetInfo. This is needed for games like Super Smash Bros. and Diablo 3 -- this PR's implementation does not run into the "ASCII reads" issue mentioned in the comments of #2626, which was caused by the following bugs in Yuzu's memory management that this PR also addresses: * Yuzu's memory coalescing does not properly merge blocks. This results in a polluted address space/svcQueryMemory results that would be impossible to replicate on hardware, which can lead to game code making the wrong assumptions about memory layout. * This implements better merging for AllocatedMemoryBlocks. * Yuzu's implementation of svcMirrorMemory unprotected the entire virtual memory range containing the range being mirrored. This could lead to games attempting to map data at that unprotected range/attempting to access that range after yuzu improperly unmapped it. * This PR fixes it by simply calling ReprotectRange instead of Reprotect.
* | | | | Clang formatDavid Marcec2019-07-121-2/+4
| | | | |
* | | | | "AudioRenderer" thread should have a unique nameDavid Marcec2019-07-122-4/+4
| | | | | | | | | | | | | | | | | | | | Creating multiple "AudioRenderer" threads cause the previous thread to be overwritten. The thread will name be renamed to AudioRenderer-InstanceX, where X is the current instance number.
* | | | | Merge pull request #2717 from SciresM/unmirror_memorybunnei2019-07-112-7/+34
|\ \ \ \ \ | | | | | | | | | | | | Restore memory perms on svcUnmapMemory/UnloadNro
| * | | | | Restore memory perms on svcUnmapMemory/UnloadNroMichael Scire2019-07-112-7/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prior to PR, Yuzu did not restore memory to RW- on unmap of mirrored memory or unloading of NRO. (In fact, in the NRO case, the memory was unmapped instead of reprotected to --- on Load, so it was actually lost entirely...) This PR addresses that, and restores memory to RW- as it should. This fixes a crash in Super Smash Bros when creating a World of Light save for the first time, and possibly other games/circumstances.
* | | | | | Merge pull request #2723 from lioncash/membunnei2019-07-111-20/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/arm: Remove obsolete Unicorn memory mapping
| * | | | | | core/arm: Remove obsolete Unicorn memory mappingLioncash2019-07-111-20/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was initially necessary when AArch64 JIT emulation was in its infancy and all memory-related instructions weren't implemented. Given the JIT now has all of these facilities implemented, we can remove these functions from the CPU interface.
* | | | | | service/am: Implement IsAutoSleepDisabledLioncash2019-07-112-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This simply queries whether or not auto-sleep facilities are disabled and has no special handling. It's a basic getter function.
* | | | | | service/am: Implement SetAutoSleepDisabledLioncash2019-07-112-1/+23
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a basic implementation of SetAutoSleepDisabled. Until idle handling is implemented, this is about the best we can do. In the meantime, provide a rough documenting of specifics that occur when this function is called on actual hardware.
* | | | | Merge pull request #2700 from ogniK5377/GetFriendListbunnei2019-07-101-1/+34
|\ \ \ \ \ | | | | | | | | | | | | IFriendService::GetFriendList
| * | | | | IFriendService::GetFriendListDavid Marcec2019-07-091-1/+34
| | |_|/ / | |/| | | | | | | | | | | | | We don't have any friends implemented in Yuzu yet so it doesn't make sense to return any friends. For now we'll be returning 0 friends however the information provided will allow a proper implementation of this cmd when needed.
* | | | | Merge pull request #2611 from DarkLordZach/pm-info-cmdbunnei2019-07-103-16/+116
|\ \ \ \ \ | | | | | | | | | | | | pm: Implement various pm commands for finding process and title IDs
| * | | | | pm: Implement pm:shell and pm:dmnt GetApplicationPidZach Hilman2019-06-273-7/+33
| | | | | | | | | | | | | | | | | | | | | | | | Returns the process ID of the current application or 0 if no app is running.
| * | | | | pm: Implement pm:dmnt GetTitlePidZach Hilman2019-06-271-7/+36
| | | | | | | | | | | | | | | | | | | | | | | | Takes a title ID and searches for a matching process, returning error if it doesn't exist, otherwise the process ID.
| * | | | | pm: Implement pm:info GetTitleIdZach Hilman2019-06-271-2/+47
| | | | | | | | | | | | | | | | | | | | | | | | Searches the process list for a process with the specified ID, returning the title ID if it exists.
* | | | | | Merge pull request #2650 from DarkLordZach/mii-iface-verbunnei2019-07-101-1/+15
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | mii: Implement IDatabaseService SetInterfaceVersion
| * | | | | mii: Implement IDatabaseService SetInterfaceVersionZach Hilman2019-07-071-1/+15
| |/ / / / | | | | | | | | | | Appears to set a member variable used to affect the API that games access, and the method used to store data.
* | | | | Merge pull request #2657 from ogniK5377/npad-assignmentsZach Hilman2019-07-085-3/+99
|\ \ \ \ \ | | | | | | | | | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignment
| * | | | | addressed issuesDavid Marcec2019-07-081-6/+7
| | | | | |
| * | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignmentDavid Marcec2019-07-015-3/+98
| | | | | | | | | | | | | | | | | | | | | | | | StartLrAssignmentMode and StopLrAssignmentMode don't require any implementation as it's just used for showing the screen of changing the controller orientation if the user wishes to do so. Ever since #1634 this has not been needed as users can specify the controller orientation from the config and swap at any time. We store a private member just in case this gets used for anything extra in the future
* | | | | | Merge pull request #2651 from DarkLordZach/apm-boost-mode-1bunnei2019-07-0811-57/+236
|\ \ \ \ \ \ | | | | | | | | | | | | | | apm: Initial implementation of performance config and boost mode
| * | | | | | am: Implement SetCpuBoostMode in terms of APMZach Hilman2019-06-295-13/+26
| | | | | | |
| * | | | | | apm: Implement SetCpuBoostModeZach Hilman2019-06-292-0/+14
| | | | | | |
| * | | | | | apm: Add getters for performance config and modeZach Hilman2019-06-292-33/+49
| | | | | | |
| * | | | | | apm: Add apm:am serviceZach Hilman2019-06-292-11/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | 8.0.0+ identical version of apm
| * | | | | | apm: Add Controller class to manage speed data and applicationZach Hilman2019-06-292-0/+138
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2642 from DarkLordZach/fsp-log-2bunnei2019-07-086-27/+73
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | fsp-srv: Implement Access Logging Functionality
| * | | | | fsp-srv: Implement GetAccessLogVersionInfoZach Hilman2019-06-292-3/+14
| | | | | | | | | | | | | | | | | | | | | | | | Returns some misc. data about logging to help the game determine if it should log.
| * | | | | fsp-srv: Implement OutputAccessLogToSdCardZach Hilman2019-06-296-26/+61
| |/ / / / | | | | | | | | | | | | | | | Allows games to log data to the SD.
* | | | | Merge pull request #2677 from lioncash/assertZach Hilman2019-07-073-37/+48
|\ \ \ \ \ | | | | | | | | | | | | kernel/vm_manager: Handle stack/TLS IO region placement a little better
| * | | | | kernel/vm_manager: Rename 'new map' to 'stack'Lioncash2019-07-063-37/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a more accurate name for the memory region and also disambiguates between the map and new map regions of memory, making it easier to understand.
| * | | | | kernel/vm_manager: Handle stack/TLS IO region placement betterLioncash2019-07-061-2/+13
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Handles the placement of the stack a little nicer compared to the previous code, which was off in a few ways. e.g. The stack (new map) region, shouldn't be the width of the entire address space if the size of the region calculation ends up being zero. It should be placed at the same location as the TLS IO region and also have the same size. In the event the TLS IO region contains a size of zero, we should also be doing the same thing. This fixes our memory layout a little bit and also resolves some cases where assertions can trigger due to the memory layout being incorrect.
* | | | | clang-format fixesMichael Scire2019-07-061-4/+5
| | | | |
* | | | | am: Implement GetAccumulatedSuspendedTickValueMichael Scire2019-07-062-7/+19
|/ / / /
* | | | Merge pull request #2555 from lioncash/tlsZach Hilman2019-07-046-81/+148
|\ \ \ \ | | | | | | | | | | kernel/process: Decouple TLS handling from threads
| * | | | kernel/process: Default initialize all member variablesLioncash2019-07-041-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | Ensures a Process instance is always created with a deterministic initial state.
| * | | | kernel/process: Decouple TLS handling from threadsLioncash2019-07-044-66/+97
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Extracts out all of the thread local storage management from thread instances themselves and makes the owning process handle the management of the memory. This brings the memory management slightly more in line with how the kernel handles these allocations. Furthermore, this also makes the TLS page management a little more readable compared to the lingering implementation that was carried over from Citra.
| * | | | kernel/vm_manager: Add overload of FindFreeRegion() that operates on a boundaryLioncash2019-07-042-13/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary for making our TLS slot management slightly more straightforward. This can also be utilized for other purposes in the future. We can implement the existing simpler overload in terms of this one anyways, we just pass the beginning and end of the ASLR region as the boundaries.
* | | | | Merge pull request #2658 from ogniK5377/QueryAudioDeviceOutputEventbunnei2019-07-041-3/+16
|\ \ \ \ \ | | | | | | | | | | | | IAudioDevice::QueryAudioDeviceOutputEvent
| * | | | | IAudioDevice::QueryAudioDeviceOutputEventDavid Marcec2019-07-011-3/+16
| | |_|/ / | |/| | | | | | | | | | | | | The event should only be signaled when an output audio device gets changed. Example, Speaker to USB headset. We don't identify different devices internally yet so there's no need to signal the event yet.
* | | | | Merge pull request #2638 from DarkLordZach/quest-flagbunnei2019-07-042-1/+10
|\ \ \ \ \ | |_|/ / / |/| | | | set: Implement GetQuestFlag with config option
| * | | | set: Implement GetQuestFlagZach Hilman2019-06-292-1/+10
| | |/ / | |/| | | | | | Simply returns a true/false value indicating if the system is a kiosk system. This has been mapped to a config option for the purposes of yuzu.
* | | | Merge pull request #2613 from ogniK5377/InitalizeApplicationInfoZach Hilman2019-07-044-6/+109
|\ \ \ \ | | | | | | | | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestricted
| * | | | Addressed issuesDavid Marcec2019-06-282-17/+12
| | | | |
| * | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestrictedDavid Marcec2019-06-274-6/+114
| |/ / / | | | | | | | | | | | | InitializeApplicationInfoRestricted will need further implementation as it's checking for other user requirements about the game. As we're emulating, we're assuming the user owns the game so we skip these checks currently, implementation will need to be added further on
* | | | Merge pull request #2608 from ogniK5377/Time_GetSharedMemoryNativeHandleZach Hilman2019-07-047-28/+258
|\ \ \ \ | | | | | | | | | | Implement Time::GetSharedMemoryNativeHandle
| * | | | Addressed issuesDavid Marcec2019-06-265-37/+53
| | | | |
| * | | | Implement Time::GetSharedMemoryNativeHandleDavid Marcec2019-06-257-29/+243
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This PR attempts to implement the shared memory provided by GetSharedMemoryNativeHandle. There is still more work to be done however that requires a rehaul of the current time module to handle clock contexts. This PR is mainly to get the basic functionality of the SharedMemory working and allow the use of addition to it whilst things get improved on. Things to note: Memory Barriers are used in the SharedMemory and a better solution would need to be done to implement this. Currently in this PR I’m faking the memory barriers as everything is sync and single threaded. They work by incrementing the counter and just populate the two data slots. On data reading, it will read the last added data. Specific values in the shared memory would need to be updated periodically. This isn't included in this PR since we don't actively do this yet. In a later PR when time is refactored this should be done. Finally, as we don't handle clock contexts. When time is refactored, we will need to update the shared memory for specific contexts. This PR does this already however since the contexts are all identical and not separated. We're just updating the same values for each context which in this case is empty. Tiime:SetStandardUserSystemClockAutomaticCorrectionEnabled, Time:IsStandardUserSystemClockAutomaticCorrectionEnabled are also partially implemented in this PR. The reason the implementation is partial is because once again, a lack of clock contexts. This will be improved on in a future PR. This PR closes issue #2556
* | | | | Merge pull request #2604 from ogniK5377/INotificationServicebunnei2019-07-034-1/+129
|\ \ \ \ \ | |_|_|_|/ |/| | | | Implemented INotificationService
| * | | | Attemp clang format fix?David Marcec2019-06-281-1/+0
| | | | | | | | | | | | | | | | | | | | Seems to be an issue with clang format
| * | | | Addressed issuesDavid Marcec2019-06-282-13/+13
| | | | |
| * | | | SizedNotificationInfo should be 0x10 bytes, user_uuid is incorrect, this should be the users account idDavid Marcec2019-06-251-1/+3
| | | | |
| * | | | fixed spelling errors and fixed issue with Pop not returning the SizedNotificationInfoDavid Marcec2019-06-251-6/+8
| | | | |
| * | | | Implemented INotificationServiceDavid Marcec2019-06-244-1/+126
| |/ / /
* | | / file_sys: Rename other ContentRecordType membersBakugo2019-07-021-2/+2
| |_|/ |/| |
* | | Merge pull request #2583 from FernandoS27/core-timing-safebunnei2019-06-301-3/+3
|\ \ \ | |_|/ |/| | Core_Timing: Make core_timing threadsafe by default.
| * | Core_Timing: Make core_timing threadsafe by default.Fernando Sahmkow2019-06-161-3/+3
| | | | | | | | | | | | | | | | | | The old implementation had faulty Threadsafe methods where events could be missing. This implementation unifies unsafe/safe methods and makes core timing thread safe overall.
* | | Merge pull request #2548 from DarkLordZach/applet-shopnbunnei2019-06-2613-112/+690
|\ \ \ | | | | | | | | applets: Implement backend and default frontend for Parental Controls and EShop (ShopN) applets
| * | | applets: Pass current process title ID to appletsZach Hilman2019-06-2511-41/+59
| | | | | | | | | | | | | | | | Avoids using system accessor to get current process in applet code.
| * | | general_frontend: Add documentation for parental controls and ecommerce appletsZach Hilman2019-06-252-16/+16
| | | |
| * | | web_browser: Only delete temporary directory if it was createdZach Hilman2019-06-251-1/+3
| | | | | | | | | | | | | | | | Prevents crashes with ShopN applet occasionally.
| * | | web_browser: Take ECommerce applet frontend optionally in constructorZach Hilman2019-06-251-1/+6
| | | | | | | | | | | | If it is needed but wasn't passed (or passed nullptr), the Shop handling code will alert and throw an error.
| * | | web_browser: Use function tables for execute and initializeZach Hilman2019-06-252-7/+285
| | | | | | | | | | | | Allows easy handling of multiple shim types, as they have enough in common to be the same backend but not enough to share init/exec.
| * | | web_browser: Correct structures and properly parse TLVs/ShimKindZach Hilman2019-06-252-61/+168
| | | | | | | | | | | | Much, much more HW-accurate and allows us to easily support all of the different web 'shim' types.
| * | | applets: Track ECommerce and Parental Control applet frontendsZach Hilman2019-06-252-7/+29
| | | |
| * | | applets: Implement Auth applet backendZach Hilman2019-06-252-0/+146
| | |/ | |/| | | | This is responsible for parental controls and supports verifying, changing, and registering PIN codes.
* | | glue: Correct missing bytes in ApplicationLaunchParameterZach Hilman2019-06-264-28/+61
| | |
* | | glue: Implement arp:w and arp:r servicesZach Hilman2019-06-253-2/+330
| | | | | | | | | | | | These keep track of running process' launch properties and control properties and allows for issuing and reading them by process and title ID.
* | | glue: Add errors for glue/arp servicesZach Hilman2019-06-253-0/+58
| | |
* | | glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
| | |
* | | arp: Move to glue servicesZach Hilman2019-06-252-91/+0
| | | | | | | | | | | | Glue is the name of the sysmodule that contains both arp and bgtc.
* | | glue: Add manager to keep track of application registryZach Hilman2019-06-252-0/+119
|/ / | | | | | | Manages mapping between title IDs and application launch and control properties.
* | Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\ \ | | | | | | service/acc: Silence truncation warnings
| * | service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
| | | | | | | | | | | | | | | The sanitizing function ensures that the returned type is always the correct type. This eliminates warnings without extra casts.
* | | Merge pull request #2575 from DarkLordZach/process-id-typesbunnei2019-06-214-8/+25
|\ \ \ | | | | | | | | kernel: Differentiate kernel and user processes when picking ID
| * | | kernel: Differentiate kernel and user processes when picking IDZach Hilman2019-06-104-8/+25
| | |/ | |/| | | | | | | This allows kernel internal type processes to be assigned IDs in the KIP range while userland processes are assigned in the user range.
* | | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-219-44/+102
|\ \ \ | |_|/ |/| | core: Add detailed local reporting feature for development
| * | loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-263-6/+7
| | | | | | | | | Also cleanup of general stuff
| * | prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| | | | | | | | | | | | Logs a lot of seemingly innocuous telemetry games generate.
| * | fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| | | | | | | | | | | | Matches offical behavior with creport and replaces old log/text based report system.
| * | service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| | |
| * | applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| | | | | | | | | | | | This matches official behavior with the erpt/eclct/eupld service chain.
| * | applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
| | | | | | | | | | | | This also reworks the applet data storage to be peekable.
| * | svc: Save report on call to svcBreakZach Hilman2019-05-251-1/+7
| | |
* | | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | Even though it has been proven that IAudioRenderer:SystemEvent is actually an automatic event. The current implementation of such event is all thought to be manual. Thus it's implementation needs to be corrected when doing such change. As it is right now this PR introduced a series of regressions on softlocks on multiple games. Therefore, this pr reverts such change until a correct implementation is made.
* | | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \ \ | | | | | | | | service/audio/audren_u: Correct event reset type for the system event
| * | | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
| | | | | | | | | | | | | | | | | | | | This is actually an auto-reset event in the audio service itself, not a manual one.
* | | | Addressed issuesDavid Marcec2019-06-173-8/+13
| | | |
* | | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
| | | |
* | | | CleanupDavid Marcec2019-06-1611-29/+38
| | | |
* | | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-166-7/+72
| | | | | | | | | | | | | | | | IPC-100 was changed to InitializeApplicationInfoOld instead of InitializeApplicationInfo. IPC-150 makes an indentical call to IPC-100 however does extra processing. They should not have the same name as it's quite confusing to debug.
* | | | Merge pull request #2581 from lioncash/hexZach Hilman2019-06-152-7/+7
|\ \ \ \ | | | | | | | | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()
| * | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-122-7/+7
| | |_|/ | |/| | | | | | | | | | | | | | | | | | These can be generified together by using a concept type to designate them. This also has the benefit of not making copies of potentially very large arrays.
* / | | kernel/vm_manager: Remove redundant Reset call in destructorLioncash2019-06-121-3/+1
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | This is performing more work than would otherwise be necessary during VMManager's destruction. All we actually want to occur in this scenario is for any allocated memory to be freed, which will happen automatically as the VMManager instance goes out of scope. Anything else being done is simply unnecessary work.
* | | Merge pull request #2571 from lioncash/refZach Hilman2019-06-102-2/+2
|\ \ \ | | | | | | | | kernel/process: Make Create()'s name parameter be taken by value
| * | | kernel/process: Make Create()'s name parameter be taken by valueLioncash2019-06-102-2/+2
| |/ / | | | | | | | | | | | | Makes the interface more flexible in terms of how Create() may be called, while still allowing the parameter itself to be moved into.
* | | kernel/svc: Implement TotalMemoryUsedWithoutMmHeap/TotalMemoryAvailableWithoutMmHeapLioncash2019-06-103-2/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | Given we don't currently implement the personal heap yet, the existing memory querying functions are essentially doing what the memory querying types introduced in 6.0.0 do. So, we can build the necessary machinery over the top of those and just use them as part of info types.
* | | kernel/svc: Amend naming for TotalMemoryUsage in svcGetInfo()Lioncash2019-06-103-6/+6
| | | | | | | | | | | | | | | Disambiguates and makes the name a little more consistent with TotalPhysicalMemoryUsed.
* | | kernel/svc: Remove duplicate enum entry in svcGetInfo()Lioncash2019-06-101-2/+1
|/ /
* | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-071-16/+4
| |
* | Merge pull request #2549 from lioncash/headerZach Hilman2019-06-061-1/+0
|\ \ | | | | | | kernel/process: Remove unused boost header include
| * | kernel/process: Remove unused boost header includeLioncash2019-06-051-1/+0
| | | | | | | | | | | | | | | Boost headers typically include a lot of other headers, so removing this can prevent a bit of unnecessary compiler churn when building.
* | | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \ \ | | | | | | | | service/ns: Add missing override specifiers
| * | | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
| | | |
* | | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ \ | |/ / / |/| | | lr: Add command handler skeletons for Open*LocationResolver
| * | | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| | | | | | | | | | | | Returns an object of type IAddOnContentLocationResolver for the provided StorageId.
| * | | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| | | | | | | | | | | | Returns an object of type IRegisteredLocationResolver for the StorageId.
| * | | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
| | | | | | | | | | | | Returns an object of type ILocationResolver with the provided StorageId.
* | | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-052-5/+37
|\ \ \ \ | | | | | | | | | | core/telemetry_session: Remove usages of the global system accessor
| * | | | core/core: Remove unnecessary includesLioncash2019-05-292-5/+37
| |/ / / | | | | | | | | | | | | | | | | The contents of these includes aren't used anywhere in this translation unit.
* | | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-053-7/+9
|\ \ \ \ | | | | | | | | | | core/core_timing_util: Use std::chrono types for specifying time units
| * | | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-052-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Makes the casing consistent with all of our general function naming conventions.
| * | | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-053-7/+9
| | |/ / | |/| | | | | | | | | | | | | | Makes the interface more type-safe and consistent in terms of return values.
* | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-057-402/+1073
|\ \ \ \ | |/ / / |/| | | Implement/Fix IApplicationFunctions::GetDesiredLanguage
| * | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| | | |
| * | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| | | |
| * | | Address review commentsMichael Scire2019-05-235-45/+118
| | | |
| * | | clang-format fixesMichael Scire2019-05-234-31/+32
| | | |
| * | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-236-403/+1002
| | | |
* | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-308-104/+1051
|\ \ \ \ | |_|/ / |/| | | mii: Implement MiiManager backend and several mii service commands
| * | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| | | |
| * | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-253-6/+6
| | | |
| * | | mii: Implement Delete and Destroy fileZach Hilman2019-04-253-8/+116
| | | |
| * | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| | | |
| * | | mii_manager: Cleanup and optimizationZach Hilman2019-04-253-36/+50
| | | |
| * | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-251-15/+242
| | | | | | | | | | | | Since the MiiManager was designed around the IPC interface, this is quite easy. Only functions that were clearly defined were implemented.
| * | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| | | | | | | | | | | | Provides serialization/deserialization to the database in system save files, accessors for database state and proper handling of both major Mii formats (MiiInfo and MiiStoreData)
| * | | common: Extract UUID to its own classZach Hilman2019-04-253-78/+28
| | | | | | | | | | | | Since the Mii database uses UUIDs very similar to the Accounts database, it makes no sense to not share code between them.
* | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ | |_|_|/ |/| | | service/aoc_u: Minor cleanup
| * | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the code was accumulating data into a std::vector and then tossing all of it away if a setting was disabled. Instead, we can just check if it's disabled and do no work at all if possible. If it's enabled, then we can append to the vector and allocate. Unlikely to impact usage much, but it is slightly less sloppy with resources.
| * | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| | | | | | | | | | | | | | | | | | | | Removes two header dependencies related to file handling that aren't actually used within the source file.
| * | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| | |/ | |/| | | | | | | | | | | | | A few of the aoc service stubs/implementations weren't fully popping all of the parameters passed to them. This ensures that all parameters are popped and, at minimum, logged out.
* | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-254-9/+10
|\ \ \ | |/ / |/| | Port citra-emu/citra#4716: "HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThread"
| * | Address review commentTobias2019-05-191-1/+1
| | | | | | | | | Co-Authored-By: Mat M. <mathew1800@gmail.com>
| * | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-184-9/+10
| | | | | | | | | | | | This reduces the boilerplate that services have to write out the current thread explicitly. Using current thread instead of client thread is also semantically incorrect, and will be a problem when we implement multicore (at which time there will be multiple current threads)
* | | Merge pull request #2410 from lioncash/affinitybunnei2019-05-192-42/+58
|\ \ \ | | | | | | | | kernel/svc: Reorganize and fix up the initial handling of svcSetThreadCoreMask()
| * | | kernel/svc: Make svcCreateThread/svcStartThread/svcSleepThread/svcExitThread calls show up in the debug logLioncash2019-04-291-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | These are actually quite important indicators of thread lifetimes, so they should be going into the debug log, rather than being treated as misc info and delegated to the trace log.
| * | | kernel/svc: Reorganize svcSetThreadCoreMask()Lioncash2019-04-291-32/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the code much nicer to follow in terms of behavior and control flow. It also fixes a few bugs in the implementation. Notably, the thread's owner process shouldn't be accessed in order to retrieve the core mask or ideal core. This should be done through the current running process. The only reason this bug wasn't encountered yet is because we currently only support running one process, and thus every owner process will be the current process. We also weren't checking against the process' CPU core mask to see if an allowed core is specified or not. With this out of the way, it'll be less noisy to implement proper handling of the affinity flags internally within the kernel thread instances.
| * | | kernel/thread: Update thread processor ID flagsLioncash2019-04-292-7/+16
| | | | | | | | | | | | | | | | Adds the missing flags to the enum and documents them.
* | | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \ \ | | | | | | | | | | service/audren_u: Get rid of magic values within GetAudioRendererWorkBufferSize
| * | | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also introduced in REV5 was a variable-size audio command buffer. This also affects how the size of the work buffer should be determined, so we can add handling for this as well. Thankfully, no other alterations were made to how the work buffer size is calculated in 7.0.0-8.0.0. There were indeed changes made to to how some of the actual audio commands are generated though (particularly in REV7), however they don't apply here.
| * | | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Introduced in REV5. This is trivial to add support for, now that everything isn't a mess of random magic constant values. All this is, is a change in data type sizes as far as this function cares.
| * | | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |_|/ | |/| | | | | | | | | | | | | | | | | | "Unmagics" quite a few magic constants within this code, making it much easier to understand. Particularly given this factors out specific sections into their own self-contained lambda functions.
* | | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \ \ | | | | | | | | | | service/set: Correct and simplify behavior related to copying language codes
| * | | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This corrects cases where it was possible to write more entries into the write buffer than were requested. Now, we check the size of the buffer before actually writing into them. We were also returning the wrong value for GetAvailableLanguageCodeCount2(). This was previously returning 64, but only 17 should have been returned. 64 entries is the size of the static array used in MakeLanguageCode() within the service binary itself, but isn't the actual total number of language codes present.
* | | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \ \ | | | | | | | | | | service/am: Add missing return in error case for IStorageAccessor's Read/Write()
| * | | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ / / | | | | | | | | | | | | | | | | Previously this would fall through and return successfully, despite being an out of bounds read or write.
* | | | Merge pull request #2490 from lioncash/floatHexagon122019-05-191-1/+1
|\ \ \ \ | | | | | | | | | | ipc_helpers: Amend floating-point type in Pop<double> specialization
| * | | | ipc_helpers: Amend floating-point type in Pop<double> specializationLioncash2019-05-191-1/+1
| |/ / / | | | | | | | | | | | | | | | | Currently, this overload isn't used, so this wasn't actually hit in any code, only the float overload is used.
* | | | Merge pull request #2486 from lioncash/resetnameSebastian Valle2019-05-1918-31/+32
|\ \ \ \ | | | | | | | | | | core/kernel/object: Rename ResetType enum members for clarity
| * | | | core/kernel/object: Rename ResetType enum membersLioncash2019-05-1818-31/+32
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Renames the members to more accurately indicate what they signify. "OneShot" and "Sticky" are kind of ambiguous identifiers for the reset types, and can be kind of misleading. Automatic and Manual communicate the kind of reset type in a clearer manner. Either the event is automatically reset, or it isn't and must be manually cleared. The "OneShot" and "Sticky" terminology is just a hold-over from Citra where the kernel had a third type of event reset type known as "Pulse". Given the Switch kernel only has two forms of event reset types, we don't need to keep the old terminology around anymore.
* / / / kernel/svc: Mark GetThreadList() and UnmapProcessCodeMemory() as internally linkedLioncash2019-05-191-4/+4
|/ / / | | | | | | | | | | | | | | | These are only used from within this translation unit, so they don't need to have external linkage. They were intended to be marked with this anyways to be consistent with the other service functions.
* | | Merge pull request #2437 from lioncash/audctlbunnei2019-05-091-2/+2
|\ \ \ | | | | | | | | service/audctl: Update documentation comments to be relative to 8.0.0
| * | | service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
| |/ / | | | | | | | | | The state of these service calls are still the same in version 8.0.0.
* | | Merge pull request #2412 from lioncash/systembunnei2019-04-293-7/+11
|\ \ \ | |/ / |/| | kernel/vm_manager: Remove usages of global system accessors
| * | kernel/vm_manager: Remove usages of global system accessorsLioncash2019-04-173-7/+11
| | | | | | | | | | | | | | | Makes the dependency on the system instance explicit within VMManager's interface.
* | | Merge pull request #2416 from lioncash/waitbunnei2019-04-256-44/+50
|\ \ \ | | | | | | | | kernel/svc: Clean up wait synchronization related functionality
| * | | kernel/thread: Unify wait synchronization typesLioncash2019-04-176-38/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a holdover from Citra, where the 3DS has both WaitSynchronization1 and WaitSynchronizationN. The switch only has one form of wait synchronizing (literally WaitSynchonization). This allows us to throw out code that doesn't apply at all to the Switch kernel. Because of this unnecessary dichotomy within the wait synchronization utilities, we were also neglecting to properly handle waiting on multiple objects. While we're at it, we can also scrub out any lingering references to WaitSynchronization1/WaitSynchronizationN in comments, and change them to WaitSynchronization (or remove them if the mention no longer applies).
| * | | kernel/svc: Migrate svcCancelSynchronization behavior to a thread functionLioncash2019-04-173-7/+17
| |/ / | | | | | | | | | | | | | | | | | | The actual behavior of this function is slightly more complex than what we're currently doing within the supervisor call. To avoid dumping most of this behavior in the supervisor call itself, we can migrate this to another function.
* | | Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2514-63/+487
|\ \ \ | | | | | | | | applets: Add AppletManager and implement PhotoViewer and Error applets
| * | | web_browser: Make OpenPage non-constZach Hilman2019-04-178-15/+20
| | | |
| * | | main: Add GMainWindow hooks for Error displayZach Hilman2019-04-171-2/+2
| | | |
| * | | general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| | | |
| * | | applets: Add Error appletZach Hilman2019-04-173-24/+224
| | | | | | | | | | | | Responsible for displaying error codes and messages
| * | | applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| | | | | | | | | | | | As opposed to using Core::System::GetInstance()
| * | | am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| | | |
| * | | applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
| |/ /
* | | Merge pull request #2420 from lioncash/audctlbunnei2019-04-232-2/+32
|\ \ \ | | | | | | | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()
| * | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
| | | | | | | | | | | | | | | | | | | | These two service functions are literally hardcoded to always return these values without any other error checking.
* | | | Merge pull request #2415 from lioncash/constbunnei2019-04-202-2/+2
|\ \ \ \ | | | | | | | | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member function
| * | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member functionLioncash2019-04-172-2/+2
| | |/ / | |/| | | | | | | | | | | | | | This doesn't actually modify internal state of a wait object, so it can be const qualified.
* | | | Merge pull request #2421 from lioncash/svc-callbunnei2019-04-201-1/+1
|\ \ \ \ | | | | | | | | | | kernel/svc: Name supervisor call 0x36
| * | | | kernel/svc: Name supervisor call 0x36Lioncash2019-04-191-1/+1
| | |/ / | |/| | | | | | | | | | | | | | This call was added to the SVC handlers in the 8.0.0 kernel, so we can finally give it a name.
* | | | Merge pull request #2374 from lioncash/pagetablebunnei2019-04-203-14/+17
|\ \ \ \ | |/ / / |/| | | core: Reorganize boot order
| * | | core/core: Move process execution start to System's Load()Lioncash2019-04-122-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gives us significantly more control over where in the initialization process we start execution of the main process. Previously we were running the main process before the CPU or GPU threads were initialized (not good). This amends execution to start after all of our threads are properly set up.
| * | | core/process: Remove unideal page table setting from LoadFromMetadata()Lioncash2019-04-121-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Initially required due to the split codepath with how the initial main process instance was initialized. We used to initialize the process like: Init() { main_process = Process::Create(...); kernel.MakeCurrentProcess(main_process.get()); } Load() { const auto load_result = loader.Load(*kernel.GetCurrentProcess()); if (load_result != Loader::ResultStatus::Success) { // Handle error here. } ... } which presented a problem. Setting a created process as the main process would set the page table for that process as the main page table. This is fine... until we get to the part that the page table can have its size changed in the Load() function via NPDM metadata, which can dictate either a 32-bit, 36-bit, or 39-bit usable address space. Now that we have full control over the process' creation in load, we can simply set the initial process as the main process after all the loading is done, reflecting the potential page table changes without any special-casing behavior. We can also remove the cache flushing within LoadModule(), as execution wouldn't have even begun yet during all usages of this function, now that we have the initialization order cleaned up.
| * | | core/cpu_core_manager: Create threads separately from initialization.Lioncash2019-04-122-2/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Our initialization process is a little wonky than one would expect when it comes to code flow. We initialize the CPU last, as opposed to hardware, where the CPU obviously needs to be first, otherwise nothing else would work, and we have code that adds checks to get around this. For example, in the page table setting code, we check to see if the system is turned on before we even notify the CPU instances of a page table switch. This results in dead code (at the moment), because the only time a page table switch will occur is when the system is *not* running, preventing the emulated CPU instances from being notified of a page table switch in a convenient manner (technically the code path could be taken, but we don't emulate the process creation svc handlers yet). This moves the threads creation into its own member function of the core manager and restores a little order (and predictability) to our initialization process. Previously, in the multi-threaded cases, we'd kick off several threads before even the main kernel process was created and ready to execute (gross!). Now the initialization process is like so: Initialization: 1. Timers 2. CPU 3. Kernel 4. Filesystem stuff (kind of gross, but can be amended trivially) 5. Applet stuff (ditto in terms of being kind of gross) 6. Main process (will be moved into the loading step in a following change) 7. Telemetry (this should be initialized last in the future). 8. Services (4 and 5 should ideally be alongside this). 9. GDB (gross. Uses namespace scope state. Needs to be refactored into a class or booted altogether). 10. Renderer 11. GPU (will also have its threads created in a separate step in a following change). Which... isn't *ideal* per-se, however getting rid of the wonky intertwining of CPU state initialization out of this mix gets rid of most of the footguns when it comes to our initialization process.
* | | | Merge pull request #2397 from lioncash/thread-unusedbunnei2019-04-183-18/+17
|\ \ \ \ | |_|/ / |/| | | kernel/thread: Remove unused guest_handle member variable
| * | | svc: Specify handle value in thread's nameLioncash2019-04-152-2/+10
| | | | | | | | | | | | | | | | Allows the handle to be seen alongside the entry point.
| * | | kernel/thread: Remove unused guest_handle member variableLioncash2019-04-143-16/+7
| | |/ | |/| | | | | | | | | | | | | This member variable is entirely unused. It was only set but never actually utilized. Given that, we can remove it to get rid of noise in the thread interface.
* | | Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\ \ \ | | | | | | | | service: Update service function tables
| * | | service: Update service function tablesLioncash2019-04-1127-57/+262
| | | | | | | | | | | | | | | | Updates function tables based off information from SwitchBrew.
* | | | Merge pull request #2393 from lioncash/svcbunnei2019-04-164-2/+274
|\ \ \ \ | | | | | | | | | | kernel/svc: Implement svcMapProcessCodeMemory/svcUnmapProcessCodeMemory
| * | | | kernel/svc: Implement svcUnmapProcessCodeMemoryLioncash2019-04-133-1/+143
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Essentially performs the inverse of svcMapProcessCodeMemory. This unmaps the aliasing region first, then restores the general traits of the aliased memory. What this entails, is: - Restoring Read/Write permissions to the VMA. - Restoring its memory state to reflect it as a general heap memory region. - Clearing the memory attributes on the region.
| * | | | kernel/svc: Implement svcMapProcessCodeMemoryLioncash2019-04-134-1/+131
| | |_|/ | |/| | | | | | | | | | | | | | This is utilized for mapping code modules into memory. Notably, the ldr service would call this in order to map objects into memory.
* | | | kernel/thread: Remove BoostPriority()Lioncash2019-04-152-11/+0
| |_|/ |/| | | | | | | | | | | This is a holdover from Citra that currently remains unused, so it can be removed from the Thread interface.
* | | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \ \ | | | | | | | | ldr: Minor amendments to IPC-related parameters
| * | | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| | | | | | | | | | | | | | | | This doesn't modify instance state, so it can be made const.
| * | | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| | |/ | |/| | | | | | | | | | The initial two words indicate a process ID. Also UnloadNro only specifies one address, not two.
* | | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-141-6/+10
|\ \ \ | | | | | | | | Add a toggle to force 30FPS mode
| * | | added a toggle to force 30fps modezarroboogs2019-04-091-6/+10
| | | |
* | | | Merge pull request #2381 from lioncash/fsbunnei2019-04-141-8/+7
|\ \ \ \ | |_|_|/ |/| | | fsp_srv: Minor cleanup related changes
| * | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
| | | | | | | | | | | | | | | | | | | | IDirectory's Read() function doesn't take any input parameters. It only uses the output parameters that we already provide.
| * | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| | |/ | |/| | | | | | | | | | | | | | | | | | | These indicate options that alter how a read/write is performed. Currently we don't need to handle these, as the only one that seems to be used is for writes, but all the custom options ever seem to do is immediate flushing, which we already do by default.
* | | Merge pull request #2360 from lioncash/svc-globalbunnei2019-04-123-322/+373
|\ \ \ | | | | | | | | kernel/svc: Deglobalize the supervisor call handlers
| * | | kernel/svc: Deglobalize the supervisor call handlersLioncash2019-04-083-322/+373
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Adjusts the interface of the wrappers to take a system reference, which allows accessing a system instance without using the global accessors. This also allows getting rid of all global accessors within the supervisor call handling code. While this does make the wrappers themselves slightly more noisy, this will be further cleaned up in a follow-up. This eliminates the global system accessors in the current code while preserving the existing interface.
* | | Merge pull request #2388 from lioncash/constexprbunnei2019-04-1210-10/+10
|\ \ \ | | | | | | | | kernel: Make handle type declarations constexpr
| * | | kernel: Make handle type declarations constexprLioncash2019-04-1110-10/+10
| | |/ | |/| | | | | | | | | | | | | | | | Some objects declare their handle type as const, while others declare it as constexpr. This makes the const ones constexpr for consistency, and prevent unexpected compilation errors if these happen to be attempted to be used within a constexpr context.
* / | kernel/server_session: Remove obsolete TODOsLioncash2019-04-101-7/+2
|/ / | | | | | | These are holdovers from Citra.
* | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-104-10/+9
|\ \ | | | | | | file_sys: Provide generic interface for accessing game data
| * | patch_manager: Dump NSO name with build IDZach Hilman2019-03-281-2/+1
| | |
| * | game_list: Register content with ContentProviderZach Hilman2019-03-271-2/+3
| | |
| * | core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-273-9/+8
| | |
* | | kernel/process: Set page table when page table resizes occur.Lioncash2019-04-091-0/+2
| |/ |/| | | | | | | | | | | | | | | We need to ensure dynarmic gets a valid pointer if the page table is resized (the relevant pointers would be invalidated in this scenario). In this scenario, the page table can be resized depending on what kind of address space is specified within the NPDM metadata (if it's present).
* | Merge pull request #2361 from lioncash/pagetablebunnei2019-04-073-4/+2
|\ \ | | | | | | core/memory: Minor simplifications to page table management
| * | kernel: Handle page table switching within MakeCurrentProcess()Lioncash2019-04-073-4/+2
| | | | | | | | | | | | | | | Centralizes the page table switching to one spot, rather than making calling code deal with it everywhere.
* | | kernel/server_session: Return a std::pair from CreateSessionPair()Lioncash2019-04-064-11/+8
| | | | | | | | | | | | | | | | | | Keeps the return type consistent with the function name. While we're at it, we can also reduce the amount of boilerplate involved with handling these by using structured bindings.
* | | kernel/server_port: Return a std::pair from CreatePortPair()Lioncash2019-04-062-7/+7
|/ / | | | | | | Returns the same type that the function name describes.
* | Merge pull request #2325 from lioncash/namebunnei2019-04-061-0/+4
|\ \ | | | | | | kernel/server_session: Provide a GetName() override
| * | kernel/server_session: Provide a GetName() overrideLioncash2019-04-031-0/+4
| | | | | | | | | | | | | | | | | | Given server sessions can be given a name, we should allow retrieving it instead of using the default implementation of GetName(), which would just return "[UNKNOWN KERNEL OBJECT]".
* | | Merge pull request #2334 from lioncash/overridebunnei2019-04-069-18/+5
|\ \ \ | | | | | | | | core: Add missing override specifiers where applicable
| * | | core: Add missing override specifiers where applicableLioncash2019-04-049-18/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Applies the override specifier where applicable. In the case of destructors that are defaulted in their definition, they can simply be removed. This also removes the unnecessary inclusions being done in audin_u and audrec_u, given their close proximity.
* | | | Merge pull request #2339 from lioncash/rankbunnei2019-04-063-12/+15
|\ \ \ \ | | | | | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structs
| * | | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-052-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | Passing around a 64 byte data struct by value is kind of wasteful, instead pass a reference to the struct.
| * | | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | The unknown member here is actually padding due to being passed as a struct. We can do the same, and remove the need to pop a padding word.
| * | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-051-1/+3
| |/ / / | | | | | | | | | | | | | | | | I realized that I updated the documentation on SwitchBrew a while ago, but never actually updated the structs within yuzu.
* | | | Merge pull request #2329 from lioncash/sanitizebunnei2019-04-061-0/+14
|\ \ \ \ | | | | | | | | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomic
| * | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomicLioncash2019-04-041-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We need to be checking whether or not the given address is within the kernel address space or if the given address isn't word-aligned and bail in these scenarios instead of trashing any kernel state.
* | | | | Merge pull request #2344 from lioncash/resultbunnei2019-04-061-4/+0
|\ \ \ \ \ | | | | | | | | | | | | hle/result: Remove unnecessary bitfield entry for ResultCode
| * | | | | hle/result: Remove unnecessary bitfield entry for ResultCodeLioncash2019-04-051-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | This is a hold over from the 3DS error codes in Citra.
* | | | | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \ \ \ \ | |/ / / / / |/| | | | | filesystem: Use a std::string_view in OpenFile()
| * | | | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | Rather than make a full copy of the path, we can just use a string view and truncate the viewed portion of the string instead of creating a totally new truncated string.
* / | | | hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In several places, we have request parsers where there's nothing to really parse, simply because the HLE function in question operates on buffers. In these cases we can just remove these instances altogether. In the other cases, we can retrieve the relevant members from the parser and at least log them out, giving them some use.
* | | | Merge pull request #2328 from lioncash/transferbunnei2019-04-043-17/+37
|\ \ \ \ | | | | | | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()
| * | | | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For whatever reason, shared memory was being used here instead of transfer memory, which (quite clearly) will not work based off the name of the function. This corrects this wonky usage of shared memory.
| * | | | kernel/transfer_memory: Add accessors to data and sizesLioncash2019-04-032-11/+31
| |/ / / | | | | | | | | | | | | Also amend erroneous use of size_t. We should be using u64 here.
* | | | Merge pull request #2324 from lioncash/enum-unusedbunnei2019-04-042-2/+0
|\ \ \ \ | | | | | | | | | | kernel/object: Remove unused handle type entry
| * | | | kernel/object: Remove unused handle type entryLioncash2019-04-032-2/+0
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | The AddressArbiter type isn't actually used, given the arbiter itself isn't a direct kernel object (or object that implements the wait object facilities). Given this, we can remove the enum entry entirely.
* | | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ \ | |_|/ / |/| | | service/am: Implement EnterFatalSection/LeaveFatalSection
| * | | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions act in tandem similar to how a lock or mutex require a balanced lock()/unlock() sequence. EnterFatalSection simply increments a counter for how many times it has been called, while LeaveFatalSection ensures that a previous call to EnterFatalSection has occured. If a previous call has occurred (the counter is not zero), then the counter gets decremented as one would expect. If a previous call has not occurred (the counter is zero), then an error code is returned.
| * | | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
| | | | | | | | | | | | | | | | | | | | Makes the declaration order of the handling functions consistent with the handler table itself.
* | | | Merge pull request #2305 from lioncash/sharedbunnei2019-04-033-5/+18
|\ \ \ \ | | | | | | | | | | kernel/shared_memory: Sanitize supplied size when unmapping
| * | | | kernel/shared_memory: Remove unused core/memory.h includeLioncash2019-03-291-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | Nothing from this header is used, so we can remove this include, getting rid of a dependency on it.
| * | | | kernel/shared_memory: Sanitize supplied size when unmappingLioncash2019-03-293-4/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel makes sure that the given size to unmap is always the same size as the entire region managed by the shared memory instance, otherwise it returns an error code signifying an invalid size. This is similarly done for transfer memory (which we already check for).
* | | | | Merge pull request #2314 from lioncash/constbunnei2019-04-0311-18/+18
|\ \ \ \ \ | |_|_|/ / |/| | | | kernel/thread: Minor interface cleanup
| * | | | kernel/thread: Make AllWaitObjectsReady() a const qualified member functionLioncash2019-04-022-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that ShouldWait() is a const qualified member function, this one can be made const qualified as well, since it can handle passing a const qualified this pointer to ShouldWait().
| * | | | kernel/wait_object: Make ShouldWait() take thread members by pointer-to-constLioncash2019-04-0211-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | Given this is intended as a querying function, it doesn't make sense to allow the implementer to modify the state of the given thread.
| * | | | kernel/thread: Avoid sign conversion within GetCommandBufferAddress()Lioncash2019-04-011-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this was performing a u64 + int sign conversion. When dealing with addresses, we should generally be keeping the arithmetic in the same signedness type. This also gets rid of the static lifetime of the constant, as there's no need to make a trivial type like this potentially live for the entire duration of the program.
| * | | | kernel/thread: Make parameter of GetWaitObjectIndex() const qualifiedLioncash2019-04-012-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | The pointed to member is never actually modified, so it can be made const.
* | | | | Merge pull request #2270 from lioncash/plistbunnei2019-04-037-2/+123
|\ \ \ \ \ | | | | | | | | | | | | kernel/svc: Implement svcGetProcessList and svcGetThreadList
| * | | | | kernel/svc: Implement svcGetThreadListLioncash2019-04-024-1/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similarly like svcGetProcessList, this retrieves the list of threads from the current process. In the kernel itself, a process instance maintains a list of threads, which are used within this function. Threads are registered to a process' thread list at thread initialization, and unregistered from the list upon thread destruction (if said thread has a non-null owning process). We assert on the debug event case, as we currently don't implement kernel debug objects.
| * | | | | kernel/svc: Implement svcGetProcessListLioncash2019-04-024-1/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function simply copies out a specified number of kernel process IDs, while simultaneously reporting the total number of processes.
* | | | | | Merge pull request #2313 from lioncash/reslimitbunnei2019-04-023-14/+6
|\ \ \ \ \ \ | |/ / / / / |/| | | | | kernel/resource_limit: Remove the name member from resource limits
| * | | | | kernel/resource_limit: Remove the name member from resource limitsLioncash2019-04-013-14/+6
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't really provide any benefit to the resource limit interface. There's no way for callers to any of the service functions for resource limits to provide a custom name, so all created instances of resource limits other than the system resource limit would have a name of "Unknown". The system resource limit itself is already trivially identifiable from its limit values, so there's no real need to take up space in the object to identify one object meaningfully out of N total objects.
* | | | | process: Fix up compilationReinUsesLisp2019-04-021-1/+1
| | | | |
* | | | | Merge pull request #2281 from lioncash/memorybunnei2019-04-022-4/+5
|\ \ \ \ \ | |/ / / / |/| | | | kernel/codeset: Make CodeSet's memory data member a regular std::vector
| * | | | kernel/codeset: Make CodeSet's memory data member a regular std::vectorLioncash2019-03-222-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The use of a shared_ptr is an implementation detail of the VMManager itself when mapping memory. Because of that, we shouldn't require all users of the CodeSet to have to allocate the shared_ptr ahead of time. It's intended that CodeSet simply pass in the required direct data, and that the memory manager takes care of it from that point on. This means we just do the shared pointer allocation in a single place, when loading modules, as opposed to in each loader.
* | | | | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-011-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core/yuzu: Remove enable_nfc setting
| * | | | | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-291-1/+1
| | |_|/ / | |/| | | | | | | | | | | | | This was initially added to prevent problems from stubbed/not implemented NFC services, but as we never encountered such and as it's only used in a deprecated function anyway, I guess we can just remove it to prevent more clutter of the settings.
* | | | | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-013-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since C++17, the introduction of deduction guides for locking facilities means that we no longer need to hardcode the mutex type into the locks themselves, making it easier to switch mutex types, should it ever be necessary in the future.
* | | | | Merge pull request #2304 from lioncash/memsizebunnei2019-03-313-9/+28
|\ \ \ \ \ | | | | | | | | | | | | kernel/process: Report total physical memory used to svcGetInfo slightly better
| * | | | | kernel/process: Report total physical memory used to svcGetInfoLioncash2019-03-293-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reports the (mostly) correct size through svcGetInfo now for queries to total used physical memory. This still doesn't correctly handle memory allocated via svcMapPhysicalMemory, however, we don't currently handle that case anyways.
| * | | | | kernel/process: Store the total size of the code memory loadedLioncash2019-03-292-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary to properly report the used memory size in svcGetInfo.
| * | | | | kernel/process: Store the main thread stack size to a data memberLioncash2019-03-282-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary in order to properly report memory usage within svcGetInfo.
| * | | | | kernel/process: Make Run's stack size parameter a u64Lioncash2019-03-282-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will make operating with the process-related SVC commands much nicer in the future (the parameter representing the stack size in svcStartProcess is a 64-bit value).
| * | | | | kernel/process: Ensure that given stack size is always page-alignedLioncash2019-03-281-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel always makes sure that the given stack size is aligned to page boundaries.
* | | | | | Merge pull request #2308 from lioncash/deductionbunnei2019-03-313-12/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/scheduler: Minor tidying up
| * | | | | | kernel/scheduler: Remove unused parameter to AddThread()Lioncash2019-03-303-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was made unused in b404fcdf1443b91ac9994c05ad1fe039fcd9675e, but the parameter itself wasn't removed.
| * | | | | | kernel/scheduler: Use deduction guides on mutex locksLioncash2019-03-301-8/+8
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Since C++17, we no longer need to explicitly specify the type of the mutex within the lock_guard. The type system can now deduce these with deduction guides.
* | | | | | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
| | | | | |
* | | | | | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wextra-semi warning.
* | | | | | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, most of these structure members are register values, which makes, sense given this service is used to convey fatal errors. One member indicates the program entry point address, one is a set of bit flags used to determine which registers to print, and one member indicates the architecture type. The only member that still isn't determined is the final member within the data structure.
