diff options
200 files changed, 6707 insertions, 1373 deletions
diff --git a/Android/jni/Android.mk b/Android/jni/Android.mk index 3542e588b..ce142d446 100644 --- a/Android/jni/Android.mk +++ b/Android/jni/Android.mk @@ -5,7 +5,7 @@ LOCAL_MODULE := mcserver -LOCAL_SRC_FILES := $(shell find ../CryptoPP ../lua ../jsoncpp ../zlib ../src ../tolua++ ../iniFile ../expat ../md5 ../sqlite ../luaexpat '(' -name '*.cpp' -o -name '*.c' ')') +LOCAL_SRC_FILES := $(shell find ../lib/polarssl ../lib/lua ../lib/jsoncpp ../lib/zlib ../src ../lib/tolua++ ../lib/iniFile ../lib/expat ../lib/md5 ../lib/sqlite ../lib/luaexpat '(' -name '*.cpp' -o -name '*.c' ')') LOCAL_SRC_FILES := $(filter-out %SquirrelFunctions.cpp %SquirrelBindings.cpp %cPlugin_Squirrel.cpp %cSquirrelCommandBinder.cpp %minigzip.c %lua.c %tolua.c %toluabind.c %LeakFinder.cpp %StackWalker.cpp %example.c,$(LOCAL_SRC_FILES)) LOCAL_SRC_FILES := $(patsubst %.cpp,../%.cpp,$(LOCAL_SRC_FILES)) LOCAL_SRC_FILES := $(patsubst %.c,../%.c,$(LOCAL_SRC_FILES)) @@ -24,17 +24,17 @@ LOCAL_C_INCLUDES := ../src \ ../src/packets \ ../src/items \ ../src/blocks \ - ../tolua++/src/lib \ - ../lua/src \ - ../zlib-1.2.7 \ - ../iniFile \ - ../tolua++/include \ - ../jsoncpp/include \ - ../jsoncpp/src/lib_json \ - ../expat/ \ - ../md5/ \ - ../sqlite/ \ - ../luaexpat/ \ + ../lib/tolua++/src/lib \ + ../lib/lua/src \ + ../lib/zlib-1.2.7 \ + ../lib/iniFile \ + ../lib/tolua++/include \ + ../lib/jsoncpp/include \ + ../lib/jsoncpp/src/lib_json \ + ../lib/expat/ \ + ../lib/md5/ \ + ../lib/sqlite/ \ + ../lib/luaexpat/ \ .. \ @@ -1,4 +1,199 @@ - Copyright MCServer Contributors +MCServer: A performant C++ Minecraft Server +www: http://mc-server.org/ + +Copyright 2014 MCServer Team + +------ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/MCServer/.gitignore b/MCServer/.gitignore index 64f062ef7..69826ef06 100644 --- a/MCServer/.gitignore +++ b/MCServer/.gitignore @@ -6,6 +6,7 @@ MCServer MCServer_debug CommLogs/ +GalExports/ logs players world* diff --git a/MCServer/Plugins/APIDump/APIDesc.lua b/MCServer/Plugins/APIDump/APIDesc.lua index 74e7bf860..59dd93137 100644 --- a/MCServer/Plugins/APIDump/APIDesc.lua +++ b/MCServer/Plugins/APIDump/APIDesc.lua @@ -200,6 +200,8 @@ g_APIDesc = msFillAir = { Notes = "Dst is overwritten by Src only where Src has air blocks" }, msImprint = { Notes = "Src overwrites Dst anywhere where Dst has non-air blocks" }, msLake = { Notes = "Special mode for merging lake images" }, + msSpongePrint = { Notes = "Similar to msImprint, sponge block doesn't overwrite anything, all other blocks overwrite everything"}, + msMask = { Notes = "The blocks that are exactly the same are kept in Dst, all differing blocks are replaced by air"}, }, ConstantGroups = { @@ -247,6 +249,9 @@ g_APIDesc = <tr> <td> A </td><td> B </td><td> B </td><td> A </td><td> B </td> </tr> + <tr> + <td> A </td><td> A </td><td> A </td><td> A </td><td> A </td> + </td> </tbody></table> <p> @@ -258,12 +263,24 @@ g_APIDesc = </ol> </p> + <h3>Special strategies</h3> + <p>For each strategy, evaluate the table rows from top downwards, the first match wins.</p> + <p> - Special strategies: + <strong>msDifference</strong> - changes all the blocks which are the same to air. Otherwise the source block gets placed. </p> - + <table><tbody<tr> + <th colspan="2"> area block </th><th> </th><th> Notes </th> + </tr><tr> + <td> * </td><td> B </td><td> B </td><td> The blocks are different so we use block B </td> + </tr><tr> + <td> B </td><td> B </td><td> Air </td><td> The blocks are the same so we get air. </td> + </tr> + </tbody></table> + + <p> - <strong>msLake</strong> (evaluate top-down, first match wins): + <strong>msLake</strong> - used for merging areas with lava and water lakes, in the appropriate generator. </p> <table><tbody><tr> <th colspan="2"> area block </th><th> </th><th> Notes </th> @@ -293,7 +310,39 @@ g_APIDesc = <td> A </td><td> * </td><td> A </td><td> Everything else is left as it is </td> </tr> </tbody></table> - ]], + + <p> + <strong>msSpongePrint</strong> - used for most prefab-generators to merge the prefabs. Similar to + msImprint, but uses the sponge block as the NOP block instead, so that the prefabs may carve out air + pockets, too. + </p> + <table><tbody><tr> + <th colspan="2"> area block </th><th> </th><th> Notes </th> + </tr><tr> + <th> this </th><th> Src </th><th> result </th><th> </th> + </tr><tr> + <td> A </td><td> sponge </td><td> A </td><td> Sponge is the NOP block </td> + </tr><tr> + <td> * </td><td> B </td><td> B </td><td> Everything else overwrites anything </td> + </tr> + </tbody></table> + + <p> + <strong>msMask</strong> - the blocks that are the same in the other area are kept, all the + differing blocks are replaced with air. Meta is used in the comparison, too, two blocks of the + same type but different meta are considered different and thus replaced with air. + </p> + <table><tbody><tr> + <th colspan="2"> area block </th><th> </th><th> Notes </th> + </tr><tr> + <th> this </th><th> Src </th><th> result </th><th> </th> + </tr><tr> + <td> A </td><td> A </td><td> A </td><td> Same blocks are kept </td> + </tr><tr> + <td> A </td><td> non-A </td><td> air </td><td> Differing blocks are replaced with air </td> + </tr> + </tbody></table> +]], }, -- Merge strategies }, -- AdditionalInfo }, -- cBlockArea @@ -502,7 +551,22 @@ end {{cPlayer}}:SendMessage(), {{cWorld}}:BroadcastChat() and {{cRoot}}:BroadcastChat().</p> <p> Note that most of the functions in this class are so-called modifiers - they modify the object and - then return the object itself, so that they can be chained one after another. + then return the object itself, so that they can be chained one after another. See the Chaining + example below for details.</p> + <p> + Each part of the composite chat message takes a "Style" parameter, this is a string that describes + the formatting. It uses the following strings, concatenated together: + <table> + <tr><th>String</th><th>Style</th></tr> + <tr><td>b</td><td>Bold text</td></tr> + <tr><td>i</td><td>Italic text</td></tr> + <tr><td>u</td><td>Underlined text</td></tr> + <tr><td>s</td><td>Strikethrough text</td></tr> + <tr><td>o</td><td>Obfuscated text</td></tr> + <tr><td>@X</td><td>color X (X is 0 - 9 or a - f, same as dye meta</td></tr> + </table> + The following picture, taken from MineCraft Wiki, illustrates the color codes:</p> + <img src="http://hydra-media.cursecdn.com/minecraft.gamepedia.com/4/4c/Colors.png?version=34a0f56789a95326e1f7d82047b12232" /> ]], Functions = { @@ -516,6 +580,7 @@ end AddTextPart = { Params = "Text, [Style]", Return = "self", Notes = "Adds a regular text. Chaining." }, AddUrlPart = { Params = "Text, Url, [Style]", Return = "self", Notes = "Adds a text which, when clicked, opens up a browser at the specified URL. Chaining." }, Clear = { Params = "", Return = "", Notes = "Removes all parts from this object" }, + ExtractText = { Params = "", Return = "string", Notes = "Returns the text from the parts that comprises the human-readable data. Used for older protocols that don't support composite chat and for console-logging." }, GetMessageType = { Params = "", Return = "MessageType", Notes = "Returns the MessageType (mtXXX constant) that is associated with this message. When sent to a player, the message will be formatted according to this message type and the player's settings (adding \"[INFO]\" prefix etc.)" }, ParseText = { Params = "Text", Return = "self", Notes = "Adds text, while recognizing http and https URLs and old-style formatting codes (\"@2\"). Chaining." }, SetMessageType = { Params = "MessageType", Return = "self", Notes = "Sets the MessageType (mtXXX constant) that is associated with this message. When sent to a player, the message will be formatted according to this message type and the player's settings (adding \"[INFO]\" prefix etc.) Chaining." }, @@ -728,14 +793,14 @@ end</pre> GetMass = { Params = "", Return = "number", Notes = "Returns the mass of the entity. Currently unused." }, GetMaxHealth = { Params = "", Return = "number", Notes = "Returns the maximum number of hitpoints this entity is allowed to have." }, GetParentClass = { Params = "", Return = "string", Notes = "Returns the name of the direct parent class for this entity" }, - GetPitch = { Params = "", Return = "number", Notes = "Returns the pitch (nose-down rotation) of the entity" }, + GetPitch = { Params = "", Return = "number", Notes = "Returns the pitch (nose-down rotation) of the entity. Measured in degrees, normal values range from -90 to +90. +90 means looking down, 0 means looking straight ahead, -90 means looking up." }, GetPosition = { Params = "", Return = "{{Vector3d}}", Notes = "Returns the entity's pivot position as a 3D vector" }, GetPosX = { Params = "", Return = "number", Notes = "Returns the X-coord of the entity's pivot" }, GetPosY = { Params = "", Return = "number", Notes = "Returns the Y-coord of the entity's pivot" }, GetPosZ = { Params = "", Return = "number", Notes = "Returns the Z-coord of the entity's pivot" }, GetRawDamageAgainst = { Params = "ReceiverEntity", Return = "number", Notes = "Returns the raw damage that this entity's equipment would cause when attacking the ReceiverEntity. This includes this entity's weapon {{cEnchantments|enchantments}}, but excludes the receiver's armor or potion effects. See {{TakeDamageInfo}} for more information on attack damage." }, GetRoll = { Params = "", Return = "number", Notes = "Returns the roll (sideways rotation) of the entity. Currently unused." }, - GetRot = { Params = "", Return = "{{Vector3f}}", Notes = "Returns the entire rotation vector (Yaw, Pitch, Roll)" }, + GetRot = { Params = "", Return = "{{Vector3f}}", Notes = "(OBSOLETE) Returns the entire rotation vector (Yaw, Pitch, Roll)" }, GetSpeed = { Params = "", Return = "{{Vector3d}}", Notes = "Returns the complete speed vector of the entity" }, GetSpeedX = { Params = "", Return = "number", Notes = "Returns the X-part of the speed vector" }, GetSpeedY = { Params = "", Return = "number", Notes = "Returns the Y-part of the speed vector" }, @@ -743,7 +808,7 @@ end</pre> GetUniqueID = { Params = "", Return = "number", Notes = "Returns the ID that uniquely identifies the entity within the running server. Note that this ID is not persisted to the data files." }, GetWidth = { Params = "", Return = "number", Notes = "Returns the width (X and Z size) of the entity." }, GetWorld = { Params = "", Return = "{{cWorld}}", Notes = "Returns the world where the entity resides" }, - GetYaw = { Params = "", Return = "number", Notes = "Returns the yaw (direction) of the entity." }, + GetYaw = { Params = "", Return = "number", Notes = "Returns the yaw (direction) of the entity. Measured in degrees, values range from -180 to +180. 0 means ZP, 90 means XM, -180 means ZM, -90 means XP." }, Heal = { Params = "Hitpoints", Return = "", Notes = "Heals the specified number of hitpoints. Hitpoints is expected to be a positive number." }, IsA = { Params = "ClassName", Return = "bool", Notes = "Returns true if the entity class is a descendant of the specified class name, or the specified class itself" }, IsBoat = { Params = "", Return = "bool", Notes = "Returns true if the entity is a {{cBoat|boat}}." }, @@ -1826,6 +1891,7 @@ cPluginManager.AddHook(cPluginManager.HOOK_CHAT, OnChatMessage); }, Constants = { + HOOK_BLOCK_SPREAD = { Notes = "Called when a block spreads based on world conditions" }, HOOK_BLOCK_TO_PICKUPS = { Notes = "Called when a block has been dug and is being converted to pickups. The server has provided the default pickups and the plugins may modify them." }, HOOK_CHAT = { Notes = "Called when a client sends a chat message that is not a command. The plugin may modify the chat message" }, HOOK_CHUNK_AVAILABLE = { Notes = "Called when a chunk is loaded or generated and becomes available in the {{cWorld|world}}." }, @@ -2646,11 +2712,31 @@ end ItemToFullString = {Params = "{{cItem|cItem}}", Return = "string", Notes = "Returns the string representation of the item, in the format 'ItemTypeText:ItemDamage * Count'"}, ItemToString = {Params = "{{cItem|cItem}}", Return = "string", Notes = "Returns the string representation of the item type"}, ItemTypeToString = {Params = "ItemType", Return = "string", Notes = "Returns the string representation of ItemType "}, - LOG = {Params = "string", Notes = "Logs a text into the server console using 'normal' severity (gray text) "}, - LOGERROR = {Params = "string", Notes = "Logs a text into the server console using 'error' severity (black text on red background)"}, - LOGINFO = {Params = "string", Notes = "Logs a text into the server console using 'info' severity (yellow text)"}, - LOGWARN = {Params = "string", Notes = "Logs a text into the server console using 'warning' severity (red text); OBSOLETE, use LOGWARNING() instead"}, - LOGWARNING = {Params = "string", Notes = "Logs a text into the server console using 'warning' severity (red text)"}, + LOG = + { + {Params = "string", Notes = "Logs a text into the server console using 'normal' severity (gray text)"}, + {Params = "{{cCompositeChat|CompositeChat}}", Notes = "Logs the {{cCompositeChat}}'s human-readable text into the server console. The severity is converted from the CompositeChat's MessageType."