* | | | | Merge pull request #2266 from FernandoS27/arbitrationbunnei2019-03-295-14/+18
|\ \ \ \ \ | | | | | | | | | | | | Kernel: Fixes to Arbitration and SignalProcessWideKey Management
| * | | | | Fix small bug that kept a thread as a condvar thread after being signalled.Fernando Sahmkow2019-03-202-6/+8
| | | | | |
| * | | | | Add CondVar Thread State.Fernando Sahmkow2019-03-204-4/+6
| | | | | |
| * | | | | Small fixes to address_arbiter to better match the IDB.Fernando Sahmkow2019-03-202-5/+5
| | | | | |
* | | | | | Merge pull request #2265 from FernandoS27/multilevelqueuebunnei2019-03-292-19/+27
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Replace old Thread Queue for a new Multi Level Queue
| * | | | | Fixes and corrections on formatting.Fernando Sahmkow2019-03-271-6/+9
| | | | | |
| * | | | | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-272-19/+24
| | |/ / / | |/| | |
* | | | | Merge pull request #2284 from lioncash/heap-allocbunnei2019-03-283-59/+81
|\ \ \ \ \ | |/ / / / |/| | | | kernel/vm_manager: Unify heap allocation/freeing functions
| * | | | kernel/vm_manager: Handle shrinking of the heap size within SetHeapSize()Lioncash2019-03-242-24/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | One behavior that we weren't handling properly in our heap allocation process was the ability for the heap to be shrunk down in size if a larger size was previously requested. This adds the basic behavior to do so and also gets rid of HeapFree, as it's no longer necessary now that we have allocations and deallocations going through the same API function. While we're at it, fully document the behavior that this function performs.
| * | | | kernel/vm_manager: Rename HeapAllocate to SetHeapSizeLioncash2019-03-243-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it more obvious that this function is intending to stand in for the actual supervisor call itself, and not acting as a general heap allocation function. Also the following change will merge the freeing behavior of HeapFree into this function, so leaving it as HeapAllocate would be misleading.
| * | | | kernel/vm_manager: Handle case of identical calls to HeapAllocateLioncash2019-03-241-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In cases where HeapAllocate is called with the same size of the current heap, we can simply do nothing and return successfully. This avoids doing work where we otherwise don't have to. This is also what the kernel itself does in this scenario.
| * | | | kernel/vm_manager: Remove unused class variablesLioncash2019-03-241-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | Over time these have fallen out of use due to refactoring, so these can be removed.
| * | | | kernel/vm_manager: Remove unnecessary heap_used data memberLioncash2019-03-243-13/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This isn't required anymore, as all the kernel ever queries is the size of the current heap, not the total usage of it.
| * | | | kernel/vm_manager: Tidy up heap allocation codeLioncash2019-03-243-27/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another holdover from citra that can be tossed out is the notion of the heap needing to be allocated in different addresses. On the switch, the base address of the heap will always be managed by the memory allocator in the kernel, so this doesn't need to be specified in the function's interface itself. The heap on the switch is always allocated with read/write permissions, so we don't need to add specifying the memory permissions as part of the heap allocation itself either. This also corrects the error code returned from within the function. If the size of the heap is larger than the entire heap region, then the kernel will report an out of memory condition.
* | | | | Merge pull request #2285 from lioncash/unused-structbunnei2019-03-261-8/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | | kernel/process: Remove unused AddressMapping struct
| * | | | kernel/process: Remove unused AddressMapping structLioncash2019-03-241-8/+0
| | | | | | | | | | | | | | | | | | | | Another leftover from citra that's now no longer necessary.
* | | | | Merge pull request #2287 from lioncash/coretiming-cbbunnei2019-03-264-9/+9
|\ \ \ \ \ | | | | | | | | | | | | core/core_timing: Make callback parameters consistent
| * | | | | core/core_timing: Make callback parameters consistentLioncash2019-03-244-9/+9
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In some cases, our callbacks were using s64 as a parameter, and in other cases, they were using an int, which is inconsistent. To make all callbacks consistent, we can just use an s64 as the type for late cycles, given it gets rid of the need to cast internally. While we're at it, also resolve some signed/unsigned conversions that were occurring related to the callback registration.
* / / / / kernel/kernel: Remove unnecessary forward declarationLioncash2019-03-241-3/+0
|/ / / / | | | | | | | | | | | | | | | | This is no longer necessary, as ResultVal isn't used anywhere in the header.
* | | | Merge pull request #2232 from lioncash/transfer-memorybunnei2019-03-245-6/+280
|\ \ \ \ | |/ / / |/| | | core/hle/kernel: Split transfer memory handling out into its own class
| * | | core/hle/kernel/svc: Implement svcUnmapTransferMemoryLioncash2019-03-131-1/+48
| | | | | | | | | | | | | | | | | | | | Similarly, like svcMapTransferMemory, we can also implement svcUnmapTransferMemory fairly trivially as well.
| * | | core/hle/kernel/svc: Implement svcMapTransferMemoryLioncash2019-03-131-1/+57
| | | | | | | | | | | | | | | | | | | | Now that transfer memory handling is separated from shared memory, we can implement svcMapTransferMemory pretty trivially.
| * | | core/hle/kernel: Split transfer memory handling out into its own classLioncash2019-03-135-4/+175
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Within the kernel, shared memory and transfer memory facilities exist as completely different kernel objects. They also have different validity checking as well. Therefore, we shouldn't be treating the two as the same kind of memory. They also differ in terms of their behavioral aspect as well. Shared memory is intended for sharing memory between processes, while transfer memory is intended to be for transferring memory to other processes. This breaks out the handling for transfer memory into its own class and treats it as its own kernel object. This is also important when we consider resource limits as well. Particularly because transfer memory is limited by the resource limit value set for it. While we currently don't handle resource limit testing against objects yet (but we do allow setting them), this will make implementing that behavior much easier in the future, as we don't need to distinguish between shared memory and transfer memory allocations in the same place.
* | | | Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-232-2/+79
|\ \ \ \ | | | | | | | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversion
| * | | | set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| | | | |
| * | | | set_sys: Use official nintendo version stringZach Hilman2019-03-111-11/+7
| | | | |
| * | | | set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| | | | |
| * | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-102-2/+63
| | | | | | | | | | | | | | | Uses the synthesized system archive 9 (SystemVersion) and reports v5.1.0-0.0
* | | | | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-221-12/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | gpu: Rewrite MemoryManager based on the VMManager implementation.
| * | | | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-211-10/+2
| | | | |
| * | | | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-211-2/+2
| | | | |
* | | | | Merge pull request #2234 from lioncash/mutexbunnei2019-03-225-29/+62
|\ \ \ \ \ | | | | | | | | | | | | core/hle/kernel: Make Mutex a per-process class.
| * | | | | core/hle/kernel/mutex: Remove usages of global system accessorsLioncash2019-03-151-11/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the use of global system accessors, and instead uses the explicit interface provided.
| * | | | | core/hle/kernel: Make Mutex a per-process class.Lioncash2019-03-155-18/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it an instantiable class like it is in the actual kernel. This will also allow removing reliance on global accessors in a following change, now that we can encapsulate a reference to the system instance in the class.
* | | | | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-224-22/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/vm_manager: Amend flag value for code data
| * | | | | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-214-22/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it more evident that one is for actual code and one is for actual data. Mutable and static are less than ideal terms here, because read-only data is technically not mutable, but we were mapping it with that label.
| * | | | | | kernel/vm_manager: Amend flag values for CodeMutableLioncash2019-03-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This should actually be using the data flags, rather than the code flags.
* | | | | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/am: Add function table for IDebugFunctions
| * | | | | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have the service related stuff set up for this, however, it's missing the function table.
* | | | | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-222-0/+6
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | file_sys: Implement parser and interpreter for game memory cheats
| * | | | | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-053-25/+2
| | | | | | |
| * | | | | | vm_manager: Add support for storing and getting main code regionZach Hilman2019-03-052-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Used as root for one region of cheats, set by loader
| * | | | | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows frontend/features to access pressed buttons conveniently as possible
* | | | | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-216-96/+96
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port citra-emu/citra#4244 and citra-emu/citra#4599: Changes to BitField
| * | | | | | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-066-96/+96
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit it automatically generated by command in zsh: sed -i -- 's/BitField<\(.*\)_le>/BitField<\1>/g' **/*(D.) BitField is now aware to endianness and default to little endian. It expects a value representation type without storage specification for its template parameter.
* | | | | | | | Merge pull request #2268 from lioncash/codesetbunnei2019-03-214-45/+106
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | core/kernel: Migrate CodeSet to its own source files
| * | | | | | | kernel/process: Make MapSegment lambda reference parameter constLioncash2019-03-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The segment itself isn't actually modified.
| * | | | | | | kernel: Move CodeSet structure to its own source filesLioncash2019-03-204-44/+105
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is utilized by the loaders, this allows avoiding inclusion of the kernel process definitions where avoidable. This also keeps the loading format for all executable data separate from the kernel objects.
* | | | | | | Merge pull request #2267 from FernandoS27/fix-2238bunnei2019-03-211-1/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix crash caused by #2238.
| * | | | | | | Fix crash caused by 2238.Fernando Sahmkow2019-03-201-1/+2
| |/ / / / / /
* | | | | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | hwopus: Leverage multistream API for decoding regular Opus packets
| * | | | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After doing a little more reading up on the Opus codec, it turns out that the multistream API that is part of libopus can handle regular packets. Regular packets are just a degenerate case of multistream Opus packets, and all that's necessary is to pass the number of streams as 1 and provide a basic channel mapping, then everything works fine for that case. This allows us to get rid of the need to use both APIs in the future when implementing multistream variants in a follow-up PR, greatly simplifying the code that needs to be written.
* | | | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/am: Supply remaining missing IAudioController functions
| * | | | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All this does is supply a new volume level and a fade time in nanoseconds for the volume transition to occur within.
| * | | | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other volume setter, this mainly just sets a data member within the service, nothing too special.
| * | | | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function passes in the desired main applet and library applet volume levels. We can then just pass those values back within the relevant volume getter functions, allowing us to unstub those as well. The initial values for the library and main applet volumes differ. The main applet volume is 0.25 by default, while the library applet volume is initialized to 1.0 by default in the services themselves.
* | | | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This just acts as a basic setter for a given PID value and performs no further checking, so we can just store the passed in value.
* | | | | | | | Merge pull request #2238 from lioncash/threadbunnei2019-03-182-21/+41
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel/thread: Amend conditional test and assignment within UpdatePriority()
| * | | | | | | kernel/thread: Expand documentation of nominal_priority and current_priorityLioncash2019-03-162-3/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aims to disambiguate why each priority instance exists a little bit. While we're at it, also add an explanatory comment to UpdatePriority().
| * | | | | | | kernel/thread: Make bracing consistent within UpdatePriority()Lioncash2019-03-161-2/+4
| | | | | | | |
| * | | | | | | kernel/thread: Amend condition within UpdatePriority()Lioncash2019-03-161-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This condition was checking against the nominal thread priority, whereas the kernel itself checks against the current priority instead. We were also assigning the nominal priority, when we should be assigning current_priority, which takes priority inheritance into account. This can lead to the incorrect priority being assigned to a thread. Given we recursively update the relevant threads, we don't need to go through the whole mutex waiter list. This matches what the kernel does as well (only accessing the first entry within the waiting list).
| * | | | | | | kernel/thread: Maintain priority ordering of added mutex waiting threadsLioncash2019-03-161-14/+24
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | The kernel keeps the internal waiting list ordered by priority. This is trivial to do with std::find_if followed by an insertion.
* | | | | | | Merge pull request #2252 from bunnei/move-page-tablebunnei2019-03-174-9/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Move PageTable struct into Common.
| * | | | | | | core: Move PageTable struct into Common.bunnei2019-03-174-9/+10
| | | | | | | |
* | | | | | | | Merge pull request #2249 from lioncash/ipcbunnei2019-03-171-0/+30
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ipc_helpers: Allow pushing and popping floating-point values
| * | | | | | | | ipc_helpers: Allow pushing and popping floating-point valuesLioncash2019-03-161-0/+30
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Certain values that are passed through the IPC buffer are actually floating point values, not solely integral values.
* / / / / / / / kernel/thread: Actually remove the definition of ExitCurrentThread()Lioncash2019-03-161-6/+0
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was intended to be removed in 51d7f6bffcc0498a47abc7de27bf0906fc523dae, but I guess I forgot to actually save the file like a dingus.
* | | | | | | Merge pull request #2242 from lioncash/thread-fnbunnei2019-03-164-33/+31
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/thread: Remove WaitCurrentThread_Sleep() and ExitCurrentThread()
| * | | | | | | kernel/thread: Move thread exiting logic from ExitCurrentThread to svcExitThreadLioncash2019-03-162-8/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Puts the operation on global state in the same places as the rest of the svc calls.
| * | | | | | | kernel/thread: Migrate WaitCurrentThread_Sleep into the Thread interfaceLioncash2019-03-164-25/+24
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than make a global accessor for this sort of thing. We can make it a part of the thread interface itself. This allows getting rid of a hidden global accessor in the kernel code.
* | | | | / / gpu: Use host address for caching instead of guest address.bunnei2019-03-151-1/+2
| |_|_|_|/ / |/| | | | |
* | | | | | Merge pull request #2230 from lioncash/globalbunnei2019-03-152-8/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/process: Remove use of global system accessors
| * | | | | | kernel/process: Remove use of global system accessorsLioncash2019-03-132-8/+9
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Now that we pass in a reference to the system instance, we can utilize it to eliminate the global accessors in Process-related code.
* | | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-134-14/+36
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/server_port: Make data members private
| * | | | | | kernel/server_port: Make data members privateLioncash2019-03-114-14/+36
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With this, all kernel objects finally have all of their data members behind an interface, making it nicer to reason about interactions with other code (as external code no longer has the freedom to totally alter internals and potentially messing up invariants).
* | | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-133-19/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/hle/result: Tidy up the base error code result header.
| * | | | | | core/hle/result: Remove now-unnecessary manually defined copy assignment operatorLioncash2019-03-101-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this was required, as BitField wasn't trivially copyable. BitField has since been made trivially copyable, so now this isn't required anymore.
| * | | | | | core/hle/result: Amend error in comment description for ResultCodeLioncash2019-03-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of another holdover from Citra, and describes the OS on the Switch instead.
| * | | | | | core/hle/result: Remove now-unused constructor for ResultCodeLioncash2019-03-101-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the final stray ErrorDescription member was relocated, we can finally remove it and its relevant constructor in the ResultCode union.
| * | | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-103-3/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Relocates the error code to where it's most related, similar to how all the other error codes are. Previously we were including a non-generic error in the main result code header.
* | | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-139-40/+146
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | service/vi: Unstub GetDisplayService
| * | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is also supposed to check its given policy type with the permission of the service itself. This implements the necessary machinery to unstub these functions. Policy::User seems to just be basic access (which is probably why vi:u is restricted to that policy), while the other policy seems to be for extended abilities regarding which displays can be managed and queried, so this is assumed to be for a background compositor (which I've named, appropriately, Policy::Compositor).
| * | | | | core/ipc_helper: Allow popping all signed value types with RequestParserLioncash2019-02-271-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real reason this shouldn't be allowed, given some values sent via a request can be signed. This also makes it less annoying to work with popping enum values, given an enum class with no type specifier will work out of the box now. It's also kind of an oversight to allow popping s64 values, but nothing else.
| * | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This didn't really provide much benefit here, especially since the subsequent change requires that the behavior for each service's GetDisplayService differs in a minor detail. This also arguably makes the services nicer to read, since it gets rid of an indirection in the class hierarchy.
* | | | | | Merge pull request #2211 from lioncash/arbiterbunnei2019-03-127-63/+79
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: Make the address arbiter instance per-process
| * | | | | | kernel: Make the address arbiter instance per-processLioncash2019-03-086-26/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have the address arbiter extracted to its own class, we can fix an innaccuracy with the kernel. Said inaccuracy being that there isn't only one address arbiter. Each process instance contains its own AddressArbiter instance in the actual kernel. This fixes that and gets rid of another long-standing issue that could arise when attempting to create more than one process.
| * | | | | | kernel/svc: Move address arbiter signaling behind a unified API functionLioncash2019-03-083-22/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to how WaitForAddress was isolated to its own function, we can also move the necessary conditional checking into the address arbiter class itself, allowing us to hide the implementation details of it from public use.
| * | | | | | kernel/svc: Move address arbiter waiting behind a unified API functionLioncash2019-03-083-19/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than let the service call itself work out which function is the proper one to call, we can make that a behavior of the arbiter itself, so we don't need to directly expose those implementation details.
* | | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These can just be passed regularly, now that we use fmt instead of our old logging system. While we're at it, make the parameters to MakeFunctionString std::string_views.
* | | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/audio/hwopus: Move decoder state to its own class
| * | | | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the non-multistream specific state to its own class. This will be necessary to support the multistream variants of opus decoding.
| * | | | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This indicates the entropy coder's final range.
| * | | | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be utilized by more than just that class in the future. This also renames it from OpusHeader to OpusPacketHeader to be more specific about what kind of header it is.
| * | | | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it impossible to violate the ODR, as well as providing a place for future changes.
* | | | | | | Merge pull request #2193 from lioncash/globalbunnei2019-03-102-9/+11
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | kernel/scheduler: Pass in system instance in constructor
| * | | | | | kernel/scheduler: Pass in system instance in constructorLioncash2019-03-042-9/+11
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids directly relying on the global system instance and instead makes an arbitrary system instance an explicit dependency on construction. This also allows removing dependencies on some global accessor functions as well.
* | | | | | Merge pull request #2210 from lioncash/optionalbunnei2019-03-084-47/+47
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optional
| * | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optionalLioncash2019-03-084-47/+47
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real need to use a shared lifetime here, since we don't actually expose them to anything else. This is also kind of an unnecessary use of the heap given the objects themselves are so small; small enough, in fact that changing over to optionals actually reduces the overall size of the HLERequestContext struct (818 bytes to 808 bytes).
* | | | | | Merge pull request #2195 from lioncash/shared-globalbunnei2019-03-071-3/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()
| * | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()Lioncash2019-03-041-3/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we already pass in a reference to the kernel that the shared memory instance is created under, we can just use that to check the current process, rather than using the global accessor functions. This allows removing direct dependency on the system instance entirely.
* | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-076-36/+78
|\ \ \ \ \ | | | | | | | | | | | | kernel/client_session, kernel/server_session: Make data members private
| * | | | | kernel/server_session: Make data members privateLioncash2019-03-065-32/+73
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it much nicer to locally reason about server session behavior, as part of its functionality isn't placed around other classes.
| * | | | | kernel/client_session: Make data members privateLioncash2019-03-061-4/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | These can be made private, as they aren't accessed in contexts that require them to be public.
* | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \ | | | | | | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playing
| * | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |/ / / | |/| | | | | | | | | | | | | | | | | | The service itself only does further actions if the stream is playing. If the stream is already stopped, then it just exits successfully.
* | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-074-15/+5
|\ \ \ \ \ | | | | | | | | | | | | Asynchronous GPU command processing
| * | | | | gpu: Move command processing to another thread.bunnei2019-03-071-1/+1
| | | | | |
| * | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-073-14/+4
| |/ / / /
* | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-076-8/+12
|\ \ \ \ \ | |/ / / / |/| | | | core/hle/ipc: Remove unnecessary includes
| * | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-056-8/+12
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes a few inclusion dependencies from the headers or replaces existing ones with ones that don't indirectly include the required headers. This allows removing an inclusion of core/memory.h, meaning that if the memory header is ever changed in the future, it won't result in rebuilding the entirety of the HLE services (as the IPC headers are used quite ubiquitously throughout the HLE service implementations).
* | | | Merge pull request #2199 from lioncash/arbiterbunnei2019-03-065-110/+181
|\ \ \ \ | | | | | | | | | | kernel/address_arbiter: Convert the address arbiter into a class
| * | | | kernel/address_arbiter: Pass in system instance to constructorLioncash2019-03-054-21/+39
| | | | | | | | | | | | | | | | | | | | | | | | | Allows getting rid of reliance on the global accessor functions and instead operating on the provided system instance.
| * | | | kernel/address_arbiter: Minor tidying upLioncash2019-03-051-18/+18
| | | | | | | | | | | | | | | | | | | | | | | | | - Invert conditions into guard clases where applicable. - Mark std::vector parameter of WakeThreads as const
| * | | | kernel/address_arbiter: Convert the address arbiter into a classLioncash2019-03-055-82/+135
| |/ / / | | | | | | | | | | | | | | | | | | | | Places all of the functions for address arbiter operation into a class. This will be necessary for future deglobalizing efforts related to both the memory and system itself.
* | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
| | | | | | | | | | | | | | | | | | | | Previously we were overwriting the error case with a success code further down (which is definitely not what we should be doing here).
* | | | Merge pull request #2194 from lioncash/membunnei2019-03-063-30/+66
|\ \ \ \ | | | | | | | | | | svc: Move memory range checking functions to the VMManager class
| * | | | vm_manager: Use range helpers in HeapAlloc() and HeapFree()Lioncash2019-03-041-4/+2
| | | | | | | | | | | | | | | | | | | | Significantly tidies up two guard conditionals.
| * | | | vm_manager: Provide address range checking functions for other memory regionsLioncash2019-03-042-4/+35
| | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface uniform when it comes to checking various memory regions.
| * | | | svc: Migrate address range checking functions to VMManagerLioncash2019-03-043-23/+30
| |/ / / | | | | | | | | | | | | Provides a bit of a more proper interface for these functions.
* | | | Merge pull request #2200 from lioncash/audiobunnei2019-03-063-10/+20
|\ \ \ \ | | | | | | | | | | hle/service/audio: Extract audio error codes to a header
| * | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-053-10/+20
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | Places all error codes in an easily includable header. This also corrects the unsupported error code (I accidentally used the hex value when I meant to use the decimal one).
* / / / kernel/thread: Remove obsolete TODO in Create()Lioncash2019-03-051-2/+0
|/ / / | | | | | | | | | This is a TODO carried over from Citra that doesn't apply here.
* | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \ | | | | | | | | service/audio: Provide an implementation of ExecuteAudioRendererRendering
| * | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function appears to do nothing noteworthy on the switch. All it does at the moment is either return an error code or abort the system. Given we obviously don't want to kill the system, we just opt for always returning the error code.
* | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / / | | | | | | | | | | | | | | | | | | This currently has the same behavior as the regular OpenAudioRenderer API function, so we can just move the code within OpenAudioRenderer to an internal function that both service functions call.
* | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
| | | | | | | | | | | | | | | The SM namespace is within the Service namespace, so this was forward declaring a type that didn't exist.
* | | Merge pull request #2169 from lioncash/namingbunnei2019-02-271-13/+13
|\ \ \ | | | | | | | | audio_core/audio_renderer: Provide names for some parameters of AudioRendererParameter
| * | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-271-13/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides names for previously unknown entries (aside from the two u8 that appear to be padding bytes, and a single word that also appears to be reserved or padding). This will be useful in subsequent changes when unstubbing behavior related to the audio renderer services.
* | | | Merge pull request #2161 from lioncash/handle-tablebunnei2019-02-276-19/+63
|\ \ \ \ | | | | | | | | | | kernel/handle_table: Allow process capabilities to limit the handle table size
| * | | | kernel/handle_table: Make local variables as const where applicableLioncash2019-02-251-4/+5
| | | | | | | | | | | | | | | | | | | | Makes immutable state explicit.
| * | | | kernel/handle_table: Allow process capabilities to limit the handle table sizeLioncash2019-02-256-10/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel allows restricting the total size of the handle table through the process capability descriptors. Until now, this functionality wasn't hooked up. With this, the process handle tables become properly restricted. In the case of metadata-less executables, the handle table will assume the maximum size is requested, preserving the behavior that existed before these changes.
| * | | | kernel/handle-table: In-class initialize data membersLioncash2019-02-252-3/+2
| | | | | | | | | | | | | | | | | | | | Directly initializes members where applicable.
| * | | | kernel/handle_table: Resolve truncation warningsLioncash2019-02-251-2/+2
| | |/ / | |/| | | | | | | | | | | | | | Avoids implicit truncation warnings from u32 -> u16 (the truncation is desirable behavior here).
* | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-275-6/+6
| |/ / |/| | | | | | | | | | | These types are within the common library, so they should be within the Common namespace.
* | | service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
|/ / | | | | | | Amends it to add the 7.0.0+ CreateStrayLayer function.
* | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
| | | | | | | | | | | | | | The NVFlinger service is already passed into services that need to guarantee its lifetime, so the BufferQueue instances will already live as long as they're needed. Making them std::shared_ptr instances in this case is unnecessary.
* | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
| | | | | | | | | | | | | | Like the previous changes made to the Display struct, this prepares the Layer struct for changes to its interface. Given Layer will be given more invariants in the future, we convert it into a class to better signify that.
* | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
| | | | | | | | | | | | | | | | | | With the display and layer structures relocated to the vi service, we can begin giving these a proper interface before beginning to properly support the display types. This converts the display struct into a class and provides it with the necessary functions to preserve behavior within the NVFlinger class.
* | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-206-57/+119
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are more closely related to the vi service as opposed to the intermediary nvflinger. This also places them in their relevant subfolder, as future changes to these will likely result in subclassing to represent various displays and services, as they're done within the service itself on hardware. The reasoning for prefixing the display and layer source files is to avoid potential clashing if two files with the same name are compiled (e.g. if 'display.cpp/.h' or 'layer.cpp/.h' is added to another service at any point), which MSVC will actually warn against. This prevents that case from occurring. This also presently coverts the std::array introduced within f45c25aabacc70861723a7ca1096a677bd987487 back to a std::vector to allow the forward declaration of the Display type. Forward declaring a type within a std::vector is allowed since the introduction of N4510 (http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2015/n4510.html) by Zhihao Yuan.
* | address_arbiter: Use nested namespaces where applicableLioncash2019-02-162-8/+4
| | | | | | | | | | | | A fairly trivial change. Other sections of the codebase use nested namespaces instead of separate namespaces here. This one must have just been overlooked.
* | core_timing: Convert core timing into a classLioncash2019-02-1632-81/+123
| | | | | | | | | | | | | | | | | | | | | | Gets rid of the largest set of mutable global state within the core. This also paves a way for eliminating usages of GetInstance() on the System class as a follow-up. Note that no behavioral changes have been made, and this simply extracts the functionality into a class. This also has the benefit of making dependencies on the core timing functionality explicit within the relevant interfaces.
* | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1221-54/+50
| | | | | | | | | | | | Places all of the timing-related functionality under the existing Core namespace to keep things consistent, rather than having the timing utilities sitting in its own completely separate namespace.
* | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
| | | | | | | | | | This is a leftover from the early yuzu days. We shouldn't log every time when we are drawing by default, so let's change the log level to Trace.
* | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
| | | | | | | | | | | | | | Converts many of the Find* functions to return a std::optional<T> as opposed to returning the raw return values directly. This allows removing a few assertions and handles error cases like the service itself does.
* | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
| | | | | | | | | | This member function doesn't actually modify instance state, so it can be marked as a const member function.
* | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
|/ | | | | This was missed within #2075. Renames the member function to make it consistent with the rest of the Find* functions.
* Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\ | | | | hwopus: Implement DecodeInterleaved (the newest variant)
| * hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| | | | | | | | | | | | | | | | | | | | | | | | This functions almost identically to DecodeInterleavedWithPerfOld, however this function also has the ability to reset the decoder context. This is documented as a potentially desirable thing in the libopus manual in some circumstances as it says for the OPUS_RESET_STATE ctl: "This should be called when switching streams in order to prevent the back to back decoding from giving different result from one at a time decoding."
| * hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| | | | | | | | Keeps the logic in one spot for use by both functions.
| * hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| | | | | | | | | | This doesn't really offer anything over the use of a direct pointer, so we can just use that instead.
| * hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| | | | | | | | Makes non-mutable state more explicit.
| * hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
| | | | | | | | Filled in via information provided by SwitchBrew.
* | kernel: Remove the Timer classLioncash2019-02-016-227/+0
| | | | | | | | | | | | | | | | | | | | | | | | A holdover from citra, the Horizon kernel on the switch has no prominent kernel object that functions as a timer. At least not to the degree of sophistication that this class provided. As such, this can be removed entirely. This class also wasn't used at all in any meaningful way within the core, so this was just code sitting around doing nothing. This also allows removing a few things from the main KernelCore class that allows it to use slightly less resources overall (though very minor and not anything really noticeable).
* | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \ | | | | | | service: Update function tables
| * | service/ns: Update function tablesLioncash2019-01-301-14/+20
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | service/audio: Update function tablesLioncash2019-01-304-8/+23
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | service/btm: Update function tablesLioncash2019-01-301-55/+97
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | service/psc: Update function tablesLioncash2019-01-301-8/+9
| | | | | | | | | | | | | | | Updates the function tables based off information on SwitchBrew. Gets rid of a swath of unknown names.
* | | Merge pull request #2077 from lioncash/virtbunnei2019-01-315-15/+3
|\ \ \ | | | | | | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directly
| * | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directlyLioncash2019-01-301-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | No inheritors of the WaitObject class actually make use of their own implementations of these functions, so they can be made non-virtual. It's also kind of sketchy to allow overriding how the threads get added to the list anyways, given the kernel itself on the actual hardware doesn't seem to customize based off this.
| * | | kernel/timer: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | | | | | | | | | | | | | | | | | | | This implementation just calls the base class variant of the function, so this isn't necessary.
| * | | kernel/readable_event: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | |/ | |/| | | | | | | This just calls the base variant of the function, so it can be removed.
* | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
| | | | | | | | | | | | | | | This member function doesn't actually modify instance state, so it can be const-qualified.
* | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
|/ / | | | | | | | | This more accurately describes what the function is actually attempting to do (it's not a simple trivial getter).
* | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
| | | | | | | | | | | | | | In addition to the default, external, EDID, and internal displays, there's also a null display provided as well, which as the name suggests, does nothing but discard all commands given to it. This is provided for completeness.
* | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
| | | | | | | | | | | | | | | | | | Opening a display isn't really a thing to warn about. It's an expected thing, so this can be a debug log. This also alters the string to indicate the display name better. Opening "Default" display reads a little nicer compared to Opening display Default.
* | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
| |
* | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
| | | | | | | | Makes non-mutable state more explicit.
* | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
|/ | | | | The built-in set of displays is fixed, so we can utilize an array instead of a vector here.
* hle/ipc_helpers: Fix clang-format warningsLioncash2019-01-301-1/+0
|
* hle/ipc_helpers: Allow pushing signed valuesLioncash2019-01-291-0/+22
| | | | | This is kind of a large hole in the API, given we allow popping signed values. This fixes that.
* service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
| | | | | | | This quite literally functions as a basic setter. No other error checking or anything (since there's nothing to really check against). With this, it completes the pm:bm interface in terms of functionality.
* service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
| | | | Just minor tidying of interfaces.
* service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
| | | | | | | | | | This appears to be a vestigial API function that's only kept around for compatibility's sake, given the function only returns a success error code and exits. Since that's the case, we can remove the stubbed notification from the log, since doing nothing is technically the correct behavior in this case.
* kernel/svc: Log out uncaught C++ exceptions from svcBreakLioncash2019-01-271-0/+4
| | | | | | | | | | Looking into the implementation of the C++ standard facilities that seem to be within all modules, it appears that they use 7 as a break reason to indicate an uncaught C++ exception. This was primarily found via the third last function called within Horizon's equivalent of libcxxabi's demangling_terminate_handler(), which passes the value 0x80000007 to svcBreak.
* core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
| | | | Gets rid of a few indirect inclusions.
* core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-171-1/+1
| | | | | | | | This is a function that definitely doesn't always have a non-modifying behavior across all implementations, so this should be made non-const. This gets rid of the need to mark data members as mutable to work around the fact mutating data members needs to occur.
* Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-101-7/+9
|\ | | | | settings: Add support for setting the RTC manually
| * settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-081-6/+4
| |
| * time: Use custom RTC settings if applicable for gameZach Hilman2019-01-081-6/+10
| |
* | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-108-583/+898
|\ \ | |/ |/| applets: Implement HLE web browser applet (LibAppletOff)
| * travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-292-3/+2
| |
| * web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-294-132/+134
| |
| * core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-281-1/+1
| |
| * applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-283-0/+232
| |
| * hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| |
| * am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
| |
* | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \ | | | | | | service/vi: Unstub IApplicationDisplayService's SetLayerScalingMode
| * | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | These values are not equivalent, based off RE. The internal value is put into a lookup table with the following values: [3, 0, 1, 2, 4] So the values absolutely do not map 1:1 like the comment was indicating.
| * | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| | | | | | | | | | | | | | | | | | Avoids entangling the IPC buffer appending with the actual operation of converting the scaling values over. This also inserts the proper error handling for invalid scaling values.
| * | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
| | | | | | | | | | | | | | | | | | | | | | | | This appears to only check if the scaling mode can actually be handled, rather than actually setting the scaling mode for the layer. This implements the same error handling performed on the passed in values.
* | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \ | | | | | | | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()
| * | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ / | | | | | | | | | | | | | | | Within the actual service, it makes no distinguishing between docked and undocked modes. This will always return the constants values reporting 1280x720 as the dimensions.
* | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \ | | | | | | | | Return no application area when games try to open an application area
| * | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
| | | | | | | | | | | | | | | | This will prompt CreateApplicationArea
* | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ | |_|/ / |/| | | Proper no message handling for AM::PopMessage
| * | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ / | | | | | | | | | When we have no messages, we should be returning an error code.
* | | Removed pulse event typeDavid Marcec2019-01-043-7/+0
| | | | | | | | | | | | Pulse is considered a hack and nothing should be using it. We should completely remove it
* | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \ | | | | | | | | service/vi: Minor updates and corrections to the DisplayInfo struct
| * | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| | | | | | | | | | | | | | | | | | | | Based off RE, it appears that almost all display types seem to use 1920x1080 except for a few (null display, edid display).
| * | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | It appears that the two members indicate whether a display has a bounded number of layers (and if set, the second member indicates the total number of layers).
* | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| |/ / |/| | | | | | | | Upon investigating the issue with #1878, I found that games are the ones who handle the vsync event resetting and not us.
* | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \ | | | | | | | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplay
| * | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| |/ / | | | | | | | | | | | | | | | Internally within the vi services, this is essentially all that OpenDefaultDisplay does, so it's trivial to just do the same, and forward the default display string into the function.
* | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
| | | | | | | | | | | | | | | | | | | | | This IPC command is simply a stub inside the actual service itself, and just returns a successful error code regardless of input. This is likely only retained in the service interface to not break older code that relied upon it succeeding in some way.
* | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \ | | | | | | | | service/vi: Log more information where applicable
| * | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| |/ / | | | | | | | | | | | | | | | In many cases, we didn't bother to log out any of the popped data members. This logs them out to the console within the logging call to provide more contextual information.
* / / core/kernel: Remove unnecessary inclusionsLioncash2019-01-0116-16/+22
|/ / | | | | | | Gets rid of a few unnecessary header dependencies in some source files.
* | kernel/svc: Correct misleading error message within CreateThread()Lioncash2018-12-311-2/+3
| | | | | | | | | | | | | | | | | | | | This is a bounds check to ensure that the thread priority is within the valid range of 0-64. If it exceeds 64, that doesn't necessarily mean that an actual priority of 64 was expected (it actually means whoever called the function screwed up their math). Instead clarify the message to indicate the allowed range of thread priorities.
* | kernel/svc: Sanitize core number and thread priorities in CreateThread()Lioncash2018-12-311-6/+17
| | | | | | | | | | | | Now that we handle the kernel capability descriptors we can correct CreateThread to properly check against the core and priority masks like the actual kernel does.
* | kernel/process: Rename GetAllowedProcessorMask() and GetAllowedThreadPriorityMask()Lioncash2018-12-312-11/+11
| | | | | | | | Makes them consistent with their kernel capability counterparts.
* | kernel/svc: Simplify thread core ID sanitizing in CreateThreadLioncash2018-12-311-7/+1
| | | | | | | | | | Rather than use a switch here, this can be collapsed into a simple range check, which is a little easier on the eyes.
* | Merge pull request #1956 from lioncash/process-threadSebastian Valle2018-12-315-57/+51
|\ \ | | | | | | kernel/process: Start the main thread using the specified ideal core
| * | kernel/process: Start the main thread using the specified ideal coreLioncash2018-12-281-2/+2
| | | | | | | | | | | | | | | This matches kernel behavior in that processes are started using their specified ideal core, rather than always starting on core 0.
| * | kernel: Rename 'default' CPU core to 'ideal' coreLioncash2018-12-284-21/+21
| | | | | | | | | | | | | | | | | | This makes the naming more closely match its meaning. It's just a preferred core, not a required default core. This also makes the usages of this term consistent across the thread and process implementations.
| * | kernel/thread: Move process thread initialization into process.cppLioncash2018-12-283-36/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function isn't a general purpose function that should be exposed to everything, given it's specific to initializing the main thread for a Process instance. Given that, it's a tad bit more sensible to place this within process.cpp, which keeps it visible only to the code that actually needs it.
* | | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-302-1/+5
|\ \ \ | | | | | | | | Print backtrace on svcBreak
| * | | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-291-1/+2
| | | |
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-193-11/+3
| | | |
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-031-14/+1
| | | | | | | | | | | | | | | | Added to both dynarmic and unicorn
| * | | Print backtrace on svcBreakDavid Marcec2018-12-033-0/+24
| | | | | | | | | | | | | | | | When we get an svcBreak we get a backtrace now
* | | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
| | | | | | | | | | | | | | | | Moves some variables closer to their actual usage sites.
* | | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
| |_|/ |/| |
* | | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-284-49/+35
| |/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | In all cases that these functions are needed, the VMManager can just be retrieved and used instead of providing the same functions in Process' interface. This also makes it a little nicer dependency-wise, since it gets rid of cases where the VMManager interface was being used, and then switched over to using the interface for a Process instance. Instead, it makes all accesses uniform and uses the VMManager instance for all necessary tasks. All the basic memory mapping functions did was forward to the Process' VMManager instance anyways.
* | Merge pull request #1928 from lioncash/capsbunnei2018-12-276-123/+642
|\ \ | | | | | | kernel: Handle kernel capability descriptors
| * | kernel/process: Hook up the process capability parser to the process itselfLioncash2018-12-212-120/+18
| | | | | | | | | | | | | | | While we're at it, we can also toss out the leftover capability parsing from Citra.
| * | kernel/process_capability: Handle debug capability flagsLioncash2018-12-212-1/+18
| | |
| * | kernel/process_capability: Handle handle table capability flagsLioncash2018-12-212-1/+11
| | | | | | | | | | | | | | | This just specifies the handle table size. There's also a section of reserved bits that are checked against.
| * | kernel/process_capability: Handle kernel version capability flagsLioncash2018-12-212-1/+18
| | |
| * | kernel/process_capability: Handle program capability flagsLioncash2018-12-213-2/+29
| | |
| * | kernel/process_capability: Handle interrupt capability flagsLioncash2018-12-211-1/+21
| | | | | | | | | | | | | | | | | | Similar to the service capability flags, however, we currently don't emulate the GIC, so this currently handles all interrupts as being valid for the time being.
| * | kernel/process_capability: Handle syscall capability flagsLioncash2018-12-212-1/+29
| | |
| * | kernel/process_capability: Handle the priority mask and core mask flagsLioncash2018-12-212-1/+40
| | | | | | | | | | | | | | | | | | Handles the priority mask and core mask flags to allow building up the masks to determine the usable thread priorities and cores for a kernel process instance.
| * | kernel/process: Introduce process capability parsing skeletonLioncash2018-12-214-3/+466
| | | | | | | | | | | | | | | | | | | | | We've had the old kernel capability parser from Citra, however, this is unused code and doesn't actually map to how the kernel on the Switch does it. This introduces the basic functional skeleton for parsing process capabilities.
* | | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ \ | | | | | | | | hid: Fix SetNpadJoyHoldType and improve logging.
| * | | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
| | | |
* | | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ \ | | | | | | | | | | npad: Remove code to invert input in horizontal mode.
| * | | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
| | | | | | | | | | | | | | | | | | | | | | | | | - This was incorrect, the game appears to handle this for us. - Fixes horizontal mode with Puyo Puyo Tetris and Super Mario Odyssey.
* | | | | Merge pull request #1949 from lioncash/unmapbunnei2018-12-271-0/+1
|\ \ \ \ \ | | | | | | | | | | | | kernel/vm_manager: Reset region attributes when unmapping a VMA
| * | | | | kernel/vm_manager: Reset region attributes when unmapping a VMALioncash2018-12-271-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other members related to memory regions, the attributes need to be reset back to their defaults as well.
* | | | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-272-2/+47
| | | | | | | | | | | | | | | | | | These functions come in a pair and are needed by Smash Ultimate, Minecraft, and Skyrim, amongst others.
* | | | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
|/ / / / /
* | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-264-6/+72
|\ \ \ \ \ | |/ / / / |/| | | | svc: Implement SetThreadActivity (thread suspension)
| * | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-044-6/+72
| | | | |
* | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-233-0/+131
|\ \ \ \ \ | | | | | | | | | | | | am: Implement HLE profile selector applet
| * | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-034-13/+5
| | | | | | | | | | | | | | | | | | | | | | | | Fixes bugs relating to signalling in software keyboard.
| * | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| | | | | |
| * | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| | | | | | | | | | | | | | | | | | Allows the player to select an emulated profile.
| * | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
| | | | | | | | | | | | | | | | | | Previously, ILibraryAppletAccessor would signal upon creation of any applet, but this is incorrect. A flag inside of the applet code determines whether or not creation should signal state change and swkbd happens to be one of these applets.
* | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-211-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fixed uninitialized memory due to missing returns in canary
| * | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-191-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Functions which are suppose to crash on non canary builds usually don't return anything which lead to uninitialized memory being used.
* | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-216-26/+57
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/{process, thread}: Amend behavior related to IDs
| * | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a thread handle is passed to svcGetProcessId, the kernel attempts to access the process ID via the thread's instance's owning process. Technically, this function should also be handling the kernel debug objects as well, however we currently don't handle those kernel objects yet, so I've left a note via a comment about it to remind myself when implementing it in the future.
| * | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Starts the process ID counter off at 81, which is what the kernel itself checks against internally when creating processes. It's actually supposed to panic if the PID is less than 81 for a userland process.
| * | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The service call uses a 64-bit value, just like svcGetProcessId. This amends the function signature accordingly.
| * | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-193-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel uses a 64-bit value for the thread ID, so we shouldn't be using a 32-bit value.
| * | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcGetProcessId's out parameter is a pointer to a 64-bit value, not a 32-bit one.
| * | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the actual kernel, this is a 64-bit value, so we shouldn't be using a 32-bit type to handle it.
* | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | service/am: Unstub GetAppletResourceUserId
| * | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is supposed to return the current process' ID. (0 indicates an invalid ID for both process IDs and ARU IDs).
* | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Device handle should not be a random id, instead it's the current npad id
| * | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Found during hardware testing
* | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | service/sm: Improve debug log for RegisterService
| * | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now it also indicates the name and max session count. This also gives a name to the unknown bool. This indicates if the created port is supposed to be using light handles or regular handles internally. This is passed to the respective svcCreatePort parameter internally.
* | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | kernel/svc: Implement svcSetMemoryAttribute
| * | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all the basic backing functionality implemented, we can now unstub svcSetMemoryAttribute.
| * | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This puts the backing functionality for svcSetMemoryAttribute in place, which will be utilized in a following change.
| * | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| | | | | |
| * | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is shorter and more concise. This also removes the now-innaccurate comment, as it's not returned wholesale to svcQueryMemory anymore.
| * | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the barebones enumeration constants and functions in place to handle memory attributes, while also essentially leaving the attribute itself non-functional.
* | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/thread: Set default fpcr
| * | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | applets: Correct usage of SignalStateChanged event
| * | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | This was causing some games (most notably Pokemon Quest) to softlock due to an event being fired when not supposed to. This also removes a hack wherein we were firing the state changed event when the game retrieves it, which is incorrect.
* | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvhost_gpu: Skip empty GPU command lists.
| * | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
| | | | | | |
* | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Fix Service object leak on emulation stop
| * | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Services created with the ServiceFramework base class install themselves as HleHandlers with an owning shared_ptr in the ServerPort ServiceFrameworkBase::port member variable, creating a cyclic ownership between ServiceFrameworkBase and the ServerPort, preventing deletion of the service objects. Fix that by removing the ServiceFrameworkBase::port member because that was only used to detect multiple attempts at installing a port. Instead store a flag if the port was already installed to achieve the same functionality.
* | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-154-9/+165
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | svc: Implement yield types 0 and -1
| * | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| | | | | | |
| * | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| | | | | | | | | | | | | | | | | | | | | This will automatically occur anyway when PrepareReschedule is called
| * | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| | | | | | |
| * | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| | | | | | |
| * | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-225-77/+139
| | | | | | |
| * | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-195-2/+114
| | | | | | |
* | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vm_manager/svc: Modify MemoryState enum, and correct error handling for svcQueryMemory
| * | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcQueryProcessMemory is trivial to implement, given all the behavior necessary for it is present, it just needs a handler for it.
| * | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the previous change, the memory writing was moved into the service function itself, however it still had a problem, in that the entire MemoryInfo structure wasn't being written out, only the first 32 bytes of it were being written out. We still need to write out the trailing two reference count members and zero out the padding bits. Not doing this can result in wrong behavior in userland code in the following scenario: MemoryInfo info; // Put on the stack, not quaranteed to be zeroed out. svcQueryMemory(&info, ...); if (info.device_refcount == ...) // Whoops, uninitialized read. This can also cause the wrong thing to happen if the user code uses std::memcmp to compare the struct, with another one (questionable, but allowed), as the padding bits are not guaranteed to be a deterministic value. Note that the kernel itself also fully zeroes out the structure before writing it out including the padding bits.
| * | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the memory writes directly into QueryProcessMemory instead of letting the wrapper function do it. It would be inaccurate to allow the handler to do it because there's cases where memory shouldn't even be written to. For example, if the given process handle is invalid. HOWEVER, if the memory writing is within the wrapper, then we have no control over if these memory writes occur, meaning in an error case, 68 bytes of memory randomly get trashed with zeroes, 64 of those being written to wherever the memory info address points to, and the remaining 4 being written wherever the page info address points to. One solution in this case would be to just conditionally check within the handler itself, but this is kind of smelly, given the handler shouldn't be performing conditional behavior itself, it's a behavior of the managed function. In other words, if you remove the handler from the equation entirely, does the function still retain its proper behavior? In this case, no. Now, we don't potentially trash memory from this function if an invalid query is performed.
| * | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These should be swapped.
| * | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel returns a memory info instance with the base address set to the end of the address space, and the size of said block as 0 - address_space_end, it doesn't set both of said members to zero.
| * | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to directly access the managed VMAs outside of the memory manager itself just for querying memory.
| * | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets the two structures out of an unrelated header and places them with the rest of the memory management code. This also corrects the structures. PageInfo appears to only contain a 32-bit flags member, and the extra padding word in MemoryInfo isn't necessary.
| * | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends the MemoryState enum to use the same values like the actual kernel does. Also provides the necessary operators to operate on them. This will be necessary in the future for implementing svcSetMemoryAttribute, as memory block state is checked before applying the attribute.
* | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | svc_wrap: Correct register index for a wrapper specialization
| * | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This would result in svcSetMemoryAttribute getting the wrong value for its third parameter. This is currently fine, given the service function is stubbed, however this will be unstubbed in a future change, so this needs to change.
* | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Process object kept itself alive indefinitely because its handle_table contains a SharedMemory object which owns a reference to the same Process object, creating a circular ownership scenario. Break that up by storing only a non-owning pointer in the SharedMemory object.
* | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | fsp_srv: Implement IStorage::GetSize
| * | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |/ / / / | |/| | | | | | | | | | | | | | | | Takes no input and returns the size as a u64. Needed by Katamari Damacy Reroll to boot.
* | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-111-0/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | patch_manager: Add support for disabling patches
| * | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()
| * | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, the backing code only ever seems to use 0-2 as the range of values 1 being a generic log enable, with 2 indicating logging should go to the SD card. These are used as a set of flags internally. Given we only care about receiving the log in general, we can just always signify that we want logging in general.
* | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/process: Set ideal core from metadata
| * | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A very trivial change. If metadata is available, the process should use it to retrieve the desired core for the process to run on.
* | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-104-22/+36
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vm_manager: Make vma_map private
| * | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-064-22/+36
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was only ever public so that code could check whether or not a handle was valid or not. Instead of exposing the object directly and allowing external code to potentially mess with the map contents, we just provide a member function that allows checking whether or not a handle is valid. This makes all member variables of the VMManager class private except for the page table.
* | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/ldr: Amend layouts of NRO and NRR headers
| * | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The first word is just a padding byte, it's not an actual entry instruction. Also renames the rest of the entries according to SwitchBrew.
| * | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The padding after the magic signature value should be 12 bytes rather than 28 bytes. The other 16 should be placed after the title ID pattern.
* | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | hle/service, hle/sm: Minor cleanup
| * | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Combines the two into one, shortening the amount of code here.
| * | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only one usage of the specified objects made use of the lack of namespacing. Given the low usage, we can just remove these.
| * | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These auto-deduce the result based off its arguments, so there's no need to do that work for the compiler, plus, the function return value itself already indicates what we're returning.
| * | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to keep the variables separate from their actual initialization spots.
* | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | kernel/svc: Correct behavior of svcResetSignal()
| * | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While partially correct, this service call allows the retrieved event to be null, as it also uses the same handle to check if it was referring to a Process instance. The previous two changes put the necessary machinery in place to allow for this, so we can simply call those member functions here and be done with it.
| * | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Process instances can be waited upon for state changes. This is also utilized by svcResetSignal, which will be modified in an upcoming change. This simply puts all of the WaitObject related machinery in place.
| * | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcResetSignal relies on the event instance to have already been signaled before attempting to reset it. If this isn't the case, then an error code has to be returned.
* | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| |/ / / / / |/| | | | | | | | | | | | | | | | | We don't need to specify all of the ARM interfaces explicitly.
* | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-051-0/+10
|\ \ \ \ \ \ | |/ / / / / |/| | | | | file_sys: Implement open source system archives
| * | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| | | | | |
* | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
| | | | | |
* | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function simply does a handle table lookup for a writable event instance identified by the given handle value. If a writable event cannot be found for the given handle, then an invalid handle error is returned. If a writable event is found, then it simply signals the event, as one would expect.
* | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcCreateEvent operates by creating both a readable and writable event and then attempts to add both to the current process' handle table. If adding either of the events to the handle table fails, then the relevant error from the handle table is returned. If adding the readable event after the writable event to the table fails, then the writable event is removed from the handle table and the relevant error from the handle table is returned. Note that since we do not currently test resource limits, we don't check the resource limit table yet.
* | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-045-10/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/object: Amend handle types to distinguish between readable and writable events
| * | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-045-10/+19
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two kernel object should absolutely never have the same handle ID type. This can cause incorrect behavior when it comes to retrieving object types from the handle table. In this case it allows converting a WritableEvent into a ReadableEvent and vice-versa, which is undefined behavior, since the object types are not the same. This also corrects ClearEvent() to check both kernel types like the kernel itself does.
* | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | Another hold-over from Citra.
* | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
|/ / / / / | | | | | | | | | | | | | | | | | | | | Allows a process to register the resource limit as part of its handle table.
* | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
| | | | |
* | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ | |_|/ / / |/| | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categories
| * | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel uses the handle table of the current process to retrieve the process that should be used to retrieve certain information. To someone not familiar with the kernel, this might raise the question of "Ok, sounds nice, but doesn't this make it impossible to retrieve information about the current process?". No, it doesn't, because HandleTable instances in the kernel have the notion of a "pseudo-handle", where certain values allow the kernel to lookup objects outside of a given handle table. Currently, there's only a pseudo-handle for the current process (0xFFFF8001) and a pseudo-handle for the current thread (0xFFFF8000), so to retrieve the current process, one would just pass 0xFFFF8001 into svcGetInfo. The lookup itself in the handle table would be something like: template <typename T> T* Lookup(Handle handle) { if (handle == PSEUDO_HANDLE_CURRENT_PROCESS) { return CurrentProcess(); } if (handle == PSUEDO_HANDLE_CURRENT_THREAD) { return CurrentThread(); } return static_cast<T*>(&objects[handle]); } which, as is shown, allows accessing the current process or current thread, even if those two objects aren't actually within the HandleTable instance.
| * | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Our implementation of svcGetInfo was slightly incorrect in that we weren't doing proper error checking everywhere. Instead, reorganize it to be similar to how the kernel seems to do it.
* | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-033-19/+6
|\ \ \ \ \ | | | | | | | | | | | | filesystem: De-globalize registered_cache_union
| * | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-023-19/+6
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just return a new instance of this when it's requested. This only ever holds pointers to the existing registed caches, so it's not a large object. Plus, this also gets rid of the need to keep around a separate member function just to properly clear out the union. Gets rid of one of five globals in the filesystem code.
* | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0332-234/+393
|\ \ \ \ \ | | | | | | | | | | | | kernel: Divide Event into ReadableEvent and WritableEvent
| * | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| | | | | |
| * | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2930-311/+169
| | | | | |
| * | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2925-153/+274
| | | | | |
| * | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| | | | | |
| * | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | Used to store ReadableEvents of all events on the system.
| * | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-295-59/+206
| | | | | | | | | | | | | | | | | | | | | | | | More hardware accurate. On the actual system, there is a differentiation between the signaler and signalee, they form a client/server relationship much like ServerPort and ClientPort.
| * | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
| | | | | |
* | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-033-1/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/fsp_srv: Implement CleanDirectoryRecursively
| * | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-013-1/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the same behavior-wise as DeleteDirectoryRecursively, with the only difference being that it doesn't delete the top level directory in the hierarchy, so given: root_dir/ - some_dir/ - File.txt - OtherFile.txt The end result is just: root_dir/
* | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/audio/audout_u: Amend constructor initialization list order
| * | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Orders the constructor initializer list the same way the members of the class are declared. Prevents -Wreorder warnings
* | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixed crash with SetNpadMode
| * | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | fixed crash due to handheld
* | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table for IClientEpSession based off information provided by SwitchBrew.
* | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table according to information provided by SwitchBrew.
* | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.
| * | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| | |/ / / | |/| | | | | | | | | | | | | Assert that it is not empty before using it in the DequeueBuffer wait callback.