}, + }, + LOGERROR = + { + {Params = "string", Notes = "Logs a text into the server console using 'error' severity (black text on red background)"}, + {Params = "{{cCompositeChat|CompositeChat}}", Notes = "Logs the {{cCompositeChat}}'s human-readable text into the server console using 'error' severity (black text on red background)"}, + }, + LOGINFO = + { + {Params = "string", Notes = "Logs a text into the server console using 'info' severity (yellow text)"}, + {Params = "{{cCompositeChat|CompositeChat}}", Notes = "Logs the {{cCompositeChat}}'s human-readable text into the server console using 'info' severity (yellow text)"}, + }, + LOGWARN = + { + {Params = "string", Notes = "Logs a text into the server console using 'warning' severity (red text); OBSOLETE, use LOGWARNING() instead"}, + {Params = "{{cCompositeChat|CompositeChat}}", Notes = "Logs the {{cCompositeChat}}'s human-readable text into the server console using 'warning' severity (red text); OBSOLETE, use LOGWARNING() instead"}, + }, + LOGWARNING = + { + {Params = "string", Notes = "Logs a text into the server console using 'warning' severity (red text)"}, + {Params = "{{cCompositeChat|CompositeChat}}", Notes = "Logs the {{cCompositeChat}}'s human-readable text into the server console using 'warning' severity (red text)"}, + }, MirrorBlockFaceY = { Params = "{{Globals#BlockFaces|eBlockFace}}", Return = "{{Globals#BlockFaces|eBlockFace}}", Notes = "Returns the {{Globals#BlockFaces|eBlockFace}} that corresponds to the given {{Globals#BlockFaces|eBlockFace}} after mirroring it around the Y axis (or rotating 180 degrees around it)." }, NoCaseCompare = {Params = "string, string", Return = "number", Notes = "Case-insensitive string comparison; returns 0 if the strings are the same"}, NormalizeAngleDegrees = { Params = "AngleDegrees", Return = "AngleDegrees", Notes = "Returns the angle, wrapped into the [-180, +180) range." }, @@ -2767,6 +2853,14 @@ end data provided with the explosions, such as the exploding {{cCreeper|creeper}} entity or the {{Vector3i|coords}} of the exploding bed. ]], + }, + SpreadSource = + { + Include = "^ss.*", + TextBefore = [[ + These constants are used to differentiate the various sources of spreads, such as grass growing. + They are used in the {{OnBlockSpread|HOOK_BLOCK_SPREAD}} hook. + ]], } }, }, -- Globals @@ -2836,6 +2930,7 @@ end -- No sorting is provided for these, they will be output in the same order as defined here { FileName = "Writing-a-MCServer-plugin.html", Title = "Writing a MCServer plugin" }, { FileName = "SettingUpDecoda.html", Title = "Setting up the Decoda Lua IDE" }, + { FileName = "SettingUpZeroBrane.html", Title = "Setting up the ZeroBrane Studio Lua IDE" }, { FileName = "WebWorldThreads.html", Title = "Webserver vs World threads" }, } } ; diff --git a/MCServer/Plugins/APIDump/Hooks/OnBlockSpread.lua b/MCServer/Plugins/APIDump/Hooks/OnBlockSpread.lua new file mode 100644 index 000000000..ed0b5f46f --- /dev/null +++ b/MCServer/Plugins/APIDump/Hooks/OnBlockSpread.lua @@ -0,0 +1,40 @@ +return +{ + HOOK_BLOCK_SPREAD = + { + CalledWhen = "Called when a block spreads based on world conditions", + DefaultFnName = "OnBlockSpread", -- also used as pagename + Desc = [[ + This hook is called when a block spreads.</p> + <p> + The spread carries with it the type of its source - whether it's a block spreads. + It also carries the identification of the actual source. The exact type of the identification + depends on the source kind: + <table> + <tr><th>Source</th><th>Notes</th></tr> + <tr><td>ssFireSpread</td><td>Fire spreading</td></tr> + <tr><td>ssGrassSpread</td><td>Grass spreading</td></tr> + <tr><td>ssMushroomSpread</td><td>Mushroom spreading</td></tr> + <tr><td>ssMycelSpread</td><td>Mycel spreading</td></tr> + <tr><td>ssVineSpread</td><td>Vine spreading</td></tr> + </table></p> + ]], + Params = + { + { Name = "World", Type = "{{cWorld}}", Notes = "The world in which the block resides" }, + { Name = "BlockX", Type = "number", Notes = "X-coord of the block" }, + { Name = "BlockY", Type = "number", Notes = "Y-coord of the block" }, + { Name = "BlockZ", Type = "number", Notes = "Z-coord of the block" }, + { Name = "Source", Type = "eSpreadSource", Notes = "Source of the spread. See the table above." }, + }, + Returns = [[ + If the function returns false or no value, the next plugin's callback is called, and finally + MCServer will process the spread. If the function + returns true, no other callback is called for this event and the spread will not occur. + ]], + }, -- HOOK_BLOCK_SPREAD +} + + + + diff --git a/MCServer/Plugins/APIDump/Hooks/OnProjectileHitBlock.lua b/MCServer/Plugins/APIDump/Hooks/OnProjectileHitBlock.lua new file mode 100644 index 000000000..1588d420c --- /dev/null +++ b/MCServer/Plugins/APIDump/Hooks/OnProjectileHitBlock.lua @@ -0,0 +1,24 @@ +return +{ + HOOK_PROJECTILE_HIT_BLOCK = + { + CalledWhen = "A projectile hits a solid block.", + DefaultFnName = "OnProjectileHitBlock", -- also used as pagename + Desc = [[ + This hook is called when a {{cProjectileEntity|projectile}} hits a solid block.. + ]], + Params = + { + { Name = "ProjectileEntity", Type = "{{cProjectileEntity}}", Notes = "The projectile that hit an entity." }, + }, + Returns = [[ + If the function returns false or no value, the next plugin's callback is called. If the function + returns true, no other callback is called for this event and the projectile flies through block.. + ]], + }, -- HOOK_PROJECTILE_HIT_BLOCK +} + + + + + diff --git a/MCServer/Plugins/APIDump/Hooks/OnProjectileHitEntity.lua b/MCServer/Plugins/APIDump/Hooks/OnProjectileHitEntity.lua new file mode 100644 index 000000000..dd949fb46 --- /dev/null +++ b/MCServer/Plugins/APIDump/Hooks/OnProjectileHitEntity.lua @@ -0,0 +1,25 @@ +return +{ + HOOK_PROJECTILE_HIT_ENTITY = + { + CalledWhen = "A projectile hits another entity.", + DefaultFnName = "OnProjectileHitEntity", -- also used as pagename + Desc = [[ + This hook is called when a {{cProjectileEntity|projectile}} hits another entity. + ]], + Params = + { + { Name = "ProjectileEntity", Type = "{{cProjectileEntity}}", Notes = "The projectile that hit an entity." }, + { Name = "Entity", Type = "{{cEntity}}", Notes = "The entity wich was hit." }, + }, + Returns = [[ + If the function returns false or no value, the next plugin's callback is called. If the function + returns true, no other callback is called for this event and the projectile flies through the entity. + ]], + }, -- HOOK_PROJECTILE_HIT_ENTITY +} + + + + + diff --git a/MCServer/Plugins/APIDump/SettingUpZeroBrane.html b/MCServer/Plugins/APIDump/SettingUpZeroBrane.html new file mode 100644 index 000000000..4ebbcb6e6 --- /dev/null +++ b/MCServer/Plugins/APIDump/SettingUpZeroBrane.html @@ -0,0 +1,46 @@ +<!DOCTYPE html> + +<html> + <head> + <title>MCServer - Setting up ZeroBrane Studio</title> + <link rel="stylesheet" type="text/css" href="main.css" /> + <link rel="stylesheet" type="text/css" href="prettify.css" /> + <script src="prettify.js"></script> + <script src="lang-lua.js"></script> + <meta charset="UTF-8"> + </head> + <body> + <div id="content"> + <h1>Setting up the ZeroBrane Studio IDE</h1> + <p> + This article will explain how to set up ZeroBrane Studio, an IDE for writing Lua code, so that you can develop MCServer plugins with the comfort of an IDE.</p> + + <h2><img src="Static/zbs_logo.png" /> About ZeroBrane Studio</h2> + + <p>To quickly introduce ZeroBrane Studio, it is an IDE for writing Lua code. It has the basic features expected of an IDE - it allows you to manage groups of files as a project, you can edit multiple files in a tabbed editor, the code is syntax-highlighted. Code completion, symbol browsing, and more. It also features a Lua debugger that allows you to debug your Lua code within any application that uses Lua and can load Lua packages. It is written using the multiplatform WxWidgets toolkit, and runs on multiple platforms, including Windows, Linux and MacOS.</p> + <p>Here's a screenshot of a default ZBS window with the debugger stepping through the code (scaled down):<br /> + <img src="Static/zbs_workspace.png" /></p> + <p>As you can see, you can set breakpoints in the code, inspect variables' values, view the Lua call-stacks.</p> + <p>ZBS is open-source, the sources are on GitHub: <a href="https://github.com/pkulchenko/ZeroBraneStudio">https://github.com/pkulchenko/ZeroBraneStudio</a>. The project's homepage is at <a href="http://studio.zerobrane.com/">http://studio.zerobrane.com/</a>. + + <h2><img src="Static/zbs_logo.png" /> First-time setup</h2> + <p>Since ZBS is a universal Lua IDE, you need to first set it up so that it is ready for MCS plugin development. For that, you need to download one file, <a href="https://raw.githubusercontent.com/pkulchenko/ZeroBranePackage/master/mcserver.lua">mcserver.lua</a> from the <a href="https://github.com/pkulchenko/ZeroBranePackage">ZBS's plugin repository</a>. Place that file in the "packages" folder inside your ZBS's folder. Note that there are other useful plugins in the repository and you may want to have a look there later on to further customize your ZBS. To install them, simply save them into the same folder.</p> + <p>Next you should install the code-completion support specific for MCServer. You should repeat this step from time to time, because the API evolves in time so new functions and classes are added to it quite often. You should have an APIDump plugin in your MCServer installation. Enable the APIDump plugin in the server settings, it's very cheap to keep it enabled and it doesn't cost any performance during normal gameplay. To generate the code-completion support file, enter the <code style="background: #ddd; border: 1px solid #aaa">api</code> command into the server console. This will create a new file, "mcserver_api.lua", next to the MCS executable. Move that file into the "api/lua" subfolder inside your ZBS's folder.</p> + <p>After you download the mcserver.lua file and install the completion support, you need to restart ZBS in order for the plugin to load. If there are no errors, you should see two new items in the Project -> Lua Interpreter submenu: "MCServer - debug mode" and "MCServer - release mode". The only difference between the two is which filename they use to launch MCServer - mcserver_debug(.exe) for the debug option and "mcserver(.exe)" for the release option. If you built your own MCServer executable and you built it in debug mode, you should select the debug mode option. In all other cases, including if you downloaded the already-compiled MCServer executable from the internet, you should select the release mode option.</p> + <p>For a first time user, it might be a bit overwhelming that there are no GUI settings in the ZBS, yet the IDE is very configurable. There are two files that you edit in order to change settings, either system-wide (all users of the computer share those settings) or user-wide (the settings are only for a specific user of the computer). Those files are regular Lua sources and you can quickly locate them and edit them from within the IDE itself, select Edit -> Preferences -> Settings: XYZ from the menu, with XYZ being either System or User.</p> + <p>There is a documentation on most of the settings on ZBS's webpage, have a look at <a href="http://studio.zerobrane.com/documentation.html">http://studio.zerobrane.com/documentation.html</a>, especially the Preferences section. Personally I recommend setting editor.usetabs to true and possibly adjusting the editor.tabwidth, turn off the editor.smartindent feature and for debugging the option debugger.alloweditting should be set to true unless you feel like punishing yourself.</p> + + <h2><img src="Static/zbs_logo.png" /> Project management</h2> + <p>ZBS works with projects, it considers all files and subfolder in a specific folder to be a project. There's no need for a special project file nor for adding individual files to the workspace, all files are added automatically. To open a MCS plugin as the project, click the triple-dot button in the Project pane, or select Project -> Project directory -> Choose... from the menu. Browse and select the MCS plugin's folder. ZBS will load all the files in the plugin's folder and you can start editting code.</p> + <p>Note that although ZBS allows you to work with subfolders in your plugins (and you should, especially with larger plugins), the current mcserver ZBS plugin will not be able to start debugging unless you have a file open in the editor that is at the root level of the MCS plugin's folder.</p> + + <h2><img src="Static/zbs_logo.png" /> Debugging</h2> + <p>You are now ready to debug your code. Before doing that, though, don't forget to save your project files. If you haven't done so already, enable your plugin in the settings.ini file. If you want the program to break at a certain line, it is best to set the breakpoint before starting the program. Set the cursor on the line and hit F9 (or use menu Project -> Toggle Breakpoint) to toggle a breakpoint on that line. Finally, hit F5, or select menu Project -> Start Debugging to launch MCServer under the debugger. The MCServer window comes up and loads your plugin. If the window doesn't come up, inspect the Output pane in ZBS, there are usually two reasons for failure:<ul> + <li>Your code in the currently open file has a hard syntax error. These are reported as "Compilation error" in the Output pane, double-click the line to go to the error</li> + <li>ZBS cannot find the MCServer executable. Make sure you are editting a file two levels down the folder hierarchy from the MCS executable and that the MCS executable is named properly (mcserver[.exe] or mcserver_debug[.exe]). Also make sure you have selected the right Interpreter (menu Project -> Lua Interpreter).</li> + </ul></p> + <p>Once running, if the execution hits a breakpoint, the ZBS window will come up and a green arrow is displayed next to the breakpoint line. You can step through the code using F10 (Step Into) and Shift+F10 (Step Over). You can also use the Watch window to inspect variable values, or simply hover your mouse over a variable to display its value in the tooltip. Use the Remote console pane to execute commands directly *inside* the MCServer's plugin context.</p> + <p>You can also use the Project -> Break menu item to break into the debugger as soon as possible. You can also set breakpoints while the MCS plugin is running. Note that due to the way in which the debugger is implemented, MCS may execute some more Lua code before the break / breakpoint comes into effect. If MCS is not executing any Lua code in your plugin, it will not break until the plugin code kicks in again. This may result in missed breakpoints and delays before the Break command becomes effective. Therefore it's best to set breakpoints before running the program, or while the program is waiting in another breakpoint.</p> + </div> + </body> +</html> diff --git a/MCServer/Plugins/APIDump/Static/zbs_logo.png b/MCServer/Plugins/APIDump/Static/zbs_logo.png Binary files differnew file mode 100644 index 000000000..c8d6d6278 --- /dev/null +++ b/MCServer/Plugins/APIDump/Static/zbs_logo.png diff --git a/MCServer/Plugins/APIDump/Static/zbs_workspace.png b/MCServer/Plugins/APIDump/Static/zbs_workspace.png Binary files differnew file mode 100644 index 000000000..9ce17e35a --- /dev/null +++ b/MCServer/Plugins/APIDump/Static/zbs_workspace.png diff --git a/MCServer/Plugins/APIDump/main_APIDump.lua b/MCServer/Plugins/APIDump/main_APIDump.lua index 7455c3cd2..52199740b 100644 --- a/MCServer/Plugins/APIDump/main_APIDump.lua +++ b/MCServer/Plugins/APIDump/main_APIDump.lua @@ -1408,9 +1408,9 @@ end --- Dumps the entire API table into a file in the ZBS format local function DumpAPIZBS(a_API) LOG("Dumping ZBS API description...") - local f, err = io.open("mcserver.lua", "w") + local f, err = io.open("mcserver_api.lua", "w") if (f == nil) then - LOG("Cannot open mcserver.lua for writing, ZBS API will not be dumped. " .. err) + LOG("Cannot open mcserver_lua.lua for writing, ZBS API will not be dumped. " .. err) return end diff --git a/MCServer/Plugins/Debuggers/Debuggers.lua b/MCServer/Plugins/Debuggers/Debuggers.lua index fe3efa306..064d5d772 100644 --- a/MCServer/Plugins/Debuggers/Debuggers.lua +++ b/MCServer/Plugins/Debuggers/Debuggers.lua @@ -27,11 +27,13 @@ function Initialize(Plugin) PM:AddHook(cPluginManager.HOOK_CHAT, OnChat); PM:AddHook(cPluginManager.HOOK_PLAYER_RIGHT_CLICKING_ENTITY, OnPlayerRightClickingEntity); PM:AddHook(cPluginManager.HOOK_WORLD_TICK, OnWorldTick); - PM:AddHook(cPluginManager.HOOK_CHUNK_GENERATED, OnChunkGenerated); PM:AddHook(cPluginManager.HOOK_PLUGINS_LOADED, OnPluginsLoaded); PM:AddHook(cPluginManager.HOOK_PLUGIN_MESSAGE, OnPluginMessage); PM:AddHook(cPluginManager.HOOK_PLAYER_JOINED, OnPlayerJoined) + -- _X: Disabled so that the normal operation doesn't interfere with anything + -- PM:AddHook(cPluginManager.HOOK_CHUNK_GENERATED, OnChunkGenerated); + PM:BindCommand("/le", "debuggers", HandleListEntitiesCmd, "- Shows a list of all the loaded entities"); PM:BindCommand("/ke", "debuggers", HandleKillEntitiesCmd, "- Kills all the loaded entities"); PM:BindCommand("/wool", "debuggers", HandleWoolCmd, "- Sets all your armor to blue wool"); @@ -67,12 +69,22 @@ function Initialize(Plugin) LOG("Initialized " .. Plugin:GetName() .. " v." .. Plugin:GetVersion()) - -- TestBlockAreas(); - -- TestSQLiteBindings(); - -- TestExpatBindings(); - -- TestPluginCalls(); + -- TestBlockAreas() + -- TestSQLiteBindings() + -- TestExpatBindings() + -- TestPluginCalls() TestBlockAreasString() + TestStringBase64() + + --[[ + -- Test cCompositeChat usage in console-logging: + LOGINFO(cCompositeChat("This is a simple message with some @2 color formatting @4 and http://links.to .") + :AddSuggestCommandPart("(Suggested command)", "cmd") + :AddRunCommandPart("(Run command)", "cmd") + :SetMessageType(mtInfo) + ) + --]] return true end; @@ -241,6 +253,24 @@ end +function TestStringBase64() + -- Create a binary string: + local s = "" + for i = 0, 255 do + s = s .. string.char(i) + end + + -- Roundtrip through Base64: + local Base64 = Base64Encode(s) + local UnBase64 = Base64Decode(Base64) + + assert(UnBase64 == s) +end + + + + + function TestSQLiteBindings() LOG("Testing SQLite bindings..."); diff --git a/MCServer/Plugins/InfoReg.lua b/MCServer/Plugins/InfoReg.lua index b3717884a..27e63aa5b 100644 --- a/MCServer/Plugins/InfoReg.lua +++ b/MCServer/Plugins/InfoReg.lua @@ -9,16 +9,30 @@ --- Lists all the subcommands that the player has permissions for local function ListSubcommands(a_Player, a_Subcommands, a_CmdString) - a_Player:SendMessage("The " .. a_CmdString .. " command requires another verb:"); + if (a_Player == nil) then + LOGINFO("The " .. a_CmdString .. " command requires another verb:") + else + a_Player:SendMessage("The " .. a_CmdString .. " command requires another verb:") + end + + -- Enum all the subcommands: local Verbs = {}; for cmd, info in pairs(a_Subcommands) do if (a_Player:HasPermission(info.Permission or "")) then - table.insert(Verbs, a_CmdString .. " " .. cmd); + table.insert(Verbs, " " .. a_CmdString .. " " .. cmd); end end table.sort(Verbs); - for idx, verb in ipairs(Verbs) do - a_Player:SendMessage(verb); + + -- Send the list: + if (a_Player == nil) then + for idx, verb in ipairs(Verbs) do + LOGINFO(verb); + end + else + for idx, verb in ipairs(Verbs) do + a_Player:SendMessage(verb); + end end end @@ -28,6 +42,7 @@ end --- This is a generic command callback used for handling multicommands' parent commands -- For example, if there are "/gal save" and "/gal load" commands, this callback handles the "/gal" command +-- It is used for both console and in-game commands; the console version has a_Player set to nil local function MultiCommandHandler(a_Split, a_Player, a_CmdString, a_CmdInfo, a_Level) local Verb = a_Split[a_Level + 1]; if (Verb == nil) then @@ -46,7 +61,11 @@ local function MultiCommandHandler(a_Split, a_Player, a_CmdString, a_CmdInfo, a_ if (a_Level > 1) then -- This is a true subcommand, display the message and make MCS think the command was handled -- Otherwise we get weird behavior: for "/cmd verb" we get "unknown command /cmd" although "/cmd" is valid - a_Player:SendMessage("The " .. a_CmdString .. " command doesn't support verb " .. Verb); + if (a_Player == nil) then + LOGWARNING("The " .. a_CmdString .. " command doesn't support verb " .. Verb) + else + a_Player:SendMessage("The " .. a_CmdString .. " command doesn't support verb " .. Verb) + end return true; end -- This is a top-level command, let MCS handle the unknown message @@ -54,9 +73,11 @@ local function MultiCommandHandler(a_Split, a_Player, a_CmdString, a_CmdInfo, a_ end -- Check the permission: - if not(a_Player:HasPermission(Subcommand.Permission or "")) then - a_Player:SendMessage("You don't have permission to execute this command"); - return true; + if (a_Player ~= nil) then + if not(a_Player:HasPermission(Subcommand.Permission or "")) then + a_Player:SendMessage("You don't have permission to execute this command"); + return true; + end end -- If the handler is not valid, check the next sublevel: @@ -149,21 +170,27 @@ end function RegisterPluginInfoConsoleCommands() -- A sub-function that registers all subcommands of a single command, using the command's Subcommands table -- The a_Prefix param already contains the space after the previous command - local function RegisterSubcommands(a_Prefix, a_Subcommands) + local function RegisterSubcommands(a_Prefix, a_Subcommands, a_Level) assert(a_Subcommands ~= nil); for cmd, info in pairs(a_Subcommands) do local CmdName = a_Prefix .. cmd; - cPluginManager.BindConsoleCommand(cmd, info.Handler, info.HelpString or ""); + local Handler = info.Handler + if (Handler == nil) then + Handler = function(a_Split) + return MultiCommandHandler(a_Split, nil, CmdName, info, a_Level); + end + end + cPluginManager.BindConsoleCommand(CmdName, Handler, info.HelpString or ""); -- Recursively register any subcommands: if (info.Subcommands ~= nil) then - RegisterSubcommands(a_Prefix .. cmd .. " ", info.Subcommands); + RegisterSubcommands(a_Prefix .. cmd .. " ", info.Subcommands, a_Level + 1); end end end -- Loop through all commands in the plugin info, register each: - RegisterSubcommands("", g_PluginInfo.ConsoleCommands); + RegisterSubcommands("", g_PluginInfo.ConsoleCommands, 1); end diff --git a/SetFlags.cmake b/SetFlags.cmake index bbd8254ad..c5a3a0697 100644 --- a/SetFlags.cmake +++ b/SetFlags.cmake @@ -198,6 +198,7 @@ macro(set_exe_flags) add_flags_cxx("-Wno-error=covered-switch-default -Wno-error=shadow") add_flags_cxx("-Wno-error=exit-time-destructors -Wno-error=missing-variable-declarations") add_flags_cxx("-Wno-error=global-constructors -Wno-implicit-fallthrough") + add_flags_cxx("-Wno-weak-vtables -Wno-switch-enum -Wno-exit-time-destructors") endif() endif() diff --git a/Tools/ProtoProxy/Connection.cpp b/Tools/ProtoProxy/Connection.cpp index f02b503f1..d9b8e3dd1 100644 --- a/Tools/ProtoProxy/Connection.cpp +++ b/Tools/ProtoProxy/Connection.cpp @@ -387,6 +387,8 @@ bool cConnection::RelayFromServer(void) return CLIENTSEND(Buffer, res); } } + ASSERT(!"Unhandled server state while relaying from server"); + return false; } @@ -423,6 +425,8 @@ bool cConnection::RelayFromClient(void) return SERVERSEND(Buffer, res); } } + ASSERT(!"Unhandled server state while relaying from client"); + return false; } @@ -438,11 +442,11 @@ double cConnection::GetRelativeTime(void) -bool cConnection::SendData(SOCKET a_Socket, const char * a_Data, int a_Size, const char * a_Peer) +bool cConnection::SendData(SOCKET a_Socket, const char * a_Data, size_t a_Size, const char * a_Peer) { - DataLog(a_Data, a_Size, "Sending data to %s, %d bytes", a_Peer, a_Size); + DataLog(a_Data, a_Size, "Sending data to %s, %u bytes", a_Peer, (unsigned)a_Size); - int res = send(a_Socket, a_Data, a_Size, 0); + int res = send(a_Socket, a_Data, (int)a_Size, 0); if (res <= 0) { Log("%s closed the socket: %d, %d; aborting connection", a_Peer, res, SocketError); diff --git a/Tools/ProtoProxy/Connection.h b/Tools/ProtoProxy/Connection.h index 70b759d0f..9e04994b7 100644 --- a/Tools/ProtoProxy/Connection.h +++ b/Tools/ProtoProxy/Connection.h @@ -103,7 +103,7 @@ protected: double GetRelativeTime(void); /// Sends data to the specified socket. If sending fails, prints a fail message using a_Peer and returns false. - bool SendData(SOCKET a_Socket, const char * a_Data, int a_Size, const char * a_Peer); + bool SendData(SOCKET a_Socket, const char * a_Data, size_t a_Size, const char * a_Peer); /// Sends data to the specified socket. If sending fails, prints a fail message using a_Peer and returns false. bool SendData(SOCKET a_Socket, cByteBuffer & a_Data, const char * a_Peer); diff --git a/lib/md5/md5.h b/lib/md5/md5.h index ad5ad5384..3aa88ac22 100644 --- a/lib/md5/md5.h +++ b/lib/md5/md5.h @@ -90,4 +90,4 @@ private: std::string md5(const std::string & str); -#endif