* | | | | Fix debug buildLioncash2018-12-011-1/+1
| |/ / / |/| | | | | | | | | | | | | | | A non-existent parameter was left in some formatting calls (the logging macro for which only does anything meaningful on debug builds)
* | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
| | | | | | | | | | | | | | | | | | | | This code was around prior to the introduction of PushEnum, so convert it over so we don't need to cast here.
* | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / / | | | | | | | | | This function simply converts a given index into a language code.
* | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \ | | | | | | | | Changed logging to be "Log before execution", Added more error logging, all services/svc should now log on some level
| * | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| | | |
| * | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| | | |
| * | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| | | |
| * | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| | | |
| * | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| | | |
| * | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| | | |
| * | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
| | | |
* | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \ | | | | | | | | | | npad: Use NPadIdToIndex to prevent invalid array access
| * | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
| | | | |
* | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-281-5/+10
|\ \ \ \ \ | | | | | | | | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.
| * | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-281-8/+6
| | | | | |
| * | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-271-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | - More accurate impl., fixes Undertale (among other games).
* | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
| | | | | |
* | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ | |/ / / / / |/| | | | | profile_manager: Save and load ProfileData from disk
| * | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
| | | | | | | | | | | | | | | | | | | | | | | | The ProfileData is a 0x80-sized structure that stores various pieces of miscellaneous data for the account.
* | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The opposite of the getter functions, this function sets the limit value for a particular ResourceLimit resource category, with the restriction that the new limit value must be equal to or greater than the current resource value. If this is violated, then ERR_INVALID_STATE is returned. e.g. Assume: current[Events] = 10; limit[Events] = 20; a call to this service function lowering the limit value to 10 would be fine, however, attempting to lower it to 9 in this case would cause an invalid state error.
* | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This kernel service function is essentially the exact same as svcGetResourceLimitLimitValue(), with the only difference being that it retrieves the current value for a given resource category using the provided resource limit handle, rather than retrieving the limiting value of that resource limit instance. Given these are exactly the same and only differ on returned values, we can extract the existing code for svcGetResourceLimitLimitValue() to handle both values.
* | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This kernel service function retrieves the maximum allowable value for a provided resource category for a given resource limit instance. Given we already have the functionality added to the resource limit instance itself, it's sufficient to just hook it up. The error scenarios for this are: 1. If an invalid resource category type is provided, then ERR_INVALID_ENUM is returned. 2. If an invalid handle is provided, then ERR_INVALID_HANDLE is returned (bad thing goes in, bad thing goes out, as one would expect). If neither of the above error cases occur, then the out parameter is provided with the maximum limit value for the given category and success is returned.
* | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
| |/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function simply creates a ResourceLimit instance and attempts to create a handle for it within the current process' handle table. If the kernal fails to either create the ResourceLimit instance or create a handle for the ResourceLimit instance, it returns a failure code (OUT_OF_RESOURCE, and HANDLE_TABLE_FULL respectively). Finally, it exits by providing the output parameter with the handle value for the ResourceLimit instance and returning that it was successful. Note: We do not return OUT_OF_RESOURCE because, if yuzu runs out of available memory, then new will currently throw. We *could* allocate the kernel instance with std::nothrow, however this would be inconsistent with how all other kernel objects are currently allocated.
* | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | | service/sm: Take std::string by const reference in UnregisterService
| * | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to create a copy of the std::string instance (potentially allocating). The only reason RegisterService takes its argument by value is because it's std::moved internally.
* | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
| | | |
* | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ | |/ / / |/| | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.
| * | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
| | | | | | | | | | | | | | | | - Used by Undertale.
* | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \ | | | | | | | | | | sm: Implement RegisterService and UnregisterService
| * | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
| | | | | | | | | | | | | | | These are needed by Edizon to boot. They are used to see if a user is using SX OS, as SX OS registers a custom service called 'tx' and attempting to register a service of the same name lets the application know if it is present.
* | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \ | | | | | | | | | | | | filesystem: Clear registered union paths on factory creation
| * | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-242-13/+31
|\ \ \ \ \ | |_|_|/ / |/| | | | Report resolution scaling support for vi and am
| * | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| | | | |
| * | | | Report resolution scaling support for vi and amDavid Marcec2018-11-162-13/+29
| | | | | | | | | | | | | | | | | | | | Specifying an internal resolution in yuzu now will report the scaled changes to vi and am.
* | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-233-4/+100
|\ \ \ \ \ | | | | | | | | | | | | applets: Add StubApplet and use it as fallback when AppletId is not implemented
| * | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| | | | | |
| * | | | | applets: Add StubAppletZach Hilman2018-11-222-0/+96
| | | | | | | | | | | | | | | | | | | | | | | | This will log all data it receives, log all calls to its methods and push dummy data into both channels on execution.
* | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.
| * | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents memory exceptions when the debug pad is enabled.
* | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | audout_u: Add support for multiple IAudioOut streams.
| * | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | kernel/handle_table: Minor changes
| * | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't depend on class state, and are effectively implementation details, so they can go into the cpp file .
| * | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous handle table size is a holdover from Citra. The actual handle table construct on Horizon only allows for a maximum of 1024 entries.
| * | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | We don't need to potentially inline the teardown logic of all of the handle instances.
* | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ | |/ / / / / |/| | | | | am/applets: Minor cleanup
| * | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The accessor should be doing just that, accessing, rather than retaining the lifetime of the data broker as well.
| * | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also resolve places where includes should have been provided, but weren't.
| * | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
| | | | | | | | | | | | | | | | | | | | | | | | Avoids wonky wrapping and makes it nicer to read.
* | | | | | am: Correct build failureLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The interface for shared memory was changed, but another commit was merged that relied on the (previously public) internals of SharedMemory. This amends that discrepancy.
* | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/shared_memory: Make data members private, plus minor interface changes
| * | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Both member functions assume the passed in target process will not be null. Instead of making this assumption implicit, we can change the functions to be references and enforce this at the type-system level.
| * | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this doesn't mutate instance state, we can provide a const-qualified variant as well.
| * | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the interface consistent with the regular Create() function.
| * | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface nicer to use in terms of 64-bit code, as it makes it less likely for one to get truncation warnings (and also makes sense in the context of the rest of the interface where 64-bit types are used for sizes and offsets
| * | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than allow unfettered access to the class internals, we hide all members by default and create and API that other code can operate against.
* | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | ldr: Clean up error codes
| * | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The separate enum isn't particularly necessary here, and the values can just be directly put into the ResultCode instances, given the names are also self-documenting here.
* | / / / / kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| |/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | <random> isn't necesary directly within the header and can be placed in the cpp file where its needed. Avoids propagating random generation utilities via a header file.
* | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-207-106/+729
|\ \ \ \ \ | | | | | | | | | | | | am: Implement HLE software keyboard applet
| * | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| | | | | |
| * | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| | | | | |
| * | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| | | | | | | | | | | | | | | | | | | | | | | | This cleans up most of the callbacks and such in the Applets::Applet interface, while also properly implementing all four data channels.
| * | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| | | | | |
| * | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| | | | | |
| * | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| | | | | |
| * | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| | | | | |
| * | | | | applet: Add operation completed callbackZach Hilman2018-11-182-3/+5
| | | | | |
| * | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| | | | | |
| * | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-183-6/+20
| | | | | | | | | | | | | | | | | | | | | | | | a
| * | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-184-36/+34
| | | | | |
| * | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-181-4/+8
| | | | | |
| * | | | | am: Implement text check software keyboard modeZach Hilman2018-11-183-14/+95
| | | | | | | | | | | | | | | | | | | | | | | | Allows the game to verify and send a message to the frontend.
| * | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-187-31/+48
| | | | | |
| * | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| | | | | | | | | | | | | | | | | | Allows use of software keyboard applet and future applets to be easily added by adding enum ID and a switch case.
| * | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-182-0/+128
| | | | | | | | | | | | | | | | | | Provides a middleman between the Frontend provider class and the expected AM::Applets::Applet class needed by ILibraryAppletAccessor
| * | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-182-0/+75
| | | | | | | | | | | | | | | | | | Adds an Initialize and Execute methods which are used by the ILibraryAppletAccessor to start and control the applet.
| * | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| | | | | | | | | | | | | | | | | | Now starts the applet provided in constructor.
| * | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| | | | | | | | | | | | | | | | | | Used by software keyboard applet for data transfer.
| * | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| | | | | | | | | | | | | | | | | | std::stack was no longer suitable for non-trivial operations
| * | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| | | | | | | | | | | | | | | | | | Needs to be accessible by applet files.
| * | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| | | | | | | | | | | | | | | | | | Writes to an AM::IStorage object through an IStorageAccessor will now be preserved once the accessor is destroyed.
| * | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| | | | | | | | | | | | | | | | | | Creates an AM::IStorage object with the contents of the transfer memory located at the handle provided.
| * | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | | | | | | | | | | | | | | | | | Seems to be used and created identically to SharedMemory, so just reuse that.
* | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | lm: Implement SetDestination by doing nothing
| * | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function was likely intended to be a way to redirect where the output of a log went. e.g. Firing a log over a network, dumping over a tunneling session, etc. Given we always want to see the log and not change its output. It's one of the lucky service functions where the easiest implementation is to just do nothing at all and return success.
* | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleans out the citra/3DS-specific implementation details that don't apply to the Switch. Sets the stage for implementing ResourceLimit instances properly. While we're at it, remove the erroneous checks within CreateThread() and SetThreadPriority(). While these are indeed checked in some capacity, they are not checked via a ResourceLimit instance. In the process of moving out Citra-specifics, this also replaces the system ResourceLimit instance's values with ones from the Switch.
* | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-194-174/+61
| | | | | |
* | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
| | | | | |
* | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | Including finger ID, diamater x/y, and angle. Additionally, checks if the touchscreen is enabled.
* | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
| | | | | |
* | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
| | | | | |
* | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
| | | | | | | | | | | | | | | | | | | | | | | | Used by developers to test games, not present on retail systems. Some games are known to respond to DebugPad input though, for example Kirby Star Allies.
* | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
| | | | | |
* | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
| | | | | |
* | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
| | | | | |
* | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
| | | | | |
* | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
| | | | | |
* | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
| | | | | |
* | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / |/| | | |
* | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-196-21/+400
|\ \ \ \ \ | | | | | | | | | | | | ldr_ro: Complete LDR:RO implementation
| * | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| | | | | |
| * | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| | | | | | | | | | | | | | | | | | | | | | | | Includes actual unmapping and address error checking.
| * | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| | | | | | | | | | | | | | | | | | | | | | | | Includes NRO and BSS error checking, maximum loaded NRO check, NRR hash check, and proper remapping of BSS data.
| * | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| | | | | | | | | | | | | | | | | | | | | | | | Includes initialization check, proper address check, alignment check, and actual unloading of a loaded NRR.
| * | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| | | | | | | | | | | | | | | | | | | | | | | | Includes parameter error checking, hash enforcement, initialization check, and max NRR load check.
| * | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-151-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | Credits to Subv
| * | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | Fixes unmapped spam in SMP and buffer size errors in some other games
* | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUser
| * | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Seems pokemon calls this sometimes and it caused "random crashes"
* | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBuffer
| * | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | Used by homebrew on exit. According to switchbrew, returns an empty response parcel with one zero in it.
* | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | svc: ResetSignal is not stubbed
| * | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
| | | | | | | | | | | | | | | | | | | | | https://user-images.githubusercontent.com/20753089/48677874-b8e01c80-eb7b-11e8-8043-b99faa29022c.PNG
* | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
| | | | | | |
* | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Added various bluetooth based cmds for palma
| * | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | It seems palma is done through bluetooth, we need this for pokemon go however more research needs to be done when we actually get palma working. This is presumably used for transfering data between the controller and the console, it does not seem for actual input as far as I know.
* | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.
| * | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | - Fixes audio issues with Pokemon: Let's Go Pikachu & Eevee.
* / | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to PR 1706, which cleans up the error codes for the filesystem code, but done for the kernel error codes. This removes the ErrCodes namespace and specifies the errors directly. This also fixes up any straggling lines of code that weren't using the named error codes where applicable.
* | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement SetMemoryPermission
| * | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| | | | | | |
| * | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-162-4/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | game_list: Optimize game list refresh
| * | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents unnecessary re-reads of the metadata and unnecessary temporary objects.
* | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-163-13/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys/errors: Clean up error code values
| * | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-163-13/+11
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | Keeps filesystem-related error codes in one spot.
* / | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / / | | | | | | | | | | | | | | | | | | Currently unclear what these do yet, will be researched at a later time when we want to implement palma.
* | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed priority switching edge case for handheld We accidently used controller index instead of npad id * Moved NPadIdToIndex
* | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | csrng: Use random integer distribution instead of raw engine
| * | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | Prevents returning the same value every single call.
* | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/thread: Deduplicate scheduler switching code
| * | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The code in both places was the same verbatim, so we can extract it to a function to deduplicate the logic.
* | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-152-4/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | patch_manager: Add support for dumping uncompressed NSOs
| * | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-292-4/+22
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | Equates to yuzu_dir/dump/<title id>/
* | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdate
| * | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, they both currently go through the same codepath with no difference in behavior.
* | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | acc/profile_manager: Minor cleanup-related changes
| * | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| | | | | | | |
| * | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids relying on fmt always being indirectly included.
* | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()
| * | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | empty() in this case will always return false, since the returned container is a std::array. Instead, check if all given users are invalid before returning the error code.
* | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()
| * | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous expression would copy sizeof(size_t) amount of bytes (8 on a 64-bit platform) rather than the full 10 bytes comprising the uuid member. Given the source and destination types are the same, we can just use an assignment here instead.
* | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate
| * | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.
| * | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When yuzu is compiled in release mode this function is unused, however, when compiled in debug mode, it's used within a LOG_TRACE statement. This prevents erroneous compilation warnings about an unused function (that isn't actually totally unused).
* | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-143-1/+27
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | svc: Use proper random entropy generation algorithm
| * | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-133-1/+27
| |/ / / / /
* | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm manager
| * | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've moved all of the heap-related stuff to the VMManager class, we can unstub this function, as the necessary members are visible now.
| * | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Avoids a breach of responsibilities in the interface and keeps the direct code for memory management within the VMManager class.
* | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimit
| * | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | These appear to be a basic getter and setter pair, so these are fairly trivial to implement and get out of the way.
* | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-145-2/+227
|\ \ \ \ \ \ | |/ / / / / |/| | | | | [ns|fsp_srv]: Implement various functions to boot Checkpoint
| * | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-292-15/+73
| | | | | | | | | | | | | | | | | | Returns the raw NACP bytes and the raw icon bytes into a title-provided buffer. Pulls from Registration Cache for control data, returning all zeros should it not exist.
| * | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| | | | | | | | | | | | | | | | | | | | | | | | An object to read SaveDataInfo objects, which describe a unique save on the system. This implementation iterates through all the directories in the save data space and uses the paths to reconstruct the metadata.
| * | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Needed by Checkpoint. Returns an object that can iterate through all savedata on the system.
| * | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-292-0/+11
| |/ / / /
* | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-133-3/+13
|\ \ \ \ \ | | | | | | | | | | | | csrng: Add config option to set RNG seed
| * | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-131-1/+2
| | | | | |
| * | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ | |/ / / / |/| | | | Implement GetClockSnapshot, ToPosixTime & ToPosixTimeWithMyRule
| * | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| | | | |
| * | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| | | | | | | | | | | | | | | | | | | | Added instead of using a seperate PR to prevent conflicts
| * | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| | | | |
| * | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
| | | | | | | | | | | | | | | | | | | | Needed by megaman 11
* | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-106-35/+138
|\ \ \ \ \ | |/ / / / |/| | | | Ability to switch between docked and undocked mode in-game
| * | | | FixupsDavid Marcec2018-11-071-1/+1
| | | | |
| * | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-076-35/+138
| | | | | | | | | | | | | | | | | | | | Started implementation of the AM message queue mainly used in state getters. Added the ability to switch docked mode whilst in game without stopping emulation. Also removed some things which shouldn't be labelled as stubs as they're implemented correctly
* | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \ | | | | | | | | | | | | Updated npad styles on holdtype switches
| * | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| |/ / / / | | | | | | | | | | | | | | | Fixes input for megaman
* | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * svcBreak now dumps information from the debug buffer passed info1 and info2 seem to somtimes hold an address to a buffer, this is usually 4 bytes or the size of the int and contains an error code. There's other circumstances where it can be something different so we hexdump these to examine them at a later date. * Addressed comments
* | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
| | | | |
* | | | | Added missing logDavid Marcec2018-11-071-0/+1
| | | | |
* | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
|/ / / / | | | | | | | | | | | | Needed for Shantae - Half-Genie Hero - Ultimate Edition!
* | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \ | | | | | | | | | | Fixed HID crash when launching more than 1 game & signaled styleset change event
| * | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
| | | | | | | | | | | | | | | | | | | | This should fix crashes when launching multiple games in yuzu
* | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
| |_|_|/ |/| | |
* | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / /
* | | Merge pull request #1615 from lioncash/inputbunnei2018-11-021-1/+2
|\ \ \ | | | | | | | | configure_system: Contrain profile usernames to 32 characters
| * | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-311-1/+2
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we would let a user enter an unbounded name and then silently truncate away characters that went over the 32-character limit. This is kind of bad from the UX point of view, because we're essentially not doing what the user intended in certain scenarios. Instead, we clamp it to 32 characters and make that visually apparent in the dialog box to provide a name for a user.
* | / service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
| |/ |/| | | | | Updated based off information on SwitchBrew.
* | general: Remove unused boost inclusions where applicableLioncash2018-10-301-2/+0
| | | | | | | | Cleans up unused includes and trims off some dependencies on externals.
* | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-307-23/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * get rid of boost::optional * Remove optional references * Use std::reference_wrapper for optional references * Fix clang format * Fix clang format part 2 * Adressed feedback * Fix clang format and MacOS build
* | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointer
| * | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| | | | | | | | | | | | Gets rid of the need to call the getter and then check for null.
| * | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| |/ | | | | | | | | Nothing requires the shared owner ship here, so we can just return a plain pointer.
* / core: Make System references const where applicableLioncash2018-10-282-3/+3
|/
* Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ | | | | svc: Implement svcGetInfo command 0xF0000002
| * svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| | | | | | | | Nothing from this enum is intended to be used outside of this function.
| * svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
| | | | | | | | | | | | | | | | | | | | This retrieves: if (curr_thread == handle_thread) { result = total_thread_ticks + (hardware_tick_count - last_context_switch_ticks); } else if (curr_thread == handle_thread && sub_id == current_core_index) { result = hardware_tick_count - last_context_switch_ticks; }
* | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
|/
* Merge pull request #1569 from lioncash/amiibobunnei2018-10-262-3/+5
|\ | | | | yuzu/main: Notify user of loading errors with Amiibo data
| * yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-242-3/+5
| | | | | | | | | | We shouldn't silently continue if loading failed, since the general assumption is that no messages showing up implicitly indicates success.
* | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
| | | | | | | | - This is an incomplete implementation. It was tested with Super Mario Party.
* | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
| |
* | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
| |
* | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ | | | | | | service/usb: Update service function tables
| * | service/usb: Update service function tablesLioncash2018-10-251-21/+22
| | | | | | | | | | | | Updated based off the information provided by Hexkyz on Switchbrew.
* | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ | | | | | | | | service/acc: Silence compiler truncation warnings
| * | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| | | | | | | | | | | | | | | | | | | | | | | | This is just flat data, so it doesn't really need to be in the function itself. This also allows deduplicating the constant for the backup size in GetImageSize().
| * | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| | | | | | | | | | | | | | | | | | | | Silences compiler warnings related to truncation. This also introduces a small helper function to perform the clamping of the image size.
| * | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / | | | | | | | | | Allows unindenting the other branch's code.
* | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ | | | | | | | | kernel/error: Amend error return code values
| * | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| | | | | | | | | | | | | | | | | | | | | | | | Now that we've gotten the innaccurate error codes out of the way, we can finally toss away a bunch of these, trimming down the error codes to ones that are actually used and knocking out two TODO comments.
| * | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| | | | | | | | | | | | | | | | This is more consistent with what the kernel does.
| * | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| | | |
| * | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| | | | | | | | | | | | | | | | This is what the kernel does in this instance.
| * | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| | | | | | | | | | | | | | | | These are now entirely unused and can be removed.
| * | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | Like with the previous change, the kernel doesn't return NOT_AUTHORIZED here. It returns INVALID_THREAD_PRIORITY.
| * | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | All priority checks are supposed to occur before checking the validity of the thread handle, we're also not supposed to return ERR_NOT_AUTHORIZED here.
| * | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | The kernel appears to return 0xE601 for this situation. Particularly in svcWaitSynchronization, svcReplyAndReceive, and svcGetThreadContext
| * | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / | | | | | | | | | The kernel appears to return 0xF601 for this case.
* | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-253-43/+48
|\ \ \ | | | | | | | | profile_manager: Use std::optional instead of boost::optional
| * | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-243-43/+48
| |/ / | | | | | | | | | | | | Now that we can actually use std::optional on macOS, we don't need to continue using boost::optional here.
* | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ | | | | | | | | npad: Remove unused controller variable from OnInit()
| * | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |/ | |/| | | | | | | | | | This also gets rid of variable shadowing related to the lambda parameter a little bit below this code as well.
* | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ | |_|/ |/| | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() function
| * | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ | | | | | | | | | | | | | | We can just call the function instead of duplicating the code here. This also prevents an unused function warning. We also don't need to take the lambda capture by reference. It's just a u64 value, so by value is fine here.
* | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-244-29/+226
|\ \ | |/ |/| qt: Add UI to manage emulated user profiles
| * profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-242-13/+37
| |
| * acc: Fix account UUID duplication errorZach Hilman2018-10-244-17/+47
| |
| * configure_system: Clear selection after user deleteZach Hilman2018-10-241-1/+1
| |
| * profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-244-26/+129
| |
| * acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| |
| * am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| |
| * profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| |
* | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ | |/ |/| Added break types to svcBreak
| * Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| |
| * Added break types to svcBreakDavid Marcec2018-10-231-4/+42
| | | | | | | | There seems to be more such as type 1, and 2. Unsure what these currently are but when a game hits them we can investigate and add the rest
* | Added Amiibo support (#1390)David2018-10-243-50/+294
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed conflict with nfp * Few fixups for nfc * Conflict 2 * Fixed AttachAvailabilityChangeEvent * Conflict 3 * Fixed byte padding * Refactored amiibo to not reside in "System" * Removed remaining references of nfc from system * used enum for Nfc GetStateOld * Added missing newline * Moved file operations to front end * Conflict 4 * Amiibos now use structs and added mutexes * Removed amiibo_path
* | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-241-1/+5
|\ \ | | | | | | patch_manager: Add support for LayeredFS on DLC RomFS
| * | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| | |
* | | Merge pull request #1540 from lioncash/handlebunnei2018-10-248-98/+95
|\ \ \ | |_|/ |/| | kernel/process: Make the handle table per-process
| * | kernel/process: Make the handle table per-processLioncash2018-10-208-98/+95
| | | | | | | | | | | | | | | | | | | | | | | | In the kernel, there isn't a singular handle table that everything gets tossed into or used, rather, each process gets its own handle table that it uses. This currently isn't an issue for us, since we only execute one process at the moment, but we may as well get this out of the way so it's not a headache later on.
* | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-223-0/+88
|\ \ \ | | | | | | | | psm: Add psm service and stub commands 0 and 1
| * | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed as connected to official Nintendo Switch dock.
| * | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| | | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed to return 100% charge.
| * | | service: Add skeleton for psm serviceZach Hilman2018-10-213-0/+72
| |/ / | | | | | | | | | Seems to be the power controller. Listed in switchbrew under the category PTM services.
* | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ | | | | | | | | svc: Fix vma boundary check in svcQueryMemory
| * | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / | | | | | | | | | | | | | | | This should be comparing against the queried process' vma_map, not the current process'. The only reason this hasn't become an issue yet is we currently only handle one process being active at any time.
* | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-213-2/+107
| | |
* | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-213-0/+42
| | | | | | | | | | | | Added based off information provided by Switchbrew.
* | | am: Update service function tablesLioncash2018-10-214-15/+60
| | | | | | | | | | | | Updated based off information from Switchbrew
* | | prepo: Update service function table.Lioncash2018-10-211-8/+13
| | | | | | | | | | | | | | | | | | Also introduces the new prepo:a2 service. Updated based off information provided by Switchbrew.
* | | lbl: Update service function table namesLioncash2018-10-211-28/+28
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
|/ / | | | | | | This is a subset of the better-hid-2 changes, this fixes input in various games which don't support dual joycons. This pr will search for the next best controller which is supported by the current game
* | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ | | | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemory
| * | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
| | | | | | | | | | | | | | | | | | | | | | | | Now that the changes clarifying the address spaces has been merged, we can wrap the checks that the kernel performs when mapping shared memory (and other forms of memory) into its own helper function and then use those within MapSharedMemory and UnmapSharedMemory to complete the sanitizing checks that are supposed to be done.
* | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ | | | | | | | | service: Update function tables
| * | | es: Update service function tablesLioncash2018-10-191-7/+11
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | audio: Update service function tablesLioncash2018-10-191-17/+20
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | omm: Update service function tablesLioncash2018-10-191-16/+18
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| | | | | | | | | | | | | | | | Updated based off information provided by switchbrew.
| * | | hid: Update service function tablesLioncash2018-10-191-6/+45
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| | | | | | | | | | | | | | | | Added based off information provided by Switchbrew
| * | | ns: Update service function tableLioncash2018-10-191-6/+49
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | set_cal: Update service function tableLioncash2018-10-191-1/+2
| | | | | | | | | | | | | | | | Updated based on information from Switchbrew.
* | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ | | | | | | | | | | aoc_u: Stub GetAddOnContentListChangedEvent
| * | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | | | | | | | | | | | | | | | | | | | This event signals the game when new DLC is purchased from the eShop while the game is running. Since, for the forseeable future, yuzu will not have this ability, it seems safe to stub with a dummy event that will never fire. This is needed to boot Sonic Mania Plus (update v1.04).
* | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \ | |/ / / / |/| | | | hid: Minor cleanup-related changes
| * | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | swap.h only needs to be present in the header for the type aliases and definitions, it's not actually needed in the cpp files though. input.h is just unused entirely in xpad.h
| * | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| | | | | | | | | | | | | | | | | | | | Given it's unused, we may as well toss it.
| * | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| | | | |
| * | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| | | | | | | | | | | | | | | | | | | | This is only useful in headers.
| * | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | This is just a lookup table, and since it's private, there's nothing really stateful about it, so we can just move it into the cpp file.
| * | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| | | | | | | | | | | | | | | | | | | | This literally does nothing.
| * | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These classes are non-trivial and are definitely going to be changed in the future, so we default these to prevent issues with forward declarations, and to keep the compiler from inlining tear-down code.
| * | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |/ / | |/| | | | | | | | | | The destructor doesn't need to be a pure-virtual function.
* | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / |/| | | | | | | | Needed by arms due to new hid rework
* | | Merge pull request #1523 from lioncash/lockbunnei2018-10-191-9/+15
|\ \ \ | | | | | | | | svc: Add missing error checks in svcArbitrateLock/svcArbitrateUnlock
| * | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| | | | | | | | | | | | | | | | | | | | The kernel itself checks whether or not the provided addresses are word aligned before continuing, so we should be doing the same.
| * | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-181-9/+7
| |/ / | | | | | | | | | | | | Aligning on 4KB pages isn't a Switch-specific thing, so this can be moved to common so it can be used with other things as well.
* / / Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
|/ / | | | | | | InitializeWithId needs to return an id which is a u32 which should be a non zero value
* | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1821-648/+1702
|\ \ | | | | | | "Better Hid" Rework Part 1
| * | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| | | | | | | | | | | | Reason for the change is to allow both docked and undocked mode to work
| * | WipDavid Marcec2018-10-122-3/+23
| | |
| * | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| | | | | | | | | | | | Kirby input still doesn't work, should fix a lot of other games
| * | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| | | | | | | | | | | | Used by Mario Party
| * | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| | | | | | | | | | | | HandheldVariant is for specific games which expect handheld controllers to be at position 8(kirby), however this doesn't fix all games as some games require handhelds to be at position 0(snipperclips)
| * | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| | |
| * | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| | | | | | | | | | | | Fixes arms
| * | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| | |
| * | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| | |
| * | "Better Hid" rework part 1David Marcec2018-10-1021-644/+1482
| | |
* | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \ | |_|/ |/| | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()
| * | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | So, one thing that's puzzled me is why the kernel seemed to *not* use the direct code address ranges in some cases for some service functions. For example, in svcMapMemory, the full address space width is compared against for validity, but for svcMapSharedMemory, it compares against 0xFFE00000, 0xFF8000000, and 0x7FF8000000 as upper bounds, and uses either 0x200000 or 0x8000000 as the lower-bounds as the beginning of the compared range. Coincidentally, these exact same values are also used in svcGetInfo, and also when initializing the user address space, so this is actually retrieving the ASLR extents, not the extents of the address space in general.
* | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
| | | | | | | | | | | | | | | | | | | | | | | | * Implement VI ConvertScalingMode * Fixed push enum * Scale mode now uses Nintendo scale mode as an enum as well
* | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-164-15/+15
|\ \ \ | | | | | | | | core: Convert shared_ptr instances into unique_ptr instances where applicable for System and Cpu
| * | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-154-15/+15
| | | |
* | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-163-12/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The data retrieved in these cases are ultimately chiefly owned by either the RegisteredCache instance itself, or the filesystem factories. Both these should live throughout the use of their contained data. If they don't, it should be considered an interface/design issue, and using shared_ptr instances here would mask that, as the data would always be prolonged after the main owner's lifetime ended. This makes the lifetime of the data explicit and makes it harder to accidentally create cyclic references. It also makes the interface slightly more flexible than the previous API, as a shared_ptr can be created from a unique_ptr, but not the other way around, so this allows for that use-case if it ever becomes necessary in some form.
* | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-161-3/+15
|\ \ \ \ | |/ / / |/| | | aoc: Fix various bugs in current AOC implementation
| * | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-151-2/+13
| | | | | | | | | | | | Falls back to title ID + 0x1000, which is what HOS does.
| * | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
| | | |
* | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-144-14/+13
|\ \ \ \ | |_|/ / |/| | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem by reference
| * | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-134-14/+13
| |/ / | | | | | | | | | | | | | | | | | | Neither of these functions alter the ownership of the provided pointer, so we can simply make the parameters a reference rather than a direct shared pointer alias. This way we also disallow passing incorrect memory values like nullptr.
* | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ | | | | | | | | svc: Implement svcGetProcessInfo
| * | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / | | | | | | | | | | | | | | | | | | A fairly basic service function, which only appears to currently support retrieving the process state. This also alters the ProcessStatus enum to contain all of the values that a kernel process seems to be able of reporting with regards to state.
* / / Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / | | | | | | This should help diagnose crashes easier and prevent many users thinking that a game is still running when in fact it's just an audio thread still running(this is typically not killed when svcBreak is hit since the game expects us to do this)
* | Merge pull request #1483 from lioncash/codesetbunnei2018-10-134-40/+14
|\ \ | | | | | | kernel/process: Make CodeSet a regular non-inherited object
| * | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-124-40/+14
| | | | | | | | | | | | | | | | | | | | | | | | These only exist to ferry data into a Process instance and end up going out of scope quite early. Because of this, we can just make it a plain struct for holding things and just std::move it into the relevant function. There's no need to make this inherit from the kernel's Object type.
* | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ | | | | | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemory
| * | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ /
* | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ | | | | | | | | Fixed incorrect types for svcBreak
| * | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| | | |
| * | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| | | | | | | | | | | | | | | | signal_debugger seems like a more fitting name
| * | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |/ | |/| | | | | | | svcBreak reason should be a u32, not a u64.
* | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ | | | | | | | | Passing an invalid nmap handle to Remap should throw an error
| * | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| | | |
| * | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | | | | | | | | | | | | | | | Added error for invalid nmap handles
* | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ | | | | | | | | | | thread: Remove unnecessary memset from ResetThreadContext()
| * | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ | |/| | | | | | | | | | | | | | | | | | Regular value initialization is adequate here for zeroing out data. It also has the benefit of not invoking undefined behavior if a non-trivial type is ever added to the struct for whatever reason.
* | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ | |/ / / |/| | | Added error codes for nvmap
| * | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| | | |
| * | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ /
* | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ | | | | | | | | HwOpus, Implemented DecodeInterleavedWithPerformance
| * | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / | | | | | | | | | Used by sonic ages
* | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ | | | | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemory
| * | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| |/ / | | | | | | | | | | | | | | | | | | | | | This adds the missing address range checking that the service functions do before attempting to map or unmap memory. Given that both service functions perform the same set of checks in the same order, we can wrap these into a function and just call it from both functions, which deduplicates a little bit of code.
* / / nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
|/ /
* / kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-106-29/+29
|/ | | | | | | | | | | There's no real need to use a shared pointer in these cases, and only makes object management more fragile in terms of how easy it would be to introduce cycles. Instead, just do the simple thing of using a regular pointer. Much of this is just a hold-over from citra anyways. It also doesn't make sense from a behavioral point of view for a process' thread to prolong the lifetime of the process itself (the process is supposed to own the thread, not the other way around).
* Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
|
* Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
|
* svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
| | | | When loading NROs, svcBreak is called to signal to the debugger that a new "module" is loaded. As no debugger is technically attached we shouldn't be killing the programs execution.
* Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ | | | | Fixed assertion due to CountAddOnContent & Casting warnings
| * Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | | | | | | | | | | | Word count should be 3 since we're pushing a result code and a u32. Also fixed up compiler warnings due to casting
* | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
|/ | | | Hardware tests show that trying to unmap an unmapped buffer already should always succeed. Hardware test was tested up to 32 iterations of attempting to unmap
* Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-072-0/+10
|\ | | | | loader: Add support for packed updates
| * romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-052-0/+10
| |
* | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| |
* | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
| | | | | | | | This will allow us to easily remove the use of "NFC" in "System"
* | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
| | | | | | | | | | | | | | | | | | This was the result of a typo accidentally introduced in e51d715700a35a8f14e5b804b6f7553c9a40888b. This restores the previous correct behavior. The behavior with the reference was incorrect and would cause some games to fail to boot.
* | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Conceptually, it doesn't make sense for a thread to be able to persist the lifetime of a scheduler. A scheduler should be taking care of the threads; the threads should not be taking care of the scheduler. If the threads outlive the scheduler (or we simply don't actually terminate/shutdown the threads), then it should be considered a bug that we need to fix. Attributing this to balika011, as they opened #1317 to attempt to fix this in a similar way, but my refactoring of the kernel code caused quite a few conflicts.
* | Merge pull request #1439 from lioncash/threadbunnei2018-10-0511-187/+363
|\ \ | |/ |/| kernel/thread: Make all instance variables private
| * kernel/thread: Make all instance variables privateLioncash2018-10-0411-187/+363
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of the member variables of the thread class aren't even used outside of the class itself, so there's no need to make those variables public. This change follows in the steps of the previous changes that made other kernel types' members private. The main motivation behind this is that the Thread class will likely change in the future as emulation becomes more accurate, and letting random bits of the emulator access data members of the Thread class directly makes it a pain to shuffle around and/or modify internals. Having all data members public like this also makes it difficult to reason about certain bits of behavior without first verifying what parts of the core actually use them. Everything being public also generally follows the tendency for changes to be introduced in completely different translation units that would otherwise be better introduced as an addition to the Thread class' public interface.
* | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ | | | | | | aoc_u: Fix edge case with DLC that causes breaks
| * | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| | | | | | | | | | | | In some games (Splatoon 2 and Splatoon 2 Splatfest World Premiere, notably), pass offset=0 and count=2047 into the ListAddOnContent method which should return all DLCs for the current title. The (presumably) intended behavior is to successfully return a empty array but because of a < v. <= in an if statement, a failure error code was returned causing these games to svcBreak. This fixes that if statement.
* | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \ | | | | | | | | services/fsp_srv: Amend service function table
| * | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| | |/ | |/| | | | | | | | | | Adds new functions that have been given names to the table. Information is based off what is provided on Switchbrew.
* | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| |/ |/| | | | | | | Amends the lbl service table to include new names of functions that were added to Switchbrew.
* | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-011-20/+26
| |
* | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-012-3/+5
| | | | | | Command #5
* | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
|/ | | | Commands #2, #3, and #7
* Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\ | | | | Implement ISystemDisplayService::GetDisplayMode
| * Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
| |
* | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
| | | | | | | | | | | | | | | | | | Now that we have all of the rearranging and proper structure sizes in place, it's fairly trivial to implement svcGetThreadContext(). In the 64-bit case we can more or less just write out the context as is, minus some minor value sanitizing. In the 32-bit case we'll need to clear out the registers that wouldn't normally be accessible from a 32-bit AArch32 exectuable (or process).
* | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
| | | | | | | | | | | | | | | | | | | | | | This will be necessary for the implementation of svcGetThreadContext(), as the kernel checks whether or not the process that owns the thread that has it context being retrieved is a 64-bit or 32-bit process. If the process is 32-bit, then the upper 15 general-purpose registers and upper 16 vector registers are cleared to zero (as AArch32 only has 15 GPRs and 16 128-bit vector registers. not 31 general-purpose registers and 32 128-bit vector registers like AArch64).
* | kernel/process: Make data member variables privateLioncash2018-09-307-55/+100
| | | | | | | | | | | | | | Makes the public interface consistent in terms of how accesses are done on a process object. It also makes it slightly nicer to reason about the logic of the process class, as we don't want to expose everything to external code.
* | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \ | | | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()
| * | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | boost::static_pointer_cast for boost::intrusive_ptr (what SharedPtr is), takes its parameter by const reference. Given that, it means that this std::move doesn't actually do anything other than obscure what the function's actual behavior is, so we can remove this. To clarify, this would only do something if the parameter was either taking its argument by value, by non-const ref, or by rvalue-reference.
* | | Merge pull request #1395 from lioncash/vmbunnei2018-09-297-53/+319
|\ \ \ | | | | | | | | process/vm_manager: Initial modifications to load NPDM metadata
| * | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-254-13/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The locations of these can actually vary depending on the address space layout, so we shouldn't be using these when determining where to map memory or be using them as offsets for calculations. This keeps all the memory ranges flexible and malleable based off of the virtual memory manager instance state.
| * | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | Previously, these were reporting hardcoded values, but given the regions can change depending on the requested address spaces, these need to report the values that the memory manager contains.
| * | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-252-5/+16
| | | | | | | | | | | | | | | | | | | | Given games can also request a 32-bit or 39-bit address space, we shouldn't be hardcoding the address space range as 36-bit.
| * | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-244-10/+248
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than hard-code the address range to be 36-bit, we can derive the parameters from supplied NPDM metadata if the supplied exectuable supports it. This is the bare minimum necessary for this to be possible. The following commits will rework the memory code further to adjust to this.
* | | | Merge pull request #1394 from lioncash/streambunnei2018-09-271-1/+1
|\ \ \ \ | |_|/ / |/| | | stream: Preserve enum class type in GetState()
| * | | stream: Preserve enum class type in GetState()Lioncash2018-09-241-1/+1
| |/ / | | | | | | | | | | | | | | | Preserves the meaning/type-safetiness of the stream state instead of making it an opaque u32. This makes it usable for other things outside of the service HLE context.
* | | Merge pull request #1399 from lioncash/schedbunnei2018-09-262-9/+9
|\ \ \ | | | | | | | | kernel/scheduler: Take ARM_Interface instances by reference
| * | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-252-9/+9
| | | | | | | | | | | | | | | | | | | | It doesn't make sense to allow a scheduler to be constructed around a null pointer.
* | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \ | | | | | | | | | | service: Add missing headers inclusions where applicable
| * | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
| | | | | | | | | | | | | | | | | | | | Gets rid of a few indirect inclusions.
* | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-252-1/+14
|\ \ \ \ \ | |/ / / / |/| | | | file_sys: Add support for LayeredFS mods
| * | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| | | | |
* | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \ | | | | | | | | | | | | svc: Updated svc names
| * | | | | svc: Updated svc namestech4me2018-09-241-7/+7
| | | | | |
* | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented fatal:u properly fatal:u now is properly implemented with all the ipc cmds. Error reports/Crash reports are also now implemented for fatal:u. Crash reports save to yuzu/logs/crash_reports/ The register dump is currently known as sysmodules send all zeros. If there are any non zero values for the "registers" or the unknown values, let me know! * Fatal:U fixups * Made fatal:u execution break more clear * Fatal fixups
* | | | | | Stubbed IRS (#1349)David2018-09-242-18/+167
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubbed IRS Currently we have no ideal way of implementing IRS. For the time being we should have the functions stubbed until we come up with a way to emulate IRS properly. * Added IRS to logging backend * Forward declared shared memory for irs
* | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | Corrected SSL::SetInterfaceVersion
| * | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | Should be a single u32
* | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-231-1/+8
| |_|_|/ / |/| | | |
* | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces the use of Process class members externally and keeps most code related to tearing down a process with the rest of the process code.
* | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| |_|/ / |/| | | | | | | | | | | | | | | | | | | Allows making several members of the process class private, it also avoids going through Core::CurrentProcess() just to retrieve the owning process.
* | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \ | | | | | | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()
| * | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The owning process of a thread is required to exist before the thread, so we can enforce this API-wise by using a reference. We can also avoid the reliance on the system instance by using that parameter to access the page table that needs to be set.
* | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-211-0/+1
|\ \ \ \ \ | | | | | | | | | | | | arm_interface: Replace kernel vm_manager include with a forward declaration
| * | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-211-0/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Avoids an unnecessary inclusion and also uncovers three places where indirect inclusions were relied upon, which allows us to also resolve those.
* | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \ | | | | | | | | | | | | Added IRequest::Submit
| * | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| | | | | |
| * | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
| |/ / / / | | | | | | | | | | | | | | | This fixes updated versions of SMO. Currently unable to test as I don't have an updated version
* / / / / Revert GetRequestStateDavid Marcec2018-09-211-1/+1
|/ / / / | | | | | | | | | | | | Even though setting this value to 3 is more correct. We break more games than we fix due to missing implementations. We should keep this as 0 for the time being
* | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
| | | |
* | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
| |/ / |/| | | | | | | | Needed because of the recent nim fixes
* | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Reworked incorrect nifm stubs Need confirmation on `CreateTemporaryNetworkProfile`, unsure which game uses it but according to reversing. It should return a uuid which we currently don't do. Any 0 client id is considered an invalid client id. GetRequestState 0 is considered invalid. * Fixups for nifm
* | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ | | | | | | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevision
| * | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ / | | | | | | | | | With these, `Nintendo Entertainment System - Nintendo Switch Online` loads
* | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
| | |
* | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / | | | | | | Due to keeping the code style consistent in the yuzu codebase. `rb = rp.MakeBuilder(...)` was replaced with `rb{ctx, ...}`
* | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ | | | | | | Implemented IProfile::GetImageSize
| * | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
| | |
* | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ | | | | | | | | Implemented GetDefaultDisplayResolution
| * | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| |/ /
* | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \ | | | | | | | | svc_wrap: Convert the PARAM macro into a function
| * | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ / | | | | | | | | | | | | | | | This can just be a regular function, getting rid of the need to also explicitly undef the define at the end of the file. Given FuncReturn() was already converted into a function, it's #undef can also be removed.
* | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ | | | | | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensor
| * | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| | | |
| * | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| | | |
| * | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| |/ /
* | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fix bug where default username value for yuzu_cmd create an userprofile with uninitialize data as username * Fix format * Apply code review changes * Remove nullptr check
* | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \ | | | | | | | | kernel/svc: Handle invalid address cases within svcArbitrateLock() and svcArbitrateUnlock()
| * | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | We already have a ResultCode constant for the case of an invalid address, so we can just use it instead of re-rolling that ResultCode type.
| * | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel does the equivalent of the following check before proceeding: if (address + 0x8000000000 < 0x7FFFE00000) { return ERR_INVALID_MEMORY_STATE; } which is essentially what our IsKernelVirtualAddress() function does. So we should also be checking for this. The kernel also checks if the given input addresses are 4-byte aligned, however our Mutex::TryAcquire() and Mutex::Release() functions already handle this, so we don't need to add code for this case.
* / / arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-181-2/+2
|/ / | | | | | | | | | | | | | | | | This modifies the CPU interface to more accurately match an AArch64-supporting CPU as opposed to an ARM11 one. Two of the methods don't even make sense to keep around for this interface, as Adv Simd is used, rather than the VFP in the primary execution state. This is essentially a modernization change that should have occurred from the get-go.
* | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ | | | | | | service/vi: Replace includes with forward declarations where applicable
| * | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
| | |
* | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \ | | | | | | | | kernel/errors: Amend error code for ERR_NOT_FOUND
| * | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ / | | | | | | | | | | | | This is the value returned by the kernel for svcConnectToNamedPort() if the named port cannot be found.
* | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ | | | | | | | | services/sm: Amend error code constants
| * | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / | | | | | | | | | | | | | | | | | | | | | Courtesy of @ogniK5377. This also moves them into the cpp file and limits the visibility to where they're directly used. It also gets rid of unused or duplicate error codes.
* | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \ | | | | | | | | kernel/svc: Handle a few error cases within memory-related functions
| * | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel caps the size limit of shared memory to 8589930496 bytes (or (1GB - 512 bytes) * 8), so approximately 8GB, where every GB has a 512 byte sector taken off of it. It also ensures the shared memory is created with either read or read/write permissions for both permission types passed in, allowing the remote permissions to also be set as "don't care".
| * | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Part of the checking done by the kernel is to check if the given address and size are 4KB aligned, as well as checking if the size isn't zero. It also only allows mapping shared memory as readable or read/write, but nothing else, and so we shouldn't allow mapping as anything else either.
| * | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| | | | | | | | | | | | | | | | | | | | The kernel checks if the addresses and given size is 4KB aligned before continuing onwards to map the memory.
| * | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ / | | | | | | | | | | | | The kernel checks if the given size is a multiple of 2MB and <= to 4GB before going ahead and attempting to allocate that much memory.
* | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \ | | | | | | | | Port #4192 from Citra: "svc: change unknown to thread in CreateThread"
| * | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |/ | |/|
* / | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1531-119/+125
|/ /
* | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-142-7/+7
|\ \ | | | | | | kernel/thread: Include thread-related enums within the kernel namespace
| * | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-132-7/+7
| |/ | | | | | | | | | | Previously, these were sitting outside of the Kernel namespace, which doesn't really make sense, given they're related to the Thread class which is within the Kernel namespace.
* | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ | | | | | | service: Use nested namespace specifiers where applicable
| * | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ | | | | | | | | | | There were a few places where nested namespace specifiers weren't being used where they could be within the service code. This amends that to make the namespacing a tiny bit more compact.
* | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ | |/ |/| services/pl_u: Add missing Korean font to the fallback case for shared fonts
| * services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
| | | | | | | | Previously this wasn't using the Korean font at all.
* | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/
* Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ | | | | pl_u: Eliminate mutable file-scope state
| * pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | | | | | | | | | Converts the PL_U internals to use the PImpl idiom and makes the state part of the Impl struct, eliminating mutable global/file state.
* | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ | | | | | | kernel/errors: Amend invalid thread priority and invalid processor ID error codes
| * | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| | | | | | | | | | | | This is what the kernel does for an out-of-range processor ID.
| * | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
| | |
* | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
| | | | | | | | | | | | | | | | | | While unlikely, it does avoid constructing a std::string and unnecessarily calling into the memory code if a game or executable decides to be really silly about their logging.
* | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
|/ / | | | | | | This should be a u64 to represent size.
* | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ | | | | | | service/prepo: Move class into the cpp file
| * | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ | | | | | | | | | | This doesn't need to be exposed within the header and be kept in the translation unit, eliminating the need to include anything within the header.
* / service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
|/ | | | | A few headers were including other headers when a forward declaration can be used instead, allowing the include to be moved to the cpp file.
* Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ | | | | hle/service: Default constructors and destructors in the cpp file where applicable
| * hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a destructor isn't defaulted into a cpp file, it can cause the use of forward declarations to seemingly fail to compile for non-obvious reasons. It also allows inlining of the construction/destruction logic all over the place where a constructor or destructor is invoked, which can lead to code bloat. This isn't so much a worry here, given the services won't be created and destroyed frequently. The cause of the above mentioned non-obvious errors can be demonstrated as follows: ------- Demonstrative example, if you know how the described error happens, skip forwards ------- Assume we have the following in the header, which we'll call "thing.h": \#include <memory> // Forward declaration. For example purposes, assume the definition // of Object is in some header named "object.h" class Object; class Thing { public: // assume no constructors or destructors are specified here, // or the constructors/destructors are defined as: // // Thing() = default; // ~Thing() = default; // // ... Some interface member functions would be defined here private: std::shared_ptr<Object> obj; }; If this header is included in a cpp file, (which we'll call "main.cpp"), this will result in a compilation error, because even though no destructor is specified, the destructor will still need to be generated by the compiler because std::shared_ptr's destructor is *not* trivial (in other words, it does something other than nothing), as std::shared_ptr's destructor needs to do two things: 1. Decrement the shared reference count of the object being pointed to, and if the reference count decrements to zero, 2. Free the Object instance's memory (aka deallocate the memory it's pointing to). And so the compiler generates the code for the destructor doing this inside main.cpp. Now, keep in mind, the Object forward declaration is not a complete type. All it does is tell the compiler "a type named Object exists" and allows us to use the name in certain situations to avoid a header dependency. So the compiler needs to generate destruction code for Object, but the compiler doesn't know *how* to destruct it. A forward declaration doesn't tell the compiler anything about Object's constructor or destructor. So, the compiler will issue an error in this case because it's undefined behavior to try and deallocate (or construct) an incomplete type and std::shared_ptr and std::unique_ptr make sure this isn't the case internally. Now, if we had defaulted the destructor in "thing.cpp", where we also include "object.h", this would never be an issue, as the destructor would only have its code generated in one place, and it would be in a place where the full class definition of Object would be visible to the compiler. ---------------------- End example ---------------------------- Given these service classes are more than certainly going to change in the future, this defaults the constructors and destructors into the relevant cpp files to make the construction and destruction of all of the services consistent and unlikely to run into cases where forward declarations are indirectly causing compilation errors. It also has the plus of avoiding the need to rebuild several services if destruction logic changes, since it would only be necessary to recompile the single cpp file.
* | externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/ | | | | | | | | | | | | | | This places the font data within cpp files, which mitigates the possibility of the font data being duplicated within the binary if it's referred to in more than one translation unit in the future. It also stores the data within a std::array, which is more flexible when it comes to operating with the standard library. Furthermore, it makes the data arrays const. This is what we want, as it allows the compiler to store the data within the read-only segment. As it is, having several large sections of mutable data like this just leaves spots in memory that we can accidentally write to (via accidental overruns, what have you) and actually have it work. This ensures the font data remains the same no matter what.
* Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-111-1/+25
| | | | | | * Add open-source shared fonts * Address review comments
* video_core: Move command buffer loop.Markus Wick2018-09-102-31/+12
| | | | This moves the hot loop into video_core. This refactoring shall reduce the CPU overhead of calling ProcessCommandList.
* Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-101-4/+4
|\ | | | | hid: Implement ReloadInputDevices
| * hid: Implement ReloadInputDevicesfearlessTobi2018-09-091-4/+4
| |
* | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
|/ | | | | With the named port functionality all migrated over to the kernel, there's no need to keep this around anymore.
* core: Migrate current_process pointer to the kernelLioncash2018-09-072-0/+23
| | | | | | | | | | Given we now have the kernel as a class, it doesn't make sense to keep the current process pointer within the System class, as processes are related to the kernel. This also gets rid of a subtle case where memory wouldn't be freed on core shutdown, as the current_process pointer would never be reset, causing the pointed to contents to continue to live.
* core/core: Remove unnecessary sm/controller includeLioncash2018-09-064-1/+5
| | | | | | | | | | The only reason this include was necessary, was because the constructor wasn't defaulted in the cpp file and the compiler would inline it wherever it was used. However, given Controller is forward declared, all those inlined constructors would see an incomplete type, causing a compilation failure. So, we just place the constructor in the cpp file, where it can see the complete type definition, allowing us to remove this include.
* bktr: Fix bucket overlap errorZach Hilman2018-09-041-1/+1
|
* registration: Add RegisteredCacheUnionZach Hilman2018-09-042-0/+10
| | | | Aggregates multiple caches into one interface
* Merge pull request #1235 from lioncash/forward-declbunnei2018-09-041-1/+3
|\ | | | | file_sys: Replace includes with forward declarations where applicable
| * file_sys: Replace includes with forward declarations where applicableLioncash2018-09-041-1/+3
| | | | | | | | | | Cuts down on include dependencies, resulting in less files that need to be rebuilt when certain things are changed.
* | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ | |/ |/| ssl: Move SSL class to cpp file
| * ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
| | | | | | | | | | | | This isn't required to be visible to anything outside of the main source file, and will eliminate needing to rebuild anything else including the header if the SSL class needs to be changed in the future.
* | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | | | | | | | | | | | Now that we have a class representing the kernel in some capacity, we now have a place to put the named port map, so we move it over and get rid of another piece of global state within the core.
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-022-2/+30
|\ \ | | | | | | filesystem/maxwell_3d: Various changes to boot Project Octopath Traveller
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| | |
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/ | | | | We don't need to do the lookup if the path is considered empty currently.
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-316-4/+13
| | | | | | | | | | | The follow-up to e2457418dae19b889b2ad85255bb95d4cd0e4bff, which replaces most of the includes in the core header with forward declarations. This makes it so that if any of the headers the core header was previously including change, then no one will need to rebuild the bulk of the core, due to core.h being quite a prevalent inclusion. This should make turnaround for changes much faster for developers.
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-311-0/+1
|
* core: Make the main System class use the PImpl idiomLioncash2018-08-312-2/+4
| | | | | | | | | | | | | core.h is kind of a massive header in terms what it includes within itself. It includes VFS utilities, kernel headers, file_sys header, ARM-related headers, etc. This means that changing anything in the headers included by core.h essentially requires you to rebuild almost all of core. Instead, we can modify the System class to use the PImpl idiom, which allows us to move all of those headers to the cpp file and forward declare the bulk of the types that would otherwise be included, reducing compile times. This change specifically only performs the PImpl portion.
* kernel: Eliminate kernel global stateLioncash2018-08-2945-429/+629
| | | | | | | | | | | | | | | | | | | | | | As means to pave the way for getting rid of global state within core, This eliminates kernel global state by removing all globals. Instead this introduces a KernelCore class which acts as a kernel instance. This instance lives in the System class, which keeps its lifetime contained to the lifetime of the System class. This also forces the kernel types to actually interact with the main kernel instance itself instead of having transient kernel state placed all over several translation units, keeping everything together. It also has a nice consequence of making dependencies much more explicit. This also makes our initialization a tad bit more correct. Previously we were creating a kernel process before the actual kernel was initialized, which doesn't really make much sense. The KernelCore class itself follows the PImpl idiom, which allows keeping all the implementation details sealed away from everything else, which forces the use of the exposed API and allows us to avoid any unnecessary inclusions within the main kernel header.
* Merge pull request #1193 from lioncash/privbunnei2018-08-281-6/+6
|\ | | | | gpu: Make memory_manager private
| * gpu: Make memory_manager privateLioncash2018-08-281-6/+6
| | | | | | | | | | | | | | | | | | | | Makes the class interface consistent and provides accessors for obtaining a reference to the memory manager instance. Given we also return references, this makes our more flimsy uses of const apparent, given const doesn't propagate through pointers in the way one would typically expect. This makes our mutable state more apparent in some places.
* | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
|/ | | | | | | | | | | | | | | | | | | | | | | Many containers within the standard library provide different behaviors based on whether or not a move constructor/assignment operator can be guaranteed not to throw or not. Notably, implementations will generally use std::move_if_noexcept (or an internal implementation of it) to provide strong exception guarantees. If a move constructor potentially throws (in other words, is not noexcept), then certain behaviors will create copies, rather than moving the values. For example, consider std::vector. When a std::vector calls resize(), there are two ways the elements can be relocated to the new block of memory (if a reallocation happens), by copy, or by moving the existing elements into the new block of memory. If a type does not have a guarantee that it will not throw in the move constructor, a copy will happen. However, if it can be guaranteed that the move constructor won't throw, then the elements will be moved. This just allows ResultVal to be moved instead of copied all the time if ever used in conjunction with containers for whatever reason.
* Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\ | | | | kernel/error: Amend several error codes
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| | | | | | | | | | | | We can make this error code an alias of the resource limit exceeded error code, allowing us to get rid of the lingering 3DS error code of the same type.
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| | | | | | | | | | We can treat this as an alias of TooLarge for documentation purposes. This also lets us get rid of another lingering 3DS-related error code.
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| | | | | | | | | | This replaces the lingering 3DS constant with the proper one, and utilizes it within HandleTable's Create() member function.
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| |
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
| |
* | Merge pull request #1175 from lioncash/nsbunnei2018-08-284-6/+8
|\ \ | | | | | | core: Namespace all code in the arm subdirectory under the Core namespace
| * | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-254-6/+8
| | | | | | | | | | | | Gets all of these types and interfaces out of the global namespace.
* | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \ | | | | | | | | svc: Return process title ID if queried in GetInfo()
| * | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | We already have the variable itself set up to perform this task, so we can just return its value from the currently executing process instead of always stubbing it to zero.
* | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \ | | | | | | | | | | PL:U Added SharedFonts loading via TTF
| * | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| | | | |
| * | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | By having the following TTF files in your yuzu sysdata directory. You can load sharedfonts via TTF files. FontStandard.ttf FontChineseSimplified.ttf FontExtendedChineseSimplified.ttf FontChineseTraditional.ttf FontKorean.ttf FontNintendoExtended.ttf FontNintendoExtended2.ttf
* | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \ | | | | | | | | | | | | hid: Move core include to cpp file
| * | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | This isn't required to be in the header. Instead, directly include what this header needs and move it to the cpp file where it belongs.
* | | | | set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
| |_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rightnow, in games use GetAvailableLanguageCodes(), there is a WriteBuffer() with size larger than the buffer_size. (Core Critical core\hle\kernel\hle_ipc.cpp:WriteBuffer:296: size (0000000000000088) is greater than buffer_size (0000000000000078)) 0x88 = 17(languages) * 8 0x78 = 15(languages) * 8 GetAvailableLanguageCodes() can only support 15 languages. After firmware 4.0.0 there are 17 supported language instead of 15, to enable this GetAvailableLanguageCodes2() need to be used. So GetAvailableLanguageCodes() will be caped at 15 languages. Reference: http://switchbrew.org/index.php/Settings_services
* | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ | |_|_|/ |/| | | filesystem: Fix typo in log message
| * | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ /
* | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-252-12/+36
|\ \ \ | |/ / |/| | file_sys: Add support for NAX archives
| * | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-232-8/+11
| | | | | | | | | | | | Allows frontend to create registration caches for use before a game has booted.
| * | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| |/
* / Added GetBootMode (#1107)David2018-08-244-3/+25
|/ | | | | | | | * Added GetBootMode Used by homebrew * Added enum for GetBootMode
* Added missing include for pl:uDavid Marcec2018-08-221-0/+1
| | | | Should fix any compile errors
* PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
| | | | | | | | | | | | * Added bfttf loading We can now load system bfttf fonts from system archives AND shared memory dumps. This allows people who have installed their system nand dumps to yuzu to automatically get shared font support. We also now don't hard code the offsets or the sizes of the shared fonts and it's all calculated for us now. * Addressed plu fixups * Style changes for plu * Fixed logic error for plu and added more error checks.
* Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-223-2/+3
|\ | | | | vfs: Replace mode.h include with forward declarations where applicable
| * vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-213-2/+3
| | | | | | | | | | Avoids the need to rebuild these source files if the mode header changes.
* | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
|/ | | | | | Gets rid of the potential for C array-to-pointer decay, and also makes pointer arithmetic to get the end of the copy range unnecessary. We can just use std::array's begin() and end() member functions.
* Merge pull request #1129 from lioncash/headerbunnei2018-08-213-5/+19
|\ | | | | romfs_factory, service/filesystem: Use forward declarations where applicable
| * service/filesystem: Use forward declarations where applicableLioncash2018-08-213-5/+19
| | | | | | | | | | | | | | | | Avoids the need to rebuild multiple source files if the filesystem code headers change. This also gets rid of a few instances of indirect inclusions being relied upon
* | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ | |/ |/| acc/profile_manager: General cleanup
| * acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| | | | | | | | This is only used in a shared_ptr, so we can forward declare it.
| * acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| | | | | | | | | | | | We have an overload of WriteBuffer that accepts containers that satisfy the ContiguousContainer concept, which std::array does, so we only need to pass in the array itself.
| * acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| | | | | | | | Arranges them in the order the members would be initialized
| * acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| | | | | | | | This is no longer used, so it can be removed.
| * profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| | | | | | | | Makes it a little bit more self-documenting.
| * profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| | | | | | | | | | Given the source and destination types are the same std::array type, we can simply use regular assignment to perform the same behavior.
| * profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| | | | | | | | | | Avoids the need to repeatedly specify the whole array type in multiple places.
| * profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| | | | | | | | | | | | ProfileInfo is quite a large struct in terms of data, and we don't need to perform a copy in these instances, so we can just pass constant references instead.
| * profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| | | | | | | | | | This doesn't modify the passed in array, so this can be a const reference.
| * profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| | | | | | | | This can just be constexpr like the others
| * profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| | | | | | | | | | | | We can use the constructor initializer list and just compare the contained u128's together instead of comparing each element individually. Ditto for comparing against an invalid UUID.
| * profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| | | | | | | | | | This avoids needing to dump the contents of <random> into other files that include the profile manager header.
| * profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | | | | | | | | | | | Moving a const reference isn't possible, so this just results in a copy (and given ProfileInfo is composed of trivial types and aggregates, a move wouldn't really do anything).
* | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-214-16/+50
|\ \ | |/ |/| filesystem: Add support for loading of system archives
| * filesystem: Add support for loading of system archivesZach Hilman2018-08-194-16/+50
| |
* | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ | | | | | | Added CheckFreeCommunicationPermission
| * | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| |/ | | | | | | This fixes save files not loading in splatoon 2
* | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2012-74/+438
|\ \ | |/ |/| New account backend to allow for future extended support
| * Better UUID randomnessDavid Marcec2018-08-111-2/+7
| |
| * Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| |
| * Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| |
| * Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| |
| * Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| |
| * fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| |
| * Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| |
| * Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| |
| * Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| |
| * If statement style changeDavid Marcec2018-08-111-11/+19
| |
| * Second round of account changesDavid Marcec2018-08-113-18/+21
| |
| * First round of account changesDavid Marcec2018-08-113-49/+55
| |
| * Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| |
| * Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1117-36/+78
| |\
| * | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| | |
| * | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| | |
| * | Open first user addedDavid Marcec2018-08-081-1/+3
| | |
| * | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| | | | | | | | | | | | This commit verified working on puyo
| * | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| | |
| * | began initial implementation of "ProfileManager"David Marcec2018-08-084-44/+200
| | |
| * | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
| | |
* | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
| | | | | | | | | * Used by Mario Tennis Aces
* | | correct coding stylegreggameplayer2018-08-161-1/+1
| | |
* | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
| | | | | | | | | | | | Require by Toki Tori and Toki Tori 2+
* | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-162-4/+23
|\ \ \ | | | | | | | | file_sys: Add support for registration format
| * | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| | | |
* | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ | | | | | | | | | | lm: Handle threads and modules within the logger
| * | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using LOG_TRACE here isn't a good idea because LOG_TRACE is only enabled when yuzu is compiled in debug mode. Debug mode is also quite slow, and so we're potentially throwing away logging messages that can provide value when trying to boot games.
| * | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The thread field serves to indicate which thread a log is related to and provides the length of the thread's name, so we can print that out, ditto for modules. Now we can know what threads are potentially spawning off logging messages (for example Lydie & Suelle bounces between MainThread and LoadingThread when initializing the game).
* | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-161-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafe
| * | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-131-1/+1
| | | | | |
* | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSize
| * | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | This should be returning a u16 according to Switch Brew.
* / | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | Allows querying the inverse of IsDomain() to make things more readable. This will likely also be usable in the event of implementing ConvertDomainToSession().
* | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ | | | | | | | | | | | | kernel/svc: Log svcBreak parameters
| * | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given if we hit here all is lost, we should probably be logging the break reason code and associated information to distinguish between the causes.
* | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ | |/ / / / / |/| | | | | mm_u: Move interface class into the cpp file
| * | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures both variants go through the same interface, and while we're at it, add Finalize to provide the inverse of Initialize for consistency.
| * | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
| |/ / / / | | | | | | | | | | | | | | | | | | | | Now if changes are ever made to the behavior of the class, it doesn't involve rebuilding everything that includes the mm_u header.
* | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ | | | | | | | | | | | | audout_u: Correct IAudioOut initializer list order
| * | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / | | | | | | | | | | | | | | | Orders elements in the precise order they'll be initialized.
* | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-145-0/+144
|\ \ \ \ \ | |/ / / / |/| | | | Added missing channel devices
| * | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| | | | |
| * | | | Added missing channel devicesDavid Marcec2018-08-134-0/+140
| | | | |
* | | | | kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Despite being covered by a global mutex, we should still ensure that the class handles its reference counts properly. This avoids potential shenanigans when it comes to data races. Given this is the root object that drives quite a bit of the kernel object hierarchy, ensuring we always have the correct behavior (and no races) is a good thing.
* | | | Merge pull request #1043 from Subv/timingbunnei2018-08-131-1/+0
|\ \ \ \ | | | | | | | | | | Use an approximated amortized amount of ticks when advancing timing.
| * | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
| | | | | | | | | | | | | | | | | | | | The current core may have nothing to do with the core where the new thread was scheduled to run. In case it's the same core, then the following PrepareReshedule call will take care of that.
* | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-132-2/+2
|\ \ \ \ \ | | | | | | | | | | | | scheduler: Make HaveReadyThreads() a const member function
| * | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | This function doesn't modify instance state, so the const qualifier can be added to it.
* | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-131-2/+9
|\ \ \ \ \ | | | | | | | | | | | | Fixed a bunch of race conditions when running in multicore mode.
| * | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of a reschedule, thus altering the state of the schedulers.
| * | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-131-2/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | WakeAfterDelay might be called from any host thread, so err on the side of caution and use the thread-safe CoreTiming::ScheduleEventThreadsafe. Note that CoreTiming is still far from thread-safe, there may be more things we have to work on for it to be up to par with what we want.
* | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \ | | | | | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.
| * | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Exit from AddMutexWaiter early if the thread is already waiting for a mutex owned by the owner thread. This accounts for the possibility of a thread that is waiting on a condition variable being awakened twice in a row. Also added more validation asserts. This should fix one of the random crashes in Breath Of The Wild.
* | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | struct should be used when the data type is very simple or otherwise has no invariants associated with it. Given these are used to form a hierarchy, class should be used instead.
* | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \ | | | | | | | | | | | | GetAudioDeviceServiceWithRevisionInfo (Used by Bloodstained: Curse of the Moon)
| * | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| |/ / / / | | | | | | | | | | | | | | | As we're not handling any anything about the revision data for GetAudioDeviceServiceWithRevisionInfo, it's currently marked as stubbed. However for games this shouldn't affect the result. Proper revision info would be more for homebrew.
* | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-121-5/+26
|\ \ \ \ \ | | | | | | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCount
| * | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-121-4/+2
| | | | | |
| * | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-121-5/+28
| | |/ / / | |/| | | | | | | | | | | | | GetAudioRendererSampleRate is set as a "STUB" as a game could check if the sample rate it sent and the sample rate it wants don't match. Just a thought of something which could happen so keeping it as stub for the mean time
* | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
| | | | | | | | | | | | | | | | | | | | Prevents clang-format from butchering them.
* | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| |/ / / |/| | | | | | | | | | | This is required by ARMS.
* | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
|/ / / | | | | | | | | | Needed for Retro City Rampage to go in game
* | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| | | | | | | | | | | | - Used by Splatoon 2.
* | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| | |
* | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
| | |
* | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-111-0/+1
| |/ |/| | | | | | | | | | | | | | | Instead, we make a struct for renderer settings and allow the renderer to update all of these settings, getting rid of the need for global-scoped variables. This also uncovered a few indirect inclusions for certain headers, which this commit also fixes.
* | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \ | | | | | | core: Make function reference parameters const where applicable
| * | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This is simply copied by value, so there's no need to make it a modifiable reference. While we're at it, make the names of the parameters match its definition.
| * | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | This function doesn't modify anything within the reference Thread instance.
* | | Merge pull request #990 from lioncash/entrybunnei2018-08-101-6/+3
|\ \ \ | | | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing last
| * | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-091-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | Given elements inserted into a vector are zeroed out, we can just copy MAX_LEN - 1 elements and the data will already be properly null terminated.
| * | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current way were doing it would require copying a 768 character buffer (part of the Entry struct) to the new element in the vector. Given it's a plain array, std::move won't eliminate that. Instead, we can emplace an instance directly into the destination buffer and then fill it out, avoiding the need to perform any unnecessary copies. Given this is done in a loop, we can request the destination to allocate all of the necessary memory ahead of time, avoiding the need to potentially keep reallocating over and over on every few insertions into the vector.
* | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-104-12/+17
|\ \ \ \ | |_|/ / |/| | | vfs: Add VfsFilesystem and fix RealVfs* implementations
| * | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-094-11/+16
| | | |
| * | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
| | | |
* | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ | |/ / / |/| | | Service/Account: stub LoadImage function
| * | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |/ | |/|
* | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ | | | | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.
| * | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| | | |
* | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ | |_|_|/ |/| | | am: Stub SetScreenShotImageOrientation.
| * | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / | | | | | | | | | - Used by Super Mario Odyssey.
* | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ | |_|/ |/| | nvdrv: Get rid of global std::weak_ptr
| * | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| |/ | | | | | | | | Rather than use global state, we can simply pass the instance into the NVFlinger instance directly.
* | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-082-124/+0
|\ \ | | | | | | hle: Remove unused romfs.cpp/.h
| * | hle: Remove unused romfs.cpp/.hLioncash2018-08-082-124/+0
| |/ | | | | | | These files are no longer used, so we can get rid of them.
* | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ | | | | | | acc: Add missing function table entries for GetUserCount
| * | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
| | | | | | | | | | | | | | | Given this is stubbed within the common module in 5ac7b84, it should be added to the other relevant tables as well.
* | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ /
* / acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
|/ | | - Used by Pokken Tournament DX.
* Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ | | | | nvflinger: Correct typo in name of composition event
| * nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| |
* | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info array
| * | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ | | | | | | Updated based off the information on Switch Brew.
* | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ | | | | | | service/apm: Add the apm:sys service
| * | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ | | | | | | | | Adds the basic skeleton of the apm:sys service based off the information on Switch Brew.
* | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ | | | | | | nvflinger: Use std::string_view in OpenDisplay()
| * | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| | |
| * | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/ | | | | | | | | | | We don't need to use a std::string here, given all that's done is comparing the character sequence against another. This allows passing regular const char* without needing to heap allocate.
* | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()
| * | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ | | | | | | Updates the ID of these based off the information on Switch Brew.
* | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ | | | | | | nvdrv: Get rid of indirect inclusions
| * | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| | | | | | | | | | | | | | | The only reason this wasn't a compilation error is because we use little-endian systems.
| * | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/
* | Merge pull request #952 from lioncash/usbbunnei2018-08-073-0/+255
|\ \ | | | | | | service: Add usb services
| * | service: Add usb servicesLioncash2018-08-073-0/+255
| |/ | | | | | | Adds basic skeleton for the usb services based off the information provided by Switch Brew.
* / client_port: Make all data members privateLioncash2018-08-073-7/+21
|/ | | | | | | | These members don't need to be entirely exposed, we can instead expose an API to operate on them without directly needing to mutate them We can also guard against overflow/API misuse this way as well, given active_sessions is an unsigned value.
* kernel/event: Make data members privateLioncash2018-08-061-4/+8
| | | | | Instead we can simply provide accessors to the required data instead of giving external read/write access to the variables directly.
* Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
|
* Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()
| * address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| | | | | | | | | | In all cases the vector being supplied is empty, so we can just return by value in these instances.
* | Merge pull request #925 from bunnei/audrenbunnei2018-08-064-233/+16
|\ \ | | | | | | Implement audren audio output
| * | audio_core: Implement audren_u audio playback.bunnei2018-08-052-218/+9
| | |
| * | audio_core: Use s16 where possible for audio samples.bunnei2018-08-051-3/+3
| | |
| * | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-052-11/+3
| | |
| * | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-041-1/+1
| | |
* | | Merge pull request #912 from lioncash/global-varbunnei2018-08-053-10/+13
|\ \ \ | |_|/ |/| | video_core: Eliminate the g_renderer global variable
| * | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-041-2/+2
| | | | | | | | | | | | | | | | | | | | | All calling code assumes that the rasterizer will be in a valid state, which is a totally fine assumption. The only way the rasterizer wouldn't be is if initialization is done incorrectly or fails, which is checked against in System::Init().
| * | video_core: Eliminate the g_renderer global variableLioncash2018-08-043-10/+13
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | We move the initialization of the renderer to the core class, while keeping the creation of it and any other specifics in video_core. This way we can ensure that the renderer is initialized and doesn't give unfettered access to the renderer. This also makes dependencies on types more explicit. For example, the GPU class doesn't need to depend on the existence of a renderer, it only needs to care about whether or not it has a rasterizer, but since it was accessing the global variable, it was also making the renderer a part of its dependency chain. By adjusting the interface, we can get rid of this dependency.
* | Merge pull request #924 from lioncash/arpbunnei2018-08-053-0/+93
|\ \ | | | | | | service: Add arp services
| * | service: Add arp servicesLioncash2018-08-053-0/+93
| |/ | | | | | | | | Adds the basic skeleton of the arp services based off the information provided by Switch Brew.
* / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ | | | | These don't do anything within .cpp files (we don't include cpp files, so...)
* Merge pull request #914 from lioncash/codesetbunnei2018-08-042-15/+36
|\ | | | | kernel/process: Use accessors instead of class members for referencing segment array
| * kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| |
| * kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-032-15/+35
| | | | | | | | | | | | | | Using member variables for referencing the segments array increases the size of the class in memory for little benefit. The same behavior can be achieved through the use of accessors that just return the relevant segment.
* | kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
|/ | | | | | This amends cases where crashes can occur that were missed due to the odd way the previous code was set up (using 3DS memory regions that don't exist).
* Merge pull request #908 from lioncash/memorybunnei2018-08-039-302/+24
|\ | | | | core/memory: Get rid of 3DS leftovers
| * core/memory: Get rid of 3DS leftoversLioncash2018-08-039-302/+24
| | | | | | | | Removes leftover code from citra that isn't needed.
* | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-034-5/+45
| |
* | Merge pull request #898 from lioncash/migbunnei2018-08-033-0/+51
|\ \ | |/ |/| service: Add migration services
| * service: Add migration servicesLioncash2018-08-023-0/+51
| | | | | | | | | | Adds the basic skeleton for the mig:usr service based off information provided by Switch Brew.
* | Merge pull request #894 from lioncash/objectbunnei2018-08-0333-146/+177
|\ \ | | | | | | kernel: Move object class to its own source files
| * | kernel: Move object class to its own source filesLioncash2018-08-0233-146/+177
| |/ | | | | | | | | | | General moving to keep kernel object types separate from the direct kernel code. Also essentially a preliminary cleanup before eliminating global kernel state in the kernel code.
* | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ | | | | | | kernel/thread: Minor changes
| * | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| | | | | | | | | | | | | | | | | | Avoids using a u32 to compare against a range of size_t, which can be a source of warnings. While we're at it, compress a std::tie into a structured binding.
| * | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| | | | | | | | | | | | | | | This function only reads the data being referenced, it doesn't modify it, so we can turn the reference into a const reference.
| * | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| |/ | | | | | | | | This function isn't used outside of this translation unit, so we can make it internally linked.
* | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ | | | | | | kernel/vm_manager: Minor changes
| * | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| | |
| * | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| | | | | | | | | | | | Makes our immutable state explicit.
| * | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ | | | | | | These two variables correspond to address ranges.
* | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ | | | | | | service/ns: Add missing ns services
| * | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | | | | | | | | | | | | | | | | | Implements the basic skeleton of ns:am2, ns:ec, ns:rid, ns:rt, ns:su, ns:vm, and ns:web based off the information provided by Switch Brew and SwIPC.
* | | service: Add psc servicesLioncash2018-08-023-0/+94
| |/ |/| | | | | | | Adds the basic skeleton for the psc services based off the information provided by Switch Brew.
* | Merge pull request #888 from lioncash/capsbunnei2018-08-023-0/+169
|\ \ | | | | | | service: Add capture services
| * | service: Add capture servicesLioncash2018-08-013-0/+169
| |/ | | | | | | | | Adds the basic skeleton for the capture services based off information provided by Switch Brew.
* | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ | | | | | | lm: Amend name of ILogger
| * | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ | | | | | | | | Previously this was being registered with the name "Logger". While we're at it, also change the name of the class to match it.
* | Merge pull request #889 from lioncash/fspbunnei2018-08-025-0/+85
|\ \ | | | | | | service/filesystem: Add fsp:ldr and fsp:pr services
| * | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-015-0/+85
| |/ | | | | | | | | Adds the basic skeleton for the remaining fsp services based off information provided by Switch Brew.
* / service: Add bpc and pcv servicesLioncash2018-08-015-0/+175
|/ | | | | Adds the basic skeleton for the remaining pcv-related services based off information on Switch Brew.
* kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
| | | | | Given there's no implementation, we may as well remove the code entirely.
* Merge pull request #877 from lioncash/removebunnei2018-08-015-102/+0
|\ | | | | kernel: Remove unused object_address_table.cpp/.h
| * kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-315-102/+0
| | | | | | | | | | | | These source files were entirely unused throughout the rest of the codebase. This also has the benefit of getting rid of a global variable as well.
* | Merge pull request #880 from lioncash/audiobunnei2018-08-0113-0/+277
|\ \ | | | | | | service/audio: Add missing services
| * | service/audio: Add missing servicesLioncash2018-08-0113-0/+277
| | | | | | | | | | | | | | | Adds the missing audctl service, as well as the :a and :d services for audin, audout, audrec, and audren.
* | | Merge pull request #876 from lioncash/includebunnei2018-08-0122-27/+46
|\ \ \ | | | | | | | | kernel: Remove unnecessary includes
| * | | kernel: Remove unnecessary includesLioncash2018-07-3122-27/+46
| | |/ | |/| | | | | | | | | | Removes unnecessary direct dependencies in some headers and also gets rid of indirect dependencies that were being relied on to be included.
* | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ | |_|/ |/| | audout_u: Remove std::move in OpenAudioOutImpl()
| * | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
| | | | | | | | | | | | | | | | | | | | | Previously the code was using the values from params further below after it was std::moved. Thankfully, given AudoutParams is a trivially copyable struct, the values would have simply been copied in this instance and not invalidated to garbage values.
* | | Merge pull request #869 from Subv/ubsanbunnei2018-07-312-6/+17
|\ \ \ | | | | | | | | Corrected a few error cases detected by asan/ubsan
| * | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| | | |
| * | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
| | | | | | | | | | | | | | | | Passing nullptr to memcpy is undefined behavior.
* | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-313-0/+92
|\ \ \ \ | | | | | | | | | | service: Add fgm services
| * | | | service: Add fgm servicesLioncash2018-07-313-0/+92
| | |_|/ | |/| | | | | | | | | | | | | | Adds the basic skeleton for the fgm services based off the information provided by Switch Brew.
* | | | Merge pull request #874 from lioncash/ambunnei2018-07-317-0/+150
|\ \ \ \ | |_|_|/ |/| | | service/am: Add missing am services
| * | | service/am: Add missing am servicesLioncash2018-07-317-0/+150
| |/ / | | | | | | | | | | | | Adds the basic skeleton for missing am services idle:sys, omm, and spsm based off the information provided by Switch Brew.
* / / service: Add the pcie serviceLioncash2018-07-313-0/+81
|/ / | | | | | | | | Adds the basic skeleton of the pcie service based off information on Switch Brew.
* | audio_core: Move to audout_u impl.bunnei2018-07-312-4/+6
| | | | | | | | - This is necessary so streams are created on the same thread.
* | Implemented various hwopus functions (#853)David2018-07-312-5/+131
| |
* | Merge pull request #857 from lioncash/wlanbunnei2018-07-303-1/+190
|\ \ | | | | | | service: Add wlan services
| * | service: Add wlan servicesLioncash2018-07-293-1/+190
| | | | | | | | | | | | | | | Adds the basic skeleton for the wlan services based off the information on Switch Brew.
* | | Merge pull request #856 from lioncash/btmbunnei2018-07-303-0/+138
|\ \ \ | | | | | | | | service: Add btm services
| * | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| | | | | | | | | | | | | | | | Based off information on SwIPC and Switch Brew.
| * | | service: Add btm servicesLioncash2018-07-293-0/+104
| |/ / | | | | | | | | | | | | Adds the skeleton for the btm services based off the information on Switch Brew.
* / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ / | | | | | | | | | | * Added some HID commands * Addressed comments
* | Merge pull request #847 from lioncash/ncmbunnei2018-07-283-0/+76
|\ \ | | | | | | service: Add ncm services
| * | service: Add ncm servicesLioncash2018-07-273-0/+76
| | | | | | | | | | | | | | | Adds the basic skeleton for the ncm services based off information on Switch Brew.
* | | Merge pull request #846 from lioncash/miibunnei2018-07-283-0/+124
|\ \ \ | | | | | | | | service: Add mii services
| * | | service: Add mii servicesLioncash2018-07-273-0/+124
| | | | | | | | | | | | | | | | | | | | Adds the skeleton for the mii services based off information provided by Switch Brew
* | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| |/ / |/| |
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-273-0/+239
|\ \ \ | | | | | | | | service: Add nfc services
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| | | | | | | | | | | | | | | | These simply return the respective interface.
| * | | service: Add nfc servicesLioncash2018-07-273-0/+200
| |/ / | | | | | | | | | | | | Adds the skeleton of the nfc service based off the information provided on Switch Brew.
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-273-0/+107
|\ \ \ | | | | | | | | service: Add the lbl service
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-271-3/+35
| | | | | | | | | | | | | | | | | | | | Implements these functions according to the information available on Switch Brew.
| * | | service: Add the lbl serviceLioncash2018-07-273-0/+75
| |/ / | | | | | | | | | | | | Adds the skeleton of the lbl service based off the information provided by Switch Brew.
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-273-1/+91
|\ \ \ | |/ / |/| | service: Add the btdrv service
| * | service: Add the btdrv serviceLioncash2018-07-273-1/+91
| | | | | | | | | | | | Adds the skeleton for the btdrv service based off the information provided by Switch Brew
* | | Merge pull request #837 from lioncash/privbunnei2018-07-271-5/+17
|\ \ \ | | | | | | | | kernel/timer: Make data members private where applicable
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-261-5/+17
| | | | | | | | | | | | | | | | | | | | Instead, we can just expose functions that return the queryable state instead of letting anything modify it.
* | | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
| | | |
* | | | service/hid: Add the xcd:sys serviceLioncash2018-07-263-0/+55
| | | |
* | | | service/hid: Add irs servicesLioncash2018-07-263-0/+73
| |/ / |/| |
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-263-0/+48
|\ \ \ | | | | | | | | service: Add the grc:c service
| * | | service: Add the grc:c serviceLioncash2018-07-263-0/+48
| |/ / | | | | | | | | | | | | Adds the basic skeleton for the grc:c service based off the information provided by Switch Brew.
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-263-0/+141
|\ \ \ | | | | | | | | service: Add the nim services
| * | | service: Add the nim servicesLioncash2018-07-263-0/+141
| |/ / | | | | | | | | | | | | Adds the skeleton for the nim services based off information from Switch Brew.
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-263-0/+160
|\ \ \ | | | | | | | | service: Add ldn services
| * | | service: Add ldn servicesLioncash2018-07-263-0/+160
| |/ / | | | | | | | | | Adds ldn services based off information provided by Switch Brew.
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-265-0/+93
|\ \ \ | |_|/ |/| | service/sockets: Add missing socket services
| * | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-263-0/+64
| | |
| * | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/
* | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ | |/ |/| service/lm: Minor changes
| * lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| | | | | | | | | | This isn't used directly outside of this translation unit, so we can hide it from external use.
| * lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| | | | | | | | Amends these to match the information on Switch Brew.
| * lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
| |
* | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-263-0/+99
|\ \ | | | | | | service: Add ldr services
| * | service: Add ldr servicesLioncash2018-07-263-0/+99
| | | | | | | | | | | | | | | Adds the skeleton for the ldr-related services based off the information provided on Switch Brew.
* | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-265-0/+139
|\ \ \ | | | | | | | | service: Add erpt and eupld services
| * | | service: Add eupld servicesLioncash2018-07-263-0/+70
| | | | | | | | | | | | | | | | | | | | Adds the skeleton for the eupld services based off information on Switch Brew.
| * | | service: Add the erpt servicesLioncash2018-07-263-0/+69
| | |/ | |/| | | | | | | | | | Adds the basic skeleton of the erpt service based off information on Switch Brew.
* | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-268-135/+30
|\ \ \ | |_|/ |/| | service/nifm: Deduplicate interface code
| * | service/nifm: Deduplicate interface codeLioncash2018-07-258-135/+30
| | | | | | | | | | | | | | | Rather than having the same code for each nifm service variant, we can centralize it on one class and get rid of a bit of extra code.
* | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ | | | | | | | | service/nvdrv: Minor changes
| * | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids copies from being made, since the string is only ever used for lookup, the data is never transfered anywhere. Ideally, we'd use a std::string_view here, but devices is a std::unordered_map, not a std::map, so we can't use heterogenous lookup here.
| * | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / | | | | | | | | | | | | | | | | | | Avoids unnecessary reference count increments and decrements. In one case, we don't need to make a shared_ptr copy at all, just to call a member function.
* | | Merge pull request #822 from lioncash/pmbunnei2018-07-263-0/+88
|\ \ \ | |_|/ |/| | service: Add pm services
| * | service: Add pm servicesLioncash2018-07-253-0/+88
| |/ | | | | | | | | Adds the skeleton for the process management services based off information on Switch Brew.
* / service: Add the es serviceLioncash2018-07-253-0/+75
|/ | | | | Adds the skeleton for the ETicket service based off the information on Switch Brew
* Merge pull request #801 from lioncash/timeMat M2018-07-255-60/+14
|\ | | | | time: Add the time:a service
| * time: Add the time:a serviceLioncash2018-07-253-10/+11
| | | | | | | | Given we already have time:s and time:u, we should also have time:a
| * time: Simplify interface creationLioncash2018-07-245-60/+13
| | | | | | | | We can use one instance of the interface instead of duplicating code.
* | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \ | | | | | | svc: Log parameters in SetMemoryAttribute()
| * | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
| | | | | | | | | | | | Provides slightly more context than only logging out the address value.
* | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-257-0/+7
|\ \ \ | | | | | | | | core_timing: Split off utility functions into core_timing_util
| * | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-247-0/+7
| | | |
* | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \ | | | | | | | | | | set_sys: Implement SetColorSetId()
| * | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| | | | |
| * | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| | |_|/ | |/| |
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-255-44/+13
|\ \ \ \ | | | | | | | | | | friend: Deduplicate interfaces
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Given we already have friend:a and friend:u, we should add the remaining services as well.
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| | | | |
| * | | | friend: Deduplicate interfacesLioncash2018-07-245-44/+9
| | |_|/ | |/| |
* / | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
|/ / / | | | | | | | | | | | | The loop's induction variable was signed, but we were comparing against an unsigned variable.
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-242-2/+2
|\ \ \ | | | | | | | | core: Make converting constructors explicit where applicable
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-242-2/+2
| |/ / | | | | | | | | | | | | Avoids unwanted implicit conversions. Thankfully, given the large amount of cleanup in past PRs, only this tiny amount is left over to cover.
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \ | | | | | | | | apm/interface: Remove redundant declaration of InstallInterfaces()
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ / | | | | | | | | | This is already declared in apm/apm.h
* | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ | |_|/ |/| | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by reference
| * | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
| | | | | | | | | | | | | | | The pointed to thread's members are simply observed in this case, so we don't need to copy it here.
* | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ | |_|/ |/| | ipc_helpers: Make member variables of ResponseBuilder private
| * | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| | |
| * | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| |/ | | | | | | These aren't used externally at all, so they can be made private.
* / VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-241-16/+29
|/ | | | | | | | | | | | | | | | * Regression and Mode Fixes * Review Fixes * string_view correction * Add operator& for FileSys::Mode * Return std::string from SanitizePath * Farming Simulator Fix * Use != With mode operator&
* Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ | | | | vi: Minor changes
| * vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| | | | | | | | | | | | It's undefined behavior to memcpy an object that isn't considered trivially copyable, so put a compile-time check in to make sure this doesn't occur.
| * vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| | | | | | | | | | | | | | Allows avoiding unnecessary copies of the vector depending on the calling code. While we're at it, remove a redundant no-parameter base constructor call
* | Merge pull request #779 from lioncash/sharedbunnei2018-07-247-259/+0
|\ \ | | | | | | hle: Remove unused config_mem and shared_page source files
| * | hle: Remove config_mem.h/.cppLioncash2018-07-235-100/+0
| | | | | | | | | | | | | | | This is just an unused hold-over from citra, so we can get rid of this to trim off an exposed global, among other things.
| * | hle: Remove shared_page.h/.cppLioncash2018-07-235-159/+0
| |/ | | | | | | This is a holdover from citra that's essentially unused.
* / set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
|/ | | | Forgot to include this in 22f448b6327044076959e338811ee576f3dcf093
* Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ | | | | set: Amend return value of GetAvailableLanguageCodes()
| * set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| | | | | | | | This just returns the size of the language code buffer.
| * set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| | | | | | | | The return code should be 32-bit in size.
* | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ | |/ |/| Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.
| * Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
| |
* | file_util, vfs: Use std::string_view where applicableLioncash2018-07-221-1/+1
|/ | | | | Avoids unnecessary construction of std::string instances where applicable.
* Merge pull request #760 from lioncash/pathbunnei2018-07-222-3/+3
|\ | | | | file_util: Use an enum class for GetUserPath()
| * file_util: Use an enum class for GetUserPath()Lioncash2018-07-212-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | Instead of using an unsigned int as a parameter and expecting a user to always pass in the correct values, we can just convert the enum into an enum class and use that type as the parameter type instead, which makes the interface more type safe. We also get rid of the bookkeeping "NUM_" element in the enum by just using an unordered map. This function is generally low-frequency in terms of calls (and I'd hope so, considering otherwise would mean we're slamming the disk with IO all the time) so I'd consider this acceptable in this case.
* | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ | | | | This behaves quite similarly to the SubmitGPFIFO command. Referenced from Ryujinx. Many thanks to @gdkchan for investigating this!
* Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-213-0/+13
|\ | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch
| * CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-213-0/+13
| | | | | | | | Note that there's currently a dynarmic bug preventing this register from being written.
* | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \ | | | | | | apm: Improve stub for GetPerformanceConfiguration.
| * | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
| | |
* | | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows pushing strongly-typed enum members without the need to always cast them at the call sites. Note that we *only* allow strongly-typed enums in this case. The reason for this is that strongly typed enums have a guaranteed defined size, so the size of the data being pushed is always deterministic. With regular enums this can be a little more error-prone, so we disallow them. This function simply uses the underlying type of the enum to determine the size of the data. For example, if an enum is defined as: enum class SomeEnum : u16 { SomeEntry }; if PushEnum(SomeEnum::SomeEntry); is called, then it will push a u16-size amount of data.
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \ | | | | | | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/ | | | | | | | | | | And make IManagerForApplication::CheckAvailability always return false. Returning a bogus id from GetAccountId causes games to crash on boot. We should investigate this with a hwtest and either stub it properly or implement it.
* | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ | | | | | | audout_u/audren_u: Ensure null terminators are written out in ListAudioOutsImpl(), ListAudioDeviceName(), and GetActiveAudioDeviceName()
| * | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| | | | | | | | | | | | | | | std::string doesn't include the null-terminator in its data() + size() range. This ensures that the null-terminator will also be written to the buffer
| * | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| | | | | | | | | | | | | | | | | | Uses a type that doesn't potentially dynamically allocate, and ensures that the name of the interface is properly null-terminated when writing it to the buffer.
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-209-71/+70
|\ \ \ | |_|/ |/| | thread: Convert ThreadStatus into an enum class
| * | thread: Convert ThreadStatus into an enum classLioncash2018-07-209-71/+70
| |/ | | | | | | | | Makes the thread status strongly typed, so implicit conversions can't happen. It also makes it easier to catch mistakes at compile time.
* / pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/ | | | With the new overload, we can simply pass the container directly.
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\ | | | | hle_ipc: Introduce generic WriteBuffer overload for multiple container types
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This introduces a slightly more generic variant of WriteBuffer(). Notably, this variant doesn't constrain the arguments to only accepting std::vector instances. It accepts whatever adheres to the ContiguousContainer concept in the C++ standard library. This essentially means, std::array, std::string, and std::vector can be used directly with this interface. The interface no longer forces you to solely use containers that dynamically allocate. To ensure our overloads play nice with one another, we only enable the container-based WriteBuffer if the argument is not a pointer, otherwise we fall back to the pointer-based one.
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \ | | | | | | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/ | | | | | | | | This WriteBuffer overload expects its size argument to be in bytes, not elements.
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \ | | | | | | HLE/ACC: Change the default user id and small improvements to the way we handle profiles
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| | | | | | | | | | | | | | | The default username for now is "yuzu". We should eventually allow the creation of users in the emulator and have the ability to modify their parameters.
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
| | | | | | | | | | | | In IApplicationFunctions::PopLaunchParameter we tell the games that they were launched as user id 1.
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \ | | | | | | | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ / | | | | | | | | | We only emulate a single user id for now.
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/| | | | | | | This can just use the fmt specifiers and be type-agnostic.
* | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ | | | | | | | | hid: Resolve a signed/unsigned comparison warning
| * | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| | | | | | | | | | | | | | | | | | | | Modernizes the loops themselves while also getting rid of a signed/unsigned comparison in a loop condition.
| * | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | Gets rid of the use of a magic constant
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \ | | | | | | | | | | svc: Correct always true assertion case in SetThreadCoreMask
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The reason this would never be true is that ideal_processor is a u8 and THREADPROCESSORID_DEFAULT is an s32. In this case, it boils down to how arithmetic conversions are performed before performing the comparison. If an unsigned value has a lesser conversion rank (aka smaller size) than the signed type being compared, then the unsigned value is promoted to the signed value (i.e. u8 -> s32 happens before the comparison). No sign-extension occurs here either. An alternative phrasing: Say we have a variable named core and it's given a value of -2. u8 core = -2; This becomes 254 due to the lack of sign. During integral promotion to the signed type, this still remains as 254, and therefore the condition will always be true, because no matter what value the u8 is given it will never be -2 in terms of 32 bits. Now, if one type was a s32 and one was a u32, this would be entirely different, since they have the same bit width (and the signed type would be converted to unsigned instead of the other way around) but would still have its representation preserved in terms of bits, allowing the comparison to be false in some cases, as opposed to being true all the time. --- We also get rid of two signed/unsigned comparison warnings while we're at it.
* | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ | | | | | | | | | | | | hle/service: Make constructors explicit where applicable
| * | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / | | | | | | | | | | | | | | | | | | | | Prevents implicit construction and makes these lingering non-explicit constructors consistent with the rest of the other classes in services.
* | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ | | | | | | | | | | | | nvflinger: Emplace Display instances directly
| * | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use emplace_back to construct the Display instances directly, instead of constructing them separately and copying them, avoiding the need to copy std::string and std::vector instances that are part of the Display struct.
* | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | | nvdrv: Take std::string by const reference in GetDevice()
| * | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / | | | | | | | | | | | | | | | | This is only ever used as a lookup into the device map, so we don't need to take the std::string instance by value here.
* | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ | |_|_|/ |/| | | Filesystem: Return EntryType::Directory for the root directory.
| * | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
| |/ / | | | | | | | | | It is unknown if this is correct behavior, but it makes sense and fixes a regression with Stardew Valley.
* | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ | | | | | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloads
| * | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | Previously, the buffer_index parameter was unused, causing all writes to use the buffer index of zero, which is not necessarily what is wanted all the time. Thankfully, all current usages don't use a buffer index other than zero, so this just prevents a bug before it has a chance to spring.
* | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ | |_|/ |/| | fsp_srv: Misc individual changes
| * | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| | | | | | | | | | | | | | | | | | | | | We can avoid constructing a std::vector here by simply passing a pointer to the original data and the size of the copy we wish to perform to the backend's Write() function instead, avoiding copying the data where it's otherwise not needed.
| * | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were using a second std::vector as a buffer to convert another std::vector's data into a byte sequence, however we can just use pointers to the original data and use them directly with WriteBuffer, which avoids copying the data at all into a separate std::vector. We simply cast the pointers to u8* (which is allowed by the standard, given std::uint8_t is an alias for unsigned char on platforms that we support).
| * | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| | | | | | | | | | | | Prevents implicit conversions.
| * | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| | | | | | | | | | | | Gets rid of relying on indirect inclusions.
| * | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| | |
| * | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ | | | | | | | | | | | | | | | | | | | | Previously we were just copying the data whole-sale, even if the length was less than the total data size. This effectively makes the actual_data vector useless, which is likely not intended. Instead, amend this to only copy the given length amount of data. At the same time, we can avoid zeroing out the data before using it by passing iterators to the constructor instead of a size.
* | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| | | | | | | | Avoids unnecessary atomic reference count incrementing and decrementing
* | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| | | | | | | | | | This is simply a basic value check as opposed to potentially doing string based operations (unlikely, but still, avoiding it is free).
* | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
|/ | | | This was just an artifact missed during PR review.
* Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ | | | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()
| * address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
| | | | | | | | | | | | This was introduced within 4f81bc4e1bd12e4df7410c6790ba818d8dbba9c0, and considering there's no comment indicating that this is intentional, this is very likely a bug.
* | Merge pull request #690 from lioncash/movebunnei2018-07-198-13/+21
|\ \ | | | | | | core/memory, core/hle/kernel: Use std::move where applicable
| * | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-198-13/+21
| | | | | | | | | | | | Avoids pointless copies
* | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ | | | | | | | | service/prepo: Add missing header guard
| * | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ | |/|
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \ | | | | | | | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| | |/ | |/| | | | | | | | | | Without these, this would perform concatenation, which is definitely not what we want here.
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-191-6/+6
|\ \ \ | | | | | | | | core: Don't construct instance of Core::System, just to access its live instance
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-191-6/+6
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | This would result in a lot of allocations and related object construction, just to toss it all away immediately after the call. These are definitely not intentional, and it was intended that all of these should have been accessing the static function GetInstance() through the name itself, not constructed instances.
* | / Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-195-116/+383
| |/ |/| | | | | | | | | | | | | | | | | * Virtual Filesystem * Fix delete bug and documentate * Review fixes + other stuff * Fix puyo regression
* | Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
| |
* | Single touch supportZach Hilman2018-07-181-4/+19
|/
* vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
|
* vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
|
* vi: Partially implement buffer crop parameters.bunnei2018-07-186-10/+26
|
* General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-175-101/+130
|
* Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-171-0/+1
|\ | | | | scheduler: Clear exclusive state when switching contexts
| * scheduler: Clear exclusive state when switching contextsMerryMage2018-07-161-0/+1
| |
* | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \ | | | | | | svc:: Fix bug in svcWaitForAddress
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* / nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
|
* Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\ | | | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC
| * Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
| |
* | No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/
* We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
|
* initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
|
* Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ | | | | Let games/application know that we're offline
| * Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
| | | | | | | | Since we have no socket implementation we should be returning 0 to indicate we're currently offline.
* | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
|/ | | | Audout autos are identical to their counterpart except for the buffer type which yuzu already handles for us.
* Merge pull request #559 from Subv/mount_savedatabunnei2018-07-121-2/+11
|\ | | | | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.
| * Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-191-2/+11
| |
* | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
| | | | | | | | - This fixes user input in SMO.
* | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
| | | | | | | | | | Settings are only used when RMOS_SET_PRODUCTION_MODE is set to 0. If production mode is set, the error code 0x30006 is returned instead
* | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
| |
* | Revert "Virtual Filesystem (#597)"bunnei2018-07-085-405/+71
| | | | | | | | This reverts commit 77c684c1140f6bf3fb7d4560d06d2efb1a2ee5e2.
* | Virtual Filesystem (#597)Zach Hilman2018-07-065-71/+405
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add VfsFile and VfsDirectory classes * Finish abstract Vfs classes * Implement RealVfsFile (computer fs backend) * Finish RealVfsFile and RealVfsDirectory * Finished OffsetVfsFile * More changes * Fix import paths * Major refactor * Remove double const * Use experimental/filesystem or filesystem depending on compiler * Port partition_filesystem * More changes * More Overhaul * FSP_SRV fixes * Fixes and testing * Try to get filesystem to compile * Filesystem on linux * Remove std::filesystem and document/test * Compile fixes * Missing include * Bug fixes * Fixes * Rename v_file and v_dir * clang-format fix * Rename NGLOG_* to LOG_* * Most review changes * Fix TODO * Guess 'main' to be Directory by filename
* | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
| | | | | | | | | | | | | | | | * voice section updating * fixed slight offset miscalculation * fixed overflow
* | Update clang formatJames Rowe2018-07-0317-75/+70
| |
* | Rename logging macro back to LOG_*James Rowe2018-07-0354-401/+401
| |
* | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| |
* | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
| | | | | | | | This behavior is confirmed by reverse engineering.
* | Merge pull request #588 from mailwl/hwopusbunnei2018-06-283-0/+51
|\ \ | | | | | | Service/Audio: add hwopus service, stub GetWorkBufferSize function
| * | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-253-0/+51
| | |
* | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / | | | | | | | | | | | | | | * We should be returning our revision instead of what is requested. Hardware test on a 5.1.0 console * Added sysversion comment
* | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
| | | | | | | | | | | | | | | | | | | | * Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader According to game symbols(SMO), there's references to UpdateDataHeader which seems to be what AudioRendererResponse actually is * oops * AudioRendererParameters should be AudioRendererParameter according to SMO
* | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
| | | | | | | | | | * Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly This fixes RequestUpdateAudioRenderer deadlocks in games like Puyo Puyo Tetris and games which require a proper section size in games such as Retro City Rampage. This fixes causes various games to start rendering or trying to render
* | Merge pull request #579 from SciresM/masterbunnei2018-06-228-9/+295
|\ \ | | | | | | svc: Fully implement svcSignalToAddress and svcWaitForAddress
| * | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-222-17/+16
| | |
| * | Add additional missing format.Michael Scire2018-06-222-21/+27
| | |
| * | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| | |
| * | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| | |
| * | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-212-1/+5
| | |
| * | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| | |
| * | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-214-10/+110
| | |
| * | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-214-6/+67
| | |
| * | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
| | |
* | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
| | | | | | | | | | | | prevent yuzu crash, if games, like Axiom Verge, trying to read 0 bytes from file
* | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
|/ /
* | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-203-4/+5
| |
* | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | * Implement GetAvailableLanguageCodes2 * Revert "Implement GetAvailableLanguageCodes2" This reverts commit caadd9eea3497ae2a13382aecb8ca29e1c02c5af. * Implement GetAvailableLanguageCodes2 * Implement GetAvailableLanguageCodes2
* | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \ | | | | | | Avoid initializing single-joycon layouts with handheld controller
| * | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| | |
| * | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| | |
| * | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
| | |
* | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ | |/ / |/| | svc: Add a stub for UserExceptionContextAddr.
| * | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
| | |
* | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ |/|
* | Common/string_util: add StringFromBuffer functionmailwl2018-06-071-22/+9
| | | | | | | | convert input buffer (std::vector<u8>) to string, stripping zero chars
* | Merge pull request #522 from mailwl/mm-ubunnei2018-06-073-0/+81
|\ \ | | | | | | Service/MM: add service and stub some functions
| * | Remove unused header filesmailwl2018-06-061-2/+0
| | |
| * | Small fixesmailwl2018-06-052-6/+8
| | |
| * | Service/MM: add service and stub some functionsmailwl2018-06-053-0/+81
| | |
* | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \ | | | | | | | | Service/nfp:user : stub some functions.
| * | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| | | |
| * | | Correct function resultsmailwl2018-06-041-4/+16
| | | |
| * | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
| | | | | | | | | | | | | | | | Used by Zelda: BoTW
* | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add IoctlCommands with their params in nvidia_ctrl_gpu.h * add function related to the changes done previously * fix clang-format * delete trailing whitespace * correct mistake
* | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| | | |
* | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| |/ / |/| |
* | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add some IoctlCommand with their params to nvhost_gpu * fix clang-format * delete trailing whitespace * fix some clang-format * delete one other trailing whitespace * last clang-format fix
* | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
| | |
* | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
| | |
* | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/ /
* | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
| |
* | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
| |
* | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
| |
* | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
| |
* | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-033-0/+72
|\ \ | | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' device
| * | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-303-0/+72
| | |
* | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This situation may happen like so: Thread 1 with low priority calls WaitProcessWideKey with timeout. Thread 2 with high priority calls WaitProcessWideKey without timeout. Thread 3 calls SignalProcessWideKey - Thread 2 acquires the lock and awakens. - Thread 1 can't acquire the lock and is put to sleep with the lock owner being Thread 2. Thread 1's timeout expires, with the lock owner still being set to Thread 2.
* | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
| | |
* | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \ | | | | | | | | Kernel/SVC: Corrected the behavior of svcSetThreadCoreMask for core values -2 and -3.
| * | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| | | |
| * | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| | | | | | | | | | | | | | | | Also added some proper error handling.
| * | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
| |/ /
* | | add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add some CommandType * add some hid FunctionInfo * add some other HID FunctionInfo * delete non useful comments
* | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| | |
* | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
|/ /
* | Service/BCAT: add module and servicesmailwl2018-05-285-0/+114
| |
* | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \ | | | | | | NvOsGetConfigU32 should return null instead of 0 for default output value
| * | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| | |
* | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
| | | | | | | | | | | | | | | | | | | | | | | | * add some InfoType * correct OpenApplicationProxy cmd number * add IDisplayController functions * fix clang-format * add more system languages
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \ | | | | | | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUT
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
| | | | | | | | | | | | Used in Nintendo Labo ToyCon 1&2
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetAudioRendererWorkBufferSize impl Impl of GetAudioRendererWorkBufferSize based on RE, if this can be cleaned up, please contribute! * Naming conventions * Removed unneeded placeholder * lioncache changes * fixed const * switched to Common::AlignUp
* | | Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ / | | | | We have no clue on what this actually does yet so stubbing it since it's just input only should be fine for now
* | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
| | | | | | | | Games such as SMO deadlock if we have more than 2 layouts
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \ | | | | | | Add & correct some error modules
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
| | |
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \ | | | | | | | | Add ioctl commands with their params and size check
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| | | | | | | | | | | | according to the changes made previously
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| | | |
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| | |
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| | |
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
| | |
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE struct + 4 seems to be hard coded at 0 and struct + 0 seems to be ignored? * IocGetWaitbase -> IocChannelGetWaitbaseCommand * Added super late fixes
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-214-1/+98
|\ \ \ | | | | | | | | Implemented nvhost-as-gpu's UnmapBuffer and nvmap's Free ioctls.
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| | | | | | | | | | | | | | | | It releases a reference to an nvmap object
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-202-0/+50
| |/ / | | | | | | | | | It removes a mapping previously created with the MapBufferEx ioctl.
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add unknown function at the number command 2 * correct audout:u commands numbers * correct audrec:u cmd number & add Unknown function * correct IAudioDevice command numbers * correct codecctl cmd numbers & rename the 8 function * correct place of unknown function & fix clang-format
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \ | | | | | | | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ / | | | | | | | | | A thread may own multiple mutexes at the same time, and only release one of them while other threads are waiting for the other mutexes.
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \ | | | | | | | | Properly rename functions of Fatal Module & add ThrowFatal to this module
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| | | |
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| | | |
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \ | | | | | | | | Added IPC RequestWithContext & ControlWithContext
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
| | | | | | | | | | | | * Add and correct some Error Modules
* | | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-117-99/+249
|\ \ | | | | | | Initial support for multi-core
| * | thread: Rename mask to affinity_masks.bunnei2018-05-113-4/+4
| | |
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| | |
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| | |
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| | |
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-112-3/+3
| | |
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| | |
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| | |
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| | |
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| | |
| * | core: Implement multicore support.bunnei2018-05-115-45/+65
| | |
* | | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
| | | | | | | | | | | | | | | | | | | | * Stubs for QLaunch * Wiped unrelated stuff * Addressed comment * Dropped GetPopFromGeneralChannelEvent
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-072-68/+220
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * hid: Update mouse/keyboard state * hid: Working analog sticks * hid: Nits * hid: Nits * hid: Update mystery sections * hid: Tweaks
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0220-73/+74
|\ \ | | | | | | general: Make formatting of logged hex values more straightforward
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0220-73/+74
| | | | | | | | | | | | | | | | | | This makes the formatting expectations more obvious (e.g. any zero padding specified is padding that's entirely dedicated to the value being printed, not any pretty-printing that also gets tacked on).
* | | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ / | | | | | | - This can be used for domain objects as inputs to service functions.
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \ | | | | | | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
| | |
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetSharedFontInOrderOfPriority * Update pl_u.cpp * Ability to use ReadBuffer and WriteBuffer with different buffer indexes, fixed up GetSharedFontInOrderOfPriority * switched to NGLOG * Update pl_u.cpp * Update pl_u.cpp * language_code is actually language code and not index * u32->u64 * final cleanups
* | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-308-12/+16
| | | | | | | | All of these variables and functions are related to timings and should be within the namespace.
* | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-302-4/+3
| | | | | | | | Given we utilize fmt, we don't need to provide our own functions for formatting anymore
* | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
| |
* | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
| |
* | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
| |
* | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-276-12/+12
| |
* | Switched to NGLOG_WARNINGDavid Marcec2018-04-273-4/+4
| |
* | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-2661-881/+791
|\ \
| * | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| | | | | | | | | | | | Functions don't need to be terminated by semicolons.
| * | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
| | |
| * | Service/PCTL: convert to module, add services, stubmailwl2018-04-256-37/+69
| | | | | | | | | | | | PCTL::CreateServiceWithoutInitialize and IParentalControlService::Initialize, required by Kirby Star Allies
| * | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| | |
| * | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| | |
| * | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| | |
| * | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | |
| * | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | |
| * | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| | |
| * | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| | |
| * | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| | |
| * | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | |
| * | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| | |
| * | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| | |
| * | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | |
| * | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| | |
| * | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | |
| * | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | |
| * | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| | |
| * | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | |
| * | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| | |
| * | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | |
| * | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| | |
| * | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | |
| * | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | |
| * | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| | |
| * | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
| | |
| * | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-241-1/+21
| | |
| * | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2311-439/+236
| |\ \ | | | | | | | | Kernel: Reworked the new kernel synchronization primitives.
| | * | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Verified with a hwtest and implemented based on reverse engineering. Thread A's priority will get bumped to the highest priority among all the threads that are waiting for a mutex that A holds. Once A releases the mutex and ownership is transferred to B, A's priority will return to normal and B's priority will be bumped.
| | * | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-211-1/+1
| | | |
| | * | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-213-8/+8
| | | |
| | * | Kernel: Remove unused ConditionVariable class.Subv2018-04-215-148/+0
| | | |
| | * | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| | | |
| | * | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| | | | | | | | | | | | | | | | They work in tandem with guest code to provide synchronization primitives along with svcArbitrateLock/Unlock
| | * | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Switch mutexes are no longer kernel objects, they are managed in userland and only use the kernel to handle the contention case. Mutex addresses store a special flag value (0x40000000) to notify the guest code that there are still some threads waiting for the mutex to be released. This flag is updated when a thread calls ArbitrateUnlock. TODO: * Fix svcWaitProcessWideKey * Fix svcSignalProcessWideKey * Remove the Mutex class.
| * | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
| |\ \ \ | | | | | | | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.
| | * | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| | | | | | | | | | | | | | | | | | | | Also added a consistency check and a comment for the case when the object id is different than its handle. The real nvservices doesn't make a distinction between ids and handles, each object gets an unique handle which doubles as its id.
| | * | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | | | | | | | | | | | | | | | | | | | It takes a previously-reserved (AllocateSpace) GPU memory address and maps it to the address of the nvmap object passed to Remap.
| * | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ / /
* | | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-262-13/+2
| | | |
* | | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-239-25/+63
| | | |
* | | | lioncash proposed changesDavid2018-04-221-2/+2
| | | |
* | | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2210-11/+107
|/ / /
* | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \ | | | | | | | | resource_limit: Make ResourceTypes an enum class
| * | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
| | | | | | | | | | | | | | | | Prevents enum identifiers from leaking into the surrounding scope.
* | | | core: Relocate g_service_manager to the System classLioncash2018-04-214-32/+32
|/ / / | | | | | | | | | | | | Converts the service manager from a global into an instance-based variable.
* | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ | |/ / |/| | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution output
| * | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
| | | | | | | | | | | | | | | both SetLayerVisibility() functions used in Lego games, GetDisplayResolution() fixed according switchbrew.org
* | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ | | | | | | | | service: Use nested namespace specifiers where applicable
| * | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| | | | | | | | | | | | | | | | Tidies up namespace declarations
* | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-201-1/+2
|\ \ \ \ | | | | | | | | | | common_funcs: Remove ARRAY_SIZE macro
| * | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-201-1/+2
| |/ / / | | | | | | | | | | | | C++17 has non-member size() which we can just call where necessary.
* / / / vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / /
* / / nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
|/ /
* | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated ACC with more service names * Updated SVC with more service names * Updated set with more service names * Updated sockets with more service names * Updated SPL with more service names * Updated time with more service names * Updated vi with more service names
* | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \ | | | | | | pl_u: Use empty shared font if none is available.
| * | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
| | | | | | | | | | | | - Makes games work in lieu of shared_font.bin.
* | | fsp_srv: Implement DeleteFile.bunnei2018-04-151-1/+15
|/ / | | | | | | - Used by Binding of Isaac.
* | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \ | | | | | | vm_manager: Increase GetTotalMemoryUsage value.
| * | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
| | | | | | | | | | | | - Gets Binding of Isaac running.
* | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \ | | | | | | Service/HID: Stubbed out GetPlayerLedPattern
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
| | |
* | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/ /
* | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \ | | | | | | Various service name fixes - part 1
| * | Various fixes and clangHexagon122018-04-116-115/+108
| | |
| * | Decimal changeHexagon122018-04-101-4/+4
| | |
| * | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| | |
| * | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| | |
| * | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| | |
| * | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| | |
| * | Updated hid with more service names.Hexagon122018-04-101-0/+50
| | |
| * | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| | |
| * | Updated the unknown nameHexagon122018-04-101-1/+1
| | |
| * | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| | |
| * | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| | |
| * | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| | |
| * | Updated audren with more service names.Hexagon122018-04-101-10/+14
| | |
| * | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| | |
| * | Updated audout with more service names.Hexagon122018-04-101-13/+16
| | |
| * | Updated audin with more service names.Hexagon122018-04-101-9/+16
| | |
| * | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AM with more service names.Hexagon122018-04-101-2/+82
| | |
* | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
| | |
* | | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1010-127/+336
|/ /
* | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
| |
* | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
| |
* | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
| |
* | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
| |
* | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
| |
* | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
| |
* | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
| |
* | service: Add friend:u interface.bunnei2018-04-033-0/+39
| |
* | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
| | | | | | | | | | | | | | | | | | | | | | Versions prior to this didn't compile on OpenBSD due to unconditional use of the non-standard strtod_l() function. The fmt::MemoryWriter API has been removed in the intervening versions, so replace its use with fmt::memory_buffer and fmt::format_to. The library also no longer provides the fmt::fmt ALIAS, so define it in externals/CMakeLists.txt.
* | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ | | | | | | hid: Write empty touch screen state.
| * | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
| | |
* | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
| | |
* | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| | |
* | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
| | |
* | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-311-2/+21
| | |
* | | memory: Fix stack region.bunnei2018-03-312-3/+4
|/ /
* | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
| |
* | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
| |
* | service: Add NFP module interface.bunnei2018-03-305-0/+95
| | | | | | | | | | | | service: Initialize NFP service. Log: Add NFP service as a log subtype.
* | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
| | | | | | | | Avoids doing work that doesn't need to be done.
* | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-271-5/+5
| |
* | config: Add setting for whether the system is docked or not.bunnei2018-03-271-2/+6
| |
* | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \ | | | | | | Minor changes to VI, PL, HID, and AUDREN
| * | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| | |
| * | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| | |
| * | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
| | |
* | | Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-257-30/+92
|/ /
* | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-242-6/+7
|\ \ | | | | | | Tegra progress 2
| * | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-231-6/+0
| | |
| * | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-232-3/+3
| | |
| * | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| | | | | | | | | | | | - Workaround for texture forwarding until we have a better place.
| * | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-231-3/+3
| | |
* | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-243-2/+106
|\ \ \ | | | | | | | | FS: Implemented access to the SD card
| * | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-211-0/+15
| | | |
| * | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| | | | | | | | | | | | | | | | Note that the filter parameter is not yet implemented.
| * | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| | | |
| * | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| | | |
| * | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-202-0/+6
| | | |
* | | | Service/SSL: add ssl servicemailwl2018-03-233-0/+41
| | | |
* | | | Service/spl: add module and servicesmailwl2018-03-227-0/+168
| |/ / |/| |
* | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
| | |
* | | Service: add fatal:u, fatal:p servicesmailwl2018-03-207-0/+138
| | |
* | | Clang FixesN00byKing2018-03-193-7/+7
| | |
* | | oopsN00byKing2018-03-191-3/+3
| | |
* | | More Warning cleanupsN00byKing2018-03-192-2/+2
| | |
* | | Clean Warnings (?)N00byKing2018-03-1910-15/+15
|/ /
* | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
| |
* | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
| |
* | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
| |
* | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
| |
* | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-193-20/+6
| |
* | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
| |
* | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
| |
* | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
| |
* | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-161-0/+3
| |
* | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
| |
* | kernel: Move stack region outside of application heap.bunnei2018-03-163-8/+3
| |
* | process: Fix stack memory state.bunnei2018-03-161-2/+4
| |
* | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
| |
* | IGeneralService: fix function listmailwl2018-03-161-2/+3
| |
* | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
| |
* | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
| |
* | core: Move process creation out of global state.bunnei2018-03-1411-39/+43
| |
* | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-045-2/+55
|\ \ | | | | | | FS: Make EnsureSaveData create the save data if it doesn't already exist.
| * | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| | |
| * | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-043-2/+40
| | |
* | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ /
* | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ | | | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called
| * | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
| | | | | | | | | | | | | | | This prevents a thread starvation issue in Puyo Puyo Tetris. We should hwtest this behavior and figure out where exactly this event is signaled.
* | | Service/Set: add more servicesmailwl2018-03-0311-10/+340
|/ /
* | Merge pull request #216 from Subv/savedatabunnei2018-03-027-13/+209
|\ \ | | | | | | Implemented the SaveData archive and MountSaveData.
| * | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-022-9/+8
| | | | | | | | | | | | There may be many CodeSets per Process, so it's wasteful and overcomplicated to store the program id in each of them.
| * | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| | |
| * | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-022-2/+10
| | |
| * | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| |/
* / thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/
* Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ | | | | IPC: add domain header to response if only it exists in request
| * Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| |
| * Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| |
| * IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
| |
* | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ | | | | | | UnmapSharedMemory
| * | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| | |
| * | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | C++11 requires spaces on the Identifier Add inttypes include clang
* | | Merge pull request #212 from mailwl/stubsbunnei2018-02-249-8/+110
|\ \ \ | | | | | | | | Stub some functions
| * | | Stub more functionsmailwl2018-02-227-8/+90
| | | |
| * | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-224-0/+20
| |/ /
* / / time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
|/ /
* / time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
|/
* Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-2/+26
|\ | | | | Service/AOC: stub ListAddOnContent function
| * Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-2/+26
| |
* | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
| |
* | service: Add Friend service interface.bunnei2018-02-195-0/+96
|/
* Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-197-369/+223
|\ | | | | Scheduler cleanup
| * scheduler: Cleanup based on PR feedback.bunnei2018-02-192-4/+3
| |
| * kernel: Use Scheduler class for threading.bunnei2018-02-183-172/+16
| |
| * kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-182-0/+208
| |
| * kernel: Remove unused address_arbiter code.bunnei2018-02-184-197/+0
| |
* | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ | | | | The values are still unknown and the function is still considered a stub. Puyo Puyo Tetris now tries to call fsp-srv:MountSaveData.
* Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ | | | | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.
| * Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
| | | | | | | | | | | | | | | | Ported from citra PR #3091 The delay specified here is from a Nintendo 3DS, and should be measured in a Nintendo Switch. This change is enough to prevent Puyo Puyo Tetris's main thread starvation.
* | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ | |/ |/| Make the fence handling in Vi a little less of a hack.
| * nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| | | | | | | | Games like Puyo Puyo Tetris and BOTW seem to depend on the buffer always having the same handle
| * Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| |
| * Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| |
| * Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| | | | | | | | This may break libnx homebrew due to a bug in libnx but is required by official games since they always assume that the buffer will be there.
| * nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| |
| * Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| |
| * Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| |
| * Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| |
| * Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
| |
* | Service/hid: stub some functionsmailwl2018-02-164-1/+98
| |
* | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
| |
* | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-155-0/+178
| |
* | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/
* Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ | | | | Refactor IPC buffer descriptor interface
| * hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| |
| * hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| |
| * service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| |
| * audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| |
| * vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| |
| * nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| |
| * vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| |
| * hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| |
| * hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| |
| * vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
| |
* | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
| |
* | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| |
* | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| |
* | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
| |
* | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
| |
* | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| |
* | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| |
* | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
| |
* | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
|/
* audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
| | | | | | * audren_u: Schedule reoccuring event. * audren_u: Stub GetAudioRenderersProcessMasterVolume, and misc. changes.
* Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\ | | | | VI cleanup and add a hack for booting games
| * vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| |
| * vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| |
| * TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
| |
* | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
|/
* Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\ | | | | Stub RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer
| * Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
| |
* | Merge pull request #178 from Subv/command_buffersbunnei2018-02-127-172/+18
|\ \ | |/ |/| GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-127-181/+15
| | | | | | | | Also moved the GPU MemoryManager class to video_core since it makes more sense for it to be there.
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-123-3/+5
| |
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
| |
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
| |
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
|
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-104-58/+100
|
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
|
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
|
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
| | | | - Another fix for libnx.
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
|
* nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
|
* IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
|
* nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
|
* acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
|
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
|
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-082-0/+160
|
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
|
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
|
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
|
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
|
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\ | | | | Stubs for HID, AM, and a mutex fix
| * mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| |
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| |
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
| |
* | Extra nvdrv support (#162)David2018-02-0616-37/+761
|/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * FinishInitalize needed for 3.0.1+ games * nvdrv:s and nvdrv:t both use NVDRV * Most settings return 0 on hardware, disabled NV_MEMORY_PROFILER for now. NVN_THROUGH_OPENGL & NVRM_GPU_PREVENT_USE are a few interesting settings to look at. Carefully choosing settings can help with drawing graphics later on * Initial /dev/nvhost-gpu support * ZCullBind * Stubbed SetErrorNotifier * Fixed SetErrorNotifier log, Added SetChannelPriority * Allocate GPFIFO Ex2, Allocate Obj Ctx, Submit GPFIFO * oops * Fixed up naming/structs/enums. Used vector instead of array for "gpfifo_entry" * Added missing fixes * /dev/nvhost-ctrl-gpu * unneeded struct * Forgot u32 in enum class * Automatic descriptor swapping for ioctls, fixed nvgpu_gpu_get_tpc_masks_args being incorrect size * nvdrv#QueryEvent * Renamed logs for nvdrv * Refactor ioctl so nv_result isn't needed * /dev/nvhost-as-gpu * Fixed Log service naming, CtxObjects now u32, renamed all structs, added static_asserts to structs, used INSERT_PADDING_WORDS instead of u32s * nvdevices now uses "Ioctl" union, * IoctlGpfifoEntry now uses bit field * final changes
* Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
|
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
|
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
| | | | - This gets BOTW booting.
* logger: Add Time service logging category.bunnei2018-02-051-10/+10
|
* logger: Add SET service logging category.bunnei2018-02-051-1/+1
|
* logger: Add PCTL service logging category.bunnei2018-02-051-1/+1
|
* logger: Add LM service logging category.bunnei2018-02-051-2/+2
|
* logger: Add APM service logging category.bunnei2018-02-051-2/+3
|
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
|
* logger: Add NIFM service logging category.bunnei2018-02-054-11/+11
|
* logger: Add VI service logging category.bunnei2018-02-054-21/+20
|
* hid: Stub out several functions.bunnei2018-02-051-1/+39
|
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
|
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
|
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
|
* logger: Add AM service logging category.bunnei2018-02-043-42/+42
|
* logger: Add "account" service logging category.bunnei2018-02-041-8/+8
|
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
|
* Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\ | | | | Several SVC fixes and improvements
| * GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| |
| * WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| |
| * svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| |
| * ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
| |
* | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\ | | | | controller: DuplicateSession should return a ClientSession.
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
| |
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-039-0/+370
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-026-379/+569
| | | | | | * Add AppletAE, step 1: move common interfaces to am.h * Add AppletAE, step 2
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\ | | | | vi::CreateStrayLayer : add padding to request
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
| |
* | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-025-0/+124
|\ \ | | | | | | Services/vi: add vi:s and vi:u services
| * | Services/vi: add vi:s and vi:u servicesmailwl2018-02-025-0/+124
| |/
* | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ | |/ |/| shared_memory: Only mark addresses as invalid if they are within the heap
| * shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
| |
* | [WIP] sfdnsres: stub (#146)mailwl2018-01-304-2/+51
|/ | | sfdnsres: Add several stubs
* Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-272-6/+6
|\ | | | | memory: Replace all memory hooking with Special regions
| * memory: Replace all memory hooking with Special regionsMerryMage2018-01-272-6/+6
| |
* | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
| |
* | audout_u: Various cleanups.bunnei2018-01-251-29/+17
| |
* | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
| |
* | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
| |
* | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
| |
* | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
| |
* | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
| |
* | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
| |
* | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
| |
* | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-259-166/+2
| |
* | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
| |
* | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-14/+166
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * audout:u OpenAudioOut implementation and IAudioOut cmd 1,2,3,4,5 implementation * using an enum for audio_out_state as well as changing its initialize to member initializer list * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * added missing Audio loggin subclass, minor fixes, clang comment breakline * Solving backend logging conflict * minor fix * Fixed duplicated Service NVDRV in backend.cpp, my bad
* | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
| |
* | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \ | | | | | | IPC: Don't create unnecessary ports when returning sub interfaces.
| * | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| | |
| * | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| | |
| * | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| | |
| * | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| | |
| * | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
| | |
* | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ | |/ / |/| | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the default display.
| * | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| | | | | | | | | | | | This function is used by libnx to obtain a new layer.
| * | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| | | | | | | | | | | | It'll be needed when we implement CreateManagedDisplayLayer.
| * | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
| | | | | | | | | | | | It is now created during Service initialization and passed to all the services that need it.
* | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ | |/ / |/| | Stub OpenAudioOut and fix a issue with HID IAppletResource
| * | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
| | |
* | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-228-363/+448
|/ /
* | Added stubs for audio services. (#116)st4rk2018-01-2211-5/+299
| | | | | | | | | | | | * stubs for audout:u, audin:u, audrec:u, audren:u, codecctl and decoding tables with nullptr for future implementations * fixing the changes requested (remove private, explicit)
* | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \ | | | | | | nvmap: Make IoctlCommands an enum class
| * | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| | | | | | | | | | | | This macro resolves to an empty macro in release builds.
| * | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
| |/ | | | | | | Prevents the enum values from polluting the surrounding scope
* | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-217-5/+158
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid * used clang-format-3.9 instead * lowercase pid * Moved nvmemp handlers to cpp * Removed unnecessary logging for NvOsGetConfigU32. Cleaned up log and changed to LOG_DEBUG * using std::arrays instead of c arrays * nvhost get config now uses std::array completely * added pid logging back * updated cmakelist * missing includes * added array, removed memcpy * clang-format6.0
* | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ | | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.
| * | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| |/
* | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
| |
* | filesystem: Implement basic IStorage functionality.David Marcec2018-01-215-0/+254
|/
* service/time: remove accidental #pragmastgsm2018-01-212-4/+0
|
* Format: Run the new clang format on everythingJames Rowe2018-01-2130-40/+43
|
* Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
| | | | | | | | | | | | * Added svcCreateSharedMemory * Services which are not implemented now throw UNIMPLEMENTED() * clang-format * changed perms to u32 * removed camelcase
* Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-203-3/+3
| | | | | | | | * Fixes some cast warnings, partially fixes citra #3064 * Converted casts to uint32_t to u32 * Ran clang-format
* Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ | | | | ISelfController: Stub LockExit and UnlockExit
| * ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
| |
* | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-197-0/+159
|/ | | | | | | | | | | | | | * Stubs for various acc:u0 funcs needed * Stub for GetDesiredLanguage in IApplicationFunctions * Add set service + stubs needed for games * Fix formatting * Implement IProfile, IManagerForApplication, return bool in CheckAvailability, style fixes * Remove IProfile::Get(needs more research), fix IPC response sizes
* Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ | | | | Fix svcGetInfo for libnx
| * nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| |
| * svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| |
| * svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
| |
* | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ | | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.
| * | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
| | |
* | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
| | |
* | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ /
* / Fix dispdrv typogdkchan2018-01-191-1/+1
|/
* Merge pull request #100 from Rozelette/masterbunnei2018-01-196-32/+109
|\ | | | | time: Refactor time:* to use a single shared module
| * time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| |
| * time: Refactor time:* to use a single shared moduleRozlette2018-01-186-26/+103
| |
* | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
| | | | | | | | | | | | | | | | | | | | * Stub PopLaunchParameter and implement Buffer C Descriptors reading * Address PR feedback * Ensure we push a u64 not a size_t * Fix formatting
* | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-186-0/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * run clang-format (2)
* | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ | |/ |/| lm: Minor logging fix to skip a byte.
| * lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
| |
* | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ | | | | | | svc: Minor clarity changes
| * | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| | | | | | | | | | | | Makes the codebase a little more consistent with regards to available documentation. Also amends the duplicate case where there was a similar entry at 0x72 named ConnectToPort.
| * | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| | | | | | | | | | | | Makes the table match SwitchBrew for these entries
* | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ | | | | | | | | vi: Minor clean up/correctness changes
| * | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ /
* | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ | |_|/ |/| | vi: Copy data directly into the std::vector within Parcel's ReadBlock function
| * | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ | | | | | | | | Previously this would unnecessarily zero-initialize the vector before copying the actual data into the vector instance.
* / controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
|/
* TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-174-83/+164
|
* Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ | | | | hid: Adjust timing based on actual hardware
| * hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
| |
* | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ | | | | | | nvdrv: stubbed Close(cmd 2)
| * | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
| |/
* | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |
* | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-173-3/+35
|\ \ | |/ |/| Implement IPC domain command CloseVirtualHandle
| * hle_ipc: Clang format.bunnei2018-01-171-2/+3
| |
| * ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
| |
* | Merge pull request #60 from jroweboy/game-framebunnei2018-01-171-0/+3
|\ \ | |/ |/| UI: Fix frame rate perf stats
| * UI: Fix frame rate perf statsJames Rowe2018-01-171-0/+3
| | | | | | | | Adds in a missing EndGameFrame when nvdrv swaps buffers
* | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ | |/ |/| hid: Write to all layouts, implement circular buffers, set up controller metadata.
| * hid: clang-formatshinyquagsire232018-01-171-3/+3
| |
| * hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| |
| * hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
| |
* | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-175-0/+82
| |
* | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
| |
* | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-173-14/+16
| |
* | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
| |
* | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
| |
* | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
| | | | | | | | | | | | # Conflicts: # src/core/hle/service/am/applet_oe.cpp # src/core/hle/service/apm/apm.cpp
* | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
| |
* | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
| | | | | | | | | | # Conflicts: # src/core/hle/kernel/svc.cpp
* | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
| |
* | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
| |
* | Merge pull request #52 from ogniK5377/fspbunnei2018-01-175-3/+88
|\ \ | | | | | | added more svcGetInfo pairs for 3.0.0+ support, Changed HEAP_SIZE and TLS_AREA_VADDR. changed mem usage & heap usage stub added, ISelfController, IApplication function stubs. Added SetThreadCoreMask
| * | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| | |
| * | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| | |
| * | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| |/
* / clang-formatMerryMage2018-01-169-26/+21
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
|
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
|
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
|
* Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-152-0/+398
|\ | | | | HID Sharedmem Impl Start
| * hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| |
| * hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| |
| * hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
| |
* | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/
* Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
|
* renderer: Render previous frame when no new one is available.bunnei2018-01-151-1/+4
|
* lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
|
* time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-155-1/+117
|
* audio: Add files to CMake.bunnei2018-01-151-1/+0
|
* hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
|
* audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
|
* hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
|
* shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
|
* svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
|
* kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
|
* Fix build on macOS and linuxMerryMage2018-01-131-2/+0
|
* yuzu: Update license text to be consistent across project.bunnei2018-01-1349-49/+49
|
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-131-2/+0
|
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-134-249/+0
|
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
|
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
|
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
|
* core: Fix recent GCC build breaks.bunnei2018-01-121-2/+2
|
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
|
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
|
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1110-166/+423
|
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
| | | | This prevents missing frames if the vblank fires between the DequeueBuffer and Wait(vsync) calls
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
|
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
| | | | | | NVFlinger will call into the nvdisp_disp0 device to perform screen flips, bypassing the ioctl interface. We now have the address of the framebuffer to draw, we just need to actually put it on the screen.
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
| | | | | | Don't try to draw buffers that the guest application is using, only queued buffers are eligible for drawing. Drawing actual pixels is still not implemented.
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
|
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
|
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
|
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
|
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-115-0/+718
| | | | The homebrew display test application now properly writes graphics data to the graphics buffer but we still don't have a way to compose the display layers.
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
|
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
|
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
|
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
|
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-104-10/+25
|
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
|
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
|
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
|
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
|
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
|
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-098-159/+167
|
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
|
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-093-18/+16
| | | | | | Also properly keep track of data in guest memory, this fixes managing the semaphore from userland. It was found that Semaphores are actually Condition Variables, with Release(1) and Release(-1) being equivalent to notify_one and notify_all. We should change the name of the class to reflect this.
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-093-63/+60
|
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
|
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-093-11/+7
| | | | * CoreTiming: New CoreTiming; Add Test for CoreTiming
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
|
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
|
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
|
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
|
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
|
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
|
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
| | | | They should have 32 bits of padding after the error code now.
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
|
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
|
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
| | | | Popping objects from the buffer is still not implemented.
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
| | | | Service code now doesn't have to deal with this.
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
| | | | Domain object ids are always stored immediately after the raw data.
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
|
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
|
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
|
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
|
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
|
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
|
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
|
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
|
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
|
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
|
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-032-23/+11
|
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
|
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
|
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
|
* hle: Move SVC code to kernel namespace.bunnei2018-01-033-131/+118
|
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
|
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
|
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
|
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-011-2/+2
|
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
| | | | - This does not matter until we implement other kernel objects, mutexes use svcLockMutex for waiting.
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
|
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
|
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
|
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
|
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
| | | | This is kinda crufty, but we need it for now to update guest state variables.
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
|
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
|
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
|
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
|
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
|
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
|
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
|
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
|
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
|
* svc: Minor cleanups.bunnei2017-12-301-8/+9
|
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
|
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
|
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
|
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
|
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
|
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
|
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
|
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
|
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
|
* service: Add empty interface for pctl:a.bunnei2017-12-295-0/+86
|
* kernel: Add basic support for Domain object.bunnei2017-12-294-4/+110
|
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-293-10/+40
|
* svc: Implement MapMemory.bunnei2017-12-292-3/+16
|
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
|
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
|
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
|
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
|
* service: Add empty interface for aoc:u.bunnei2017-12-283-0/+42
|
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
|
* hle: Use Switch formatted result codes.bunnei2017-11-015-272/+86
|
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
|
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
|
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
|
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
|
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
|
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
|
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
|
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
|
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
|
* hle: Add service stubs for apm and appletOE.bunnei2017-10-159-2/+130
|
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1515-637/+567
|
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
|
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
|
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
|
* Remove more 3DS-specific code.bunnei2017-10-134-45/+0
|
* Remove more 3DS-specific code.bunnei2017-10-135-1411/+1
|
* Remove more 3DS-specific code.bunnei2017-10-131-9/+0
|
* Remove lots more 3DS-specific code.bunnei2017-10-1324-4161/+6
|
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10184-21488/+2
|
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-1066-610/+1824
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/CMakeLists.txt # src/core/arm/dynarmic/arm_dynarmic.cpp # src/core/arm/dyncom/arm_dyncom.cpp # src/core/hle/kernel/process.cpp # src/core/hle/kernel/thread.cpp # src/core/hle/kernel/thread.h # src/core/hle/kernel/vm_manager.cpp # src/core/loader/3dsx.cpp # src/core/loader/elf.cpp # src/core/loader/ncch.cpp # src/core/memory.cpp # src/core/memory.h # src/core/memory_setup.h
| * Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| |
| * Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-082-55/+49
| |\ | | | | | | Remove more usages of GetPointer.
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | |
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | |
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | |
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| | |
| * | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \ | | | | | | | | HLE/APT: Always set up the APT parameter when starting a library applet.
| | * | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only use the HLE interface if an HLE applet with the desired id was started. This commit reorganizes the APT code surrounding parameter creation and delivery to make it easier to support LLE applets in the future. As future work, the HLE applet interface can be reworked to utilize the same facilities as the LLE interface.
| * | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ | | |_|/ | |/| | SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it
| | * | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| | | | | | | | | | | | | | | | Also reference the right offset into the backing block for the requested address.
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-012-0/+12
| |\ \ \ | | | | | | | | | | Memory: Add overloads for ReadBlock and WriteBlock that operate on a specific process.
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| | | | |
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | | Services/NIM: Implement CheckForSysUpdateEvent.
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | Implementation verified by reverse engineering. This lets the Home Menu boot without crashing on startup.
| * | | | Moved down_count to CoreTimingHuw Pascoe2017-09-301-1/+1
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| | | | | | | | | | | | Services/UDS: Handle the rest of the connection sequence.
| * | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \ | | | | | | | | | | Implement PrepareToStartNewestHomeMenu and fixed an APT regression.
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | | | | | | | | | | | | | | | | | | | | | | | | As per 3dbrew: "During Home Menu start-up it uses APT:PrepareToStartNewestHomeMenu. If that doesn't return an error(normally NS returns 0xC8A0CFFC for that), Home Menu starts a hardware reboot with APT:StartNewestHomeMenu etc. "
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/| | | | | | | | | | | | | We need to know what is being run so we can set the APT parameter destination AppId correctly. Delaying the preparation of the parameter until we know which AppId is running lets us support booting both the Home Menu and normal game Applications.
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| | | | | | | | | | | | | | | | | | | | | | | | This change makes for a clearer (less confusing) path of execution in the scheduler, now the code to execute when a thread awakes is closer to the code that puts the thread to sleep (WaitSynch1, WaitSynchN). It also allows us to implement the special wake up behavior of ReplyAndReceive without hacking up WaitObject::WakeupAllWaitingThreads. If savestates are desired in the future, we can change this implementation to one similar to the CoreTiming event system, where we first register the callback functions at startup and assign their identifiers to the Thread callback variable instead of directly assigning a lambda to the wake up callback variable.
| * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3021-56/+59
| | | |
| * | | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| |/ / | | | | | | | | | Don't automatically assume that Thread::Create will only be called when the parent process is currently scheduled. This assumption will be broken when applets or system modules are loaded.
| * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-252-1/+24
| | | | | | | | | | | | | | | | | | | | | | | | The loaders now register each loaded ROM with the SelfNCCH factory, which keeps the data around for the duration of the emulation session. When opening the SelfNCCH archive, the factory queries the current program's programid and uses that as a key to the map that contains the NCCHData structure (RomFS, Icon, Banner, etc). 3dsx files do not have a programid and will use a default of 0 for this value, thus, only 1 3dsx file with RomFS is loadable at the same time.
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-251-7/+4
| |\ \ | | | | | | | | Switchable Page Tables
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-241-7/+4
| | |/ | | | | | | | | | Don't expose Memory::current_page_table as a global.
| * | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \ | | | | | | | | HLE/SRV: Implemented RegisterService.
| | * | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | |/ | | | | | | | | | Now system modules can do more than just crash immediately on startup.
| * / Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Added a function to generate the EAPoL-Start packet body. * Services/UDS: Added filter for beacons. * Services/UDS: Lock a mutex when accessing connection_status from both the emulation and network thread. * Services/UDS: Handle the Association Response frame and respond with the EAPoL-Start frame. * fixup: make use of current_node, changed received_beacons into a list, mutex and assert corrections * fixup: fix damn clang-format
| * Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-166-40/+73
| |\ | | | | | | Services/NS: Port ns:s to the new service framework.
| | * Services/NS: Port ns:s to the new service framework.Subv2017-09-166-40/+73
| | |
| * | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-155-30/+33
| |\ \ | | | | | | | | Kernel/Memory: Give each process its own page table and allow switching the current page table upon reschedule
| | * | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | | | | | | | | | | | | | | | We were unnecessarily clearing the cache when going from Process A -> Idle -> Process A, this caused extreme performance regressions.
| | * | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-152-25/+7
| | | |
| | * | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | | |
| | * | Kernel/Memory: Give each Process its own page table.Subv2017-09-102-5/+14
| | | | | | | | | | | | | | | | The loader is in charge of setting the newly created process's page table as the main one during the loading process.
| * | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \ | | | | | | | | | | APT: load different shared font depending on the region
| | * | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| | | | |
| * | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-056-53/+287
| |\ \ \ \ | | | | | | | | | | | | Services/UDS: Handle beacon frames and the basic AP connection sequence frames.
| | * | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | | | | |
| | * | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | | | | | | | | | | | | | | | | | | | | | | | There is currently no stage tracking, a client is considered "Connected" when it receives the EAPoL Logoff packet from the server, this is not yet implemented.
| | * | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | | | | |
| | * | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-274-11/+142
| | | | | |
| * | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| | | | | |
| * | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| | |/ / / | |/| | |
| * | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-291-4/+8
| |\ \ \ \ | | | | | | | | | | | | Refactor touch input into a TouchDevice
| | * | | | HID: use TouchDevice for touch padwwylele2017-08-241-4/+8
| | | |_|/ | | |/| |
| * / | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-293-3/+3
| |/ / /
| * | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-244-3/+36
| |\ \ \ | | | | | | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).
| | * | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-224-3/+36
| | | | | | | | | | | | | | | | | | | | This mutex is acquired in SVC::CallSVC, ie, as soon as the guest application enters the HLE kernel, and should be acquired by the aforementioned threads before modifying kernel structures.
| * | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \ | | | | | | | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.
| | * | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is necessary for loading multiple processes at the same time. The main thread will be automatically scheduled when necessary once the scheduler runs.
| * | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-211-0/+3
| | | | | |
| * | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| |/ / / /
| * | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-201-5/+27
| |\ \ \ \ | | |_|_|/ | |/| | | Refactor MotionEmu into a InputDevice
| | * | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | | | |
| | * | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-111-5/+27
| | | | |
| * | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \ | | | | | | | | | | | | dsp_dsp: Remove size assertion in LoadComponent
| | * | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| | | | | |
| * | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ | | |_|/ / / | |/| | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System)
| | * | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | | | | |
| | * | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / / | | | | | | | | | | | | | | | This gives each applet type its own set of events as per the real NS module.
| * | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \ | | | | | | | | | | | | HID: zero unused PadState bits
| | * | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | |/ / /
| * | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-091-1/+1
| |\ \ \ \ | | | | | | | | | | | | Update CryptoPP (byte ambiguity)
| | * | | | Update cryptoppJames2017-08-081-1/+1
| | |/ / /
| * / / / Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ / /
| * | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| | | |
| * | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \ | | | | | | | | | | Services/APT: Corrected the behavior of the Receive/Send/Glance/CancelParameter functions
| | * | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | | | |
| | * | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | | | |
| | * | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | | | |
| | * | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | | | |
| | * | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | | | |
| | * | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | |/ /
* | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-102-4/+4
| | | |
* | | | nso: Refactor and allocate .bss section.bunnei2017-09-302-8/+10
| | | |
* | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
| | | |
* | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
| | | |
* | | | core: Various changes to support 64-bit addressing.bunnei2017-09-302-21/+21
| | | |
* | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-302-2/+2
|/ / /
* | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-224-10/+9
|\ \ \ | |/ / |/| | Add address conversion functions returning optional, Add function to flush virtual region from rasterizer cache
| * | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-222-8/+7
| | | | | | | | | | | | | | | | | | This is slightly more ergonomic to use, correctly handles virtual regions which are disjoint in physical addressing space, and checks only regions which can be cached by the rasterizer.
| * | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-222-2/+2
| | | | | | | | | | | | And fix a few places in the code to take advantage of that.
* | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
| | |
* | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-164-22/+262
|\ \ \ | | | | | | | | load shared font from system archive
| * | | apt: load shared font from system archivewwylele2017-06-263-20/+258
| | | |
| * | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| |/ /
* | / Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| |/ |/|
* | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \ | | | | | | Kernel/SVC: Partially implemented svcReplyAndReceive
| * | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| | |
| * | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| | |
| * | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| | | | | | | | | | | | | | | | | | | | | | | | It behaves mostly as WaitSynchronizationN with wait_all = false, except for IPC buffer translation. The target thread of an IPC response will now wake up when responding. IPC buffer translation is currently not implemented. Error passing back to svcSendSyncRequest is currently not implemented.
| * | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
| | |
* | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-273-1/+432
|\ \ \ | | | | | | | | Services/UDS: Stub SendTo to generate the unencrypted data frames with the right headers
| * | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| | | |
| * | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-261-4/+1
| | | |
| * | | UDS: Run clang-format.Subv2017-06-263-51/+55
| | | |
| * | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| | | | | | | | | | | | | | | | The responsibility of encryption and encapsulation into an 802.11 MAC frame will fall into the callers of GenerateDataPayload.
| * | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| | | | | | | | | | | | | | | | It is likely that these 4 bytes are actually a different header, part of some protocol that encapsulates the SecureData protocol.
| * | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| | | |
| * | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-153-1/+259
| |/ /
* | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
| | |
* | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
| | | | | | | | | | | | The return parameters were flipped.
* | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
| | |
* | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \ | | | | | | | | Kernel: Implement CreateSession SVC
| * | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ | |/|
* / | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-211-7/+12
|/ / | | | | | | | | Missed this in my first implementation. Thanks to @wwylele for pointing out that this was missing.
* | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-211-0/+2
|\ \ | | | | | | Trivial no-op additions
| * | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/
* | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \ | | | | | | Remove ResultVal::MoveFrom
| * | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| | | | | | | | | | | | | | | Replace it with std::move(result_val).Unwrap(), or Foo().Unwrap() in case you already have an rvalue.
| * | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/
* | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \ | | | | | | UDS: Added a hook for updating the connection status when a client connects to the network.
| * | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| |/
* / Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
|/
* Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
| | | | | | | | | | * Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. This lets the application know that the host was successfully added to the session. * Services/UDS: Reset the connection status when destroying the network * Services/UDS: Reset the connection status's bitmask of changed nodes after reporting it to the game.
* Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
|
* Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
| | | | | Reduces the necessary allocation to max(in_handles, out_handles) rather than (in_handles + out_handles).
* Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
|
* Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
|
* IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
| | | | | These use the context functions to create and look-up handles for the user.
* IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
|
* Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
|
* ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
| | | | | | Copy the IPC command buffer to/from the request context before/after the handler is invoked. This is part of a move away from using global data for handling IPC requests.
* Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-098-63/+354
|\ | | | | New service framework
| * Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| |
| * Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| |
| * Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-084-3/+268
| | | | | | | | | | | | | | | | | | | | | | | | The old "Interface" class had a few problems such as using free functions (Which didn't allow you to write the service handler as if it were a regular class.) which weren't very extensible. (Only received one parameter with a pointer to the Interface object.) The new ServiceFramework aims to solve these problems by working with member functions and passing a generic context struct as parameter. This struct can be extended in the future without having to update all existing service implementations.
| * Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
| |
* | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-082-1/+2
| |
* | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
| | | | | | | | Fixes #2760
* | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ | |/ |/| Services/UDS: Implement DecryptBeaconData.
| * Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
| | | | | | | | This function decrypts the encrypted data tags contained in the 802.11 beacon frames.
* | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0631-12/+79
| | | | | | | | | | This has a huge fallout in terms of needing to fix other files because all service implementations included that file.
* | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-065-24/+145
| | | | | | | | Also enhances the GetServiceHandle implementation to be more accurate.
* | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
| | | | | | | | | | An Event was used way back then when we didn't have proper working semaphores. Our Semaphore implementation is good enough now.
* | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-063-7/+8
| | | | | | | | | | This will contain the implementation of the sm (Service Manager) system module.
* | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
| | | | | | | | | | | | This allows attaching a HLE handle to a ServerPort at any point after it is created, allowing port/session creation to be generic between HLE and regular services.
* | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
| |
* | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0613-73/+98
| | | | | | | | | | Most of the code that works with this is or will be in the kernel, so it's a more appropriate place for it to be.
* | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-031-1/+2
| | | | | | | | | | - Deleted GetStatus() because it wasn't used anywhere outside of Core::System. - Fixed design flaw where the message bar status could be set despite the game being stopped.
* | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-031-2/+1
| |
* | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-031-52/+2
| |
* | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-032-7/+53
| |
* | Made some changes from review comments:TheKoopaKingdom2017-06-032-9/+6
| | | | | | | | | | | | | | | | - Made LoadKernelSystemMode return a pair consisting of a system mode and a result code (Could use review). - Deleted ErrorOpenGL error code in favor of just having ErrorVideoCore. - Made dialog messages more clear. - Compared archive ID in fs_user.cpp to ArchiveIdCode::NCCH as opposed to hex magic. - Cleaned up some other stuff.
* | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-033-2/+12
| |
* | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \ | | | | | | CAM: use IPCHelper
| * | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| | |
| * | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| | |
| * | cam: use IPCHelperwwylele2017-05-241-278/+238
| | |
* | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3017-203/+240
| | |
* | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3012-132/+174
| | | | | | | | | | | | | | | Now that HandleTable doesn't directly depend on WaitObject anymore, this can be separated from the main kernel.h header.
* | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
| | | | | | | | | | | | | | | This isn't necessary anymore since plain Get works correctly for WaitObjects.
* | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| |/ |/|
* | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-282-2/+0
| |
* | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-281-1/+1
| |
* | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| |
* | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2522-132/+177
| |
* | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
| |
* | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-255-44/+19
| |
* | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
| | | | | | | | | | | | | | | | | | It is now known that result code description vary depending on the module, and so they're best defined on a per-module basis. To support this, allow passing in an arbitrary integer instead of limiting to the ones in the ErrorDescription enum. These will be gradually migrated to their individual users, but a few will be kept as "common" codes shared by all modules.
* | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-251-18/+15
|/
* Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-227-51/+83
|\ | | | | Kernel: Properly update port counters on session disconnection.
| * Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| | | | | | | | It is not meant to be used by anything other than CreateSessionPair.
| * Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| |
| * Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-157-32/+85
| | | | | | | | Reduce the associated port's connection count when a ServerSession is destroyed.
* | Merge pull request #2661 from Subv/uds5bunnei2017-05-194-33/+600
|\ \ | | | | | | Services/UDS: Generate 802.11 beacon frames when a network is open.
| * | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| | |
| * | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| | | | | | | | | | | | | | | This allows the applications to retrieve 802.11 beacon frames from nearby UDS networks. Note that the networks are still not announced anywhere.
| * | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-154-7/+535
| | |
* | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
| | |
* | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-144-45/+102
|\ \ \ | | | | | | | | Kernel: Map special regions according to ExHeader
| * | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-104-50/+102
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This replaces the hardcoded VRAM/DSP mappings with ones made based on the ExHeader ARM11 Kernel caps list. While this has no visible effect for most applications (since they use a standard set of mappings) it does improve support for system modules and n3DS exclusives.
| * | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-101-1/+6
| | | | | | | | | | | | | | | | Also move address space mapping out of video_core.
* | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-108-23/+207
|\ \ \ \ | |/ / / |/| | | ir: implement new 3ds HID via ir:rst
| * | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| | | |
| * | | ir: implement new 3ds HID via ir:rstwwylele2017-05-048-23/+206
| | | |
* | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-081-8/+2
| | | | | | | | | | | | | | | | | | | | This was now mostly unused except by thread creation, which used a symbol of the entrypoint, if available, to name the thread.
* | | | Create a random console_unique_id (#2668)B3n302017-05-062-5/+71
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Create a random console_id when config save_file is created Added button in system config to refresh the console unique id * Moved the connect for the button from .ui file to constructor of ConfigureSystem * Added warning and info dialog Fixup: Make use of qt5 style connects, renamed the refresh button, removed some duplicate code, changed random device and moved all to the generate function * Changed the random generator to reflect what a real 3DS stores as console unique id Fixup: Changed the warning message * Fixup: Set and Create * Fixup: Added console id label, therfore removed second message box * Fixup: fixed the endianess * Fixup: more endianness fixes * Fixup: Endianness the 3rd
* | | Merge pull request #2606 from wwylele/irbunnei2017-05-044-44/+757
|\ \ \ | | | | | | | | ir: implement circle pad pro
| * | | ir: implement circle pad prowwylele2017-05-034-44/+757
| | | |
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \ | |_|_|/ |/| | | ldr_ro: use IPC helper
| * | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| |/ /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | |_|/ |/| | dsp_dsp: Messages are modified by service before being sent to DSP
| * | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
| | |
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | |_|/ |/| | Services/UDS: Initial support for hosting local-wlan networks.
| * | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| | |
| * | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| | |
| * | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| | |
| * | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| | |
| * | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| | |
| * | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| | | | | | | | | | | | It will be needed when generating the beacon frames.
| * | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
| | | | | | | | | | | | Currently it will let games create a network as hosts, but will not broadcast it anywhere and will not allow clients to connect.
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \ | | | | | | | | IpcHelper enhancement and APT refactor
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| | | |
| * | | address more commentsLectem2017-03-191-20/+20
| | | |
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| | | |
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| | | |
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| | | |
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| | | |
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
| | | |
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \ | | | | | | | | | | shared_page: stub battery state
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
| | | | |
* | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
| | | | |
* | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
| | | | |
* | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
|/ / / /
* / / / apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / /
* | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-172-37/+56
|\ \ \ | | | | | | | | Refactor input emulation & add SDL gamepad support
| * | | Input: remove unused stuff & clean upwwylele2017-03-011-34/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | 1. removed zl, zr and c-stick from HID::PadState. They are handled by IR, not HID 2. removed button handling in EmuWindow 3. removed key_map 4. cleanup #include
| * | | HID: use AnalogDevicewwylele2017-03-011-2/+9
| | | |
| * | | HID: use ButtonDevicewwylele2017-03-012-1/+47
| |/ /
* | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \ | | | | | | | | Refined thread launch on syscore error messages
| * | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| |/ /
* / / cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
|/ /
* | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
| |
* | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ | | | | | | IR: separate functions of each port to their own files
| * | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
| | |
* | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
| | |
* | | Doxygen: Amend minor issues (#2593)Mat M2017-02-275-9/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects a few issues with regards to Doxygen documentation, for example: - Incorrect parameter referencing. - Missing @param tags. - Typos in @param tags. and a few minor other issues.
* | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-274-1/+4
|\ \ \ | |/ / |/| | Replace built-in Profiler with indicators in status bar
| * | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-271-2/+1
| | | | | | | | | | | | More ergonomic to use and will be required for upcoming changes.
| * | Add performance statistics to status barYuri Kunde Schlesner2017-02-271-0/+3
| | |
| * | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-273-1/+2
| | |
* | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-255-6/+149
|\ \ \ | | | | | | | | APT: implemented Wrap and Unwrap
| * | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| | | |
* | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
| | | |
* | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
| |/ / |/| |
* | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
| | | | | | | | | Fixes #2556
* | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
| | | | | | | | | Fixes #2567
* | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
| | |
* | | turned clang format back onnoah the goodra2017-02-141-1/+1
|/ /
* | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-132-1/+5
|\ \ | | | | | | file_sys: change RomFS archive to Self NCCH archive
| * | loader: use self NCCH archivewwylele2017-02-131-1/+1
| | |
| * | file_sys: add Self NCCH archivewwylele2017-02-131-0/+4
| | |
* | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-111-4/+0
|/ /
* | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-055-68/+363
|\ \ | | | | | | IPC helper
| * | fix wwylele's comment and use typename in templatesLectem2017-02-051-4/+4
| | |
| * | fix comments alignmentLectem2016-12-301-22/+22
| | |
| * | move Pop methods out of class bodyLectem2016-12-261-72/+88
| | |
| * | IPC helpers exampleLectem2016-12-263-35/+40
| | |
| * | IPC helpersLectem2016-12-262-48/+322
| | |
* | | Merge pull request #2496 from mailwl/cfg-memYuri Kunde Schlesner2017-02-041-5/+8
|\ \ \ | | | | | | | | Core: update Kernel Config Memory to latest version (11.2)
| * | | Core: update Kernel Config Memory to latest version (11.2)mailwl2017-01-301-5/+8
| | |/ | |/|
* | | GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
| | |
* | | HLE/Applets: Stub Mint (eShop) Applet (#2463)mailwl2017-01-313-0/+106
|/ / | | | | | | This allows Phoenix Wright - Dual Destinies to boot.
* | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-303-172/+1242
|\ \ | | | | | | CAM: build the service framework with a dummy implementation
| * | CAM: implement basic camera functions with a blank camerawwylele2017-01-113-172/+1242
| |/
* | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \ | | | | | | CFG: move language override to the boot process
| * | CFG: override language setting on bootwwylele2017-01-191-36/+38
| | |
* | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
| | |
* | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \ | | | | | | | | Service/NFC: stub some functions
| * | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
| | | | | | | | | | | | | | | | Tested on: Mini-Mario & Friends - amiibo Challenge
* | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
| | | |
* | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
| | | |
* | | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-161-3/+3
| | | |
* | | | HID: manages updating itself using correct tickswwylele2017-01-162-58/+93
|/ / /
* / / GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ /
* | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-124-32/+30
|\ \ | | | | | | Implement some TODOs in the code.
| * | Threads: Check the process' resource limit for the max allowed priority when creating a thread and remove the priority clamping code.Subv2017-01-112-13/+9
| | |
| * | Thread: Added priority range checking to svcSetThreadPriority and removed priority clamping code from Thread::SetPriority.Subv2017-01-113-18/+18
| | |
| * | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
| | |
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-128-295/+418
|\ \ \ | |/ / |/| | Service/AC: add ac:i service
| * | Service/AC: add ac:i servicemailwl2016-12-308-295/+418
| | |
* | | Merge pull request #2397 from Subv/pulsebunnei2017-01-105-13/+20
|\ \ \ | | | | | | | | Kernel: Implemented Pulse event and timers.
| * | | Kernel: Implemented Pulse event and timers.Subv2017-01-055-13/+20
| |/ / | | | | | | | | | Closes #1904
* | | Merge pull request #2410 from Subv/sleepthreadbunnei2017-01-073-0/+14
|\ \ \ | | | | | | | | Don't yield execution in SleepThread(0) if there are no available threads to run
| * | | Kernel: Don't attempt to yield execution in SleepThread(0) if there are no available threads to run.Subv2017-01-063-0/+14
| | | | | | | | | | | | | | | | With this we avoid an useless temporary deschedule of the current thread.
* | | | Merge pull request #2396 from Subv/sema_acquirebunnei2017-01-071-1/+2
|\ \ \ \ | | | | | | | | | | Kernel/Semaphore: Fixed a regression in semaphore waits.
| * | | | Kernel/Semaphore: Fixed a regression in semaphore waits.Subv2017-01-051-1/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | The regression was caused by a missing check in #2260. The new behavior is consistent with the real kernel.
* | | | Kernel: Fix SharedMemory objects always returning error when addr = 0 (#2404)Hyper2017-01-061-1/+5
| | | | | | | | | | | | Closes #2400
* | | | Merge pull request #2408 from Subv/priority_boostingbunnei2017-01-061-27/+0
|\ \ \ \ | | | | | | | | | | Kernel: Removed the priority boost code for starved threads.
| * | | | Kernel: Removed the priority boost code for starved threads.Subv2017-01-051-27/+0
| |/ / / | | | | | | | | | | | | | | | | | | | | After hwtesting and reverse engineering the kernel, it was found that the CTROS scheduler performs no priority boosting for threads like this, although some other forms of scheduling priority-starved threads might take place. For example, it was found that hardware interrupts might cause low-priority threads to run if the CPU is preempted in the middle of an SVC handler that deschedules the current (high priority) thread before scheduling it again.
* / / / Kernel: Remove some unused functions.Subv2017-01-052-32/+0
|/ / /
* | | Merge pull request #2393 from Subv/synchSebastian Valle2017-01-0517-159/+221
|\ \ \ | | | | | | | | Kernel: Mutex priority inheritance and synchronization improvements.
| * | | Kernel: Add some asserts to enforce the invariants in the scheduler.Subv2017-01-052-2/+13
| | | |
| * | | Kernel: Remove a thread from all of its waiting objects' waiting_threads list when it is awoken.Subv2017-01-051-18/+4
| | | | | | | | | | | | | | | | This fixes a potential bug where threads would not get removed from said list if they awoke after waiting with WaitSynchronizationN with wait_all = false
| * | | Kernel: Remove Thread::wait_objects_index and use wait_objects to hold all the objects that a thread is waiting on.Subv2017-01-054-21/+22
| | | |
| * | | Kernel: Use different thread statuses when a thread calls WaitSynchronization1 and WaitSynchronizationN with wait_all = true.Subv2017-01-043-16/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit removes the overly general THREADSTATUS_WAIT_SYNCH and replaces it with two more granular statuses: THREADSTATUS_WAIT_SYNCH_ANY when a thread waits on objects via WaitSynchronization1 or WaitSynchronizationN with wait_all = false. THREADSTATUS_WAIT_SYNCH_ALL when a thread waits on objects via WaitSynchronizationN with wait_all = true.
| * | | Kernel/Mutex: Propagate thread priority changes to other threads inheriting the priority via mutexesSubv2017-01-045-42/+60
| | | |
| * | | Kernel/Mutex: Update a mutex priority when a thread stops waiting on it.Subv2017-01-045-24/+42
| | | |
| * | | Kernel/Mutex: Implemented priority inheritance.Subv2017-01-045-31/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The implementation is based on reverse engineering of the 3DS's kernel. A mutex holder's priority will be temporarily boosted to the best priority among any threads that want to acquire any of its held mutexes. When the holder releases the mutex, it's priority will be boosted to the best priority among the threads that want to acquire any of its remaining held mutexes.
| * | | Kernel: Object ShouldWait and Acquire calls now take a thread as a parameter.Subv2017-01-0417-68/+56
| | | | | | | | | | | | | | | | This will be useful when implementing mutex priority inheritance.
| * | | Kernel/Synch: Do not attempt a reschedule on every syscall.Subv2017-01-042-2/+18
| |/ / | | | | | | | | | Not all syscalls should cause reschedules, this commit attempts to remedy that, however, it still does not cover all cases.
* | | Fix some warnings (#2399)Jonathan Hao2017-01-044-8/+6
| | |
* | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-305-0/+42
|/ / | | | | | | Fix Fatal Error in Mini-Mario & Friends - amiibo Challenge
* | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-302-2/+62
|\ \ | | | | | | Config: auto-select region and language
| * | Config: auto-select region and languagewwylele2016-12-072-2/+62
| | |
* | | Core: remove unused hle.cppwwylele2016-12-271-58/+0
| |/ |/|
* | core: Move emu_window and key_map into coreMerryMage2016-12-231-1/+1
| | | | | | | | * Removes circular dependences (common should not depend on core)
* | Service/NWM: add nwm servicesmailwl2016-12-2217-8/+301
| |
* | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-2213-135/+108
|\ \ | | | | | | Core: Top-level consolidate & misc cleanup
| * | ThreadContext: Move from "core" to "arm_interface".bunnei2016-12-222-4/+5
| | |
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-224-44/+43
| | |
| * | Address clang-format issues.bunnei2016-12-222-11/+12
| | |
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-2212-82/+53
| | |
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-225-45/+45
| | |
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-222-49/+92
|\ \ \ | |/ / |/| | csnd:SND: Reformat source code
| * | csnd:SND reformat source codemailwl2016-12-122-49/+92
| | |
* | | Thread: remove the thread from the thread list when exitingwwylele2016-12-173-3/+15
| | |
* | | Kernel: remove object's waiting thread if it is deadwwylele2016-12-161-1/+2
| | |
* | | Merge pull request #2260 from Subv/schedulingbunnei2016-12-167-195/+209
|\ \ \ | | | | | | | | Threading: Reworked the way our scheduler works.
| * | | Fixed the codestyle to match our clang-format rules.Subv2016-12-143-27/+39
| | | |
| * | | Properly remove a thread from its wait_objects' waitlist when it is awoken by a timeout.Subv2016-12-103-2/+11
| | | |
| * | | WaitSynch: Removed unused variables and reduced SharedPtr copies.Subv2016-12-094-73/+56
| | | | | | | | | | | | | | | | | | | | | | | | Define a variable with the value of the sync timeout error code. Use a boost::flat_map instead of an unordered_map to hold the equivalence of objects and wait indices in a WaitSynchN call.
| * | | Use boost remove_erase_if instead of the erase-remove idiomSubv2016-12-071-2/+3
| | | |
| * | | Improved the algorithm for GetHighestPriorityReadyThread.Subv2016-12-071-14/+13
| | | |
| * | | Threading: Added some utility functions and const correctness.Subv2016-12-043-15/+35
| | | |
| * | | Threading: Reworked the way our scheduler works.Subv2016-12-047-189/+179
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Threads will now be awakened when the objects they're waiting on are signaled, instead of repeating the WaitSynchronization call every now and then. The scheduler is now called once after every SVC call, and once after a thread is awakened from sleep by its timeout callback. This new implementation is based off reverse-engineering of the real kernel. See https://gist.github.com/Subv/02f29bd9f1e5deb7aceea1e8f019c8f4 for a more detailed description of how the real kernel handles rescheduling.
* | | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ \ | | | | | | | | | | Fix debug build from #2249
| * | | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
| | | | |
* | | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-167-13/+79
|\ \ \ \ \ | | | | | | | | | | | | Service/CECD: Add cecd:ndm service
| * | | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-157-13/+79
| | | | | |
* | | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Get rid of a double -> float truncation warning
| * | | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / / | |/| | | | | | | | | | | | | | | | float literals need to have the 'f' prefix.
* | | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-152-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Add missing #pragma once directives where applicable
| * | | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-152-0/+4
| |/ / / / /
* / / / / / act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / / | | | | | | | | | | | | | | | These aren't the AM services.
* | | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-157-6/+38
|\ \ \ \ \ | |/ / / / |/| | | | Service/ACT: move ACT services to folder
| * | | | Service/ACT: move ACT services to foldermailwl2016-12-147-6/+38
| | | | |
* | | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1523-168/+586
|\ \ \ \ \ | |/ / / / |/| | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.
| * | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-1416-68/+108
| | | | |
| * | | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-096-47/+38
| | | | |
| * | | | Kernel/IPC: Small codestyle cleanupSubv2016-12-092-3/+1
| | | | |
| * | | | Added a framework for partially handling Session disconnections.Subv2016-12-088-9/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Further implementation will happen in a future commit. Fixes a regression.
| * | | | Use std::move where appropriate.Subv2016-12-0811-177/+186
| | | | |
| * | | | Return an error code when connecting to a saturated port.Subv2016-12-055-7/+20
| | | | | | | | | | | | | | | | | | | | The error code was taken from the 3DS kernel.
| * | | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| | | | |
| * | | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-056-22/+59
| | | | | | | | | | | | | | | | | | | | HandleSyncRequest now takes care of calling the command buffer translate function before actually invoking the command handler for HLE services.
| * | | | Kernel: Remove the Redirection handle type.Subv2016-12-051-2/+0
| | | | |
| * | | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-0512-69/+86
| | | | |
| * | | | Declare empty ServerSession and ClientSession constructors as default.Subv2016-12-032-4/+4
| | | | |
| * | | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-012-3/+5
| | | | |
| * | | | Fixed the rebase mistakes.Subv2016-12-0110-82/+76
| | | | |
| * | | | A bit of a redesign.Subv2016-12-0113-263/+266
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sessions and Ports are now detached from each other. HLE services are handled by means of a SessionRequestHandler class, Interface now inherits from this class. The File and Directory classes are no longer kernel objects, but SessionRequestHandlers instead, bound to a ServerSession when requested. File::OpenLinkFile now creates a new session pair and binds the File instance to it.
| * | | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-016-26/+21
| | | | | | | | | | | | | | | | | | | | Pass the triggering ServerSession to the HLE command handler to differentiate which session caused the request.
| * | | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-014-24/+52
| | | | | | | | | | | | | | | | | | | | Interface is now used by aggregation in ClientPort, to forward service commands to their HLE implementation if needed.
| * | | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-014-5/+6
| | | | |
| * | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-0115-86/+310
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | All handles obtained via srv::GetServiceHandle or svcConnectToPort are references to ClientSessions. Service modules will wait on the counterpart of those ClientSessions (Called ServerSessions) using svcReplyAndReceive or svcWaitSynchronization[1|N], and will be awoken when a SyncRequest is performed. HLE Interfaces are now ClientPorts which override the HandleSyncRequest virtual member function to perform command handling immediately.
* | / / Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
| |/ / |/| |
* | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
| | |
* | | Add all services to the Service namespaceLioncash2016-12-1142-473/+378
| | | | | | | | | | | | | | | Previously there was a split where some of the services were in the Service namespace and others were not.
* | | Merge pull request #2291 from lioncash/svcbunnei2016-12-099-12/+59
|\ \ \ | | | | | | | | service: Add the cfg:nor service
| * | | service: Add cfg:nor serviceLioncash2016-12-093-0/+47
| | | |
| * | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
| | | |
* | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ | |/ / / |/| | | ptm: Use boolean instead of integral value
| * | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
| | | | | | | | | | | | | | | | The third parameter of Write is actually a bool type, not an int.
* | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
| | | | | | | | | | | | | | | | 3dbrew documents this as being the exact same as ptm:sysm
* | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
| | | | | | | | | | | | | | | | | | | | 3dbrew indicates that all services have access to these commands except for ptm:sets.
* | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
| | | | | | | | | | | | | | | | Inheriting from Service::Interface makes this obvious.
* | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-085-0/+86
| | | |
* | | | service: Add mvd and qtm servicesLioncash2016-12-0813-0/+259
| | | | | | | | | | | | | | | | | | | | | | | | Adds the two New3DS-only modules. 3dbrew was used for command information.
* | | | service: Add nfc servicesLioncash2016-12-087-30/+193
| | | | | | | | | | | | | | | | 3dbrew was used for the command information.
* | | | Merge pull request #2283 from lioncash/svcYuri Kunde Schlesner2016-12-0821-28/+212
|\ \ \ \ | | | | | | | | | | service: Update function tables
| * | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew
| * | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | nim: Update function tablesLioncash2016-12-082-0/+2
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | http_c: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| | | | |
| * | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew
| * | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| | | | |
| * | | | act: Update function tablesLioncash2016-12-082-0/+10
| | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
| |/ / / | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | Merge pull request #2281 from lioncash/appletYuri Kunde Schlesner2016-12-088-30/+22
|\ \ \ \ | |/ / / |/| | | applet: minor interface changes
| * | | applet: Move common IsRunning underlying variable to the Applet classLioncash2016-12-078-28/+19
| | | | | | | | | | | | | | | | Gets rid of basic duplication.
| * | | applet: Make virtual destructor defaultedLioncash2016-12-071-1/+1
| | | |
| * | | applet: Make constructor protectedLioncash2016-12-071-1/+2
| | | | | | | | | | | | | | | | | | | | Considering the class is abstract, there's no need to make the constructor public.
* | | | Update AM service function tablesLioncash2016-12-086-113/+246
| |_|/ |/| | | | | | | | Updated based off information from 3dbrew.
* | | Merge pull request #2232 from wwylele/other-savebunnei2016-12-073-2/+15
|\ \ \ | |/ / |/| | FS: implement archives for other game save data
| * | FileSys: Implement OtherSaveDatawwylele2016-11-293-0/+12
| | |
| * | FS: add missing MediaTypewwylele2016-11-291-1/+1
| | |
| * | FileSys: abstract SD save data archive sourcewwylele2016-11-291-1/+2
| | |
* | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| |/ |/| | | | | | | This function doesn't need to do anything for HLE and some games call it quite often, spamming up the logs.
* | Set client SDK version to Service APIsmailwl2016-11-307-13/+86
|/
* Merge pull request #2196 from Subv/system_modeYuri Kunde Schlesner2016-11-282-6/+4
|\ | | | | Kernel/Loader: Grab the system mode from the NCCH ExHeader.
| * Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-202-6/+4
| | | | | | | | | | | | | | 3dsx and elf files default to system mode 2 (96MB allocated to the application). This allows Home Menu to boot without modifications. Closes #1849
* | Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-285-43/+37
|\ \ | | | | | | Correct FS error codes & add path boundary checks
| * | FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-192-6/+5
| | | | | | | | | | | | According to the observation from game and 3dbrew "Used for accessing general NCCH data"
| * | PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| | |
| * | FileSys: add SDMCWriteOnlyArchivewwylele2016-11-192-0/+9
| | |
| * | FileSys: add ExtSaveDataArchivewwylele2016-11-191-0/+1
| | | | | | | | | | | | ExtSaveData is more similar to SaveData, so let it be a subclass of SaveData
| * | FileSys: add SaveDataArchivewwylele2016-11-191-0/+7
| | | | | | | | | | | | The error checking of SaveDataArchive is completely different from DiskArchive, so it has to be a new class instead of a subclass of DiskArchive.
| * | FileSys: make Archive interfaces return error codewwylele2016-11-011-32/+9
| | | | | | | | | | | | and make the mode parameter a reference since it is a BitField union
* | | Output parameters to logmailwl2016-11-251-4/+6
| | |
* | | MIC_U: Stub service funcionsmailwl2016-11-252-16/+305
| | |
* | | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Bravely Default/Second stuck #1822 CancelLibraryApplet stub * Log parameter. * Taking care of comments * Sync with 3DBrew * White space ? * lower case
* | | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ \ | | | | | | | | cfg: add config block 0x00090000
| * | | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
| | |/ | |/|
* | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \ | | | | | | | | Rework the code of err:f service!
| * | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
| | | |
* | | | Merge pull request #2193 from Subv/pulse_eventsbunnei2016-11-202-0/+10
|\ \ \ \ | | | | | | | | | | Kernel/Events: Log an error when trying to create Pulse events and timers
| * | | | Kernel/Events: Log an error when trying to create Pulse events and timers.Subv2016-11-192-0/+10
| | |/ / | |/| | | | | | | | | | Related to #1904
* / | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-195-16/+27
|/ / / | | | | | | | | | Names now make sense and match 3dbrew.
* | | Style fixmailwl2016-11-021-2/+2
| | |
* | | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
| | |
* | | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
| |/ |/|
* | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \ | | | | | | NWM: stub Initialize with an error
| * | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| |/
* | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/soc_u.cpp:107:6: error: 'ENODATA' was not declared in this scope {ENODATA, 43}, ^ src/core/hle/service/soc_u.cpp:117:6: error: 'ENOSR' was not declared in this scope {ENOSR, 53}, ^ src/core/hle/service/soc_u.cpp:118:6: error: 'ENOSTR' was not declared in this scope {ENOSTR, 54}, ^ src/core/hle/service/soc_u.cpp:139:6: error: 'ETIME' was not declared in this scope {ETIME, 75}, ^
* | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
| |
* | Fix typosRicardo de Almeida Gonzaga2016-10-203-3/+3
| |
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-083-4/+1808
|\ \ | |/ |/| Update the stub code of BOSS
| * Update the stub code of BOSSJamePeng2016-10-023-4/+1808
| |
* | Merge pull request #1652 from wwylele/kernal-toolbunnei2016-10-057-7/+26
|\ \ | | | | | | Debugger: implement wait tree widget
| * | move ResetType to kernel.hwwylele2016-09-223-7/+6
| | |
| * | name objectswwylele2016-09-221-0/+4
| | |
| * | implement wait tree widgetwwylele2016-09-224-0/+16
| |/
* | fs: clean up log formatwwylele2016-10-021-22/+24
| |
* | fs: implement DeleteDirectoryRecursivelywwylele2016-10-023-1/+51
|/
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-2172-72/+72
|
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-2182-210/+71
| | | | | | | This makes clang-format useful on those. Also add a bunch of forgotten transitive includes, which otherwise prevented compilation.
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-1971-362/+383
|
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-18132-3462/+4009
|
* arm: ResetContext shouldn't be part of ARM_Interface.bunnei2016-09-151-1/+17
|
* Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\ | | | | Auto-detect original shared_font.bin memory base
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
| | | | | | | | | | This allows a file dumped from either an o3DS or a n3DS (and potentially even an original unrebased file) to be used.
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-298-97/+3007
|\ \ | | | | | | Implemented CRO
| * | LDR: Implement CROwwylele2016-08-278-97/+3007
| |/
* / fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-025-22/+110
|/
* Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\ | | | | Correct APT::0x00550040 and APT::0x00560000 function
| * Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
| |
* | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
| |
* | HLE: implement system timewwylele2016-07-232-2/+60
|/
* Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-106-37/+253
|\ | | | | Implement config savegame editing & clean up
| * Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| |
| * Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| |
| * Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| |
| * Service::CFG: add missing languagewwylele2016-07-021-1/+2
| |
| * Service::CFG: name sound output modeswwylele2016-07-022-2/+7
| |
* | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-072-10/+15
|\ \ | | | | | | Fix the errorcode of archive handle
| * | Fix the errorcode of archive handleJamePeng2016-07-042-10/+15
| | |
* | | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ \ | | | | | | | | HLE/FS: Document some command parameters and implemented command 0x08560240
| * | | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
| | | |
* | | | HLE/Applets: Implement ErrEula appletmailwl2016-07-044-0/+116
| |/ / |/| |
* | | Result: fix and update ErrorModulewwylele2016-06-301-6/+19
| |/ |/|
* | Merge pull request #1869 from wwylele/dont-be-lazyYuri Kunde Schlesner2016-06-291-2/+6
|\ \ | | | | | | Switch context to the same thread if necessary
| * | Switch context on the same thread if necessarywwylele2016-05-301-2/+6
| | |
* | | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-292-15/+125
|\ \ \ | | | | | | | | srv: Update according 3dbrew
| * | | Fix parameter name in EnableNotificationmailwl2016-05-312-2/+6
| | | |
| * | | Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| | | |
| * | | remove ugly functionmailwl2016-05-311-35/+3
| | | |
| * | | srv: Update according 3dbrewmailwl2016-05-311-15/+137
| |/ /
* | | Merge pull request #1877 from wwylele/wait-fix-timeoutbunnei2016-06-181-0/+49
|\ \ \ | |_|/ |/| | Thread: update timeout when reruning WaitSynch
| * | Thread: update timeout when rerunning WaitSynchwwylele2016-06-041-0/+49
| |/
* | Merge pull request #1842 from Subv/portsbunnei2016-06-127-3/+174
|\ \ | | | | | | Kernel: Added ClientPort and ServerPort classes, along with svcCreatePort.
| * | Kernel/SVC: Implemented svcCreatePort.Subv2016-06-116-3/+41
| | |
| * | Kernel: Added ClientPort and ServerPort classes.Subv2016-06-055-2/+135
| | | | | | | | | | | | This is part of an ongoing effort to implement support for multiple processes.
* | | hid: add missing headerwwylele2016-06-111-0/+2
| | |
* | | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-112-35/+36
|\ \ \ | | | | | | | | Refactor input mapping & implement circle pad modifier
| * | | fixup! fixup! Refactor input systemwwylele2016-05-151-1/+1
| | | |
| * | | Refactor input subsystemwwylele2016-05-152-35/+36
| | | |
* | | | service: Add other DLP servicesLioncash2016-06-059-21/+142
| |/ / |/| | | | | | | | | | | | | | Specifically, dlp::CLNT and dlp::FKCL Moves them to their own folder like with other services.
* | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-012-15/+22
| |/ |/|
* | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-3013-128/+202
|\ \ | | | | | | Memory: Remove most usages of GetPointer
| * | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-281-1/+0
| | |
| * | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-282-13/+11
| | |
| * | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| | |
| * | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| | |
| * | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| | |
| * | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| | |
| * | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| | |
| * | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| | |
| * | APT: Remove use of Memory::GetPointerMerryMage2016-05-215-35/+36
| | |
| * | Kernel/Thread: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| | |
| * | Applets/swkdb: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| | |
* | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \ | | | | | | | | Config block: clean up
| * | | clean up config blockwwylele2016-05-031-29/+13
| | | |
* | | | Merge pull request #1855 from MerryMage/memory-headers-20160526Mat M2016-05-261-0/+1
|\ \ \ \ | | | | | | | | | | Memory: Added necessary headers and removed unnecessary header
| * | | | Memory: Added necessary headers and removed unnecessary headerMerryMage2016-05-261-0/+1
| | |/ / | |/| |
* | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-241-2/+2
| | | |
* | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-248-10/+135
|\ \ \ \ | | | | | | | | | | Implement CheckNew3DS and CheckNew3DSApp
| * | | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-208-10/+135
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Append an item[is_new3ds] to config file[System] group Implement APT::SetNSStateField,it will update the unknown NS_state_field
* | | | | SVC::WaitSynchronizationN: Reschedule at the endwwylele2016-05-211-2/+3
| |/ / / |/| | |
* | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-184-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Update ACT_U * Create act_a.h * Create act_a.cpp * Add service ACT:A * Add ACT:A source and header * Fix wrong header
* | | | Merge pull request #1800 from JayFoxRox/set-fpscrbunnei2016-05-182-0/+5
|\ \ \ \ | | | | | | | | | | Set fpscr for new threads
| * | | | Set fpscr for new threadsJannik Vogel2016-05-172-0/+5
| | | | |
* | | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|_|/ |/| | |
* | | | Memory: Fixed a regression caused by #1695 and #1689.Subv2016-05-141-0/+3
|/ / / | | | | | | | | | | | | | | | Reserve enough space in the vector that holds the linear heap memory to prevent relocations of the backing memory when growing too much. Closes #1790
* | | Merge pull request #1689 from Subv/shmembunnei2016-05-1317-128/+415
|\ \ \ | | | | | | | | Kernel: Implemented shared memory.
| * | | HLE/Applets: Give each applet its own block of heap memory, and use that when creating the framebuffer shared memory block.Subv2016-05-135-5/+44
| | | |
| * | | Kernel: Account for automatically-allocated shared memories in the amount of used linear heap memory.Subv2016-05-131-0/+5
| | | |
| * | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-133-66/+165
| | | |
| * | | Kernel/SharedMemory: Log an error when Map fails.Subv2016-05-131-1/+10
| | | |
| * | | Kernel: Implemented shared memory permissions.Subv2016-05-134-9/+50
| | | |
| * | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
| | | |
| * | | Kernel/Memory: Remove the Shared Memory region from the legacy memory map.Subv2016-05-131-1/+0
| | | |
| * | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-1310-118/+147
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Applications can request the kernel to allocate a piece of the linear heap for them when creating a shared memory object. Shared memory areas are now properly mapped into the target processes when calling svcMapMemoryBlock. Removed the APT Shared Font hack as it is no longer needed.
| * | | Kernel/SVC: Fixed the register order for svcCreateMemoryBlock.Subv2016-05-132-2/+3
| | | | | | | | | | | | | | | | R0 is used as the last parameter instead of R4.
* | | | Merge pull request #1695 from Subv/tls_allocbunnei2016-05-134-22/+74
|\ \ \ \ | |/ / / |/| | | Kernel/Threads: Dynamically allocate the TLS region for threads.
| * | | Kernel/Threads: Dynamically allocate the TLS region for threads in the BASE region of the linear heap.Subv2016-05-074-22/+74
| | | | | | | | | | | | | | | | | | | | | | | | Each thread gets a 0x200-byte area from the 0x1000-sized page, when all 8 thread slots in a single page are used up, the kernel allocates a new page to hold another 8 entries. This is consistent with what the real kernel does.
* | | | Merge pull request #1766 from Subv/log_cpubunnei2016-05-082-0/+7
|\ \ \ \ | | | | | | | | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1)
| * | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1).Subv2016-05-072-0/+7
| |/ / / | | | | | | | | | | | | We do not currently implement any cores other than the AppCore (Core 0).
* | | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-071-2/+2
|\ \ \ \ | | | | | | | | | | fixup simple type conversions where possible
| * | | | fixup simple type conversions where possibleAlexander Laties2016-05-071-2/+2
| | | | |
* | | | | Merge pull request #1761 from Subv/applets_fbbunnei2016-05-075-23/+44
|\ \ \ \ \ | |/ / / / |/| | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory
| * | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-075-23/+44
| | |_|/ | |/| |
* | | | Merge pull request #1762 from bunnei/globalbunnei2016-05-063-7/+20
|\ \ \ \ | | | | | | | | | | hle: Get rid of direct global access to g_reschedule
| * | | | HLE: Rename RescheduleIsPending to IsReschedulePending.bunnei2016-05-062-2/+2
| | | | |
| * | | | hle: Get rid of global access to g_rescheduleLioncash2016-03-213-7/+20
| | | | | | | | | | | | | | | | | | | | | | | | | This shouldn't be directly exposed if there's already a partial API that operates on it. We can just provide the rest of that API.
* | | | | Layout Mii parameters input/output, and return success as result of applet workmailwl2016-05-052-0/+49
| |/ / / |/| | |
* | | | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \ \ \ | | | | | | | | | | add config block 0x00170000; remove duplicated content
| * | | | remove duplicated function declarationwwylele2016-05-011-13/+0
| | | | |
| * | | | add config block 0x00170000wwylele2016-04-291-0/+4
| | | | |
* | | | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-302-1/+1
| | | | |
* | | | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \ \ \ | | | | | | | | | | | | Update the stub code of NDM service!
| * | | | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
| | | | | |
* | | | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-302-1/+29
|\ \ \ \ \ \ | | | | | | | | | | | | | | ac:u: stub CloseAsync; align memory size in svc:GetProcessInfo(type=2)
| * | | | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-212-1/+29
| |/ / / / /
* | | | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functions
| * | | | | return checks if event and memory createdmailwl2016-04-231-1/+8
| | | | | |
| * | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
| | | | | |
* | | | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-292-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | This has been entirely superseded by MicroProfile. The rest of the code can go when a simpler frametime/FPS meter is added to the GUI.
* | | | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-273-59/+152
|\ \ \ \ \ \ | | | | | | | | | | | | | | DSP Service: Cleanup
| * | | | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| | | | | | |
| * | | | | | DSP_DSP: Add return IPC headersMerryMage2016-04-272-4/+27
| | | | | | |
| * | | | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-272-42/+106
| | | | | | |
| * | | | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
| | | | | | |
* | | | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
| | | | | | |
* | | | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Update the code of service y2r!
| * | | | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|/ / / / | |/| | | | |
* | | | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
| |/ / / / / |/| | | | |
* | | | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
| |/ / / / |/| | | |
* | | | | HWRasterizer: Texture forwardingtfarley2016-04-213-24/+18
|/ / / /
* | | | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ \ \ | |_|/ / |/| | | SOC:U GetSockOpt/SetSockOpt
| * | | Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| | | |
| * | | Code styleRyan Loebs2016-03-301-2/+2
| | | |
| * | | Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| | | | | | | | | | | | | | | | Filter out and translate invalid sockopt names.
| * | | Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| | | |
| * | | But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| | | |
| * | | Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| | | |
| * | | Formatting...Ryan Loebs2016-03-291-1/+1
| | | |
| * | | Addressing PR commentsRyan Loebs2016-03-291-4/+4
| | | |
| * | | SOC UpdatesRyan Loebs2016-03-291-3/+46
| | | | | | | | | | | | | | | | | | | | | | | | -Implement GetSockOpt / SetSockOpt -Fix bug in RecvFrom where sending from localhost does not fill in src_addr/src_addr_len on Linux
* | | | core: Clean out some unnecessary header includesLioncash2016-04-162-9/+0
| | | |
* | | | Set Kernel config "Unknown Value" to 0x1mailwl2016-04-112-2/+7
| |_|/ |/| |
* | | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
| | |
* | | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-083-0/+28
| | |
* | | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \ \ | | | | | | | | Append the missing function name"GetAppletInfo", "SetAppCpuTimeLimit" and "GetAppCpuTimeLimit" to APT:A
| * | | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| | | |
| * | | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| | | |
| * | | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
| | | |
* | | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-064-55/+234
|\ \ \ \ | | | | | | | | | | frd:u: Initial stub some functions
| * | | | frd:u: Initial stub some functionsmailwl2016-03-274-55/+234
| | |/ / | |/| |
* | | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-062-8/+8
|\ \ \ \ | |_|/ / |/| | | Common: Remove Common::make_unique, use std::make_unique
| * | | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-052-8/+8
| | |/ | |/|
* | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-033-0/+61
|\ \ \ | | | | | | | | Dummy implementation dlp:SRVR Service.
| * | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-023-0/+61
| | | |
* | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-023-3/+54
|\ \ \ \ | | | | | | | | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandle
| * | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-313-3/+54
| | | | |
* | | | | Merge pull request #1390 from purpasmart96/citra_gsp_error_codesbunnei2016-04-013-80/+97
|\ \ \ \ \ | | | | | | | | | | | | GSP: Return proper error codes for register writes
| * | | | | GSP: Return proper error codes for register writespurpasmart962016-03-313-80/+97
| |/ / / /
* | | | | Merge pull request #1419 from mailwl/branch-gspbunnei2016-03-311-6/+41
|\ \ \ \ \ | |/ / / / |/| | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueue
| * | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueuemailwl2016-03-311-6/+41
| | |_|/ | |/| |
* / | | Add common methods to all cfg:* portsRyan Loebs2016-03-293-0/+21
|/ / /
* | | use reference instead of pointerwwylele2016-03-261-9/+9
| | |
* | | Merge pull request #1549 from wwylele/acc_gyrobunnei2016-03-264-23/+187
|\ \ \ | |/ / |/| | hid: implement accelerometer and gyroscope back-end
| * | implement GyroscopeCalibrateParamwwylele2016-03-252-9/+20
| | |
| * | implement accel and gyro backendwwylele2016-03-224-23/+176
| | |
* | | Merge pull request #1559 from lioncash/vecbunnei2016-03-211-8/+5
|\ \ \ | | | | | | | | soc_u: Get rid of explicit delete and new
| * | | soc_u: Get rid of explicit delete and newLioncash2016-03-211-8/+5
| | |/ | |/|
* / | session: Make helper functions constexprLioncash2016-03-211-6/+6
|/ /
* | HLE/FS: Change the error code returned when an ExtSaveData archive is not found.Subv2016-03-201-4/+8
| | | | | | | | This allows Fire Emblem to boot again.
* | HLE/FS: Corrected some style concerns.Subv2016-03-204-6/+4
| |
* | HLE/FS: Fixed creating the config savefile when it doesn't exist.Subv2016-03-201-1/+1
| | | | | | | | This fixes a regression.
* | HLE/FS: Implemented GetFormatInfoSubv2016-03-206-48/+127
| | | | | | | | Format information is currently only implemented for the ExtSaveData, SharedExtSaveData and SaveData archives, the information is stored in a file alongside the root folder of the archive.
* | HLE/FS: Don't return an error when deleting the ExtSaveData if it does not exist.Subv2016-03-201-1/+1
| |
* | HLE/FS: Return the proper error codes when opening files.Subv2016-03-201-3/+4
| |
* | HLE/FS: Fixed the OpenDirectory error codeSubv2016-03-201-1/+1
| |
* | HLE/FS: Return the proper error codes on file Read/Write operations.Subv2016-03-202-2/+16
| | | | | | | | These operations are limited by the open flags specified while opening the file.
* | HLE/FS: Corrected the error codes for DeleteFileSubv2016-03-201-4/+1
| |
* | HLE/FS: Corrected the error codes for CreateFileSubv2016-03-201-1/+3
| |
* | HLE/FS: FS::CreateFile takes an u64 for the file size.Subv2016-03-203-5/+5
|/
* Merge pull request #1505 from pippo2931/fefbunnei2016-03-181-1/+25
|\ | | | | GetArchiveResource stub
| * Fix headerpippo29312016-03-121-1/+1
| |
| * GetArchiveResource stubpippo29312016-03-121-1/+25
| |
* | Reorganize the ndm service path for dummy implement functionJamePeng2016-03-145-24/+118
| | | | | | | | | | | | SuspendDaemons , ResumeDaemons , OverrideDefaultDaemons The NDM file move to /core/hle/service/ndm/ now!
* | hid: fix pad updatewwylele2016-03-131-1/+1
| |
* | svc: Move ResetType enum to the kernel event headerLioncash2016-03-1310-16/+17
| |
* | svc: Remove unused ArbitrationType enumLioncash2016-03-121-9/+0
| | | | | | | | An equivalent enum already exists within address_arbiter.h
* | svc: Make ResetType an enum classLioncash2016-03-1211-24/+23
|/
* Merge pull request #1266 from Subv/miiappletbunnei2016-03-126-2/+154
|\ | | | | HLE/Applets: Implemented a dummy Mii Selector applet.
| * HLE/Applets: Implemented a dummy Mii Selector applet.Subv2016-03-126-2/+154
| | | | | | | | This prevents some games (like Super Mario 3D Land) from freezing when trying to launch it, however, it's not complete and won't let you go past Mii selection as the parameter structure hasn't been reverse engineered yet.
* | Merge pull request #1500 from lioncash/nullptrbunnei2016-03-121-1/+1
|\ \ | | | | | | gsp_gpu: Change 0 literal to nullptr
| * | gsp_gpu: Change 0 literal to nullptrLioncash2016-03-121-1/+1
| | |
* | | hle: Update service function tablesLioncash2016-03-124-1/+16
|/ /
* | renderer_base: Don't directly expose the rasterizer unique_ptrLioncash2016-03-092-5/+5
| | | | | | | | | | There's no reason to allow direct access to the unique_ptr instance. Only its contained pointer.
* | DSP: Implement Pipe 2MerryMage2016-03-061-43/+151
| | | | | | | | | | | | Pipe 2 is a DSP pipe that is used to initialize both the DSP hardware (the application signals to the DSP to initialize) and the application (the DSP provides the memory location of structures in the shared memory region).
* | Memory: Do correct Phys->Virt address translation for non-APP linheapYuri Kunde Schlesner2016-03-062-2/+5
| |
* | Merge pull request #1455 from yuriks/ResultVal-unionMathew Maidment2016-03-061-42/+16
|\ \ | | | | | | core: Use unrestricted union to hold storage of ResultVal value
| * | core: Use unrestricted union to hold storage of ResultVal valueYuri Kunde Schlesner2016-03-051-42/+16
| | |
* | | DSP: Print hash of firmware to consoleMerryMage2016-03-061-8/+21
|/ /
* | Merge pull request #1429 from mailwl/branch-acubunnei2016-03-051-2/+17
|\ \ | | | | | | ac:u IsConnected implemented
| * | ac:u: Stub IsConnectedmailwl2016-03-041-2/+17
| | |
* | | Merge pull request #1389 from yuriks/stub-cambunnei2016-03-043-20/+563
|\ \ \ | |/ / |/| | Stub CAM:U service
| * | Service/CAM: Add doxycomments to all service functionsYuri Kunde Schlesner2016-03-011-0/+217
| | |
| * | Service/CAM: Dummy implementation of some functionsYuri Kunde Schlesner2016-02-133-20/+346
| | | | | | | | | | | | Thanks to @mailwl for the initial version of the stubs.
* | | Merge pull request #1434 from Kloen/legendbunnei2016-03-021-0/+1
|\ \ \ | | | | | | | | Add THREADPROCESSORID_ALL on SVC::CreateThread
| * | | ThreadProcessorId_All on SVC::CreateThreadKloen2016-03-011-0/+1
| | | |
* | | | Service/CFG: Fix potential endianess issueYuri Kunde Schlesner2016-03-011-2/+3
| | | |
* | | | Service/CFG: Add block 0x000A0000 (username) to default config fileYuri Kunde Schlesner2016-03-011-1/+14
|/ / /
* | | Initial implementation ir:usermailwl2016-02-263-18/+142
| | |
* | | AudioCore: Skeleton ImplementationMerryMage2016-02-213-58/+94
| | | | | | | | | | | | | | | | | | | | | | | | | | | This commit: * Adds a new subproject, audio_core. * Defines structures that exist in DSP shared memory. * Hooks up various other parts of the emulator into audio core. This sets the foundation for a later HLE DSP implementation.
* | | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-127-20/+20
|/ /
* | services: Get rid of unnecessary includesLioncash2016-02-0269-132/+32
| |
* | services: Update function tablesLioncash2016-02-022-5/+11
| |
* | Memory: Implement MMIOMerryMage2016-01-302-4/+8
| |
* | Merge pull request #1327 from Subv/unmap_memblockbunnei2016-01-155-5/+60
|\ \ | | | | | | HLE/SVC: Implement UnmapMemoryBlock.
| * | HLE/SVC: Implement UnmapMemoryBlock.Subv2016-01-145-5/+60
| | | | | | | | | | | | This implementation will need to be (almost completely) changed when we implement multiprocess support.
* | | Merge pull request #1283 from Subv/soc_fixupbunnei2016-01-051-3/+13
|\ \ \ | | | | | | | | HLE/Sockets: Fixed the buffer offset in recvfrom.
| * | | HLE/Sockets: Fixed the buffer offset in recvfrom.Subv2015-12-241-3/+13
| | | | | | | | | | | | | | | | Closes #1277
* | | | services: Update some function tablesLioncash2015-12-3025-113/+369
| |/ / |/| |
* | | HLE/Timers: Reset OneShot timers when they are acquired instead of when they're triggered.Subv2015-12-301-3/+3
| | | | | | | | | | | | Closes #1139
* | | Merge pull request #1300 from Subv/arbitrateaddressbunnei2015-12-292-9/+18
|\ \ \ | | | | | | | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.
| * | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.Subv2015-12-282-9/+18
| | | | | | | | | | | | | | | | This was verified with hwtests that i plan to upload later on.
* | | | svc: Remove superfluous printf argumentLioncash2015-12-251-1/+1
|/ / /
* / / svc: Fix compilation with LOG_TRACE enabledLioncash2015-12-131-1/+1
|/ /
* | VideoCore: Unify interface to OpenGL and SW rasterizersYuri Kunde Schlesner2015-12-082-5/+5
| | | | | | | | | | | | This removes explicit checks sprinkled all over the codebase to instead just have the SW rasterizer expose an implementation with no-ops for most operations.
* | VideoCore: Rename HWRasterizer methods to be less confusingYuri Kunde Schlesner2015-12-072-5/+5
| |
* | Merge pull request #1252 from Subv/cambunnei2015-12-041-0/+156
|\ \ | |/ |/| Services/Cam: Added new log type and camera enums from 3dbrew.
| * Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-231-0/+156
| | | | | | | | | | Followup to #1102 Original author @mailwl
* | Kernel: Implement svcGetSystemInfoYuri Kunde Schlesner2015-12-017-1/+95
| | | | | | | | | | This makes smealum/ctrulib@b96dd51d3349961189d4ab1bc2a5c45deff21c09 work with Citra.
* | Merge pull request #1225 from lioncash/cleanbunnei2015-11-291-12/+13
|\ \ | | | | | | csnd_snd: Get rid of type punning
| * | csnd_snd: Get rid of type punningLioncash2015-10-281-12/+13
| | |
* | | Add stub functions for Initialize and GenerateRandomData in ssl:Cpolaris-2015-11-221-2/+51
| |/ |/|
* | Add Initialize and GenerateRandomData stubspolaris-2015-11-221-0/+2
|/
* Merge pull request #1165 from esoteric-programmer/masterbunnei2015-10-282-4/+66
|\ | | | | Added CSND_ExecuteType0Commands stub.
| * Added CSND stub.Matthias Ernst2015-10-282-4/+66
| |
* | Merge pull request #1208 from archshift/free-bytesbunnei2015-10-283-1/+42
|\ \ | | | | | | Implement FS_User::GetFreeBytes
| * | Implement FS_User::GetFreeBytesarchshift2015-10-283-1/+42
| | |
* | | Fix copy pasteFiliph Sandström2015-10-241-1/+1
| | |
* | | Fix wrong branchFiliph Sandström2015-10-231-0/+12
| | |
* | | Add GetTotalStepCount StubFiliph Sandström2015-10-231-1/+1
| | |
* | | Update ptm.hFiliph Sandström2015-10-231-0/+8
|/ /
* | Silence -Wsign-compare warnings.Rohit Nirmal2015-10-071-1/+1
| |
* | Service/CFG: Use a constexpr function for country initializationEmmanuel Gil Peyrot2015-09-301-4/+3
| | | | | | | | This fixes a TODO left over from when we supported MSVC 2013.
* | fix some xcode 7.0 warningsMartin Lindhe2015-09-291-1/+1
| |
* | general: Silence some warnings when using clangLioncash2015-09-165-10/+12
|/
* Service/CFG: Add default entry for block 0x000A0001 (birthday)Yuri Kunde Schlesner2015-09-141-0/+6
|
* Service/CFG: Correct flags in 2 default blocksYuri Kunde Schlesner2015-09-141-2/+2
| | | | Verified against a 9.2.0-20 config save
* Service/CFG: Add additional blocks to default save dataYuri Kunde Schlesner2015-09-141-0/+34
| | | | These blocks are required by various games to boot.
* Fix narrowing conversion warningYuri Kunde Schlesner2015-09-141-1/+1
|
* Service/CFG: Move several private types from the header to the cppYuri Kunde Schlesner2015-09-142-63/+49
|
* Service/CFG: Clean up default block creationYuri Kunde Schlesner2015-09-142-27/+17
|
* GSP: Implement command 0x05, used for flushing cachesYuri Kunde Schlesner2015-09-142-13/+34
| | | | | | May fix additional texture caching issues. (Though mostly in homebrew, I haven't seen any commercial software use this to flush anything but command lists.)
* General: Replace NULL and '0' usages with nullptr where applicableLioncash2015-09-111-1/+1
|
* General: Fix up doxygen commentsLioncash2015-09-104-7/+4
|
* Merge pull request #1101 from archshift/camu-service-namesbunnei2015-09-031-3/+60
|\ | | | | Add cam:u service function names to its function table
| * Add cam:u service function names to its function tablearchshift2015-09-031-3/+60
| |
* | Merge pull request #1072 from yuriks/GetSystemTick-advance-timebunnei2015-09-011-1/+4
|\ \ | |/ |/| SVC: Advance time when calling GetSystemTick to escape busy-wait loops
| * SVC: Advance time when calling GetSystemTick to escape busy-wait loopsYuri Kunde Schlesner2015-08-301-1/+4
| | | | | | | | | | | | | | | | Cubic Ninja waited for the frame to end by spinning on a loop calling GetSystemTick while doing nothing else. Since GetSystemTick doesn't cause a reschedule (which advances time), this meant that very little emulated time would pass inside that loop, causing the game to spend most of the frame burning away CPU.
* | Kernel: Fix wrong linear heap base on titles using newer kernelsYuri Kunde Schlesner2015-08-281-1/+1
| | | | | | | | Typo which sneaked in through review on #1025
* | Kernel: Fix assertion failure when ControlMemory is called with size=0Yuri Kunde Schlesner2015-08-271-0/+8
| |
* | Core: Improve APT Shared Font hackYuri Kunde Schlesner2015-08-273-4/+29
|/ | | | Should fix invalid read loops in some games
* Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-252-0/+9
| | | | | This brings goodies such as a configurable user interface and multi-threaded timeline view.
* Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-2219-88/+659
|\ | | | | Kernel: Correct(er) handling of Heap and Linear Heap allocations
| * Kernel: Remove unused legacy heap MapBlock_* functionsYuri Kunde Schlesner2015-08-162-77/+0
| |
| * APT: Adjust shared font hack so it works with the new linear heap codeYuri Kunde Schlesner2015-08-161-10/+11
| |
| * Kernel: Implement svcGetProcessInfo in a basic wayYuri Kunde Schlesner2015-08-165-2/+70
| | | | | | | | | | This also adds some basic memory usage accounting. These two types are used by Super Smash Bros. during startup.
| * Kernel: Add more infrastructure to support different memory layoutsYuri Kunde Schlesner2015-08-168-27/+139
| | | | | | | | | | | | This adds some structures necessary to support multiple memory regions in the future. It also adds support for different system memory types and the new linear heap mapping at 0x30000000.
| * HLE: Remove empty ConfigMem and SharedPage Shutdown functionsYuri Kunde Schlesner2015-08-165-10/+0
| |
| * Move core/mem_map.{cpp,h} => core/hle/kernel/memory.{cpp,h}Yuri Kunde Schlesner2015-08-164-2/+161
| |
| * Memory: Move address type conversion routines to memory.cpp/hYuri Kunde Schlesner2015-08-163-3/+0
| | | | | | | | | | These helpers aren't really part of the kernel, and mem_map.cpp/h is going to be moved there next.
| * Process: Store kernel compatibility version during loadingYuri Kunde Schlesner2015-08-162-3/+7
| |
| * Kernel: Properly implement ControlMemory FREE and COMMITYuri Kunde Schlesner2015-08-165-36/+338
| |
| * VMManager: Introduce names for used ResultCodesYuri Kunde Schlesner2015-08-162-6/+11
| |
| * VMManager: Make LogLayout log level configurable as a parameterYuri Kunde Schlesner2015-08-163-5/+15
| |
| * VMManager: Change block offsets to size_tYuri Kunde Schlesner2015-08-162-3/+3
| |
* | GPU: Implement TextureCopy-mode display transfersYuri Kunde Schlesner2015-08-162-11/+25
|/ | | | Fixes glitchy garbage in Fire Emblem 3D scenes.
* core: Eliminate some unused variable warningsLioncash2015-07-292-3/+5
|
* core: Fix missing prototype warningsLioncash2015-07-291-0/+1
|
* Merge pull request #1009 from lioncash/tableYuri Kunde Schlesner2015-07-291-1/+2
|\ | | | | am_net: Update function table data
| * am_net: Add missing function to the function tableLioncash2015-07-291-0/+1
| |
| * am_net: Add correct function name to the function tableLioncash2015-07-291-1/+1
| |
* | Merge pull request #982 from Subv/homebunnei2015-07-297-18/+84
|\ \ | |/ |/| Service/APT: Return proper parameters in GetLockHandle.
| * Service/APT: Fixed a regression, PreloadLibraryApplet should also start an applet when called.Subv2015-07-246-5/+36
| |
| * Service/APT: Return proper parameters in GetLockHandle.Subv2015-07-244-14/+49
| | | | | | | | | | Documented some APT functions This allows applets to boot.
* | Merge pull request #899 from zawata/Winsock-Deprecationbunnei2015-07-281-2/+8
|\ \ | | | | | | SOC:U : Fix WinSock function deprecation
| * | SOC:U : Update deprecated function gethostbyname() to getaddrinfo()zawata2015-07-201-2/+8
| | |
* | | Merge pull request #873 from jroweboy/input_arrayTony Wasserka2015-07-282-1/+14
|\ \ \ | | | | | | | | Move input values into an array.
| * | | Move input values into an arrayJames Rowe2015-07-282-1/+14
| | | |
* | | | dyncom: Rename armdefs.h to armstate.hLioncash2015-07-261-1/+1
|/ / /
* | | Merge pull request #888 from zawata/Warning-Fixes-2Yuri Kunde Schlesner2015-07-252-3/+3
|\ \ \ | | | | | | | | Core\HLE : Fix Warning
| * | | Core\HLE : Fix Warningzawata2015-07-172-3/+3
| |/ / | | | | | | | | | "signed/unsigned mismatch"
* | | Merge pull request #983 from yuriks/null-memory-fillYuri Kunde Schlesner2015-07-241-13/+18
|\ \ \ | | | | | | | | GSP: Don't try to write memory fill registers if start address is 0
| * | | GSP: Don't try to write memory fill registers if start address is 0Yuri Kunde Schlesner2015-07-241-13/+18
| | |/ | |/| | | | | | | | | | Verified to be what GSP does via REing. Fixes invalid virt->phys translation error spam in some games.
* / | Qt/GPU Breakpoints: Added three more breakpoint types:Subv2015-07-231-0/+7
|/ / | | | | | | | | | | * IncomingDisplayTransfer: Triggered just before a display transfer is performed. * GSPCommandProcessed: Triggered right after a GSP command is processed. * BufferSwapped: Triggered when the frames flip
* | Merge pull request #962 from Subv/am_appbunnei2015-07-223-3/+33
|\ \ | | | | | | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.
| * | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.Subv2015-07-213-3/+33
| | | | | | | | | | | | | | | | | | Named the service functions in am:app as per 3dbrew. This fixes an illegal read loop in Steel Diver
* | | Merge pull request #966 from Subv/logbunnei2015-07-211-4/+8
|\ \ \ | | | | | | | | Services/Logging: Log more useful information when some operations fail.
| * | | Services/Logging: Log more useful information when some operations fail.Subv2015-07-211-4/+8
| |/ / | | | | | | | | | Namely OpenFileDirectly, OpenDirectory and OpenArchive
* | | Merge pull request #957 from Subv/hwtest_crashbunnei2015-07-211-0/+8
|\ \ \ | | | | | | | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.
| * | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.Subv2015-07-211-0/+8
| |/ / | | | | | | | | | They'll be reset if needed during the next svcWaitSynchronization call (if there's any pending)
* | | dyncom: Pass SVC immediates directly.Lioncash2015-07-212-5/+4
| | | | | | | | | | | | Previously it would just re-read the already decoded instruction and extract the immediate value.
* | | Services/CFG: Added some missing functions to cfg:sSubv2015-07-211-1/+3
|/ /
* | Merge pull request #939 from Subv/queryprocmembunnei2015-07-202-6/+28
|\ \ | | | | | | Kernel/SVC: Implemented svcQueryProcessMemory
| * | Kernel/SVC: Implemented svcQueryProcessMemorySubv2015-07-172-6/+28
| | |
* | | Merge pull request #946 from archshift/update-frdubunnei2015-07-201-1/+12
|\ \ \ | | | | | | | | Add more frd:u unknown service commands from 3dbrew
| * | | Add more frd:u unknown service commands from 3dbrewarchshift2015-07-191-1/+12
| |/ /
* / / Change trace/unimplemented service call logs to use hexarchshift2015-07-191-1/+1
|/ / | | | | | | Changes the log to use hex in the parameter list instead of decimal.
* | Merge pull request #938 from Subv/querymemYuri Kunde Schlesner2015-07-172-4/+24
|\ \ | | | | | | Kernel/SVC: Implemented svcQueryMemory.
| * | Kernel/SVC: Implemented svcQueryMemory.Subv2015-07-172-4/+24
| | |
* | | Ensure all kernel objects are released during shutdownYuri Kunde Schlesner2015-07-1712-8/+45
|/ / | | | | | | | | | | | | | | This commit fixes several kernel object leaks. The most severe of them was threads not being removed from the private handle table used for CoreTiming events. This resulted in Threads never being released, which in turn held references to Process, causing CodeSets to never be freed when loading other applications.
* | Archive: Correct a few incorrect types in function signaturesYuri Kunde Schlesner2015-07-141-1/+1
| | | | | | | | Buffer lengths should be size_t, and file offsets should be u64.
* | Add CiTrace recording support.Tony Wasserka2015-07-131-1/+1
| | | | | | | | | | | | This is exposed in the GUI as a new "CiTrace Recording" widget. Playback is implemented by a standalone 3DS homebrew application (which only runs reliably within Citra currently; on an actual 3DS it will often crash still).
* | Merge pull request #921 from linkmauve/fix-appletbunnei2015-07-127-7/+32
|\ \ | | | | | | Fix applet includes using iwyu
| * | Core: Fix applet includes using iwyu.Emmanuel Gil Peyrot2015-07-127-7/+32
| | |
* | | Kernel: Add CodeSet case to Object::IsWaitableYuri Kunde Schlesner2015-07-121-0/+1
|/ /
* | Merge pull request #823 from Subv/applets_drawingbunnei2015-07-1210-58/+563
|\ \ | | | | | | Library applet support (swkbd for now)
| * | Applets: Reworked how the Applet update event is handled.Subv2015-07-127-35/+61
| | | | | | | | | | | | Applets are now cleaned up in AppletUpdateEvent after calling their respective Update method.
| * | Applets: Add infrastructure to allow custom drawing and input handling in Applets.Subv2015-07-127-39/+162
| | |
| * | HLE/APT: Initial HLE support for applets.Subv2015-07-128-50/+406
| | | | | | | | | | | | Currently only the SWKBD is emulated, and there's currently no way to ask the user for input, so it always returns "Subv" as the text.
* | | Core: Properly configure address space when loading a binaryYuri Kunde Schlesner2015-07-125-14/+88
| | | | | | | | | | | | | | | | | | The code now properly configures the process image to match the loaded binary segments (code, rodata, data) instead of just blindly allocating a large chunk of dummy memory.
* | | Kernel: Remove unused member from EventYuri Kunde Schlesner2015-07-122-2/+1
|/ /
* | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-1123-66/+100
|\ \ | | | | | | Cleanup includes, mostly in common
| * | Core: Cleanup hw includes.Emmanuel Gil Peyrot2015-06-283-0/+7
| | |
| * | Core: Cleanup soc:U includes.Emmanuel Gil Peyrot2015-06-282-26/+36
| | |
| * | Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-284-8/+20
| | |
| * | Core: Cleanup core includes.Emmanuel Gil Peyrot2015-06-284-7/+5
| | |
| * | CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-283-1/+5
| | |
| * | Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-288-16/+20
| | |
| * | Services: Use the standard _WIN32 define in soc:U instead of our own EMU_PLATFORM.Emmanuel Gil Peyrot2015-06-271-8/+7
| |/
* / Services/SOC: Added command headers to some of the soc commands.Subv2015-06-251-5/+13
|/
* Add helpers to create IPC command buffer headers and descriptorsYuri Kunde Schlesner2015-06-233-7/+43
|
* Merge pull request #860 from yuriks/y2r-colorYuri Kunde Schlesner2015-06-222-174/+348
|\ | | | | Color support for Y2R
| * Y2R: Rework conversion process, enabling support for all formatsYuri Kunde Schlesner2015-06-222-163/+309
| |
| * Y2R: Re-organize how params are stored. Support SetConversionParamsYuri Kunde Schlesner2015-06-211-72/+100
| |
* | Merge pull request #855 from purpasmart96/service_rearrangmentbunnei2015-06-2172-607/+1134
|\ \ | |/ |/| Services: Continue separation of services into their own folders
| * Services: Continue separation of services into their own folderspurpasmart962015-06-1272-607/+1134
| |
* | kernel: Fix svcWaitSynch to always acquire requested wait objects.bunnei2015-06-179-113/+68
|/
* ExtSavedata: Save the icon passed to CreateExtSaveData to the correct folder.Subv2015-06-023-11/+32
| | | | Organize the ExtSaveData folders as they are stored in the console.
* Merge pull request #810 from yuriks/memmapYuri Kunde Schlesner2015-05-302-0/+445
|\ | | | | Kernel: Add VMManager to manage process address spaces
| * Kernel: Add VMManager to manage process address spacesYuri Kunde Schlesner2015-05-272-0/+445
| | | | | | | | | | | | | | | | This enables more dynamic management of the process address space, compared to just directly configuring the page table for major areas. This will serve as the foundation upon which the rest of the Kernel memory management functions will be built.
* | Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-2922-65/+65
| |
* | hid: Get rid of undefined behaviorLioncash2015-05-271-2/+2
|/ | | | Modifying a variable twice across a sequence point.
* Merge pull request #821 from Subv/ImportDisplayCaptureInfobunnei2015-05-261-1/+47
|\ | | | | Service/GSP: Implemented ImportDisplayCaptureInfo.
| * Service/GSP: Implemented ImportDisplayCaptureInfo.Subv2015-05-261-1/+47
| |
* | Core/SVC: Map the shared memory created in CreateMemoryBlock to the specified address.Subv2015-05-251-0/+2
|/ | | | This SharedMemory can be passed to service functions (Which should map the memory into their own address space).
* y2r_u: Remove unused variable in StartConversionLioncash2015-05-231-1/+0
|
* Merge pull request #801 from purpasmart96/hid_stubsbunnei2015-05-234-9/+47
|\ | | | | HID: Stub DisableAccelerometer and DisableGyroscopeLow
| * HID: Stub DisableAccelerometer and DisableGyroscopeLowpurpasmart962015-05-234-9/+47
| |
* | Flush for y2r (moflex)tfarley2015-05-231-0/+11
| |
* | OpenGL renderertfarley2015-05-231-0/+9
|/
* Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-221-35/+265
| | | | | | | | | | | | Implements unrotated planar YUV 4:2:0 -> RGB24 conversions in Y2R. Currently only the Y (luma) channel is used, so the results don't contain color. This will be added in a later PR at some point. This is enough to get all currently know Moflex videos to decode. (Some don't display on-screen due to seemingly unrelated reasons.) Thanks to @archshift for doing the initial implementation which I cleaned up and then fixed the 8x8 block mode.
* Kernel: Fix a warning introduced with ResourceLimit, and remove the fallback code to prevent it from happening again.Emmanuel Gil Peyrot2015-05-211-2/+1
|
* y2r_u: Stub StartConversion to prevent moflex games from hanging.bunnei2015-05-211-1/+17
|
* Kernel: Move reschedules from SVCs to actual mechanisms that reschedule.bunnei2015-05-217-20/+22
|
* Merge pull request #766 from purpasmart96/cfg_service_updatebunnei2015-05-185-337/+304
|\ | | | | CFG: Update the cfg service to be like other integrated services
| * CFG: Update the cfg service to be like other integrated servicespurpasmart962015-05-165-337/+304
| |
* | Merge pull request #772 from lioncash/warnbunnei2015-05-181-3/+3
|\ \ | | | | | | core/video_core: Fix a few warnings when compiling on MSVC.
| * | process: Get rid of warningsLioncash2015-05-141-3/+3
| |/ | | | | | | Sign mismatches and "forcing value to bool" warnings.
* | Implement svcBreakarchshift2015-05-172-1/+17
| |
* | Merge pull request #781 from archshift/deletebunnei2015-05-161-33/+0
|\ \ | | | | | | Delete unused hle/coprocessor.cpp
| * | Delete unused hle/coprocessor.cpparchshift2015-05-161-33/+0
| | |
* | | APT/FS: Remove asserts that were causing false positivespurpasmart962015-05-162-5/+5
|/ /
* | Core/ResourceLimits: Implemented the basic structure of ResourceLimits.Subv2015-05-158-14/+326
| | | | | | | | | | | | Implemented svcs GetResourceLimit, GetResourceLimitCurrentValues and GetResourceLimitLimitValues. Note that the resource limits do not currently keep track of used objects, since we have no way to distinguish between an object created by the application, and an object created by some HLE module once we're inside Kernel::T::Create.
* | Memory: Read SharedPage directly from Memory::ReadYuri Kunde Schlesner2015-05-152-58/+35
| |
* | Memory: Read ConfigMem directly from Memory::ReadYuri Kunde Schlesner2015-05-152-49/+36
| |
* | Memmap: Re-organize memory function in two filesYuri Kunde Schlesner2015-05-1511-12/+12
| | | | | | | | | | | | | | memory.cpp/h contains definitions related to acessing memory and configuring the address space mem_map.cpp/h contains higher-level definitions related to configuring the address space accoording to the kernel and allocating memory.
* | thread: Fix a conditional check in RescheduleLioncash2015-05-141-1/+1
|/
* Merge pull request #756 from purpasmart96/ptm_service_changesbunnei2015-05-135-125/+112
|\ | | | | PTM: Changed the ptm services to be like the IR, HID, and APT services.
| * PTM: Changed the way the ptm services are handled to be like thepurpasmart962015-05-125-125/+112
| | | | | | | | IR, HID, and APT services.
* | Merge pull request #748 from Subv/tls_maxbunnei2015-05-123-7/+19
|\ \ | | | | | | Core/Memory: Add TLS support for creating up to 300 threads
| * | Core/Memory: Add TLS support for creating up to 300 threadsSubv2015-05-123-7/+19
| | |
* | | Merge pull request #751 from yuriks/idle-threadbunnei2015-05-122-44/+19
|\ \ \ | | | | | | | | Thread: Remove the idle thread
| * | | Thread: Remove the idle threadYuri Kunde Schlesner2015-05-122-44/+19
| | | | | | | | | | | | | | | | Instead just use nullptr to represent no thread is active.
* | | | Merge pull request #757 from Subv/schedulingbunnei2015-05-121-0/+2
|\ \ \ \ | |_|/ / |/| | | Core/Scheduling: Prepare the new priority in the thread queue when svcSetPriority is called
| * | | Core/Scheduling: Prepare the new priority in the thread queue when svcSetPriority is calledSubv2015-05-121-0/+2
| |/ /
* | | Merge pull request #750 from Subv/process_svcYuri Kunde Schlesner2015-05-126-4/+46
|\ \ \ | |_|/ |/| | Core/HLE: Implemented the SVCs GetProcessId and GetProcessIdOfThread
| * | fixup!Subv2015-05-123-16/+12
| | |
| * | Core/HLE: Implemented the SVCs GetProcessId and GetProcessIdOfThreadSubv2015-05-116-4/+50
| | |
* | | NWM_UDS: Fix a typo in the nwm service port namepurpasmart962015-05-121-1/+1
| |/ |/|
* | Thread: Correctly set main thread initial stack positionYuri Kunde Schlesner2015-05-113-5/+4
|/
* Merge pull request #740 from yuriks/gsp-shmemarchshift2015-05-117-34/+67
|\ | | | | Fix crashes due to un-initialized GSP shared memory
| * fixup! GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-1/+1
| |
| * GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-9/+11
| |
| * Kernel: Zero-fill shared memory blocks when mappingYuri Kunde Schlesner2015-05-111-0/+8
| | | | | | | | | | | | This works around crashes related to GSP/HID/etc. shared memory blocks having garbage values. The proper fix requires proper management of mapped memory blocks in the process.
| * Kernel: Capture SharedMemory attributes at creation, not when mappingYuri Kunde Schlesner2015-05-117-28/+51
| |
* | fixup! Set the TLS address in the schedulerSubv2015-05-112-2/+7
| |
* | Core/Memory: Give every emulated thread it's own TLS area.Subv2015-05-113-4/+22
|/ | | | | The TLS area for thread T with id Ti is located at TLS_AREA_VADDR + (Ti - 1) * 0x200. This allows some games like Mario Kart 7 to continue further.
* Common: Remove the BIT macroYuri Kunde Schlesner2015-05-091-2/+2
| | | | | | | When the macro was introduced in 326ec51261299e48de97592631c02523da9c8118 it wasn't noticed that it conflicted in name with a heavily used macro inside of dyncom. This causes some compiler warnings. Since it's only lightly used, it was opted to simply remove the new macro.
* Memory: Re-organize and rename memory area address constantsYuri Kunde Schlesner2015-05-093-4/+5
|
* Kernel: Remove unused g_main_thread variableYuri Kunde Schlesner2015-05-093-5/+1
|
* Process: Rename StaticAddressMapping => AddressMappingYuri Kunde Schlesner2015-05-092-5/+5
|
* Process: Add more documentation to the class membersYuri Kunde Schlesner2015-05-091-2/+16
|
* Process: Use BitField to store process flagsYuri Kunde Schlesner2015-05-092-16/+24
|
* Process: Support parsing of exheader kernel capsYuri Kunde Schlesner2015-05-092-4/+72
|
* Kernel: Remove g_program_idYuri Kunde Schlesner2015-05-092-8/+0
| | | | This has been obsoleted by the field in Process.
* Kernel: Introduce skeleton Process class to hold process dataYuri Kunde Schlesner2015-05-094-19/+101
|
* Fix printf format warningYuri Kunde Schlesner2015-05-071-1/+1
|
* Common: Remove common.hYuri Kunde Schlesner2015-05-0732-18/+48
|
* Clean-up includesYuri Kunde Schlesner2015-05-072-2/+7
|
* FileSys: De-inline Path membersYuri Kunde Schlesner2015-05-071-0/+2
|
* FileSys: Clean-up includes, de-inline destructorsYuri Kunde Schlesner2015-05-074-13/+21
|
* Move typedefs from kernel.h to more appropriate placesYuri Kunde Schlesner2015-05-072-10/+8
|
* HLE: Clean up SVC dispatch mechanismYuri Kunde Schlesner2015-05-064-77/+38
|
* HLE: Properly initialize and shutdown remaining modules.bunnei2015-05-025-3/+20
|
* Kernel: Properly initialize and shutdown all modules.bunnei2015-05-024-9/+20
|
* Services: Initialize all state variables at bootup.bunnei2015-05-028-22/+38
|
* ConfigMem: Remove duplicate retail bitpurpasmart962015-04-291-1/+0
|
* Merge pull request #692 from purpasmart96/log_improvementsbunnei2015-04-282-8/+22
|\ | | | | Services/Loader: Use more sensible log formats for certain functions along with more info being logged.
| * Services/Loader: Use more sensible log formats for certain functionspurpasmart962015-04-282-8/+22
| | | | | | | | along with more info being logged.
* | ptm_sysm: Add static specifier to IsLegacyPowerOffLioncash2015-04-251-1/+1
| |
* | Merge pull request #696 from yuriks/interface-deinlinebunnei2015-04-153-50/+49
|\ \ | | | | | | De-inline functions from Interface, removing them from service.h
| * | De-inline functions from Interface, removing them from service.hYuri Kunde Schlesner2015-04-143-50/+49
| | | | | | | | | | | | This reduces the time for a full recompile from 65.43s to 59.53s (~9%)
* | | Kernel: Use the correct format string for u64 hex.Emmanuel Gil Peyrot2015-04-141-1/+1
|/ /
* | SVC: Assert on unsupported CreateThread processor ID.bunnei2015-04-101-3/+9
| |
* | SVC: Update various SVCs to cause a reschedule.bunnei2015-04-102-6/+22
| | | | | | | | - CreateMutex/ReleaseMutex/ReleaseSemaphore/SetTimer/CancelTimer/ArbitrateAddress
* | Kernel: Implemented priority inheritance for mutexes.bunnei2015-04-103-4/+22
| |
* | Thread: Implement priority boost for starved threads.bunnei2015-04-104-28/+74
| | | | | | | | | | | | SVC: Return correct error code on invalid CreateThread processor ID. SVC: Assert when creating a thread with an invalid userland priority.
* | SVC: Reschedule on svcCreateThread.bunnei2015-04-101-0/+2
| |
* | APT: (Subv) Fix bug where start event was being incorrectly signaled.bunnei2015-04-101-6/+7
| |
* | Kernel: Fixed default thread priority.bunnei2015-04-102-5/+4
| |
* | Initialize base address to 0x0Gareth Higgins2015-04-091-0/+1
|/
* Merge pull request #676 from purpasmart96/ir_service_refcbunnei2015-04-0810-55/+180
|\ | | | | IR: Move The IR services to their own folder and implement "GetHandles"
| * IR: Move The IR services to their own folder and implement "GetHandles"purpasmart962015-04-0410-55/+180
| |
* | Clean-up mem_map constants and fix framebuffer translation errorsYuri Kunde Schlesner2015-04-061-4/+6
|/
* Merge pull request #641 from purpasmart96/service_stubsbunnei2015-04-0416-67/+402
|\ | | | | Services: Stubs and minor changes
| * Services: Stubs and minor changespurpasmart962015-04-0316-67/+402
| |
* | ConfigMem: Set the app memory to be 96MB instead of the default 64MBpurpasmart962015-03-241-2/+2
|/
* Merge pull request #656 from Subv/nzbunnei2015-03-223-24/+189
|\ | | | | Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and Del...
| * Service/FS: Document and log some unknown values.Subv2015-03-191-1/+26
| | | | | | | | In CreateExtSaveData, DeleteExtSaveData and CreateSystemSaveData
| * Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and DeleteSystemSaveDataSubv2015-03-143-24/+164
| | | | | | | | Also fixed a bug with CreateExtSaveData that made it unable to create ExtSaveData archives in the SDMC directory.
* | Merge pull request #655 from purpasmart96/hid_fixesbunnei2015-03-174-12/+72
|\ \ | | | | | | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow along with a stub for GetSoundVolume
| * | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow alongpurpasmart962015-03-174-12/+72
| |/ | | | | | | with a stub for GetSoundVolume
* / arm_interface: Get rid of GetTicks.Lioncash2015-03-162-5/+6
|/ | | | Removes a TODO.
* Merge pull request #642 from bunnei/touchpadbunnei2015-03-123-130/+136
|\ | | | | Touchpad support
| * hid_user: Removed unnecessary includes.bunnei2015-03-111-2/+0
| |
| * HID: Removed unnecessary global variables.bunnei2015-03-112-58/+42
| |
| * HID: Added additional variable comments and some code cleanups.bunnei2015-03-112-20/+29
| |
| * HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-112-111/+28
| |
| * HID: Cleanup how `next_touch_index` is calculated for Pad and touch.bunnei2015-03-101-2/+2
| |
| * HID: Changed TouchDataEntry `valid` to a BitField and added some doc strings.bunnei2015-03-102-4/+4
| |
| * HID: Added static asserts to check register position in shared memory.bunnei2015-03-101-2/+16
| |
| * HID: Added functions to emulate the touchpad.bunnei2015-03-102-0/+61
| |
| * HID: Moved some docstrings to the header.bunnei2015-03-102-24/+16
| |
| * HID: Refactored shared memory decoding for touchpad support.bunnei2015-03-102-33/+64
| |
* | Merge pull request #629 from archshift/lcdfbbunnei2015-03-101-6/+38
|\ \ | |/ |/| Implement SetLcdForceBlack and add implementation for color filling in the GPU code
| * Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-091-17/+15
| |
| * Implement SetLcdForceBlack, move register enum to hw.harchshift2015-03-061-5/+39
| |
* | Merge pull request #589 from kevinhartman/config-errorsbunnei2015-03-091-5/+10
|\ \ | | | | | | Fix errorcodes for bad config block request
| * | Fix error message for bad config block request.Kevin Hartman2015-02-211-5/+10
| | |
* | | Merge pull request #538 from yuriks/perf-statTony Wasserka2015-03-071-0/+6
|\ \ \ | |_|/ |/| | Add profiling infrastructure and widget
| * | Add profiling infrastructure and widgetYuri Kunde Schlesner2015-03-021-0/+6
| | |
* | | Services: Moved the PTM and APT services to their own folderSubv2015-03-0439-1098/+1186
| | | | | | | | | | | | | | | | | | This coincidentally fixes an issue about the PTM service failing to create its SharedExtSaveData archive due to the FS service not being initialized by the time the creating code runs. Ideally I'd like to move each process to its own folder, and have a single file per process that registers the service classes, which would be in their own files inside that folder. Then each service class would just call functions from the process to complete the commands.
* | | Merge pull request #622 from Subv/titlesYuri Kunde Schlesner2015-03-021-8/+45
|\ \ \ | | | | | | | | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.
| * | | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.Subv2015-03-021-8/+45
| |/ / | | | | | | | | | | | | They will always return 0 titles for every media type for now. This is needed to boot Home Menu further
* | | Merge pull request #623 from Subv/cardbunnei2015-03-021-1/+25
|\ \ \ | | | | | | | | Services/FS: Stubbed CardSlotIsInserted to always return false
| * | | Services/FS: Stubbed CardSlotIsInserted to always return falseSubv2015-03-011-1/+25
| |/ / | | | | | | | | | We won't be emulating this for the foreseeable future and it is needed for Home Menu to boot further
* | | Merge pull request #618 from lioncash/refbunnei2015-03-021-2/+2
|\ \ \ | | | | | | | | result: Make comparison operators take references
| * | | result: Make comparison operators take referencesLioncash2015-02-281-2/+2
| |/ / | | | | | | | | | It's unnecessary to make copies for simple comparisons like this.
* / / Services/PTM: Stubbed PTM_Sysm::IsLegacyPowerOff.Subv2015-03-011-1/+13
|/ / | | | | | | This allows the Home Menu to boot further
* | Merge pull request #604 from Subv/arc_ssdYuri Kunde Schlesner2015-02-262-26/+42
|\ \ | | | | | | Archives: Properly implemented the SystemSaveData archive.
| * | Archives: Properly implemented the SystemSaveData archive.Subv2015-02-262-26/+42
| | | | | | | | | | | | Ported to the new factory pattern we have for archives.
* | | Services: Implemented Y2R_U::GetTransferEndEventSubv2015-02-241-1/+18
|/ / | | | | | | Aero Porter was throwing an "Invalid Handle" fatal error without this.
* | Merge pull request #595 from linkmauve/new-3ds-inputbunnei2015-02-241-0/+19
|\ \ | | | | | | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.
| * | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.Emmanuel Gil Peyrot2015-02-221-0/+19
| | |
* | | Merge pull request #581 from archshift/tfebunnei2015-02-231-1/+164
|\ \ \ | |/ / |/| | Added information reporting from ThrowFatalError
| * | Added information reporting from ThrowFatalErrorarchshift2015-02-221-1/+164
| | | | | | | | | | | | This was RE'd from the errdisp applet.
* | | Merge pull request #588 from archshift/somebranchbunnei2015-02-201-2/+3
|\ \ \ | |_|/ |/| | Sweeping cleanup of Common
| * | Misc cleanup of common and related functionsarchshift2015-02-201-2/+3
| |/
* / Convert a few C stdlib asserts to Citra's own assertsarchshift2015-02-191-6/+4
|/
* GPU: Properly implement memory fills.Tony Wasserka2015-02-182-17/+21
|
* Merge pull request #570 from purpasmart96/config_membunnei2015-02-184-50/+58
|\ | | | | ConfigMem: Clean up the Config memory to be more like the shared page
| * ConfigMem: Clean up the Config memory to be more like the shared page and movedpurpasmart962015-02-174-50/+58
| | | | | | | | the helper macro for padding to common_funcs.h
* | Services: Fixed "Tried to connect to named port err:f".Subv2015-02-161-1/+1
| | | | | | | | err:f is a named port, not a service
* | Merge pull request #529 from Subv/masterbunnei2015-02-146-40/+56
|\ \ | | | | | | Build: Fixed some warnings
| * | Build: Fixed some warningsSubv2015-02-126-40/+56
| |/
* / core: Apply static to local functionsLioncash2015-02-135-17/+18
|/
* Implemented WriteHWRegsWithMask for GSP.Kevin Hartman2015-02-111-6/+91
|
* Asserts: break/crash program, fit to style guide; log.h->assert.harchshift2015-02-1154-72/+27
| | | | | | | Involves making asserts use printf instead of the log functions (log functions are asynchronous and, as such, the log won't be printed in time) As such, the log type argument was removed (printf obviously can't use it, and it's made obsolete by the file and line printing) Also removed some GEKKO cruft.
* GSP: Fixed typo in SignalInterruptbunnei2015-02-111-1/+1
|
* Merge pull request #552 from bunnei/setbufferswap-fixbunnei2015-02-111-4/+3
|\ | | | | GSP SetBufferSwap fix
| * GSP: Call SetBufferSwap for each screen on corresponding signal interrupt.bunnei2015-02-111-4/+3
| |
* | Merge pull request #526 from purpasmart96/citra_stubsbunnei2015-02-113-8/+188
|\ \ | | | | | | Services: Stub some functions
| * | Services: Stub some functionspurpasmart962015-02-083-8/+188
| | |
* | | PTM: Fixed a problem with the gamecoin PTM file.Subv2015-02-101-21/+13
| | |
* | | Archives: Made the Format function more generic.Subv2015-02-103-9/+10
| | |
* | | Archives: Expose the File and Directory classes to HLESubv2015-02-103-58/+62
| | |
* | | ResultVal: Fixed compilation when reassigning a ResultVal.Subv2015-02-101-3/+3
| | |
* | | FS: Allow multiple instances of the same archive type to be open at onceYuri Kunde Schlesner2015-02-103-29/+35
| | |
* | | FS: Get rid of completely useless Archive classYuri Kunde Schlesner2015-02-101-36/+26
| | |
* | | Scheduler refactor Pt. 1Kevin Hartman2015-02-104-228/+267
| |/ |/| | | | | | | | | | | | | | | | | | | | | | | * Simplifies scheduling logic, specifically regarding thread status. It should be much clearer which statuses are valid for a thread at any given point in the system. * Removes dead code from thread.cpp. * Moves the implementation of resetting a ThreadContext to the corresponding core's implementation. Other changes: * Fixed comments in arm interfaces. * Updated comments in thread.cpp * Removed confusing, useless, functions like MakeReady() and ChangeStatus() from thread.cpp. * Removed stack_size from Thread. In the CTR kernel, the thread's stack would be allocated before thread creation.
* | Mutex: Locks should be recursive.bunnei2015-02-102-16/+20
| |
* | WaitSynch: Always reschedule (verified behavior on hw).bunnei2015-02-101-4/+4
| |
* | core: Fix some warnings on OSXLioncash2015-02-031-1/+0
| |
* | Kernel: Stop creating useless Handles during object creationYuri Kunde Schlesner2015-02-0218-57/+41
| | | | | | | | | | They're finally unnecessary, and will stop cluttering the application's handle table.
* | Kernel: Make WaitObjects share ownership of Threads waiting on themYuri Kunde Schlesner2015-02-026-12/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | During normal operation, a thread waiting on an WaitObject and the object hold mutual references to each other for the duration of the wait. If a process is forcefully terminated (The CTR kernel has a SVC to do this, TerminateProcess, though no equivalent exists for threads.) its threads would also be stopped and destroyed, leaving dangling pointers in the WaitObjects. The solution is to simply have the Thread remove itself from WaitObjects when it is stopped. The vector of Threads in WaitObject has also been changed to hold SharedPtrs, just in case. (Better to have a reference cycle than a crash.)
* | Explicitly instantiate constructors/destructors for Kernel objectsYuri Kunde Schlesner2015-02-0216-8/+50
| | | | | | | | | | | | This should speed up compile times a bit, as well as enable more liberal use of forward declarations. (Due to SharedPtr not trying to emit the destructor anymore.)
* | Mutex: Replace g_mutex_held_locks with a set inside ThreadYuri Kunde Schlesner2015-02-023-23/+18
| |
* | HID: Fix crash when pressing a key when the emulator is stoppedYuri Kunde Schlesner2015-02-021-0/+2
| |
* | SVC: Enable CloseHandle, clean up DuplicateHandleYuri Kunde Schlesner2015-02-021-9/+5
| |
* | Kernel: Fix bug in HandleTable::CloseYuri Kunde Schlesner2015-02-021-1/+1
| |
* | Kernel: Remove Object::GetHandle (it's not used anymore :D)Yuri Kunde Schlesner2015-02-022-9/+1
| |
* | Kernel: Introduce unique Object ids for debuggingYuri Kunde Schlesner2015-02-024-8/+16
| |
* | Kernel: Use separate Handle tables for CoreTiming userdataYuri Kunde Schlesner2015-02-024-18/+25
| | | | | | | | This is to support the removal of GetHandle soon
* | Kernel: Remove previous scheduled event when a Timer is re-SetYuri Kunde Schlesner2015-02-021-0/+3
| |
* | FS: Remove use of GetHandleYuri Kunde Schlesner2015-02-021-1/+1
| |
* | Thread: Modernize two functions that slipped through previous rebasesYuri Kunde Schlesner2015-02-024-18/+16
| |
* | Service: Store function names as const char* instead of std::stringYuri Kunde Schlesner2015-02-021-6/+6
| | | | | | | | | | Uses less memory (strings and function table is stored in constant data) and speeds up start up (no need to allocate and copy strings).
* | Service: Clean-up InterfaceYuri Kunde Schlesner2015-02-0246-67/+54
| |
* | Make Port/Service registration and querying more HW-accurateYuri Kunde Schlesner2015-02-024-106/+80
| |
* | Filesys: Move creation of Handles for File/Directory to service handlersYuri Kunde Schlesner2015-02-023-32/+33
| |
* | arm: Clean up ARMul_StateLioncash2015-02-011-1/+1
| | | | | | | | Remove unnecessary/unused struct variables.
* | Merge pull request #512 from lioncash/assignmentTony Wasserka2015-01-312-4/+4
|\ \ | |/ |/| shared_memory: Fix assignments in SharedMemory::Map
| * shared_memory: Fix assignments in SharedMemory::MapLioncash2015-01-302-4/+4
| |
* | archive: Fix initializer list order for the File class.Lioncash2015-01-301-1/+1
| |
* | apt_u: Fix missing printf specifiersLioncash2015-01-301-2/+2
|/
* Kernel: Mark all appropriate kernel objects as "final"Yuri Kunde Schlesner2015-01-307-8/+7
|
* SVC: Use CASCADE_RESULT in SVC handlersYuri Kunde Schlesner2015-01-302-77/+32
|
* Remove result.h InvalidHandleYuri Kunde Schlesner2015-01-304-30/+32
| | | | | It was only being used in two places, where it was replaced by a local constant.
* SVC: Change return type of handlers to ResultCodeYuri Kunde Schlesner2015-01-302-132/+127
|
* Kernel: Convert Event to not use HandlesYuri Kunde Schlesner2015-01-3010-152/+151
|
* Kernel: Convert Timer to (mostly) not use HandlesYuri Kunde Schlesner2015-01-303-111/+112
|
* Kernel: Convert Mutex to not use HandlesYuri Kunde Schlesner2015-01-305-114/+110
|
* Kernel: Convert AddressArbiter to not use HandlesYuri Kunde Schlesner2015-01-303-38/+55
|
* Kernel: Convert Semaphore to not use HandlesYuri Kunde Schlesner2015-01-303-67/+88
|
* Kernel: Convert SharedMemory to not use HandlesYuri Kunde Schlesner2015-01-308-102/+107
|
* Additions to ResultVal to make it more convenient to use.Yuri Kunde Schlesner2015-01-301-1/+25
|
* Move VAddr/PAddr typedefs to kernel.hYuri Kunde Schlesner2015-01-301-0/+5
|
* Kernel: Remove useless/duplicated comments; mark functions staticYuri Kunde Schlesner2015-01-306-32/+8
|
* Merge pull request #412 from purpasmart96/svc_table_cleanupbunnei2015-01-281-7/+7
|\ | | | | SVC: Update the SVC function table
| * SVC: Update the SVC function tablepurpasmart962015-01-271-7/+7
| |
* | Merge pull request #345 from purpasmart96/apt_stubsbunnei2015-01-271-91/+276
|\ \ | | | | | | APT_U: Stub some functions & misc changes
| * | APT_U: Stub some functions & misc changespurpasmart962015-01-231-91/+276
| | |
* | | Merge pull request #485 from Subv/more_servsbunnei2015-01-2618-1/+393
|\ \ \ | | | | | | | | Services: Stubbed more services.
| * | | Services/HID: Removed some files due to a rebase errorSubv2015-01-243-267/+0
| | | |
| * | | Services: Stubbed more services.Subv2015-01-2421-1/+660
| | | | | | | | | | | | | | | | Implemented FSUser::CreateExtSaveData
* | | | cam_u.h: fix indentationarchshift2015-01-221-2/+2
|/ / / | | | | | | Withholding my profanity towards Xcode.
* | | Merge pull request #493 from archshift/ptmplaybunnei2015-01-225-0/+102
|\ \ \ | | | | | | | | Stubbed some services
| * | | Stubbed cam:u servicearchshift2015-01-213-0/+49
| | | |
| * | | Stubbed ptm:play servicearchshift2015-01-213-0/+53
| | | |
* | | | WaitSynchronization: Added a result code for invalid result, fixed bug.bunnei2015-01-221-3/+9
| | | |
* | | | Thread: Fix WaitSynchronization1 to not set register 1 on thread wakeup.bunnei2015-01-223-25/+45
| | | |
* | | | Thread: Use std::find in CheckWait_WaitObject.bunnei2015-01-221-4/+5
| | | |
* | | | Mutex: Cleanup and remove redundant code.bunnei2015-01-223-47/+29
| | | |
* | | | Kernel: Renamed some functions for clarity.bunnei2015-01-227-10/+10
| | | | | | | | | | | | | | | | | | | | - ReleaseNextThread->WakeupNextThread - ReleaseAllWaitingThreads->WakeupAllWaitingThreads.
* | | | Kernel: Changed "ShouldWait" to return bool and "Acquire" to return void.bunnei2015-01-229-71/+42
| | | |
* | | | WaitObject: Renamed "Wait" to "ShouldWait", made "ShouldWait" and "Acquire" pure virtual.bunnei2015-01-229-23/+22
| | | |
* | | | Event: Fix implementation of "non-sticky" events.bunnei2015-01-221-0/+4
| | | |
* | | | Session: Change to a WaitObject.bunnei2015-01-223-2/+9
| | | |
* | | | Kernel: Reschedule on SignalEvent and SendSyncRequest, fix some bugs.bunnei2015-01-222-1/+2
| | | |
* | | | Mutex: Fix a bug where the thread should not wait if it already has the mutex.bunnei2015-01-221-1/+4
| | | |
* | | | Kernel: Moved Wait and Acquire to WaitObject, added way to retrieve a WaitObject safely.bunnei2015-01-224-20/+59
| | | |
* | | | SVC: Removed a Sleep that made no sensebunnei2015-01-221-6/+1
| | | | | | | | | | | | | | | | | | | | - Would deadlock the calling thread - Code would never get hit anyways
* | | | AddressArbiter: Changed to Kernel::Object, big cleanup, removed code that made no sense.bunnei2015-01-225-38/+45
| | | |
* | | | Kernel: Get rid of WaitTypes and simplify lots of code, removing hacks.bunnei2015-01-229-122/+63
| | | |
* | | | WaitSynchronizationN: Improved commentsbunnei2015-01-221-7/+12
| | | |
* | | | WaitSynchronizationN: Refactor to fix several bugsbunnei2015-01-228-79/+76
| | | | | | | | | | | | | | | | | | | | | | | | - Separate wait checking from waiting the current thread - Resume thread when wait_all=true only if all objects are available at once - Set output to correct wait object index when there are duplicate handles
* | | | Kernel: Separate WaitSynchronization into Wait and Acquire methods.bunnei2015-01-228-18/+59
| | | |
* | | | WaitSynchronizationN: Handle case where handles=nullptr.bunnei2015-01-221-0/+4
| | | |
* | | | WaitSynchronizationN: Handle case where handle_count is invalid.bunnei2015-01-221-3/+7
| | | |
* | | | WaitSynchronizationN: Handle case where handle_count=0.bunnei2015-01-221-19/+29
| | | |
* | | | WaitSynchronizationN: Implement return valuesbunnei2015-01-2210-83/+189
| | | |
* | | | Event: Fixed some bugs and cleanup (Subv)bunnei2015-01-224-57/+16
| | | |
* | | | Thread: Keep track of multiple wait objects.bunnei2015-01-223-16/+30
| | | |
* | | | Event: Get rid of permanent_lock hack.bunnei2015-01-222-36/+8
| | | |
* | | | WaitObject: Added RemoveWaitingThread, fixed a bug, and cleanup.bunnei2015-01-222-4/+17
| | | |
* | | | Kernel: Added WaitObject and changed "waitable" objects inherit from it.bunnei2015-01-228-71/+73
| | | |
* | | | Added HID_SPVR service and split HID_U implementation into service/hid/hid.xxxarchshift2015-01-219-217/+327
|/ / /
* | | core: Fix a few docstringsLioncash2015-01-204-4/+4
| | |
* | | Merge pull request #492 from archshift/aptbunnei2015-01-202-1/+4
|\ \ \ | | | | | | | | Expose GetSharedFont and NotifyToWait to APT:A and APT:S respectively
| * | | Expose GetSharedFont and NotifyToWait to APT:A and APT:S respectivelyarchshift2015-01-192-1/+4
| |/ /
* | | Merge pull request #383 from zhuowei/shared_pagebunnei2015-01-193-0/+109
|\ \ \ | |/ / |/| | Add some support for the shared page
| * | Add some support for the shared page (currently 3d slider is implemented)Zhuowei Zhang2015-01-163-0/+109
| | |
* | | APT: Fix typo in setting return code for NotifyToWaitbunnei2015-01-161-1/+1
| | |
* | | DSP: Removed useless spam log for SignalInterruptbunnei2015-01-161-5/+2
| | |
* | | Merge pull request #482 from yuriks/fix-vblankbunnei2015-01-162-35/+25
|\ \ \ | | | | | | | | Correctness fixes for GPU flipping and interrupts
| * | | GSP: Fix appending of interrupts to the shared memory bufferYuri Kunde Schlesner2015-01-142-17/+12
| | | | | | | | | | | | | | | | | | | | The code was previously appending the interrupt to after the end of the buffer, instead of at the end.
| * | | GSP: Update framebuffer info on all interruptsYuri Kunde Schlesner2015-01-141-12/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Hardware testing determined that the GSP processes shared memory framebuffer update info even when no memory transfer or filling GX commands are used. They are now updated on every interrupt, which isn't confirmed correct but matches hardware behaviour more closely. This also reverts the hack introduced in #404. It made a few games behave better, but I believe it's incorrect and also breaks other games.
| * | | GPU: Fire GPU interrupts at the correct places.Yuri Kunde Schlesner2015-01-141-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | PDC0 and PDC1 are both VBlank interrupts. PDC0 was being treated as a HBlank interrupt and fired many more times than it should. They now both fire together at 60 Hz. This puzzlingly *improves* apparent framerate on many applications. A few other interrupts were being fired inside the GSP command processing instead of on the actual GPU register writes, so they were moved there, which should cover direct writes tho those registers not going through the GX command queue.
* | | | Merge pull request #481 from Subv/hm_bbunnei2015-01-151-7/+21
|\ \ \ \ | | | | | | | | | | APTU: Stubbed NotifyToWait, taken from 3dmoo.
| * | | | APT: Fixed the comment style in some variablesSebastian Valle2015-01-141-2/+2
| | | | |
| * | | | APTU: Stubbed NotifyToWait, taken from 3dmoo.Subv2015-01-141-7/+21
| |/ / / | | | | | | | | | | | | | | | | Also renamed some handles in the APT:U service to be more descriptive. Fixed a typo in InquireNotification
* | | | Merge pull request #480 from Subv/arb_2bunnei2015-01-143-4/+21
|\ \ \ \ | |/ / / |/| | | AddrArbiter: Implement arbitration types 3 and 4.
| * | | AddrArbiter: Implement arbitration types 3 and 4.Subv2015-01-133-4/+21
| | |/ | |/|
* / | Services: Added some missing services.Subv2015-01-138-1/+358
|/ / | | | | | | | | cfg:s, ptm:sysm, apt:s. apt:s is almost exactly the same as apt:u as per 3dbrew
* | Fix building on MinGWdarkf2015-01-121-0/+13
| |
* | Merge pull request #456 from Subv/waitsync1bunnei2015-01-121-3/+2
|\ \ | | | | | | SVC: Wake up the thread after the delay in WaitSync1
| * | SVC: Wake up the thread after the delay in WaitSync1Subv2015-01-111-3/+2
| | |
* | | Merge pull request #466 from Subv/wakebunnei2015-01-111-0/+3
|\ \ \ | |/ / |/| | Thread: Prevent waking a thread multiple times.
| * | Thread: Prevent waking a thread multiple times.Subv2015-01-111-0/+3
| | | | | | | | | | | | If a thread was woken up by something, cancel the wakeup timeout.
* | | Stubbed y2r:u IsBusyConversionarchshift2015-01-111-1/+16
| | | | | | | | | | | | | | | There is no documentation available on this function, but we set the result to false as a stub. This allows Super Little Acorns to move all the way in game with pp3c.
* | | Added Archive ID to fs:USER debug logs involving opening the archive.archshift2015-01-101-3/+3
| | |
* | | Logging: Log all called service functions (under trace). Compile out all trace logs under release for performance.archshift2015-01-109-33/+22
| | |
* | | Kernel: Start using boost::intrusive_ptr for lifetime managementYuri Kunde Schlesner2015-01-0912-90/+95
| | |
* | | Kernel: Don't re-assign object's handle when duplicating oneYuri Kunde Schlesner2015-01-092-2/+3
|/ /
* | Merge pull request #444 from yuriks/handle-reform2bunnei2015-01-0915-360/+289
|\ \ | | | | | | Kernel Lifetime Reform Pt. 2
| * | Thread: Fix nullptr access in a logging functionYuri Kunde Schlesner2015-01-091-1/+2
| | |
| * | Thread: Rename thread_queue => thread_listYuri Kunde Schlesner2015-01-091-6/+6
| | |
| * | Thread: Reduce use of Handles and move some funcs to inside the class.Yuri Kunde Schlesner2015-01-0910-301/+221
| | |
| * | Kernel: Move Thread's definition to the header fileYuri Kunde Schlesner2015-01-093-53/+67
| | |
| * | Move ThreadContext to core/core.h and deal with the falloutYuri Kunde Schlesner2015-01-098-19/+13
| | |
* | | Merge pull request #436 from kevinhartman/system-corebunnei2015-01-091-0/+5
|\ \ \ | |/ / |/| | Warn if a new thread is intended to be run on the system CPU core
| * | Warn if a new thread is intended to be run on the system CPU core until we implement correct scheduling for such a thread.Kevin Hartman2015-01-071-0/+5
| | |
* | | Merge pull request #255 from Subv/cbranch_3bunnei2015-01-097-5/+232
|\ \ \ | | | | | | | | Implemented timers
| * | | SVC: Implemented the Timer service calls.Subv2015-01-097-5/+232
| | | |
* | | | SVC: Fixed SleepThread.Subv2015-01-093-8/+43
| |_|/ |/| | | | | | | | It will now properly wait the specified number of nanoseconds and then wake up the thread.
* | | Threads: Use a dummy idle thread when no other are ready.Subv2015-01-083-1/+35
| | | | | | | | | | | | This thread will not actually execute instructions, it will only advance the timing/events and try to yield immediately to the next ready thread, if there aren't any ready threads then it will be rescheduled and start its job again.
* | | Merge pull request #404 from bunnei/more-frame-synch-fixesbunnei2015-01-081-1/+4
|\ \ \ | | | | | | | | GPU: Toggle active framebuffer each frame
| * | | GSP: Toggle active framebuffer each framebunnei2015-01-081-1/+4
| | | |
* | | | Merge pull request #431 from yuriks/thread-queue-cleanupbunnei2015-01-071-1/+1
|\ \ \ \ | |_|/ / |/| | | Common: Clean up ThreadQueueList
| * | | Common: Clean up ThreadQueueListYuri Kunde Schlesner2015-01-071-1/+1
| | |/ | |/| | | | | | | | | | | | | | | | | | | Replace all the C-style complicated buffer management with a std::deque. In addition to making the code easier to understand it also adds support for non-POD IdTypes. Also clean the rest of the code to follow our code style.
* / | Fix double-free in Service manager during shutdownYuri Kunde Schlesner2015-01-072-25/+4
|/ / | | | | | | Fixes #423.
* | Merge pull request #376 from Subv/arc_reorderbunnei2015-01-074-18/+23
|\ \ | |/ |/| Archives: Change the folder layout of some archives.
| * Archives: Changed the unimplemented archives comment.Subv2015-01-061-1/+1
| | | | | | | | It now refers to me as the PoC
| * Archives: Addressed some commentsSubv2015-01-061-2/+2
| |
| * Archives: Make SYSTEM_ID and SDCARD_ID stringsSubv2015-01-042-4/+4
| |
| * Archives: Changed the way paths are built for the archives.Subv2015-01-044-15/+20
| | | | | | | | Each archive now takes a mount point of either NAND or SDMC, and builds its own directory structure there, trying to simulate an HLE-friendly hardware layout
| * Archives: Change the folder layout of some archives.Subv2015-01-032-2/+2
| | | | | | | | This is to better represent the hardware layout, they are still aren't quite accurate, but this better and will help a bit when implementing the other archives like NAND-RO and NAND-RW
* | Merge pull request #413 from purpasmart96/serv_cleanbunnei2015-01-067-33/+36
|\ \ | | | | | | Services: Clean up a few things and add a few function names
| * | Services: Clean up a few things and add a few function namespurpasmart962015-01-067-33/+36
| | |
* | | Merge pull request #272 from rohit-n/sign-comparebunnei2015-01-061-4/+4
|\ \ \ | | | | | | | | Silence some -Wsign-compare warnings.
| * | | Silence some -Wsign-compare warnings.Rohit Nirmal2015-01-011-4/+4
| |/ /
* | | DSP: Signal (faked) interrupt on every frame.bunnei2015-01-052-4/+21
| | | | | | | | | | | | - Hack to work around games checking that the DSP event has been signaled by a real DSP interrupt.
* | | Merge pull request #407 from Subv/arbiterbunnei2015-01-051-0/+11
|\ \ \ | | | | | | | | AddressArbiter: Ported arbitration type 2 from 3dmoo.
| * | | AddressArbiter: Ported arbitration type 2 from 3dmoo.Subv2015-01-031-0/+11
| | |/ | |/| | | | | | | (Thanks 3dmoo!)
* | | Merge pull request #408 from Subv/mutexbunnei2015-01-051-2/+2
|\ \ \ | | | | | | | | Mutex: Add the calling thread to the waiting list when needed
| * | | Mutex: Add the calling thread to the waiting list when neededSubv2015-01-041-2/+2
| |/ / | | | | | | | | | This will happen when the mutex is already owned by another thread. Should fix some issues with games being stuck due to waiting threads not being awoken.
* | | Merge pull request #386 from archshift/y2rubunnei2015-01-053-0/+70
|\ \ \ | |/ / |/| | Stub the y2r:u service
| * | Stub the y2r:u servicearchshift2015-01-033-0/+70
| |/
* | Archives: Reduced duplicate code in RomFS and SaveCheck.Subv2015-01-032-4/+5
| | | | | | | | Fixed a few warnings and cleaned up the code
* | SaveDataCheck: Preliminary work in this archive.Subv2015-01-032-3/+35
| | | | | | | | | | | | This allows Steel Diver to boot further, some files are needed. This is still not ready and needs a big cleanup, this will possibly be delayed until the way we handle archives is fixed (with factory classes instead of ahead-of-time creation of archives)
* | Merge pull request #391 from lioncash/pedanticbunnei2015-01-031-3/+3
|\ \ | | | | | | archive/elf: Minor misc changes.
| * | archive: Fix initializer list orderLioncash2015-01-031-3/+3
| |/
* / soc_u: Fix a missing formatting argumentLioncash2015-01-031-1/+1
|/
* SOC_U: Preliminary implementation of sockets.Subv2014-12-314-22/+721
| | | | | | | | | | | | | Stubbed CreateMemoryBlock Using Berkeley sockets, and Winsock2.2 on Windows. So far ftpony creates the socket and accepts incoming connections SOC_U: Renamed functions to maintain consistency Also prevents possible scope errors / conflicts with the actual Berkeley socket functions SOCU: Close all the opened sockets when cleaning up SOCU
* APT:A: Some style changesSubv2014-12-301-12/+12
|
* Archives: Implemented ExtSaveData and SharedExtSaveDataSubv2014-12-305-45/+94
| | | | | | | | They will be stored in /extsavedata/SDMC and /extsavedata/NAND respectively. Also redirect some APT_A functions to their APT_U equivalents. Implemented the gamecoin.dat file in SharedExtSaveData in the PTM module. Implemented formatting the savegame. Retake a previous savegame if it exists instead of reporting them as not formatted every time a game is loaded.
* Kernel: New handle managerYuri Kunde Schlesner2014-12-2813-168/+209
| | | | | | | | | | | This handle manager more closely mirrors the behaviour of the CTR-OS one. In addition object ref-counts and support for DuplicateHandle have been added. Note that support for DuplicateHandle is still experimental, since parts of the kernel still use Handles internally, which will likely cause troubles if two different handles to the same object are used to e.g. wait on a synchronization primitive.
* Kernel: Replace GetStaticHandleType by HANDLE_TYPE constantsYuri Kunde Schlesner2014-12-288-15/+15
|
* Rename ObjectPool to HandleTableYuri Kunde Schlesner2014-12-2812-54/+54
|
* Merge pull request #339 from bunnei/fixup-gsp-synchbunnei2014-12-261-0/+8
|\ | | | | Fixup gsp synch
| * ARM: Add a mechanism for faking CPU time elapsed during HLE.bunnei2014-12-261-0/+8
| | | | | | | | - Also a few cleanups.
* | Merge pull request #330 from purpasmart96/new_srvbunnei2014-12-2660-305/+355
|\ \ | | | | | | More services & small clean ups
| * | More services & small clean upspurpasmart962014-12-2660-305/+355
| | |
* | | Stubbed IsSdmcWriteable to always return writeable.archshift2014-12-241-1/+18
| |/ |/|
* | Merge pull request #322 from chinhodado/masterbunnei2014-12-221-2/+2
|\ \ | |/ |/| More warning cleanups
| * More warning cleanupsChin2014-12-211-2/+2
| |
* | CFG: Fixed some warnings and errors in ClangSubv2014-12-222-4/+4
| |
* | CFG: More style changesSubv2014-12-221-5/+5
| |
* | CFGU: IndentationSubv2014-12-211-4/+3
| |
* | CFG: Some indentationSubv2014-12-211-11/+13
| |
* | CFG: Changed the CreateConfigInfoBlk search loopSubv2014-12-211-7/+4
| |
* | CFG: Corrected the licenses in cfg_i.cpp and cfg_u.cppSubv2014-12-212-2/+2
| |
* | CFG: Create a new subfolder cfg inside service to handle cfgSubv2014-12-219-485/+610
| | | | | | | | Moved most of the shared CFG code there, implemented a few CFG:I functions
* | CFGU: Some changesSubv2014-12-211-12/+33
| |
* | CFGU: Addressed some issues.Subv2014-12-211-43/+55
| |
* | CFGU: Addressed some comments.Subv2014-12-211-11/+13
| |
* | Style: Addressed some commentsSubv2014-12-211-4/+5
| |
* | CFG_U: Use Common::make_unique instead of the std versionSubv2014-12-211-1/+2
| |
* | CFG:U: Implemented some more blocksSubv2014-12-211-4/+30
| |
* | CFG: Implemented block 0x00070001 in the config savefileSubv2014-12-211-0/+5
| |
* | CFGU: Use an absolute offset in the config savefile blocksSubv2014-12-211-1/+3
| |
* | CFG: Load the Config savedata file if it already exists.Subv2014-12-211-3/+4
| |
* | CFGU: Added block 0x000A0002 to the default savegame fileSubv2014-12-211-0/+18
| | | | | | | | That's the language id block, we're using LANGUAGE_EN for now. This block allows some games to boot further
* | CFG: Refactored how the config file works.Subv2014-12-211-55/+126
| | | | | | | | It is now kept in memory as per 3dbrew, all updates happen on memory, then they can be saved using UpdateConfigNANDSavegame.
* | CFG:U: Add some data to the 0x00050005 config block.Subv2014-12-211-6/+11
| | | | | | | | Seems to allow some games to boot further, thanks @Normmatt for sharing this information
* | CFG: Implemented the GetConfigInfoBlk2 function.Subv2014-12-212-12/+188
| | | | | | | | | | | | Added a "config" file to the CFG process service (CFG:U), and added a few default blocks to it. Implemented GetSystemModel and GetModelNintendo2DS
* | Merge pull request #291 from purpasmart96/licensebunnei2014-12-2182-84/+84
|\ \ | | | | | | License change
| * | License changepurpasmart962014-12-2182-84/+84
| | |
* | | Merge pull request #271 from archshift/createfbunnei2014-12-213-1/+47
|\ \ \ | | | | | | | | Added CreateFile to the FS_USER service
| * | | Added CreateFile to the FS_USER servicearchshift2014-12-213-1/+47
| | | | | | | | | | | | | | | | Tested with hwtests.
* | | | Thread: Wait current thread on svc_SleepThreadbunnei2014-12-213-22/+35
| |_|/ |/| | | | | | | | | | | | | | - Removed unused VBLANK sleep mode - Added error log for bad context switch - Renamed VerifyWait to CheckWaitType to be more clear
* | | Merge pull request #316 from yuriks/thread-handlebunnei2014-12-203-2/+16
|\ \ \ | | | | | | | | Kernel: Implement support for current thread pseudo-handle
| * | | Kernel: Implement support for current thread pseudo-handleYuri Kunde Schlesner2014-12-203-2/+16
| | | | | | | | | | | | | | | | This boots a few (mostly Nintendo 1st party) games further.
* | | | Merge pull request #315 from chinhodado/masterbunnei2014-12-202-5/+5
|\ \ \ \ | |_|/ / |/| | | Clean up some warnings
| * | | Clean up some warningsChin2014-12-202-5/+5
| | | |
* | | | Common: Add a clone of std::make_uniqueYuri Kunde Schlesner2014-12-201-6/+7
| | | |
* | | | Merge pull request #306 from Subv/even_more_savedatabunnei2014-12-201-2/+31
|\ \ \ \ | |/ / / |/| | | SaveData: Added some documentation to FormatSaveData
| * | | FS_U: Added the command to the docs of SaveData functionsSubv2014-12-201-0/+2
| | | |
| * | | SaveData: Added some documentation to FormatSaveDataSubv2014-12-181-2/+29
| | | | | | | | | | | | | | | | | | | | We still don't know what the other parameters do, but they appear to be very similar to those of FormatThisUserSaveData. Most likely FormatThisUserSaveData is just an alias for FormatSaveData with LowPathType Empty
* | | | Merge pull request #302 from purpasmart96/flushshutupbunnei2014-12-191-1/+25
|\ \ \ \ | |_|_|/ |/| | | GSP_GPU: Shut up FlushDataCache
| * | | GSP_GPU: Shut up FlushDataCachepurpasmart962014-12-191-1/+25
| | | |
* | | | Merge pull request #308 from Subv/more_savedatabunnei2014-12-191-1/+1
|\ \ \ \ | | | | | | | | | | SystemSaveData: Fixed a typo that was segfaulting
| * | | | SystemSaveData: Fixed a typo that was segfaultingSubv2014-12-191-1/+1
| | | | |
* | | | | Merge pull request #301 from Subv/more_savedatabunnei2014-12-181-0/+9
|\| | | | | |/ / / |/| | | SaveData: Implemented the SystemSaveData archive.
| * | | SaveData: Implemented the SystemSaveData archive.Subv2014-12-181-0/+9
| |/ / | | | | | | | | | It will be stored in the /syssavedata folder. This archive is user by various Services and possibly games via the FS:U service.
* | | Merge pull request #185 from purpasmart96/mem_permbunnei2014-12-182-5/+13
|\ \ \ | |/ / |/| | Kernel: Add missing permissions
| * | Kernel:Add missing permissions in shared memory & svcpurpasmart962014-11-192-5/+13
| | |
* | | Filesystem/Archives: Implemented the SaveData archiveSubv2014-12-186-13/+95
| |/ |/| | | | | | | | | | | | | | | | | The savedata for each game is stored in /savedata/<ProgramID> for NCCH files. ELF files and 3DSX files use the folder 0 because they have no ID information Got rid of the code duplication in File and Directory Files that deal with the host machine's file system now live in DiskFile, similarly for directories and DiskDirectory and archives with DiskArchive. FS_U: Use the correct error code when a file wasn't found
* | Comment out empty arrays causing compile errors in MSVCYuri Kunde Schlesner2014-12-162-6/+8
| |
* | Merge pull request #283 from yuriks/archive-refactorbunnei2014-12-167-241/+245
|\ \ | | | | | | Archive refactor
| * | Work around libstdc++'s lack of support for std::hash on enumsYuri Kunde Schlesner2014-12-161-0/+15
| | |
| * | FS.Archive: Clean up treatment of archives and their handlesYuri Kunde Schlesner2014-12-163-196/+175
| | | | | | | | | | | | | | | | | | | | | - Refactor FS::Archive internals to make Archive creation and lifetime management clearer. - Remove the "Archive as a File" hack. - Implement 64-bit Archive handles.
| * | Service.FS: Rename FileSys::File to FileBackendYuri Kunde Schlesner2014-12-161-1/+1
| | |
| * | Service.FS: Rename FileSys::Directory to DirectoryBackendYuri Kunde Schlesner2014-12-161-2/+2
| | |
| * | Service.FS: Rename FileSys::Archive to ArchiveBackendYuri Kunde Schlesner2014-12-162-5/+5
| | |
| * | Service.FS: Do archive registration using IdCode instead of nameYuri Kunde Schlesner2014-12-163-16/+27
| | |
| * | HLE: Rename namespaces to match move & fix initialization orderYuri Kunde Schlesner2014-12-167-36/+36
| | |
| * | HLE: Move kernel/archive.* to service/fs/Yuri Kunde Schlesner2014-12-166-6/+5
| | |
* | | Merge pull request #282 from archshift/servicesbunnei2014-12-169-0/+221
|\ \ \ | |/ / |/| | Added stubs for ldr:ro, cecd:u, nim:aoc, and am:app services
| * | Added stub for nim:aoc service...archshift2014-12-163-0/+60
| | |
| * | Added stub for cecd:u service...archshift2014-12-163-0/+52
| | | | | | | | | | | | I couldn't find any information about this service...
| * | Added stub for ldr:ro service...archshift2014-12-163-0/+57
| | |
| * | Added am:app service stub.archshift2014-12-163-0/+52
| | | | | | | | | | | | Apparently nothing at all is known about this service...
* | | Remove SyncRequest from K::Object and create a new K::Session typeYuri Kunde Schlesner2014-12-1514-104/+128
|/ / | | | | | | | | | | | | This is a first step at fixing the conceptual insanity that is our handling of service and IPC calls. For now, interfaces still directly derived from Session because we don't have the infrastructure to do it properly. (That is, Processes and scheduling them.)
* | Kernel/Semaphores: Fixed buildSubv2014-12-131-2/+2
| |
* | Kernel/Semaphore: Small style changeSubv2014-12-131-1/+1
| |
* | Kernel/Semaphores: Invert the available count checking.Subv2014-12-131-11/+9
| | | | | | | | Same semantics, idea by @yuriks
* | Kernel/Semaphores: Addressed some issues.Subv2014-12-132-32/+18
| |
* | Semaphore: Removed an unneeded functionSubv2014-12-131-5/+0
| |
* | Semaphores: Addressed some style issuesSubv2014-12-131-6/+5
| |
* | Semaphore: Implemented the initial_count parameter.Subv2014-12-132-5/+7
| |
* | SVC: Implemented ReleaseSemaphore.Subv2014-12-134-19/+81
| | | | | | | | This behavior was tested on hardware, however i'm still not sure what use the "initial_count" parameter has
* | SVC: Implemented svcCreateSemaphoreSubv2014-12-134-1/+115
| | | | | | | | | | ToDo: Implement svcReleaseSemaphore * Some testing against hardware needed
* | kernel: Remove unused log argumentsLioncash2014-12-131-3/+3
| |
* | Convert old logging calls to new logging macrosYuri Kunde Schlesner2014-12-1320-191/+138
| |
* | New logging systemYuri Kunde Schlesner2014-12-131-0/+1
| |
* | Merge pull request #267 from bunnei/apt-shared-fontbunnei2014-12-132-35/+101
|\ \ | | | | | | APT shared font loading
| * | APT_U: Added GetSharedFont service function.bunnei2014-12-131-34/+100
| | |
| * | MemMap: Renamed "GSP" heap to "linear", as this is not specific to GSP.bunnei2014-12-121-1/+1
| | | | | | | | | | | | - Linear simply indicates that the mapped physical address is always MappedVAddr+0x0C000000, thus this memory can be used for hardware devices' DMA (such as the GPU).
* | | DSP: Added stub for ReadPipeIfPossible.bunnei2014-12-121-1/+45
|/ /
* | Merge pull request #256 from Subv/mutexbunnei2014-12-113-37/+67
|\ \ | | | | | | Kernel/Mutex: Properly lock the mutex when a thread enters it
| * | Mutex: Remove some forward declarationsSubv2014-12-071-16/+15
| | | | | | | | | | | | Moved Mutex::WaitSynchronization to the end of the file.
| * | Mutex: Release all held mutexes when a thread exits.Subv2014-12-073-22/+56
| | |
| * | Mutex: Properly lock the mutex when a thread enters itSubv2014-12-061-12/+9
| | | | | | | | | | | | Also resume only the next immediate thread waiting for the mutex when it is released, instead of resuming them all.
* | | CFG:U: Store country codes as u16 instead of char pointers, and return the correct error in GetCountryCodeID.Emmanuel Gil Peyrot2014-12-101-44/+48
| | |
* | | GSP: Trigger GPU interrupts at more accurate locations.bunnei2014-12-101-7/+6
| | |
* | | GSP: Updated TriggerCmdReqQueue to return success code.bunnei2014-12-101-0/+3
| | |
* | | GSP: Updated RegisterInterruptRelayQueue to return expected magic number.bunnei2014-12-101-1/+4
| | |
* | | GPU: Fixed bug in command list size decoding.bunnei2014-12-101-1/+1
| | |
* | | Merge pull request #217 from archshift/cmd_buffbunnei2014-12-091-12/+12
|\ \ \ | | | | | | | | Log the cmd_buff arguments when citra comes across an unimplemented function
| * | | Log the cmd_buff arguments when citra comes across an unimplemented functionarchshift2014-11-251-12/+12
| | | |
* | | | Thread: Fixed to wait on address when in arbitration.bunnei2014-12-093-11/+31
| | | |
* | | | Make OpenDirectory fail if the directory doesn't existarchshift2014-12-071-0/+5
| |/ / |/| | | | | | | | | | | | | | | | | This is in line with what the hardware itself does. It does this by splitting the initial directory opening into Directory.Open(), which will return false if a stat fails. Then, Archive::OpenDirectory will return nullptr, and archive.cpp will return an error code .
* | | Merge pull request #250 from Subv/cbranch_2bunnei2014-12-053-4/+31
|\ \ \ | | | | | | | | SVC: Implemented GetThreadId.
| * | | Threads: Remove a redundant function.Subv2014-12-041-9/+1
| | | | | | | | | | | | | | | | Use the next_thread_id variable directly.
| * | | Threads: Implemented a sequential thread idSubv2014-12-042-4/+19
| | | |
| * | | SVC: Implemented GetThreadId.Subv2014-12-043-4/+24
| | | | | | | | | | | | | | | | For now threads are using their Handle value as their Id, it should not really cause any problems because Handle values are unique in Citra, but it should be changed. I left a ToDo there because this is not correct behavior as per hardware.
* | | | Merge pull request #222 from archshift/renamexyzbunnei2014-12-053-38/+163
|\ \ \ \ | | | | | | | | | | Implemented RenameFile and RenameDirectory in FS:USER
| * | | | Updated archive.cpp functions for proper error handlingarchshift2014-12-043-70/+41
| | | | |
| * | | | Implemented RenameDirectory in FS:USERarchshift2014-11-253-1/+78
| | | | |
| * | | | Implemented RenameFile in FS:USERarchshift2014-11-253-1/+78
| | |/ / | |/| |
* | | | Merge pull request #248 from lioncash/kernelbunnei2014-12-052-10/+7
|\ \ \ \ | | | | | | | | | | Misc minor kernel-related changes.
| * | | | kernel: Shorten GetCountLioncash2014-12-041-6/+3
| | | | |
| * | | | kernel: Make some functions constLioncash2014-12-042-4/+4
| | | | |
* | | | | Merge pull request #247 from lioncash/constbunnei2014-12-042-4/+4
|\ \ \ \ \ | | | | | | | | | | | | hid_user: Pass by reference with PadButtonPress/PadButtonRelease
| * | | | | hid_user: Pass by reference with PadButtonPress/PadButtonReleaseLioncash2014-12-042-4/+4
| | |_|/ / | |/| | |
* | | | | Merge pull request #238 from archshift/dspbunnei2014-12-041-25/+44
|\ \ \ \ \ | | | | | | | | | | | | Add stub for ConvertProcessFromDspDram
| * | | | | Add stub for ConvertProcessFromDspDramarchshift2014-12-041-25/+44
| | |/ / / | |/| | | | | | | | | | | | | Should theoretically push retail stuff further along
* | | | | PTM_U: Added a stub for GetBatteryLevel & GetBatteryChargeState & GetAdapterStatepurpasmart962014-12-041-3/+72
| |/ / / |/| | |
* | | | Merge pull request #231 from purpasmart96/serv_ac_wifi_statusbunnei2014-12-031-1/+19
|\ \ \ \ | | | | | | | | | | AC_U: Added a stub for GetWifiStatus
| * | | | AC_U: Added a stub for GetWifiStatuspurpasmart962014-12-031-1/+19
| | |/ / | |/| |
* | | | Merge pull request #219 from Subv/ptmbunnei2014-12-031-1/+18
|\ \ \ \ | |_|/ / |/| | | PTM_U: Implemented the GetShellState function.
| * | | PTM_U: Implemented the GetShellState function.Subv2014-12-011-1/+18
| | | |
* | | | Merge pull request #224 from bunnei/dsp-service-improvementsbunnei2014-12-012-26/+107
|\ \ \ \ | | | | | | | | | | Dsp service improvements
| * | | | DSP: Added stubs for several commonly used DSP service functions.bunnei2014-12-011-25/+106
| | | | |
| * | | | DSP: Fixed typo in port name.bunnei2014-12-011-1/+1
| | |/ / | |/| |
* | | | Merge pull request #214 from Subv/masterbunnei2014-12-011-2/+86
|\ \ \ \ | | | | | | | | | | CFG:U: Implemented the GetCountryCodeID and GetCountryCodeString
| * | | | CFG:U: Implemented the GetCountryCodeID and GetCountryCodeString.Subv2014-11-301-2/+86
| | | | |
* | | | | Merge pull request #225 from bunnei/fix-release-mutexbunnei2014-11-301-8/+7
|\ \ \ \ \ | | | | | | | | | | | | Mutex: Changed behavior to always release mutex for all threads.
| * | | | | Mutex: Changed behavior to always release mutex for all threads.bunnei2014-11-261-8/+7
| | |/ / / | |/| | |
* | | | | Merge pull request #226 from bunnei/svc-and-thread-fixesbunnei2014-11-302-1/+6
|\ \ \ \ \ | |_|/ / / |/| | | | Svc and thread fixes
| * | | | Thread: Check that thread is actually in "wait state" when verifying wait.bunnei2014-11-261-1/+1
| | | | |
| * | | | SVC: Add debug log to ArbitrateAddress.bunnei2014-11-261-0/+2
| | | | |
| * | | | SVC: SleepThread should yield to the next ready thread.bunnei2014-11-261-0/+3
| |/ / /
* / / / Fixed formatting and switch statement warningsvaguilar2014-11-271-3/+3
|/ / /
* | | Use pointers instead of passing handles around in some functions.Yuri Kunde Schlesner2014-11-241-19/+15
| | |
* | | Remove duplicated docs/update them for changed parameters.Yuri Kunde Schlesner2014-11-2410-88/+0
| | |
* | | HLE: Revamp error handling throrough the HLE codeYuri Kunde Schlesner2014-11-2421-294/+670
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All service calls in the CTR OS return result codes indicating the success or failure of the call. Previous to this commit, Citra's HLE emulation of services and the kernel universally either ignored errors or returned dummy -1 error codes. This commit makes an initial effort to provide an infrastructure for error reporting and propagation which can be use going forward to make HLE calls accurately return errors as the original system. A few parts of the code have been updated to use the new system where applicable. One part of this effort is the definition of the `ResultCode` type, which provides facilities for constructing and parsing error codes in the structured format used by the CTR. The `ResultVal` type builds on `ResultCode` by providing a container for values returned by function that can report errors. It enforces that correct error checking will be done on function returns by preventing the use of the return value if the function returned an error code. Currently this change is mostly internal since errors are still suppressed on the ARM<->HLE border, as a temporary compatibility hack. As functionality is implemented and tested this hack can be eventually removed.
* | | Merge pull request #191 from archshift/deletexyzbunnei2014-11-243-26/+114
|\ \ \ | |/ / |/| | Added DeleteFile and DeleteDirectory functions to FS:USER and the archives.
| * | Added DeleteFile and DeleteDirectory functions to FS:USER and the archives.archshift2014-11-233-26/+114
| | |
* | | Add more services and some fixes, along with more "override"purpasmart962014-11-2125-17/+452
| | | | | | | | | | | | in the service's headers
* | | Merge pull request #211 from linkmauve/masterbunnei2014-11-1930-86/+86
|\ \ \ | | | | | | | | Remove trailing spaces from the entire project
| * | | Remove trailing spaces in every file but the ones imported from SkyEye, AOSP or generatedEmmanuel Gil Peyrot2014-11-1930-86/+86
| | | |
* | | | Merge pull request #208 from lioncash/staticsbunnei2014-11-192-23/+23
|\ \ \ \ | |/ / / |/| | | Add static to some variables
| * | | Add static to some variablesLioncash2014-11-192-23/+23
| | | |
* | | | Remove extraneous semicolonsLioncash2014-11-181-1/+1
|/ / /
* / / core: Mark some hle functions as staticLioncash2014-11-185-46/+46
|/ / | | | | | | These functions are not referred to by their linkage name outside of the translation unit, so they can be marked as static.
* | Archive: Fixed to not destroy archive handle on close.bunnei2014-11-181-3/+3
| |
* | Archive: Fixed close archive before freeing.bunnei2014-11-181-1/+1
| |
* | FS_User: Support FileSye::Path in a more generic way.bunnei2014-11-182-42/+76
| | | | | | | | added a todo to kernel archive
* | FileSys: Updated backend code to use FileSys::Path instead of string for paths.bunnei2014-11-183-14/+14
| |
* | Add missing boss:U service, needed according to Nintendo Zone logs.archshift2014-11-173-0/+57
| |
* | Fix two format strings.Lioncash2014-11-141-1/+1
| |
* | Merge pull request #183 from archshift/lowpathbunnei2014-11-131-83/+81
|\ \ | | | | | | Add support for UTF-16 strings for LowPaths in FS:USER
| * | Use std::u16string for conversion between UTF-8 and UTF-16, FS:USER functionsarchshift2014-11-132-138/+40
| | |
| * | Add support for UTF-16 strings for LowPaths in FS:USERarchshift2014-11-102-86/+182
| |/
* | Merge pull request #188 from bunnei/apt-fixesbunnei2014-11-121-19/+90
|\ \ | | | | | | APT_U: Various improvements and bug fixes.
| * | APT_U: Added stub for function AppletUtility.bunnei2014-11-121-1/+29
| | |
| * | APT_U: Set a valid parameter buffer size in GlanceParameter.bunnei2014-11-121-17/+39
| | | | | | | | | | | | - Also Clarified GlanceParameter/ReceiveParameter documentation.
| * | APT_U: Release service lock on initialization.bunnei2014-11-121-0/+4
| | |
| * | APT_U: Fixes for GetLockHandle to boot system titles.bunnei2014-11-121-1/+18
| |/ | | | | | | - Also added comment to GetLockHandle function.
* / Add FRD:U service and functionsarchshift2014-11-113-0/+64
|/
* Merge pull request #163 from archshift/create-directorybunnei2014-11-023-4/+63
|\ | | | | Added CreateDirectory function to service/fs.cpp, and in Archive.
| * Added CreateDirectory function to service/fs.cpp, and in Archive.archshift2014-11-023-4/+63
| |
* | Added ReceiveNotification, PublishToSubscriber unimplemented functions to SRVarchshift2014-11-021-0/+2
|/
* Added stub err:f service.archshift2014-11-023-0/+56
|
* Added a bunch of servicespurpasmart962014-11-0117-0/+581
|
* Merge pull request #162 from SeannyM/warning-fixesbunnei2014-10-302-6/+6
|\ | | | | Fix some warnings
| * Fix some warningsSean2014-10-302-6/+6
| |
* | FS:USER - Implemented IsSdmcDetectedarchshift2014-10-301-1/+17
| |
* | Renamed souce files of services to match port namesGareth Poole2014-10-2911-10/+10
|/
* Merge pull request #141 from archshift/crash-huntbunnei2014-10-281-0/+4
|\ | | | | hid.cpp: Fixed crash when updating pad data while null
| * hid.cpp: Fixed crash when updating pad data while nullarchshift2014-10-141-0/+4
| | | | | | | | Fixes #137
* | Add `override` keyword through the code.Yuri Kunde Schlesner2014-10-2613-46/+46
| | | | | | | | This was automated using `clang-modernize`.
* | ARM: Integrate SkyEye faster "dyncom" interpreter.bunnei2014-10-251-20/+0
| | | | | | | | | | | | | | | | | | | | Fixed typo (make protected member public) Added license header back in. I originally removed this because I mostly rewrote the file, but meh ARM: Fixed a type error in dyncom interpreter. ARM: Updated dyncom to use unique_ptr for internal ARM state.
* | Don’t fail on empty filename in OpenFileDirectly, return the archive handle insteadEmmanuel Gil Peyrot2014-10-251-8/+7
|/
* Merge pull request #128 from purpasmart96/masterbunnei2014-10-081-1/+31
|\ | | | | APT:U Added a stub fuction for "GlanceParameter"
| * APT: Added a stub for the "GlanceParameter" function.purpasmart962014-10-081-1/+31
| |
* | FileSys: split the constructor into an Open method, in order to notify the opener something went wrong.Emmanuel Gil Peyrot2014-10-061-0/+3
| | | | | | | | Kernel: Return an invalid handle to OpenFile when it failed to open.
* | FileSys/Kernel: Implement SetSize service call for File objects.Emmanuel Gil Peyrot2014-10-061-0/+8
|/
* Added some more names to the function tablepurpasmart962014-10-051-0/+2
| | | Added "SetApplicationCpuTimeLimit" and "GetApplicationCpuTimeLimit" to apt.cpp
* added "StoreDataCache" to the function tablepurpasmart962014-09-301-0/+1
| | | seems simple enough
* Use the citra user path for the sdmc directoryarchshift2014-09-211-2/+1
|
* Kernel: Implement the Close command for Archive, File and Directory.Emmanuel Gil Peyrot2014-09-172-0/+43
|
* FS: Implement OpenArchive, OpenDirectory, OpenFile and OpenFileDirectly calls.Emmanuel Gil Peyrot2014-09-171-20/+177
|
* Kernel: Add a Directory object and a getter for it from an Archive object.Emmanuel Gil Peyrot2014-09-173-0/+91
|
* Kernel: Add a File object and a getter for it from an Archive object.Emmanuel Gil Peyrot2014-09-172-0/+118
|
* Core: Get rid of unnecessary switch statement in KernelLioncash2014-09-151-41/+2
|
* Added support for multiple input device types for KeyMap and connected Qt.Kevin Hartman2014-09-122-113/+127
|
* Initial HID PAD work, with GLFW only.Kevin Hartman2014-09-122-24/+197
|
* Created structure for PAD.Kevin Hartman2014-09-122-0/+28
|
* Merge pull request #99 from archshift/ext-checkbunnei2014-09-111-1/+1
|\ | | | | loader.cpp: improved file extension checking, made Upper/LowerStr useful, moved string_util into Common namespace
| * Added string_util to common, small changes in loader.cpparchshift2014-09-091-1/+1
| |
* | core: Prune redundant includesarchshift2014-09-0912-23/+0
|/
* core: Pass string by reference in FetchFromPortName and DeleteServiceLioncash2014-09-062-4/+4
|
* Threading: Fix thread starting to execute first instruction correctly.bunnei2014-08-281-0/+5
|
* srv::Initialize: Return "success" status code.bunnei2014-08-281-0/+4
|
* Pica/citra-qt: Replace command list view and command list debugging code with something more sophisticated.Tony Wasserka2014-08-251-5/+0
|
* GSP: Update framebuffer information when necessary.Tony Wasserka2014-08-252-2/+41
|
* GSP: Implement SetBufferSwap.Tony Wasserka2014-08-252-1/+47
|
* GSP: Add a helper function for convenience.Tony Wasserka2014-08-251-17/+22
|
* Added FS functions to Archive and Archive_RomFSarchshift2014-08-231-3/+31
|
* Core: Use std::array for managing kernel object spaceLioncash2014-08-192-5/+5
| | | | These avoid relying on memset for clearing the arrays.
* Merge pull request #55 from lioncash/stringbunnei2014-08-1916-41/+38
|\ | | | | Core: Alter the kernel string functions to use std::string instead of const char*.
| * Core: Alter the kernel string functions to use std::string instead of const char*.Lioncash2014-08-1816-41/+38
| | | | | | | | Most functions already operate on std::strings. This also removes the need to manually null terminate thread names.
* | SVC: Added support for svc_GetSystemTick.bunnei2014-08-192-19/+48
|/ | | | Changed HLE function return methods to be static inline functions.
* Core: Fix a formatting error in svc.cppLioncash2014-08-171-3/+2
| | | | | entry_point would not be added to the string. Also used StringFromFormat so that the buffer is unnecessary.
* Merge pull request #39 from bunnei/hid-minor-improvementsbunnei2014-08-132-6/+45
|\ | | | | Hid minor improvements
| * HID: Added new function entries from 3dbrew to FunctionTable.bunnei2014-08-131-0/+5
| | | | | | | | HID: Fix typo with DisableGyroscopeLow command.
| * HID: Implemented HID_User::GetIPCHandles service function.bunnei2014-08-081-5/+39
| |
| * SVC: Fixed typo with MapMemoryBlock DEBUG_LOG call.bunnei2014-08-081-1/+1
| |
* | Pica/GPU: Change hardware registers to use physical addresses rather than virtual ones.Tony Wasserka2014-08-121-9/+9
| | | | | | | | | | This cleans up the mess that address reading/writing had become and makes the code a *lot* more sensible. This adds a physical<->virtual address converter to mem_map.h. For further accuracy, we will want to properly extend this to support a wider range of address regions. For now, this makes simply homebrew applications work in a good manner though.
* | GSP: Fix a major regression introduced in ffda035c, due to which no display transfers were triggered at all anymore.Tony Wasserka2014-08-121-4/+13
| |
* | Remove the fancy RegisterSet class introduced in 4c2bff61e.Tony Wasserka2014-08-121-18/+18
|/ | | | | While it was some nice and fancy template usage, it ultimately had many practical issues regarding length of involved expressions under regular usage as well as common code completion tools not being able to handle the structures. Instead, we now use a more conventional approach which is a lot more clean to use.
* Thread: Added more descriptive comment to WaitCurrentThread.bunnei2014-08-072-2/+10
|
* GSP: Cleaned up command buffer decoding.bunnei2014-08-072-61/+69
| | | | | | | | GSP: Cleaned up code and added additional comments. GSP: Removed unnecessary TODO comment. GSP: Changed u32 iterators in TriggerCmdReqQueue to unsigned.
* GSP: Added reinitialization of other state objects.bunnei2014-08-061-0/+3
|
* GSP: Removed dumb GX prefixes to functions/structs in GSP namespace.bunnei2014-08-062-77/+78
| | | | - Various other cleanups.
* GSP: Removed unnecessary GX_FinishCommand function.bunnei2014-08-061-13/+5
|
* GSP: Implements preliminary command synchronization via GPU interrupts.bunnei2014-08-062-18/+109
| | | | Core: Added a comment to explain the logic for the RunLoop iterations.
* AddressArbiter: Removed unnecessary HLE::Reschedule.bunnei2014-08-061-1/+0
|
* AddressArbiter: Fixed bug with break statements missing from case statements.bunnei2014-08-061-0/+2
|
* SRV: Updated GetProcSemaphore to create an event instead of a mutex.bunnei2014-08-061-8/+10
|
* SVC: Removed ArbitrateAddress log message that spams to much.bunnei2014-08-061-2/+0
|
* Kernel: Updated Event and Mutex to specify handle that they are blocking for.bunnei2014-08-062-2/+2
|
* FS: Fix port name (old port name was based on an unaligned memory read).bunnei2014-08-061-1/+1
|
* Fix a few warnings.Tony Wasserka2014-07-231-3/+3
| | | | Templates shouldn't be marked as inline if they aren't defined in the header.
* GSP: Add a few comments.Tony Wasserka2014-07-232-1/+15
|
* GSP: Clean up GX command processing a lot and treat command id as a u8 rather than a u32.Tony Wasserka2014-07-232-37/+79
| | | | Anonymous structs are not standard C++, hence don't use them.
* GPU: Make use of RegisterSet.Tony Wasserka2014-07-231-21/+28
|
* GPU: Emulate memory fills.Tony Wasserka2014-07-232-1/+9
|
* GSP: HLE GXCommandId::SET_DISPLAY_TRANSFER and GXCommandId::SET_TEXTURE_COPY.Tony Wasserka2014-07-231-2/+9
|
* GSP: Implement ReadHWRegs and WriteHWRegs properly.Tony Wasserka2014-07-231-27/+46
|
* Kernel: Added preliminary support for address arbiters.bunnei2014-07-094-9/+134
| | | | | | | | AddressArbiter: Added documentation comment, fixed whitespace issue. AddressArbiter: Fixed incorrect comment, reordered if-statement to be more clear. SVC: Removed trailing whitespace.
* Thread: Added functions to resume threads from address arbitration.bunnei2014-07-092-0/+44
| | | | | | Thread: Cleaned up arbitrate address functions. Thread: Cleaned up ArbitrateAllThreads function.
* function_wrappers: Fixed incorrect wrapper, added another.bunnei2014-07-081-2/+9
|
* SharedMemory: Updated MapSharedMemory to use an enum for permissions.bunnei2014-07-053-16/+36
| | | | - Also added some safety checks to MapSharedMemory.
* GSP: Fixed to use real shared memory object, various cleanups.bunnei2014-07-052-30/+40
| | | | | | | | - Previously, used a hard-coded shared memory handle of 0x10002000 (as used by libctru homebrew) GSP: Added name for shared memory. GSP: Cleaned up assertion message.
* Kernel: Added support for shared memory objects.bunnei2014-07-052-0/+132
| | | | SharedMemory: Added optional name field for tracking known objects.
* Archive: Added Init/Shutdown methods to reset kernel archive state.bunnei2014-07-053-0/+19
|
* FileSys: Added preliminary support for applications reading the RomFS archive.bunnei2014-07-053-13/+135
| | | | | | | | | | Archive: Fixed brace ugliness for neobrain :) FS: Commented out unused local variables to prevent warnings. ...But keeping them here for future use. archive_romfs: Removed unused #include.
* APT: Added stubbed ReceiveParameter and various cleanups.bunnei2014-07-041-71/+93
| | | | | | APT: More cleanups. APT: Changed SignalType to be type u32.
* FS: Added stubbed code to intercept and decode file system service functions.bunnei2014-06-273-0/+154
| | | | FS: Added to CMakeLists.txt
* Kernel: Added stubbed code to support creation of kernel Archive objects.bunnei2014-06-273-0/+85
|
* Merge branch 'threading' of https://github.com/bunnei/citrabunnei2014-06-1424-1124/+1133
|\ | | | | | | | | | | Conflicts: src/core/hle/function_wrappers.h src/core/hle/service/gsp.cpp
| * Kernel: Removed unnecessary "#pragma once".bunnei2014-06-131-2/+0
| |
| * Kernel: Added freeing of kernel objects on emulator shutdown.bunnei2014-06-132-0/+10
| |
| * Event: Updated several log messages to be assertions.bunnei2014-06-131-16/+8
| |
| * HLE: Moved "PARAM" and "RETURN" macros to function_wrappers.h (this is only module where they are needed).bunnei2014-06-132-5/+6
| |
| * SVC: Renamed all function wrapper templates to Wrap, moved to HLE namespace.bunnei2014-06-132-157/+145
| |
| * Thread: Renamed occurrences of "t" to "thread" to improve readability.bunnei2014-06-131-48/+45
| |
| * Thread: Cleaned up VerifyWait, fixed issue where nullptr msg could unnecessarily be logged.bunnei2014-06-131-9/+7
| |
| * HLE: Removed usnused EatCycles function.bunnei2014-06-133-15/+0
| |
| * SVC: Cleaned up function wrappers to pass in correct argument types.bunnei2014-06-132-870/+201
| |
| * Thread: Moved position of * in arguments.bunnei2014-06-131-2/+2
| |
| * Thread: Updated VerifyWait to be more readable (but functionally the same).bunnei2014-06-131-4/+3
| |
| * SVC: Moved declaration of "wait" variable in SendSyncRequest for improved readability.bunnei2014-06-131-1/+1
| |
| * HLE: Updated all uses of NULL to nullptr (to be C++11 compliant)bunnei2014-06-1312-235/+235
| |
| * Kernel: Updated various kernel function "name" arguments to be const references.bunnei2014-06-134-6/+6
| |
| * HLE: Updated various handle debug assertions to be more clear.bunnei2014-06-134-10/+10
| |
| * Mutex: Moved ReleaseMutex iterator declaration to be inside while loop.bunnei2014-06-131-2/+1
| |
| * Kernel: Updated several member functions to be constbunnei2014-06-135-13/+13
| |
| * Thread: Fixed bug with ResetThread where cpu_registers[15] was being incorrectly setbunnei2014-06-131-1/+1
| |
| * Kernel: Made SyncRequest not pure virtual, with a default implementation of error (as this is not required for all kernel objects)bunnei2014-06-133-23/+4
| |
| * Kernel: Added real support for thread and event blockingbunnei2014-06-136-76/+196
| | | | | | | | | | | | | | | | | | | | | | | | | | - SVC: Added ExitThread support - SVC: Added SignalEvent support - Thread: Added WAITTYPE_EVENT for waiting threads for event signals - Thread: Added support for blocking on other threads to finish (e.g. Thread::Join) - Thread: Added debug function for printing current threads ready for execution - Thread: Removed hack/broken thread ready state code from Kernel::Reschedule - Mutex: Moved WaitCurrentThread from SVC to Mutex::WaitSynchronization - Event: Added support for blocking threads on event signalling Kernel: Added missing algorithm #include for use of std::find on non-Windows platforms.
| * hle: added a hokey way to force a thread reschedule during CPU single step mode (as used by the debugger)bunnei2014-06-052-0/+5
| |
| * kernel: changed current default thread priority back to 0x30 - I think this is more correctbunnei2014-06-051-1/+1
| |
| * arm: fixed bug in how thread context switch occurs with SkyEyebunnei2014-06-051-0/+4
| |
| * service: added a error log messages for unimplemented WaitSynchronizationbunnei2014-06-051-0/+1
| |
| * svc: added optional name field to Event and Mutex (used for debugging)bunnei2014-06-036-12/+25
| |
| * kernel: moved position of * for GetTypeName and GetNamebunnei2014-06-031-2/+2
| |
| * coprocessor: reenabled debug logbunnei2014-06-031-1/+1
| |
| * svc: updated WaitSynchronizationN to properly use first pointer argumentbunnei2014-06-022-4/+6
| |
| * svc: changed DuplicateHandle log message from "error" to "debug"bunnei2014-06-021-1/+1
| |
| * svc: added GetThreadPriority and SetThreadPriority, added (incomplete) DuplicateHandle supportbunnei2014-06-023-3/+77
| |
| * kernel: changed main thread priority to default, updated Kernel::Reschedule to use PrepareReschedulebunnei2014-06-026-9/+17
| |
| * svc: cleaned up function_wrappers, updated various SVCs to make use of pointer argumentsbunnei2014-06-022-31/+40
| |
| * svc: added missing function wrapper for SleepThreadbunnei2014-06-011-0/+4
| |
| * gsp: always pass through synchronization barrier for commandsbunnei2014-06-011-1/+16
| |
| * svc: updated waitSychronization to not overwrite handle on return, added stub for SleepThread (does nothing)bunnei2014-06-011-2/+21
| |
| * thread: updated Reschedule to sit at a synchronization barrier when no other threads are ready for executionbunnei2014-06-011-0/+18
| |
| * event: added a hackish ability to set an event as "locked" to its current state, cleaned up some commentsbunnei2014-06-012-4/+32
| |
| * hle: added stubbed service for ndm_ubunnei2014-05-302-0/+65
| |
| * service: cleaned up log messagesbunnei2014-05-301-2/+2
| |
| * service: removed PT_A from, as this was just an alias for APT_Ubunnei2014-05-301-2/+0
| |
| * srv: fix to log unimplemented service (instead of crash)bunnei2014-05-301-6/+2
| |
| * mutex: fixed typo in ReleaseMutexbunnei2014-05-301-1/+3
| |
| * hle: cleaned up log messagesbunnei2014-05-307-42/+47
| |
| * svc: updated OutputDebugString to use OS_LOGbunnei2014-05-301-1/+1
| |
| * svc: changed unimplemented SVC log messages from "debug" messages to "error" messagesbunnei2014-05-301-8/+8
| |
| * svc: added svcClearEvent, stubbed function for svcArbitrateAddress, and various fixesbunnei2014-05-302-22/+38
| | | | | | | | | | | | - force kernel reschedule after svcWaitSynchronization - fixed some bugs with passing in pointer arguments - cleaned up some comments and log messages
| * event: added support for ClearEvent, fixed a bug with CreateEvent, fixed some commentsbunnei2014-05-302-9/+14
| |
| * service: added additional hack to return success on unimplemented service callsbunnei2014-05-301-2/+10
| |
| * srv: changed a NOTICE_LOG to DEBUG_LOGbunnei2014-05-301-1/+1
| |
| * svc: added ArbitrationType enumerationbunnei2014-05-301-0/+9
| |
| * apt: added stubbed function for InquireNotificationbunnei2014-05-291-78/+86
| |
| * hle: properly cast 64-bit function wrapper parameters to (u64)bunnei2014-05-291-2/+2
| |
| * hle: removed PARAM64 macro (this was incorrect), made several bug fixes accordingly for decoding U64 function parametersbunnei2014-05-292-3/+2
| |
| * service: changed interface to return 0 (no error) when a service method is unimplemented - hack to make apps boot furtherbunnei2014-05-291-2/+2
| |
| * APT_U: added stubbed function for APT_U::Enable, fixed some log messages to be more consistentbunnei2014-05-281-3/+10
| |
| * mutex: added preliminary SyncRequest/WaitSynchronization, added some comments/assertionsbunnei2014-05-281-0/+6
| |
| * svc: implemented WaitSynchronization1, WaitSynchronizationN, and CreateEventbunnei2014-05-281-14/+54
| |
| * APT_U: added event creation to Initialize methodbunnei2014-05-281-1/+11
| |
| * event: fixed typos and updated CMakeListsbunnei2014-05-281-1/+1
| |
| * event: added SetEventLocked method to change status an events lockbunnei2014-05-282-0/+18
| |
| * kernel: added event module to support creation of CTR "Event" objectsbunnei2014-05-282-0/+119
| |
| * mutex: removed docstring comment that is no longer relevantbunnei2014-05-271-1/+0
| |
| * mutex: added additional docstringsbunnei2014-05-271-0/+2
| |
| * kernel: added WaitSynchronization method to Kernel::Objectbunnei2014-05-274-0/+39
| |
| * kernel: updated SyncRequest to take boolean thread wait result as a parameterbunnei2014-05-275-10/+33
| |
| * svc: added some assertionsbunnei2014-05-271-6/+4
| |
| * service: Renamed Sync to SyncRequestbunnei2014-05-271-1/+1
| |
| * kernel: added enum for known CurrentThread and CurrentProcess handlesbunnei2014-05-271-0/+5
| |
| * srv: added a real mutex for GetProcSemaphore (instead of stubbed)bunnei2014-05-271-3/+10
| |
| * svc: changed SendSyncRequest to use Kernel::Object SyncRequest (instead of just service Interface class)bunnei2014-05-271-2/+2
| |
| * kernel: add a SyncRequest method to KernelObject for use with svcSendSyncRequestbunnei2014-05-274-6/+11
| |
| * svc: added stub for DuplicateHandle SVC callbunnei2014-05-271-1/+8
| |
* | GPU debugger: Add functionality to inspect command lists.Tony Wasserka2014-06-121-0/+4
| |
* | GPU: Cleanup register definitions.Tony Wasserka2014-06-121-3/+3
| |
* | Rename LCD to GPU.Tony Wasserka2014-06-121-8/+8
| |
* | Add initial graphics debugger interface.Tony Wasserka2014-06-121-0/+6
| |
* | GSP: Define more GX commands.Tony Wasserka2014-06-122-14/+54
| |
* | service: fixed typo that MSVC did not catch as an errorbunnei2014-05-231-1/+1
| |
* | Merge branch 'threading'bunnei2014-05-2321-131/+1124
|\|
| * svc: added a check to ensure that a service was implemented before attempting to connect to its portbunnei2014-05-231-1/+5
| |
| * thread: renamed "WaitCurThread" to "WaitCurrentThread", removed unused "reason" argumentbunnei2014-05-233-6/+6
| |
| * thread: removed unused SwitchContext/Reschedule reason field, added missing arg parameter to SVC CreateThreadbunnei2014-05-233-12/+9
| |
| * kernel: refactored function naming to remove "__" prefixbunnei2014-05-235-62/+72
| |
| * thread: moved ThreadStatus/WaitType to header, added support for arg on CreateThread, added correct CPSR resetbunnei2014-05-232-35/+40
| |
| * APT_U: added a debug log on calling GetLockHandlebunnei2014-05-231-0/+1
| |
| * thread: fixed bug where result of __NextThread was not being properly checked when NULLbunnei2014-05-221-1/+1
| |
| * svc: added Kernel::Reschedule to svc WaitSynchronization1, updated log messages to include newly created handlesbunnei2014-05-221-4/+7
| |
| * svc: enabled use of newly created kernel thread handlebunnei2014-05-211-5/+5
| |
| * mutex: refactored the interface to code to return a Mutex* handlebunnei2014-05-214-5/+16
| |
| * mutex: initial commit of HLE modulebunnei2014-05-214-10/+157
| |
| * svc: added some commentsbunnei2014-05-211-0/+7
| |
| * kernel: fixed include, in general include "common.h" not "common_types.h"bunnei2014-05-211-1/+1
| |
| * service: removed redundant include of common_types.hbunnei2014-05-211-1/+0
| |
| * thread: added correct lowest thread priority, added a thread priority check, and added some commentsbunnei2014-05-212-6/+10
| |
| * thread: exposed ResumeThreadFromWait function for use in other kernel modulesbunnei2014-05-212-8/+11
| |
| * thread: moved threading calls to the Kernel namespacebunnei2014-05-214-103/+117
| |
| * ARM_Interface: added SaveContext and LoadContext functions for HLE thread switchingbunnei2014-05-211-36/+2
| |
| * renamed "syscall" module to "svc" (more accurate naming)bunnei2014-05-216-17/+19
| |
| * thread: whitespace change - fixed * and & placementbunnei2014-05-212-27/+27
| |
| * - created a Kernel namespacebunnei2014-05-216-75/+87
| | | | | | | | | | - cleaned up Kernel code a bit (moved stuff into namespace, fixed whitespace issues) - added handle types for all different CTROS handles
| * apt: changed stubbed handle to be something other than 0xDEADBEEF (used as a magic value in other places) so that I can track how it propagates through the app codebunnei2014-05-201-1/+1
| |
| * thread: added declaration for __KernelReschedule to be used by syscall modulebunnei2014-05-201-0/+3
| |
| * renamed "session" to "handle"bunnei2014-05-191-3/+3
| |
| * - renamed NewHandle to CreateHandlebunnei2014-05-192-8/+8
| | | | | | | | - updated CreateHandle/DeleteHandle to use KernelObject's
| * fix warningbunnei2014-05-191-1/+1
| |
| * - updated service(s) to be KernelObject'sbunnei2014-05-197-59/+31
| | | | | | | | - various cleanups
| * renamed "UID" to "Handle" where appropriatebunnei2014-05-194-24/+22
| |
| * - moved Handle/Result definitions to kernel.hbunnei2014-05-196-14/+19
| | | | | | | | - added ResetType enum
| * - added stub for CreateEventbunnei2014-05-181-8/+22
| | | | | | | | - changed some stubbed SVCs to return unique handle names for debugging purposes
| * added stubbed function for WaitSynchronizationNbunnei2014-05-182-4/+19
| |
| * changed a commentbunnei2014-05-172-2/+2
| |
| * cleanups to SVC CreateThreadbunnei2014-05-171-8/+15
| |
| * - added enum ThreadProcessorIdbunnei2014-05-172-53/+107
| | | | | | | | | | - reorganized some kernel thread functions - added placeholder __KernelWaitThread_Synchronization function
| * - replaced KERNELOBJECT_MAX_NAME_LENGTH with KERNEL_MAX_NAME_LENGTHbunnei2014-05-173-8/+12
| | | | | | | | - added KERNEL_DEFAULT_STACK_SIZE definition (0x4000)
| * added stubbed GetProcSemaphore - does nothing but avoids an exceptionbunnei2014-05-171-1/+7
| |
| * updated APT_U::GetLockHandle to return a valid handlebunnei2014-05-171-1/+5
| |
| * Merge master into threading to add support for VFPbunnei2014-05-172-21/+2
| |\
| * | - added SVC stubs for QueryMemory and GetThreadIdbunnei2014-05-163-2/+30
| | | | | | | | | | | | - added SVC structs MemoryInfo and PageInfo
| * | completely gutted/refactored threading code to be simplerbunnei2014-05-162-658/+230
| | |
| * | changed "UID" to "Handle" to be a little more consistent with CTR namingbunnei2014-05-162-18/+21
| | |
| * | - added ThreadContext structbunnei2014-05-162-8/+26
| | | | | | | | | | | | - cleaned up CreateThread svc
| * | - added helper function for __KernelCreateThreadbunnei2014-05-152-4/+76
| | | | | | | | | | | | | | | - added __KernelSwitchToThread for enabling a thread - added __KernelRotateThreadReadyQueue
| * | changed primary thread priority to 0x30 - this is typical, not 0x31bunnei2014-05-151-1/+2
| | |
| * | added function stubs for EatCycles and ReSchedulebunnei2014-05-152-0/+15
| | |
| * | fixed thread reset to not set stack addressbunnei2014-05-141-1/+1
| | |
| * | various cleanups / remove unused codebunnei2014-05-142-65/+29
| | |
| * | added a bunch of threading code, recycled from PPSSPP, with lots of hacks in for 3DS... doesn't really do much yet. Just a jumping off pointbunnei2014-05-142-70/+543
| | |
| * | added CreateThread, CreateMutex, and ReleaseMutex SVC stubs (just parameter decoding for now)bunnei2014-05-142-7/+38
| | |
| * | - added __KernelLoadExec functionbunnei2014-05-142-13/+35
| | | | | | | | | | | | - fixed some logging
| * | added initial kernel/thread modulesbunnei2014-05-104-0/+527
| | |
* | | Merge remote-tracking branch 'upstream/master' into issue-7-fixarchshift2014-05-1713-282/+403
|\ \ \ | | |/ | |/|
| * | - reenabled MCR and MRC functions now that VFP is attachedbunnei2014-05-172-21/+2
| |/ | | | | | | - removed HLE::CallMCR function (was pointless)
| * removed unknown fields from GX_CmdBufferHeaderbunnei2014-05-081-5/+0
| |
| * removed unnecessary log messagebunnei2014-05-081-1/+1
| |
| * - removed HLE mem "hack" and replaced with kernel mem regionbunnei2014-05-087-105/+89
| | | | | | | | | | - added a helper function for getting command buffer for services - fixed bug where GSP DMA was incorrectly being done in DataSynchronizationBarrier (instead of gsp_TriggerCmdReqQueue)
| * - added debug logging to syscall.cppbunnei2014-05-072-135/+173
| | | | | | | | - added stubbed HLE syscall functions for svc_GetResourceLimit and svc_GetResourceLimitCurrentValues
| * added config_mem module for HLE of firmware configuration memory settingsbunnei2014-05-072-0/+91
| |
| * - added CallMCR function to coprocessor HLE modulebunnei2014-05-022-7/+20
| | | | | | | | - moved instruction decoding to coprocessor HLE module
| * fixed include in coprocessor.cppbunnei2014-05-021-1/+1
| |
| * renamed hle "mrc" module to "coprocessor"bunnei2014-05-022-0/+0
| |
| * - added some function wrappers for HLEbunnei2014-05-022-10/+29
| | | | | | | | | | - added stub for SVC CreateAddressArbiter - added OutputDebugString SVC
* | Problematic template functionsarchshift2014-04-281-15/+0
|/
* removed DISALLOW_COPY_AND_ASSIGN in favor of NonCopyable classbunnei2014-04-283-9/+0
|
* fixed weird spacingbunnei2014-04-281-1/+1
|
* hackish but working way to set the framebuffer location to VRAM (used in ARM11 demos tested thus far, e.g. yeti3DS)bunnei2014-04-271-3/+9
|
* added simple GSP GPU ReadHWRegs function to support returning the framebuffer addressbunnei2014-04-261-1/+37
|
* added preliminary DataSynchronizationBarrier support with simple DMA copybunnei2014-04-261-7/+39
|
* moved HLE::MRC to its own module, added support for catching data synchronization barrier commandbunnei2014-04-254-10/+52
|
* fixed bug where svc_ControlMemory was not properly getting passed in parametersbunnei2014-04-251-2/+2
|
* - added preliminary support for svc_MapMemoryBlockbunnei2014-04-251-4/+34
| | | | | - added shared memory region - moarrrr cleanups to memory_map
* added GSP::RegisterInterruptRelayQueue functionbunnei2014-04-251-31/+40
|
* - refactored how service functions are calledbunnei2014-04-255-19/+39
| | | | - added option to create/delete service handles
* renamed hw_lcd module to just lcdbunnei2014-04-181-2/+0
|
* added GSP heap memory allocationbunnei2014-04-181-1/+25
|
* added a new function wrapperbunnei2014-04-171-0/+5
|
* fixed bug with printing std::string in log messagesbunnei2014-04-171-2/+2
|
* added class stub for HID:User servicebunnei2014-04-173-0/+72
|
* updated service commentsbunnei2014-04-176-5/+17
|
* - fixed tabs in function_wrappers.hbunnei2014-04-174-395/+413
| | | | | - fixed log message wording in hle.cpp - added syscall stubs for CloseHandle and WaitSynchronization1
* - added stubbed out GSP::Gpu service interfacebunnei2014-04-167-7/+103
| | | | - various cleanups/refactors to HLE services
* removed no longer used function headerbunnei2014-04-161-2/+0
|
* restructured hle:services completely to use function lookup tablesbunnei2014-04-165-137/+215
|
* fixed naming for APT_Ubunnei2014-04-163-9/+9
|
* - extracted srv: calls from service.cpp and put in its own modulebunnei2014-04-164-106/+105
| | | | | - added function tables for service calls - lots of refactoring
* added a stub for GetLockHandlebunnei2014-04-143-9/+44
|
* added framework for APT service (application and title launching service)bunnei2014-04-135-5/+118
|
* renamed class Interface_SRV to SRVbunnei2014-04-131-6/+6
|
* added some very initial command parsing for SRV Syncbunnei2014-04-131-5/+31
|
* added a GetPointer function for reading from HLE command bufferbunnei2014-04-132-0/+14
|
* added OS memory read/write for thread command bufferbunnei2014-04-132-3/+55
|
* cleanups to service HLEbunnei2014-04-132-8/+8
|
* - added HLE to connect to "srv:" servicebunnei2014-04-135-130/+328
| | | | | | - added a manager for keeping track of services/ports - added a memory mapped region for memory accessed by HLE - added HLE for GetThreadCommandBuffer function
* - renamed hle_syscall to just syscallbunnei2014-04-125-101/+145
| | | | - added service.h as an initial service interface
* replace tabs with spacesbunnei2014-04-121-6/+6
|
* moved hle.cpp into hle folder (due to mistake earlier)bunnei2014-04-121-0/+57
|
* added remaining known syscall functions to Syscall_Tablebunnei2014-04-111-0/+80
|
* base code to call a syscall from ARM11 appcorebunnei2014-04-113-7/+56
|
* changed some naming/misc cleanupsbunnei2014-04-113-18/+17
|
* - removed syscall classes (will just use HLEFunction)bunnei2014-04-113-15/+17
| | | | | - added hle.cpp and module registration - removed unused code
* added initial modules for setting up SysCall HLEbunnei2014-04-114-0/+825