\ No newline at end of file +#endif diff --git a/lib/tolua++/CMakeLists.txt b/lib/tolua++/CMakeLists.txt index 4df698e89..e68a0e15b 100644 --- a/lib/tolua++/CMakeLists.txt +++ b/lib/tolua++/CMakeLists.txt @@ -7,28 +7,32 @@ include_directories ("${PROJECT_SOURCE_DIR}/include/") include_directories ("${PROJECT_SOURCE_DIR}/../") include_directories ("${PROJECT_SOURCE_DIR}") -if(UNIX) +find_program(XXD_EXECUTABLE xxd) + +if(NOT XXD_EXECUTABLE STREQUAL "XXD_EXECUTABLE-NOTFOUND") add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/basic_lua.h - COMMAND xxd -i lua/basic.lua | sed 's/unsigned char/static const unsigned char/g' >basic_lua.h + COMMAND ${XXD_EXECUTABLE} -i lua/basic.lua | sed 's/unsigned char/static const unsigned char/g' >basic_lua.h WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/basic.lua) add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/enumerate_lua.h - COMMAND xxd -i lua/enumerate.lua | sed 's/unsigned char/static const unsigned char/g' >enumerate_lua.h + COMMAND ${XXD_EXECUTABLE} -i lua/enumerate.lua | sed 's/unsigned char/static const unsigned char/g' >enumerate_lua.h WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/enumerate.lua) add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/function_lua.h - COMMAND xxd -i lua/function.lua | sed 's/unsigned char/static const unsigned char/g' >function_lua.h + COMMAND ${XXD_EXECUTABLE} -i lua/function.lua | sed 's/unsigned char/static const unsigned char/g' >function_lua.h WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/function.lua) add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/declaration_lua.h - COMMAND xxd -i lua/declaration.lua | sed 's/unsigned char/static const unsigned char/g' >declaration_lua.h + COMMAND ${XXD_EXECUTABLE} -i lua/declaration.lua | sed 's/unsigned char/static const unsigned char/g' >declaration_lua.h WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/declaration.lua) add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/container_lua.h - COMMAND xxd -i lua/container.lua | sed 's/unsigned char/static const unsigned char/g' >container_lua.h + COMMAND ${XXD_EXECUTABLE} -i lua/container.lua | sed 's/unsigned char/static const unsigned char/g' >container_lua.h WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/container.lua) set_property(SOURCE src/bin/toluabind.c APPEND PROPERTY OBJECT_DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/enumerate_lua.h ${PROJECT_SOURCE_DIR}/src/bin/basic_lua.h ${PROJECT_SOURCE_DIR}/src/bin/function_lua.h ${PROJECT_SOURCE_DIR}/src/bin/declaration_lua.h ${PROJECT_SOURCE_DIR}/src/bin/container_lua.h) +else() + message("xxd not found, changes to tolua scripts will be ignored") endif() diff --git a/lib/tolua++/src/bin/basic_lua.h b/lib/tolua++/src/bin/basic_lua.h index 2128cb44b..effd79ee9 100644 --- a/lib/tolua++/src/bin/basic_lua.h +++ b/lib/tolua++/src/bin/basic_lua.h @@ -61,6 +61,8 @@ static const unsigned char lua_basic_lua[] = { 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x64, 0x6f, 0x75, 0x62, 0x6c, 0x65, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c, 0x0a, + 0x20, 0x5b, 0x27, 0x73, 0x69, 0x7a, 0x65, 0x5f, 0x74, 0x27, 0x5d, 0x20, + 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x5f, 0x63, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x5f, 0x75, 0x73, 0x65, 0x72, 0x64, 0x61, @@ -755,4 +757,4 @@ static const unsigned char lua_basic_lua[] = { 0x73, 0x65, 0x72, 0x74, 0x79, 0x70, 0x65, 0x22, 0x0a, 0x65, 0x6e, 0x64, 0x0a }; -unsigned int lua_basic_lua_len = 9049; +unsigned int lua_basic_lua_len = 9073; diff --git a/lib/tolua++/src/bin/lua/basic.lua b/lib/tolua++/src/bin/lua/basic.lua index 425cb6861..4bff5276b 100644 --- a/lib/tolua++/src/bin/lua/basic.lua +++ b/lib/tolua++/src/bin/lua/basic.lua @@ -23,6 +23,7 @@ _basic = { ['unsigned'] = 'number', ['float'] = 'number', ['double'] = 'number', + ['size_t'] = 'number', ['_cstring'] = 'string', ['_userdata'] = 'userdata', ['char*'] = 'string', diff --git a/src/Bindings/DeprecatedBindings.cpp b/src/Bindings/DeprecatedBindings.cpp index 408b1b84a..d51ba2da3 100644 --- a/src/Bindings/DeprecatedBindings.cpp +++ b/src/Bindings/DeprecatedBindings.cpp @@ -2,6 +2,7 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "DeprecatedBindings.h" +#undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" #include "Plugin.h" @@ -20,47 +21,23 @@ #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockLightValue static int tolua_get_AllToLua_g_BlockLightValue(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + { tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockLightValue */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockLightValue -static int tolua_set_AllToLua_g_BlockLightValue(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_LightValue = ((unsigned char) tolua_tonumber(tolua_S,3,0)); - return 0; + tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -72,7 +49,7 @@ static int tolua_set_AllToLua_g_BlockLightValue(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockSpreadLightFalloff static int tolua_get_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -80,39 +57,13 @@ static int tolua_get_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetSpreadLightFalloff(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockSpreadLightFalloff */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockSpreadLightFalloff -static int tolua_set_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_SpreadLightFalloff = ((unsigned char) tolua_tonumber(tolua_S,3,0)); - return 0; + tolua_pushnumber(tolua_S, (lua_Number)cBlockInfo::GetSpreadLightFalloff((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -124,7 +75,7 @@ static int tolua_set_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockTransparent static int tolua_get_AllToLua_g_BlockTransparent(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -132,39 +83,13 @@ static int tolua_get_AllToLua_g_BlockTransparent(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockTransparent */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockTransparent -static int tolua_set_AllToLua_g_BlockTransparent(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_Transparent = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -176,7 +101,7 @@ static int tolua_set_AllToLua_g_BlockTransparent(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockOneHitDig static int tolua_get_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -184,39 +109,13 @@ static int tolua_get_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsOneHitDig(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockOneHitDig */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockOneHitDig -static int tolua_set_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_OneHitDig = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::IsOneHitDig((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -228,7 +127,7 @@ static int tolua_set_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockPistonBreakable static int tolua_get_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -236,39 +135,13 @@ static int tolua_get_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsPistonBreakable(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockPistonBreakable */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockPistonBreakable -static int tolua_set_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_PistonBreakable = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::IsPistonBreakable((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -280,7 +153,7 @@ static int tolua_set_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockIsSnowable static int tolua_get_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -288,39 +161,13 @@ static int tolua_get_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsSnowable(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockIsSnowable */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockIsSnowable -static int tolua_set_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_IsSnowable = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::IsSnowable((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -332,7 +179,7 @@ static int tolua_set_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockRequiresSpecialTool static int tolua_get_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -340,39 +187,13 @@ static int tolua_get_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::RequiresSpecialTool(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockRequiresSpecialTool */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockRequiresSpecialTool -static int tolua_set_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_RequiresSpecialTool = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::RequiresSpecialTool((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -384,7 +205,7 @@ static int tolua_set_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockIsSolid static int tolua_get_AllToLua_g_BlockIsSolid(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -392,39 +213,13 @@ static int tolua_get_AllToLua_g_BlockIsSolid(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsSolid(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockIsSolid */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockIsSolid -static int tolua_set_AllToLua_g_BlockIsSolid(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_IsSolid = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, (bool)cBlockInfo::IsSolid((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -436,7 +231,7 @@ static int tolua_set_AllToLua_g_BlockIsSolid(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockFullyOccupiesVoxel static int tolua_get_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -444,39 +239,13 @@ static int tolua_get_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::FullyOccupiesVoxel(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockFullyOccupiesVoxel */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockFullyOccupiesVoxel -static int tolua_set_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_FullyOccupiesVoxel = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, (bool)cBlockInfo::FullyOccupiesVoxel((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -488,15 +257,15 @@ void DeprecatedBindings::Bind(lua_State * tolua_S) { tolua_beginmodule(tolua_S, NULL); - tolua_array(tolua_S, "g_BlockLightValue", tolua_get_AllToLua_g_BlockLightValue, tolua_set_AllToLua_g_BlockLightValue); - tolua_array(tolua_S, "g_BlockSpreadLightFalloff", tolua_get_AllToLua_g_BlockSpreadLightFalloff, tolua_set_AllToLua_g_BlockSpreadLightFalloff); - tolua_array(tolua_S, "g_BlockTransparent", tolua_get_AllToLua_g_BlockTransparent, tolua_set_AllToLua_g_BlockTransparent); - tolua_array(tolua_S, "g_BlockOneHitDig", tolua_get_AllToLua_g_BlockOneHitDig, tolua_set_AllToLua_g_BlockOneHitDig); - tolua_array(tolua_S, "g_BlockPistonBreakable", tolua_get_AllToLua_g_BlockPistonBreakable, tolua_set_AllToLua_g_BlockPistonBreakable); - tolua_array(tolua_S, "g_BlockIsSnowable", tolua_get_AllToLua_g_BlockIsSnowable, tolua_set_AllToLua_g_BlockIsSnowable); - tolua_array(tolua_S, "g_BlockRequiresSpecialTool", tolua_get_AllToLua_g_BlockRequiresSpecialTool, tolua_set_AllToLua_g_BlockRequiresSpecialTool); - tolua_array(tolua_S, "g_BlockIsSolid", tolua_get_AllToLua_g_BlockIsSolid, tolua_set_AllToLua_g_BlockIsSolid); - tolua_array(tolua_S, "g_BlockFullyOccupiesVoxel", tolua_get_AllToLua_g_BlockFullyOccupiesVoxel, tolua_set_AllToLua_g_BlockFullyOccupiesVoxel); + tolua_array(tolua_S, "g_BlockLightValue", tolua_get_AllToLua_g_BlockLightValue, NULL); + tolua_array(tolua_S, "g_BlockSpreadLightFalloff", tolua_get_AllToLua_g_BlockSpreadLightFalloff, NULL); + tolua_array(tolua_S, "g_BlockTransparent", tolua_get_AllToLua_g_BlockTransparent, NULL); + tolua_array(tolua_S, "g_BlockOneHitDig", tolua_get_AllToLua_g_BlockOneHitDig, NULL); + tolua_array(tolua_S, "g_BlockPistonBreakable", tolua_get_AllToLua_g_BlockPistonBreakable, NULL); + tolua_array(tolua_S, "g_BlockIsSnowable", tolua_get_AllToLua_g_BlockIsSnowable, NULL); + tolua_array(tolua_S, "g_BlockRequiresSpecialTool", tolua_get_AllToLua_g_BlockRequiresSpecialTool, NULL); + tolua_array(tolua_S, "g_BlockIsSolid", tolua_get_AllToLua_g_BlockIsSolid, NULL); + tolua_array(tolua_S, "g_BlockFullyOccupiesVoxel", tolua_get_AllToLua_g_BlockFullyOccupiesVoxel, NULL); tolua_endmodule(tolua_S); } diff --git a/src/Bindings/LuaState.cpp b/src/Bindings/LuaState.cpp index 47380b8a7..a33459ad2 100644 --- a/src/Bindings/LuaState.cpp +++ b/src/Bindings/LuaState.cpp @@ -11,6 +11,7 @@ extern "C" #include "lua/src/lualib.h" } +#undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" #include "Bindings.h" #include "ManualBindings.h" @@ -479,6 +480,18 @@ void cLuaState::Push(cEntity * a_Entity) +void cLuaState::Push(cProjectileEntity * a_ProjectileEntity) +{ + ASSERT(IsValid()); + + tolua_pushusertype(m_LuaState, a_ProjectileEntity, "cProjectileEntity"); + m_NumCurrentFunctionArgs += 1; +} + + + + + void cLuaState::Push(cMonster * a_Monster) { ASSERT(IsValid()); diff --git a/src/Bindings/LuaState.h b/src/Bindings/LuaState.h index f0047b362..b9ca2f29b 100644 --- a/src/Bindings/LuaState.h +++ b/src/Bindings/LuaState.h @@ -38,6 +38,7 @@ extern "C" class cWorld; class cPlayer; class cEntity; +class cProjectileEntity; class cMonster; class cItem; class cItems; @@ -183,6 +184,7 @@ public: void Push(cPlayer * a_Player); void Push(const cPlayer * a_Player); void Push(cEntity * a_Entity); + void Push(cProjectileEntity * a_ProjectileEntity); void Push(cMonster * a_Monster); void Push(cItem * a_Item); void Push(cItems * a_Items); diff --git a/src/Bindings/ManualBindings.cpp b/src/Bindings/ManualBindings.cpp index 20bbc48f2..92b410481 100644 --- a/src/Bindings/ManualBindings.cpp +++ b/src/Bindings/ManualBindings.cpp @@ -2,6 +2,7 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "ManualBindings.h" +#undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" #include "Plugin.h" @@ -115,10 +116,44 @@ static int tolua_StringSplitAndTrim(lua_State * tolua_S) -static int tolua_LOG(lua_State* tolua_S) +/** Retrieves the log message from the first param on the Lua stack. +Can take either a string or a cCompositeChat. +*/ +static AString GetLogMessage(lua_State * tolua_S) { - const char* str = tolua_tocppstring(tolua_S,1,0); - cMCLogger::GetInstance()->LogSimple( str, 0 ); + tolua_Error err; + if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err)) + { + return ((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->ExtractText(); + } + else + { + size_t len = 0; + const char * str = lua_tolstring(tolua_S, 1, &len); + if (str != NULL) + { + return AString(str, len); + } + } + return ""; +} + + + + + +static int tolua_LOG(lua_State * tolua_S) +{ + // If the param is a cCompositeChat, read the log level from it: + cMCLogger::eLogLevel LogLevel = cMCLogger::llRegular; + tolua_Error err; + if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err)) + { + LogLevel = cCompositeChat::MessageTypeToLogLevel(((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->GetMessageType()); + } + + // Log the message: + cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), LogLevel); return 0; } @@ -126,10 +161,9 @@ static int tolua_LOG(lua_State* tolua_S) -static int tolua_LOGINFO(lua_State* tolua_S) +static int tolua_LOGINFO(lua_State * tolua_S) { - const char* str = tolua_tocppstring(tolua_S,1,0); - cMCLogger::GetInstance()->LogSimple( str, 1 ); + cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llInfo); return 0; } @@ -137,10 +171,9 @@ static int tolua_LOGINFO(lua_State* tolua_S) -static int tolua_LOGWARN(lua_State* tolua_S) +static int tolua_LOGWARN(lua_State * tolua_S) { - const char* str = tolua_tocppstring(tolua_S,1,0); - cMCLogger::GetInstance()->LogSimple( str, 2 ); + cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llWarning); return 0; } @@ -148,10 +181,9 @@ static int tolua_LOGWARN(lua_State* tolua_S) -static int tolua_LOGERROR(lua_State* tolua_S) +static int tolua_LOGERROR(lua_State * tolua_S) { - const char* str = tolua_tocppstring(tolua_S,1,0); - cMCLogger::GetInstance()->LogSimple( str, 3 ); + cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llError); return 0; } @@ -159,6 +191,50 @@ static int tolua_LOGERROR(lua_State* tolua_S) +static int tolua_Base64Encode(lua_State * tolua_S) +{ + cLuaState L(tolua_S); + if ( + !L.CheckParamString(1) || + !L.CheckParamEnd(2) + ) + { + return 0; + } + + AString Src; + L.GetStackValue(1, Src); + AString res = Base64Encode(Src); + L.Push(res); + return 1; +} + + + + + +static int tolua_Base64Decode(lua_State * tolua_S) +{ + cLuaState L(tolua_S); + if ( + !L.CheckParamString(1) || + !L.CheckParamEnd(2) + ) + { + return 0; + } + + AString Src; + L.GetStackValue(1, Src); + AString res = Base64Decode(Src); + L.Push(res); + return 1; +} + + + + + cPluginLua * GetLuaPlugin(lua_State * L) { // Get the plugin identification out of LuaState: @@ -2838,6 +2914,8 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_function(tolua_S, "LOGWARN", tolua_LOGWARN); tolua_function(tolua_S, "LOGWARNING", tolua_LOGWARN); tolua_function(tolua_S, "LOGERROR", tolua_LOGERROR); + tolua_function(tolua_S, "Base64Encode", tolua_Base64Encode); + tolua_function(tolua_S, "Base64Decode", tolua_Base64Decode); tolua_beginmodule(tolua_S, "cFile"); tolua_function(tolua_S, "GetFolderContents", tolua_cFile_GetFolderContents); diff --git a/src/Bindings/ManualBindings.h b/src/Bindings/ManualBindings.h index e6594947e..f38e26267 100644 --- a/src/Bindings/ManualBindings.h +++ b/src/Bindings/ManualBindings.h @@ -5,4 +5,4 @@ class ManualBindings { public: static void Bind( lua_State* tolua_S ); -};
\ No newline at end of file +}; diff --git a/src/Bindings/Plugin.h b/src/Bindings/Plugin.h index 949e4693a..df0bd4dcc 100644 --- a/src/Bindings/Plugin.h +++ b/src/Bindings/Plugin.h @@ -46,6 +46,7 @@ public: * On all these functions, return true if you want to override default behavior and not call other plugins on that callback. * You can also return false, so default behavior is used. **/ + virtual bool OnBlockSpread (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) = 0; virtual bool OnBlockToPickups (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0; virtual bool OnChat (cPlayer * a_Player, AString & a_Message) = 0; virtual bool OnChunkAvailable (cWorld * a_World, int a_ChunkX, int a_ChunkZ) = 0; @@ -89,6 +90,8 @@ public: virtual bool OnPluginsLoaded (void) = 0; virtual bool OnPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0; virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0; + virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile) = 0; + virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) = 0; virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) = 0; virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) = 0; virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) = 0; diff --git a/src/Bindings/PluginLua.cpp b/src/Bindings/PluginLua.cpp index cccbc3c93..dcc816839 100644 --- a/src/Bindings/PluginLua.cpp +++ b/src/Bindings/PluginLua.cpp @@ -5,7 +5,11 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules +#ifdef __APPLE__ +#define LUA_USE_MACOSX +#else #define LUA_USE_POSIX +#endif #include "PluginLua.h" #include "../CommandOutput.h" @@ -14,6 +18,7 @@ extern "C" #include "lua/src/lualib.h" } +#undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" @@ -195,6 +200,26 @@ void cPluginLua::Tick(float a_Dt) +bool cPluginLua::OnBlockSpread(cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) +{ + cCSLock Lock(m_CriticalSection); + bool res = false; + cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_BLOCK_SPREAD]; + for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr) + { + m_LuaState.Call((int)(**itr), a_World, a_BlockX, a_BlockY, a_BlockZ, a_Source, cLuaState::Return, res); + if (res) + { + return true; + } + } + return false; +} + + + + + bool cPluginLua::OnBlockToPickups(cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) { cCSLock Lock(m_CriticalSection); @@ -1088,6 +1113,46 @@ bool cPluginLua::OnPreCrafting(const cPlayer * a_Player, const cCraftingGrid * a +bool cPluginLua::OnProjectileHitBlock(cProjectileEntity & a_Projectile) +{ + cCSLock Lock(m_CriticalSection); + bool res = false; + cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_BLOCK]; + for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr) + { + m_LuaState.Call((int)(**itr), &a_Projectile, cLuaState::Return, res); + if (res) + { + return true; + } + } + return false; +} + + + + + +bool cPluginLua::OnProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity) +{ + cCSLock Lock(m_CriticalSection); + bool res = false; + cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_ENTITY]; + for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr) + { + m_LuaState.Call((int)(**itr), &a_Projectile, &a_HitEntity, cLuaState::Return, res); + if (res) + { + return true; + } + } + return false; +} + + + + + bool cPluginLua::OnSpawnedEntity(cWorld & a_World, cEntity & a_Entity) { cCSLock Lock(m_CriticalSection); @@ -1430,6 +1495,7 @@ const char * cPluginLua::GetHookFnName(int a_HookType) { switch (a_HookType) { + case cPluginManager::HOOK_BLOCK_SPREAD: return "OnBlockSpread"; case cPluginManager::HOOK_BLOCK_TO_PICKUPS: return "OnBlockToPickups"; case cPluginManager::HOOK_CHAT: return "OnChat"; case cPluginManager::HOOK_CHUNK_AVAILABLE: return "OnChunkAvailable"; diff --git a/src/Bindings/PluginLua.h b/src/Bindings/PluginLua.h index a177f5288..59542d23a 100644 --- a/src/Bindings/PluginLua.h +++ b/src/Bindings/PluginLua.h @@ -69,6 +69,7 @@ public: virtual void Tick(float a_Dt) override; + virtual bool OnBlockSpread (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) override; virtual bool OnBlockToPickups (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) override; virtual bool OnChat (cPlayer * a_Player, AString & a_Message) override; virtual bool OnChunkAvailable (cWorld * a_World, int a_ChunkX, int a_ChunkZ) override; @@ -112,6 +113,8 @@ public: virtual bool OnPluginsLoaded (void) override; virtual bool OnPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override; virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override; + virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile) override; + virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) override; virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) override; virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) override; virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) override; diff --git a/src/Bindings/PluginManager.cpp b/src/Bindings/PluginManager.cpp index b9cf160c4..6a5356c0b 100644 --- a/src/Bindings/PluginManager.cpp +++ b/src/Bindings/PluginManager.cpp @@ -205,6 +205,27 @@ void cPluginManager::Tick(float a_Dt) +bool cPluginManager::CallHookBlockSpread(cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) +{ + HookMap::iterator Plugins = m_Hooks.find(HOOK_BLOCK_SPREAD); + if (Plugins == m_Hooks.end()) + { + return false; + } + for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr) + { + if ((*itr)->OnBlockSpread(a_World, a_BlockX, a_BlockY, a_BlockZ, a_Source)) + { + return true; + } + } + return false; +} + + + + + bool cPluginManager::CallHookBlockToPickups( cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, @@ -1133,6 +1154,48 @@ bool cPluginManager::CallHookPreCrafting(const cPlayer * a_Player, const cCrafti +bool cPluginManager::CallHookProjectileHitBlock(cProjectileEntity & a_Projectile) +{ + HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_BLOCK); + if (Plugins == m_Hooks.end()) + { + return false; + } + for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr) + { + if ((*itr)->OnProjectileHitBlock(a_Projectile)) + { + return true; + } + } + return false; +} + + + + + +bool cPluginManager::CallHookProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity) +{ + HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_ENTITY); + if (Plugins == m_Hooks.end()) + { + return false; + } + for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr) + { + if ((*itr)->OnProjectileHitEntity(a_Projectile, a_HitEntity)) + { + return true; + } + } + return false; +} + + + + + bool cPluginManager::CallHookSpawnedEntity(cWorld & a_World, cEntity & a_Entity) { HookMap::iterator Plugins = m_Hooks.find(HOOK_SPAWNED_ENTITY); diff --git a/src/Bindings/PluginManager.h b/src/Bindings/PluginManager.h index 44bc5a8d7..512bc1351 100644 --- a/src/Bindings/PluginManager.h +++ b/src/Bindings/PluginManager.h @@ -18,6 +18,9 @@ class cChunkDesc; // fwd: Entities/Entity.h class cEntity; +// fwd: Entities/ProjectileEntity.h +class cProjectileEntity; + // fwd: Mobs/Monster.h class cMonster; @@ -58,6 +61,7 @@ public: // tolua_export // tolua_begin enum PluginHook { + HOOK_BLOCK_SPREAD, HOOK_BLOCK_TO_PICKUPS, HOOK_CHAT, HOOK_CHUNK_AVAILABLE, @@ -101,6 +105,8 @@ public: // tolua_export HOOK_PLUGINS_LOADED, HOOK_POST_CRAFTING, HOOK_PRE_CRAFTING, + HOOK_PROJECTILE_HIT_BLOCK, + HOOK_PROJECTILE_HIT_ENTITY, HOOK_SPAWNED_ENTITY, HOOK_SPAWNED_MONSTER, HOOK_SPAWNING_ENTITY, @@ -127,6 +133,8 @@ public: // tolua_export class cCommandEnumCallback { public: + virtual ~cCommandEnumCallback() {} + /** Called for each command; return true to abort enumeration For console commands, a_Permission is not used (set to empty string) */ @@ -154,6 +162,7 @@ public: // tolua_export unsigned int GetNumPlugins() const; // tolua_export // Calls for individual hooks. Each returns false if the action is to continue or true if the plugin wants to abort + bool CallHookBlockSpread (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source); bool CallHookBlockToPickups (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups); bool CallHookChat (cPlayer * a_Player, AString & a_Message); bool CallHookChunkAvailable (cWorld * a_World, int a_ChunkX, int a_ChunkZ); @@ -197,6 +206,8 @@ public: // tolua_export bool CallHookPluginsLoaded (void); bool CallHookPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe); bool CallHookPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe); + bool CallHookProjectileHitBlock (cProjectileEntity & a_Projectile); + bool CallHookProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity); bool CallHookSpawnedEntity (cWorld & a_World, cEntity & a_Entity); bool CallHookSpawnedMonster (cWorld & a_World, cMonster & a_Monster); bool CallHookSpawningEntity (cWorld & a_World, cEntity & a_Entity); diff --git a/src/Bindings/WebPlugin.cpp b/src/Bindings/WebPlugin.cpp index 3b71d553c..bf45405ba 100644 --- a/src/Bindings/WebPlugin.cpp +++ b/src/Bindings/WebPlugin.cpp @@ -110,4 +110,4 @@ AString cWebPlugin::SafeString( const AString & a_String ) RetVal.push_back( c ); } return RetVal; -}
\ No newline at end of file +} diff --git a/src/Bindings/lua5.1.dll b/src/Bindings/lua51.dll Binary files differindex 515cf8b30..515cf8b30 100644 --- a/src/Bindings/lua5.1.dll +++ b/src/Bindings/lua51.dll diff --git a/src/Bindings/tolua++.exe b/src/Bindings/tolua++.exe Binary files differindex 86ab1d70f..1e3cc7789 100644 --- a/src/Bindings/tolua++.exe +++ b/src/Bindings/tolua++.exe diff --git a/src/BlockArea.cpp b/src/BlockArea.cpp index 406e18a3b..40cca8882 100644 --- a/src/BlockArea.cpp +++ b/src/BlockArea.cpp @@ -54,7 +54,7 @@ template<typename Combinator> void InternalMergeBlocks( /// Combinator used for cBlockArea::msOverwrite merging -static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +static inline void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { a_DstType = a_SrcType; a_DstMeta = a_SrcMeta; @@ -65,7 +65,7 @@ static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, /// Combinator used for cBlockArea::msFillAir merging -static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +static inline void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { if (a_DstType == E_BLOCK_AIR) { @@ -80,7 +80,7 @@ static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N /// Combinator used for cBlockArea::msImprint merging -static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +static inline void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { if (a_SrcType != E_BLOCK_AIR) { @@ -95,7 +95,7 @@ static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N /// Combinator used for cBlockArea::msLake merging -static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +static inline void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { // Sponge is the NOP block if (a_SrcType == E_BLOCK_SPONGE) @@ -158,17 +158,59 @@ static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBB +/** Combinator used for cBlockArea::msSpongePrint merging */ +static inline void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +{ + // Sponge overwrites nothing, everything else overwrites anything + if (a_SrcType != E_BLOCK_SPONGE) + { + a_DstType = a_SrcType; + a_DstMeta = a_SrcMeta; + } +} + + + + + +/** Combinator used for cBlockArea::msDifference merging */ +static inline void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +{ + if ((a_DstType == a_SrcType) && (a_DstMeta == a_SrcMeta)) + { + a_DstType = E_BLOCK_AIR; + a_DstMeta = 0; + } + else + { + a_DstType = a_SrcType; + a_DstMeta = a_SrcMeta; + } +} + + + + + +/** Combinator used for cBlockArea::msMask merging */ +static inline void MergeCombinatorMask(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +{ + // If the blocks are the same, keep the dest; otherwise replace with air + if ((a_SrcType != a_DstType) || (a_SrcMeta != a_DstMeta)) + { + a_DstType = E_BLOCK_AIR; + a_DstMeta = 0; + } +} + + + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cBlockArea: cBlockArea::cBlockArea(void) : - m_OriginX(0), - m_OriginY(0), - m_OriginZ(0), - m_SizeX(0), - m_SizeY(0), - m_SizeZ(0), - m_WEOffset(0, 0, 0), m_BlockTypes(NULL), m_BlockMetas(NULL), m_BlockLight(NULL), @@ -195,12 +237,8 @@ void cBlockArea::Clear(void) delete[] m_BlockMetas; m_BlockMetas = NULL; delete[] m_BlockLight; m_BlockLight = NULL; delete[] m_BlockSkyLight; m_BlockSkyLight = NULL; - m_OriginX = 0; - m_OriginY = 0; - m_OriginZ = 0; - m_SizeX = 0; - m_SizeY = 0; - m_SizeZ = 0; + m_Origin.Set(0, 0, 0); + m_Size.Set(0, 0, 0); } @@ -243,12 +281,17 @@ void cBlockArea::Create(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes) m_BlockSkyLight[i] = 0x0f; } } - m_SizeX = a_SizeX; - m_SizeY = a_SizeY; - m_SizeZ = a_SizeZ; - m_OriginX = 0; - m_OriginY = 0; - m_OriginZ = 0; + m_Size.Set(a_SizeX, a_SizeY, a_SizeZ); + m_Origin.Set(0, 0, 0); +} + + + + + +void cBlockArea::Create(const Vector3i & a_Size, int a_DataTypes) +{ + Create(a_Size.x, a_Size.y, a_Size.z, a_DataTypes); } @@ -275,9 +318,7 @@ void cBlockArea::SetWEOffset(const Vector3i & a_Offset) void cBlockArea::SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ) { - m_OriginX = a_OriginX; - m_OriginY = a_OriginY; - m_OriginZ = a_OriginZ; + m_Origin.Set(a_OriginX, a_OriginY, a_OriginZ); } @@ -286,7 +327,7 @@ void cBlockArea::SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ) void cBlockArea::SetOrigin(const Vector3i & a_Origin) { - SetOrigin(a_Origin.x, a_Origin.y, a_Origin.z); + m_Origin.Set(a_Origin.x, a_Origin.y, a_Origin.z); } @@ -342,9 +383,7 @@ bool cBlockArea::Read(cForEachChunkProvider * a_ForEachChunkProvider, int a_MinB { return false; } - m_OriginX = a_MinBlockX; - m_OriginY = a_MinBlockY; - m_OriginZ = a_MinBlockZ; + m_Origin.Set(a_MinBlockX, a_MinBlockY, a_MinBlockZ); cChunkReader Reader(*this); // Convert block coords to chunks coords: @@ -408,10 +447,10 @@ bool cBlockArea::Write(cForEachChunkProvider * a_ForEachChunkProvider, int a_Min LOGWARNING("%s: MinBlockY less than zero, adjusting to zero", __FUNCTION__); a_MinBlockY = 0; } - else if (a_MinBlockY > cChunkDef::Height - m_SizeY) + else if (a_MinBlockY > cChunkDef::Height - m_Size.y) { LOGWARNING("%s: MinBlockY + m_SizeY more than chunk height, adjusting to chunk height", __FUNCTION__); - a_MinBlockY = cChunkDef::Height - m_SizeY; + a_MinBlockY = cChunkDef::Height - m_Size.y; } return a_ForEachChunkProvider->WriteBlockArea(*this, a_MinBlockX, a_MinBlockY, a_MinBlockZ, a_DataTypes); @@ -443,10 +482,8 @@ void cBlockArea::CopyTo(cBlockArea & a_Into) const } a_Into.Clear(); - a_Into.SetSize(m_SizeX, m_SizeY, m_SizeZ, GetDataTypes()); - a_Into.m_OriginX = m_OriginX; - a_Into.m_OriginY = m_OriginY; - a_Into.m_OriginZ = m_OriginZ; + a_Into.SetSize(m_Size.x, m_Size.y, m_Size.z, GetDataTypes()); + a_Into.m_Origin = m_Origin; int BlockCount = GetBlockCount(); if (HasBlockTypes()) { @@ -487,13 +524,13 @@ void cBlockArea::DumpToRawFile(const AString & a_FileName) LOGWARNING("cBlockArea: Cannot open file \"%s\" for raw dump", a_FileName.c_str()); return; } - UInt32 SizeX = ntohl(m_SizeX); - UInt32 SizeY = ntohl(m_SizeY); - UInt32 SizeZ = ntohl(m_SizeZ); + UInt32 SizeX = ntohl(m_Size.x); + UInt32 SizeY = ntohl(m_Size.y); + UInt32 SizeZ = ntohl(m_Size.z); f.Write(&SizeX, 4); f.Write(&SizeY, 4); f.Write(&SizeZ, 4); - unsigned char DataTypes = GetDataTypes(); + unsigned char DataTypes = (unsigned char)GetDataTypes(); f.Write(&DataTypes, 1); int NumBlocks = GetBlockCount(); if (HasBlockTypes()) @@ -532,13 +569,13 @@ void cBlockArea::DumpToRawFile(const AString & a_FileName) void cBlockArea::Crop(int a_AddMinX, int a_SubMaxX, int a_AddMinY, int a_SubMaxY, int a_AddMinZ, int a_SubMaxZ) { if ( - (a_AddMinX + a_SubMaxX >= m_SizeX) || - (a_AddMinY + a_SubMaxY >= m_SizeY) || - (a_AddMinZ + a_SubMaxZ >= m_SizeZ) + (a_AddMinX + a_SubMaxX >= m_Size.x) || + (a_AddMinY + a_SubMaxY >= m_Size.y) || + (a_AddMinZ + a_SubMaxZ >= m_Size.z) ) { LOGWARNING("cBlockArea:Crop called with more croping than the dimensions: %d x %d x %d with cropping %d, %d and %d", - m_SizeX, m_SizeY, m_SizeZ, + m_Size.x, m_Size.y, m_Size.z, a_AddMinX + a_SubMaxX, a_AddMinY + a_SubMaxY, a_AddMinZ + a_SubMaxZ ); return; @@ -560,12 +597,10 @@ void cBlockArea::Crop(int a_AddMinX, int a_SubMaxX, int a_AddMinY, int a_SubMaxY { CropNibbles(m_BlockSkyLight, a_AddMinX, a_SubMaxX, a_AddMinY, a_SubMaxY, a_AddMinZ, a_SubMaxZ); } - m_OriginX += a_AddMinX; - m_OriginY += a_AddMinY; - m_OriginZ += a_AddMinZ; - m_SizeX -= a_AddMinX + a_SubMaxX; - m_SizeY -= a_AddMinY + a_SubMaxY; - m_SizeZ -= a_AddMinZ + a_SubMaxZ; + m_Origin.Move(a_AddMinX, a_AddMinY, a_AddMinZ); + m_Size.x -= a_AddMinX + a_SubMaxX; + m_Size.y -= a_AddMinY + a_SubMaxY; + m_Size.z -= a_AddMinZ + a_SubMaxZ; } @@ -590,12 +625,10 @@ void cBlockArea::Expand(int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMa { ExpandNibbles(m_BlockSkyLight, a_SubMinX, a_AddMaxX, a_SubMinY, a_AddMaxY, a_SubMinZ, a_AddMaxZ); } - m_OriginX -= a_SubMinX; - m_OriginY -= a_SubMinY; - m_OriginZ -= a_SubMinZ; - m_SizeX += a_SubMinX + a_AddMaxX; - m_SizeY += a_SubMinY + a_AddMaxY; - m_SizeZ += a_SubMinZ + a_AddMaxZ; + m_Origin.Move(-a_SubMinX, -a_SubMinY, -a_SubMinZ); + m_Size.x += a_SubMinX + a_AddMaxX; + m_Size.y += a_SubMinY + a_AddMaxY; + m_Size.z += a_SubMinZ + a_AddMaxZ; } @@ -645,7 +678,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R SrcOffX, SrcOffY, SrcOffZ, DstOffX, DstOffY, DstOffZ, a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), - m_SizeX, m_SizeY, m_SizeZ, + m_Size.x, m_Size.y, m_Size.z, MergeCombinatorOverwrite ); break; @@ -660,7 +693,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R SrcOffX, SrcOffY, SrcOffZ, DstOffX, DstOffY, DstOffZ, a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), - m_SizeX, m_SizeY, m_SizeZ, + m_Size.x, m_Size.y, m_Size.z, MergeCombinatorFillAir ); break; @@ -675,7 +708,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R SrcOffX, SrcOffY, SrcOffZ, DstOffX, DstOffY, DstOffZ, a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), - m_SizeX, m_SizeY, m_SizeZ, + m_Size.x, m_Size.y, m_Size.z, MergeCombinatorImprint ); break; @@ -690,12 +723,57 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R SrcOffX, SrcOffY, SrcOffZ, DstOffX, DstOffY, DstOffZ, a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), - m_SizeX, m_SizeY, m_SizeZ, + m_Size.x, m_Size.y, m_Size.z, MergeCombinatorLake ); break; } // case msLake + case msSpongePrint: + { + InternalMergeBlocks( + m_BlockTypes, a_Src.GetBlockTypes(), + DstMetas, SrcMetas, + SizeX, SizeY, SizeZ, + SrcOffX, SrcOffY, SrcOffZ, + DstOffX, DstOffY, DstOffZ, + a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), + m_Size.x, m_Size.y, m_Size.z, + MergeCombinatorSpongePrint + ); + break; + } // case msSpongePrint + + case msDifference: + { + InternalMergeBlocks( + m_BlockTypes, a_Src.GetBlockTypes(), + DstMetas, SrcMetas, + SizeX, SizeY, SizeZ, + SrcOffX, SrcOffY, SrcOffZ, + DstOffX, DstOffY, DstOffZ, + a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), + m_Size.x, m_Size.y, m_Size.z, + MergeCombinatorDifference + ); + break; + } // case msDifference + + case msMask: + { + InternalMergeBlocks( + m_BlockTypes, a_Src.GetBlockTypes(), + DstMetas, SrcMetas, + SizeX, SizeY, SizeZ, + SrcOffX, SrcOffY, SrcOffZ, + DstOffX, DstOffY, DstOffZ, + a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), + m_Size.x, m_Size.y, m_Size.z, + MergeCombinatorMask + ); + break; + } // case msMask + default: { LOGWARNING("Unknown block area merge strategy: %d", a_Strategy); @@ -982,17 +1060,17 @@ void cBlockArea::RotateCCW(void) } // We are guaranteed that both blocktypes and blockmetas exist; rotate both at the same time: - BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ]; - NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ]; - for (int x = 0; x < m_SizeX; x++) + BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()]; + NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()]; + for (int x = 0; x < m_Size.x; x++) { - int NewZ = m_SizeX - x - 1; - for (int z = 0; z < m_SizeZ; z++) + int NewZ = m_Size.x - x - 1; + for (int z = 0; z < m_Size.z; z++) { int NewX = z; - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - int NewIdx = NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ; + int NewIdx = NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z; int OldIdx = MakeIndex(x, y, z); NewTypes[NewIdx] = m_BlockTypes[OldIdx]; NewMetas[NewIdx] = BlockHandler(m_BlockTypes[OldIdx])->MetaRotateCCW(m_BlockMetas[OldIdx]); @@ -1004,7 +1082,7 @@ void cBlockArea::RotateCCW(void) delete[] NewTypes; delete[] NewMetas; - std::swap(m_SizeX, m_SizeZ); + std::swap(m_Size.x, m_Size.z); } @@ -1027,17 +1105,17 @@ void cBlockArea::RotateCW(void) } // We are guaranteed that both blocktypes and blockmetas exist; rotate both at the same time: - BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ]; - NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ]; - for (int x = 0; x < m_SizeX; x++) + BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()]; + NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()]; + for (int x = 0; x < m_Size.x; x++) { int NewZ = x; - for (int z = 0; z < m_SizeZ; z++) + for (int z = 0; z < m_Size.z; z++) { - int NewX = m_SizeZ - z - 1; - for (int y = 0; y < m_SizeY; y++) + int NewX = m_Size.z - z - 1; + for (int y = 0; y < m_Size.y; y++) { - int NewIdx = NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ; + int NewIdx = NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z; int OldIdx = MakeIndex(x, y, z); NewTypes[NewIdx] = m_BlockTypes[OldIdx]; NewMetas[NewIdx] = BlockHandler(m_BlockTypes[OldIdx])->MetaRotateCW(m_BlockMetas[OldIdx]); @@ -1049,7 +1127,7 @@ void cBlockArea::RotateCW(void) delete[] NewTypes; delete[] NewMetas; - std::swap(m_SizeX, m_SizeZ); + std::swap(m_Size.x, m_Size.z); } @@ -1072,13 +1150,13 @@ void cBlockArea::MirrorXY(void) } // We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time: - int HalfZ = m_SizeZ / 2; - int MaxZ = m_SizeZ - 1; - for (int y = 0; y < m_SizeY; y++) + int HalfZ = m_Size.z / 2; + int MaxZ = m_Size.z - 1; + for (int y = 0; y < m_Size.y; y++) { for (int z = 0; z < HalfZ; z++) { - for (int x = 0; x < m_SizeX; x++) + for (int x = 0; x < m_Size.x; x++) { int Idx1 = MakeIndex(x, y, z); int Idx2 = MakeIndex(x, y, MaxZ - z); @@ -1112,13 +1190,13 @@ void cBlockArea::MirrorXZ(void) } // We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time: - int HalfY = m_SizeY / 2; - int MaxY = m_SizeY - 1; + int HalfY = m_Size.y / 2; + int MaxY = m_Size.y - 1; for (int y = 0; y < HalfY; y++) { - for (int z = 0; z < m_SizeZ; z++) + for (int z = 0; z < m_Size.z; z++) { - for (int x = 0; x < m_SizeX; x++) + for (int x = 0; x < m_Size.x; x++) { int Idx1 = MakeIndex(x, y, z); int Idx2 = MakeIndex(x, MaxY - y, z); @@ -1152,11 +1230,11 @@ void cBlockArea::MirrorYZ(void) } // We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time: - int HalfX = m_SizeX / 2; - int MaxX = m_SizeX - 1; - for (int y = 0; y < m_SizeY; y++) + int HalfX = m_Size.x / 2; + int MaxX = m_Size.x - 1; + for (int y = 0; y < m_Size.y; y++) { - for (int z = 0; z < m_SizeZ; z++) + for (int z = 0; z < m_Size.z; z++) { for (int x = 0; x < HalfX; x++) { @@ -1180,16 +1258,16 @@ void cBlockArea::RotateCCWNoMeta(void) { if (HasBlockTypes()) { - BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ]; - for (int x = 0; x < m_SizeX; x++) + BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()]; + for (int x = 0; x < m_Size.x; x++) { - int NewZ = m_SizeX - x - 1; - for (int z = 0; z < m_SizeZ; z++) + int NewZ = m_Size.x - x - 1; + for (int z = 0; z < m_Size.z; z++) { int NewX = z; - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - NewTypes[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockTypes[MakeIndex(x, y, z)]; + NewTypes[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockTypes[MakeIndex(x, y, z)]; } // for y } // for z } // for x @@ -1198,23 +1276,23 @@ void cBlockArea::RotateCCWNoMeta(void) } if (HasBlockMetas()) { - NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ]; - for (int x = 0; x < m_SizeX; x++) + NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()]; + for (int x = 0; x < m_Size.x; x++) { - int NewZ = m_SizeX - x - 1; - for (int z = 0; z < m_SizeZ; z++) + int NewZ = m_Size.x - x - 1; + for (int z = 0; z < m_Size.z; z++) { int NewX = z; - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - NewMetas[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockMetas[MakeIndex(x, y, z)]; + NewMetas[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockMetas[MakeIndex(x, y, z)]; } // for y } // for z } // for x std::swap(m_BlockMetas, NewMetas); delete[] NewMetas; } - std::swap(m_SizeX, m_SizeZ); + std::swap(m_Size.x, m_Size.z); } @@ -1225,16 +1303,16 @@ void cBlockArea::RotateCWNoMeta(void) { if (HasBlockTypes()) { - BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ]; - for (int z = 0; z < m_SizeZ; z++) + BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()]; + for (int z = 0; z < m_Size.z; z++) { - int NewX = m_SizeZ - z - 1; - for (int x = 0; x < m_SizeX; x++) + int NewX = m_Size.z - z - 1; + for (int x = 0; x < m_Size.x; x++) { int NewZ = x; - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - NewTypes[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockTypes[MakeIndex(x, y, z)]; + NewTypes[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockTypes[MakeIndex(x, y, z)]; } // for y } // for x } // for z @@ -1243,23 +1321,23 @@ void cBlockArea::RotateCWNoMeta(void) } if (HasBlockMetas()) { - NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ]; - for (int z = 0; z < m_SizeZ; z++) + NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()]; + for (int z = 0; z < m_Size.z; z++) { - int NewX = m_SizeZ - z - 1; - for (int x = 0; x < m_SizeX; x++) + int NewX = m_Size.z - z - 1; + for (int x = 0; x < m_Size.x; x++) { int NewZ = x; - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - NewMetas[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockMetas[MakeIndex(x, y, z)]; + NewMetas[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockMetas[MakeIndex(x, y, z)]; } // for y } // for x } // for z std::swap(m_BlockMetas, NewMetas); delete[] NewMetas; } - std::swap(m_SizeX, m_SizeZ); + std::swap(m_Size.x, m_Size.z); } @@ -1268,15 +1346,15 @@ void cBlockArea::RotateCWNoMeta(void) void cBlockArea::MirrorXYNoMeta(void) { - int HalfZ = m_SizeZ / 2; - int MaxZ = m_SizeZ - 1; + int HalfZ = m_Size.z / 2; + int MaxZ = m_Size.z - 1; if (HasBlockTypes()) { - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { for (int z = 0; z < HalfZ; z++) { - for (int x = 0; x < m_SizeX; x++) + for (int x = 0; x < m_Size.x; x++) { std::swap(m_BlockTypes[MakeIndex(x, y, z)], m_BlockTypes[MakeIndex(x, y, MaxZ - z)]); } // for x @@ -1286,11 +1364,11 @@ void cBlockArea::MirrorXYNoMeta(void) if (HasBlockMetas()) { - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { for (int z = 0; z < HalfZ; z++) { - for (int x = 0; x < m_SizeX; x++) + for (int x = 0; x < m_Size.x; x++) { std::swap(m_BlockMetas[MakeIndex(x, y, z)], m_BlockMetas[MakeIndex(x, y, MaxZ - z)]); } // for x @@ -1305,15 +1383,15 @@ void cBlockArea::MirrorXYNoMeta(void) void cBlockArea::MirrorXZNoMeta(void) { - int HalfY = m_SizeY / 2; - int MaxY = m_SizeY - 1; + int HalfY = m_Size.y / 2; + int MaxY = m_Size.y - 1; if (HasBlockTypes()) { for (int y = 0; y < HalfY; y++) { - for (int z = 0; z < m_SizeZ; z++) + for (int z = 0; z < m_Size.z; z++) { - for (int x = 0; x < m_SizeX; x++) + for (int x = 0; x < m_Size.x; x++) { std::swap(m_BlockTypes[MakeIndex(x, y, z)], m_BlockTypes[MakeIndex(x, MaxY - y, z)]); } // for x @@ -1325,9 +1403,9 @@ void cBlockArea::MirrorXZNoMeta(void) { for (int y = 0; y < HalfY; y++) { - for (int z = 0; z < m_SizeZ; z++) + for (int z = 0; z < m_Size.z; z++) { - for (int x = 0; x < m_SizeX; x++) + for (int x = 0; x < m_Size.x; x++) { std::swap(m_BlockMetas[MakeIndex(x, y, z)], m_BlockMetas[MakeIndex(x, MaxY - y, z)]); } // for x @@ -1342,13 +1420,13 @@ void cBlockArea::MirrorXZNoMeta(void) void cBlockArea::MirrorYZNoMeta(void) { - int HalfX = m_SizeX / 2; - int MaxX = m_SizeX - 1; + int HalfX = m_Size.x / 2; + int MaxX = m_Size.x - 1; if (HasBlockTypes()) { - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - for (int z = 0; z < m_SizeZ; z++) + for (int z = 0; z < m_Size.z; z++) { for (int x = 0; x < HalfX; x++) { @@ -1360,9 +1438,9 @@ void cBlockArea::MirrorYZNoMeta(void) if (HasBlockMetas()) { - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - for (int z = 0; z < m_SizeZ; z++) + for (int z = 0; z < m_Size.z; z++) { for (int x = 0; x < HalfX; x++) { @@ -1393,7 +1471,7 @@ void cBlockArea::SetRelBlockType(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE a void cBlockArea::SetBlockType(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType) { - SetRelBlockType(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType); + SetRelBlockType(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType); } @@ -1470,7 +1548,7 @@ BLOCKTYPE cBlockArea::GetRelBlockType(int a_RelX, int a_RelY, int a_RelZ) const BLOCKTYPE cBlockArea::GetBlockType(int a_BlockX, int a_BlockY, int a_BlockZ) const { - return GetRelBlockType(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ); + return GetRelBlockType(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z); } @@ -1533,7 +1611,7 @@ NIBBLETYPE cBlockArea::GetBlockSkyLight(int a_BlockX, int a_BlockY, int a_BlockZ void cBlockArea::SetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) { - SetRelBlockTypeMeta(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType, a_BlockMeta); + SetRelBlockTypeMeta(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType, a_BlockMeta); } @@ -1567,7 +1645,7 @@ void cBlockArea::SetRelBlockTypeMeta(int a_RelX, int a_RelY, int a_RelZ, B void cBlockArea::GetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const { - return GetRelBlockTypeMeta(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType, a_BlockMeta); + return GetRelBlockTypeMeta(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType, a_BlockMeta); } @@ -1670,9 +1748,7 @@ bool cBlockArea::SetSize(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes) return false; } } - m_SizeX = a_SizeX; - m_SizeY = a_SizeY; - m_SizeZ = a_SizeZ; + m_Size.Set(a_SizeX, a_SizeY, a_SizeZ); return true; } @@ -1683,13 +1759,13 @@ bool cBlockArea::SetSize(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes) int cBlockArea::MakeIndex(int a_RelX, int a_RelY, int a_RelZ) const { ASSERT(a_RelX >= 0); - ASSERT(a_RelX < m_SizeX); + ASSERT(a_RelX < m_Size.x); ASSERT(a_RelY >= 0); - ASSERT(a_RelY < m_SizeY); + ASSERT(a_RelY < m_Size.y); ASSERT(a_RelZ >= 0); - ASSERT(a_RelZ < m_SizeZ); + ASSERT(a_RelZ < m_Size.z); - return a_RelX + a_RelZ * m_SizeX + a_RelY * m_SizeX * m_SizeZ; + return a_RelX + a_RelZ * m_Size.x + a_RelY * m_Size.x * m_Size.z; } @@ -1712,7 +1788,7 @@ void cBlockArea::SetRelNibble(int a_RelX, int a_RelY, int a_RelZ, NIBBLETYPE a_V void cBlockArea::SetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE a_Value, NIBBLETYPE * a_Array) { - SetRelNibble(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_Value, a_Array); + SetRelNibble(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_Value, a_Array); } @@ -1735,7 +1811,7 @@ NIBBLETYPE cBlockArea::GetRelNibble(int a_RelX, int a_RelY, int a_RelZ, NIBBLETY NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE * a_Array) const { - return GetRelNibble(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_Array); + return GetRelNibble(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_Array); } @@ -1748,9 +1824,7 @@ NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBL cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) : m_Area(a_Area), - m_OriginX(a_Area.m_OriginX), - m_OriginY(a_Area.m_OriginY), - m_OriginZ(a_Area.m_OriginZ) + m_Origin(a_Area.m_Origin.x, a_Area.m_Origin.y, a_Area.m_Origin.z) { } @@ -1760,8 +1834,8 @@ cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) : void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLETYPE * a_ChunkSrc) { - int SizeY = m_Area.m_SizeY; - int MinY = m_OriginY; + int SizeY = m_Area.m_Size.y; + int MinY = m_Origin.y; // SizeX, SizeZ are the dmensions of the block data to copy from the current chunk (size of the geometric union) // OffX, OffZ are the offsets of the current chunk data from the area origin @@ -1770,7 +1844,7 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET int SizeZ = cChunkDef::Width; int OffX, OffZ; int BaseX, BaseZ; - OffX = m_CurrentChunkX * cChunkDef::Width - m_OriginX; + OffX = m_CurrentChunkX * cChunkDef::Width - m_Origin.x; if (OffX < 0) { BaseX = -OffX; @@ -1781,7 +1855,7 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET { BaseX = 0; } - OffZ = m_CurrentChunkZ * cChunkDef::Width - m_OriginZ; + OffZ = m_CurrentChunkZ * cChunkDef::Width - m_Origin.z; if (OffZ < 0) { BaseZ = -OffZ; @@ -1793,13 +1867,13 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET BaseZ = 0; } // If the chunk extends beyond the area in the X or Z axis, cut off the Size: - if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_OriginX + m_Area.m_SizeX) + if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_Origin.x + m_Area.m_Size.x) { - SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_OriginX + m_Area.m_SizeX); + SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_Origin.x + m_Area.m_Size.x); } - if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_OriginZ + m_Area.m_SizeZ) + if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_Origin.z + m_Area.m_Size.z) { - SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_OriginZ + m_Area.m_SizeZ); + SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_Origin.z + m_Area.m_Size.z); } for (int y = 0; y < SizeY; y++) @@ -1843,8 +1917,8 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes) return; } - int SizeY = m_Area.m_SizeY; - int MinY = m_OriginY; + int SizeY = m_Area.m_Size.y; + int MinY = m_Origin.y; // SizeX, SizeZ are the dmensions of the block data to copy from the current chunk (size of the geometric union) // OffX, OffZ are the offsets of the current chunk data from the area origin @@ -1853,7 +1927,7 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes) int SizeZ = cChunkDef::Width; int OffX, OffZ; int BaseX, BaseZ; - OffX = m_CurrentChunkX * cChunkDef::Width - m_OriginX; + OffX = m_CurrentChunkX * cChunkDef::Width - m_Origin.x; if (OffX < 0) { BaseX = -OffX; @@ -1864,7 +1938,7 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes) { BaseX = 0; } - OffZ = m_CurrentChunkZ * cChunkDef::Width - m_OriginZ; + OffZ = m_CurrentChunkZ * cChunkDef::Width - m_Origin.z; if (OffZ < 0) { BaseZ = -OffZ; @@ -1876,13 +1950,13 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes) BaseZ = 0; } // If the chunk extends beyond the area in the X or Z axis, cut off the Size: - if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_OriginX + m_Area.m_SizeX) + if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_Origin.x + m_Area.m_Size.x) { - SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_OriginX + m_Area.m_SizeX); + SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_Origin.x + m_Area.m_Size.x); } - if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_OriginZ + m_Area.m_SizeZ) + if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_Origin.z + m_Area.m_Size.z) { - SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_OriginZ + m_Area.m_SizeZ); + SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_Origin.z + m_Area.m_Size.z); } for (int y = 0; y < SizeY; y++) @@ -2002,21 +2076,21 @@ void cBlockArea::CropNibbles(NIBBLEARRAY & a_Array, int a_AddMinX, int a_SubMaxX void cBlockArea::ExpandBlockTypes(int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMaxY, int a_SubMinZ, int a_AddMaxZ) { - int NewSizeX = m_SizeX + a_SubMinX + a_AddMaxX; - int NewSizeY = m_SizeY + a_SubMinY + a_AddMaxY; - int NewSizeZ = m_SizeZ + a_SubMinZ + a_AddMaxZ; + int NewSizeX = m_Size.x + a_SubMinX + a_AddMaxX; + int NewSizeY = m_Size.y + a_SubMinY + a_AddMaxY; + int NewSizeZ = m_Size.z + a_SubMinZ + a_AddMaxZ; int BlockCount = NewSizeX * NewSizeY * NewSizeZ; BLOCKTYPE * NewBlockTypes = new BLOCKTYPE[BlockCount]; memset(NewBlockTypes, 0, BlockCount * sizeof(BLOCKTYPE)); int OldIndex = 0; - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - int IndexBaseY = (y + a_SubMinY) * m_SizeX * m_SizeZ; - for (int z = 0; z < m_SizeZ; z++) + int IndexBaseY = (y + a_SubMinY) * m_Size.x * m_Size.z; + for (int z = 0; z < m_Size.z; z++) { - int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_SizeX; + int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_Size.x; int idx = IndexBaseZ + a_SubMinX; - for (int x = 0; x < m_SizeX; x++) + for (int x = 0; x < m_Size.x; x++) { NewBlockTypes[idx++] = m_BlockTypes[OldIndex++]; } // for x @@ -2032,21 +2106,21 @@ void cBlockArea::ExpandBlockTypes(int a_SubMinX, int a_AddMaxX, int a_SubMinY, i void cBlockArea::ExpandNibbles(NIBBLEARRAY & a_Array, int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMaxY, int a_SubMinZ, int a_AddMaxZ) { - int NewSizeX = m_SizeX + a_SubMinX + a_AddMaxX; - int NewSizeY = m_SizeY + a_SubMinY + a_AddMaxY; - int NewSizeZ = m_SizeZ + a_SubMinZ + a_AddMaxZ; + int NewSizeX = m_Size.x + a_SubMinX + a_AddMaxX; + int NewSizeY = m_Size.y + a_SubMinY + a_AddMaxY; + int NewSizeZ = m_Size.z + a_SubMinZ + a_AddMaxZ; int BlockCount = NewSizeX * NewSizeY * NewSizeZ; NIBBLETYPE * NewNibbles = new NIBBLETYPE[BlockCount]; memset(NewNibbles, 0, BlockCount * sizeof(NIBBLETYPE)); int OldIndex = 0; - for (int y = 0; y < m_SizeY; y++) + for (int y = 0; y < m_Size.y; y++) { - int IndexBaseY = (y + a_SubMinY) * m_SizeX * m_SizeZ; - for (int z = 0; z < m_SizeZ; z++) + int IndexBaseY = (y + a_SubMinY) * m_Size.x * m_Size.z; + for (int z = 0; z < m_Size.z; z++) { - int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_SizeX; + int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_Size.x; int idx = IndexBaseZ + a_SubMinX; - for (int x = 0; x < m_SizeX; x++) + for (int x = 0; x < m_Size.x; x++) { NewNibbles[idx++] = a_Array[OldIndex++]; } // for x @@ -2057,6 +2131,9 @@ void cBlockArea::ExpandNibbles(NIBBLEARRAY & a_Array, int a_SubMinX, int a_AddMa } + + + void cBlockArea::RelSetData( int a_RelX, int a_RelY, int a_RelZ, int a_DataTypes, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, diff --git a/src/BlockArea.h b/src/BlockArea.h index e0e8fe972..c48175b8c 100644 --- a/src/BlockArea.h +++ b/src/BlockArea.h @@ -43,12 +43,17 @@ public: baSkyLight = 8, } ; + /** The per-block strategy to use when merging another block area into this object. + See the Merge function for the description of these */ enum eMergeStrategy { msOverwrite, msFillAir, msImprint, msLake, + msSpongePrint, + msDifference, + msMask, } ; cBlockArea(void); @@ -57,12 +62,18 @@ public: /** Clears the data stored to reclaim memory */ void Clear(void); - /** Creates a new area of the specified size and contents. - Origin is set to all zeroes. + /** Creates a new area of the specified size and contents. + Origin is set to all zeroes. BlockTypes are set to air, block metas to zero, blocklights to zero and skylights to full light. */ void Create(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes = baTypes | baMetas); + /** Creates a new area of the specified size and contents. + Origin is set to all zeroes. + BlockTypes are set to air, block metas to zero, blocklights to zero and skylights to full light. + */ + void Create(const Vector3i & a_Size, int a_DataTypes = baTypes | baMetas); + /** Resets the origin. No other changes are made, contents are untouched. */ void SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ); @@ -119,8 +130,8 @@ public: - msFillAir overwrites only those blocks that were air - msImprint overwrites with only those blocks that are non-air - Special strategies: - msLake (evaluate top-down, first match wins): + Special strategies (evaluate top-down, first match wins): + msLake: | area block | | | this | Src | result | +----------+--------+--------+ @@ -135,6 +146,22 @@ public: | mycelium | stone | stone | ... and mycelium | A | stone | A | ... but nothing else | A | * | A | Everything else is left as it is + + msSpongePrint: + Used for most generators, it allows carving out air pockets, too, and uses the Sponge as the NOP block + | area block | | + | this | Src | result | + +----------+--------+--------+ + | A | sponge | A | Sponge is the NOP block + | * | B | B | Everything else overwrites anything + + msMask: + Combines two areas, the blocks that are the same are kept, differing ones are reset to air + | area block | | + | this | Src | result | + +------+-------+--------+ + | A | A | A | Same blocks are kept + | A | non-A | air | Everything else is replaced with air */ void Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy); @@ -232,18 +259,24 @@ public: void GetBlockTypeMeta (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const; void GetRelBlockTypeMeta(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const; + // GetSize() is already exported manually to return 3 numbers, can't auto-export + const Vector3i & GetSize(void) const { return m_Size; } + + // GetOrigin() is already exported manually to return 3 numbers, can't auto-export + const Vector3i & GetOrigin(void) const { return m_Origin; } + // tolua_begin - int GetSizeX(void) const { return m_SizeX; } - int GetSizeY(void) const { return m_SizeY; } - int GetSizeZ(void) const { return m_SizeZ; } + int GetSizeX(void) const { return m_Size.x; } + int GetSizeY(void) const { return m_Size.y; } + int GetSizeZ(void) const { return m_Size.z; } /** Returns the volume of the area, as number of blocks */ - int GetVolume(void) const { return m_SizeX * m_SizeY * m_SizeZ; } + int GetVolume(void) const { return m_Size.x * m_Size.y * m_Size.z; } - int GetOriginX(void) const { return m_OriginX; } - int GetOriginY(void) const { return m_OriginY; } - int GetOriginZ(void) const { return m_OriginZ; } + int GetOriginX(void) const { return m_Origin.x; } + int GetOriginY(void) const { return m_Origin.y; } + int GetOriginZ(void) const { return m_Origin.z; } /** Returns the datatypes that are stored in the object (bitmask of baXXX values) */ int GetDataTypes(void) const; @@ -261,7 +294,7 @@ public: NIBBLETYPE * GetBlockMetas (void) const { return m_BlockMetas; } // NOTE: one byte per block! NIBBLETYPE * GetBlockLight (void) const { return m_BlockLight; } // NOTE: one byte per block! NIBBLETYPE * GetBlockSkyLight(void) const { return m_BlockSkyLight; } // NOTE: one byte per block! - int GetBlockCount(void) const { return m_SizeX * m_SizeY * m_SizeZ; } + int GetBlockCount(void) const { return m_Size.x * m_Size.y * m_Size.z; } int MakeIndex(int a_RelX, int a_RelY, int a_RelZ) const; protected: @@ -276,9 +309,7 @@ protected: protected: cBlockArea & m_Area; - int m_OriginX; - int m_OriginY; - int m_OriginZ; + Vector3i m_Origin; int m_CurrentChunkX; int m_CurrentChunkZ; @@ -295,12 +326,8 @@ protected: typedef NIBBLETYPE * NIBBLEARRAY; - int m_OriginX; - int m_OriginY; - int m_OriginZ; - int m_SizeX; - int m_SizeY; - int m_SizeZ; + Vector3i m_Origin; + Vector3i m_Size; /** An extra data value sometimes stored in the .schematic file. Used mainly by the WorldEdit plugin. cBlockArea doesn't use this value in any way. */ diff --git a/src/BlockEntities/CommandBlockEntity.cpp b/src/BlockEntities/CommandBlockEntity.cpp index d395997a6..96ca0ac37 100644 --- a/src/BlockEntities/CommandBlockEntity.cpp +++ b/src/BlockEntities/CommandBlockEntity.cpp @@ -160,7 +160,7 @@ bool cCommandBlockEntity::LoadFromJson(const Json::Value & a_Value) m_Command = a_Value.get("Command", "").asString(); m_LastOutput = a_Value.get("LastOutput", "").asString(); - m_Result = a_Value.get("SuccessCount", 0).asInt(); + m_Result = (NIBBLETYPE)a_Value.get("SuccessCount", 0).asInt(); return true; } diff --git a/src/BlockID.h b/src/BlockID.h index 8adefcfba..2fec512e2 100644 --- a/src/BlockID.h +++ b/src/BlockID.h @@ -866,6 +866,19 @@ enum eShrapnelLevel slAll } ; + + + + +enum eSpreadSource +{ + ssFireSpread, + ssGrassSpread, + ssMushroomSpread, + ssMycelSpread, + ssVineSpread, +} ; + // tolua_end diff --git a/src/BlockInfo.cpp b/src/BlockInfo.cpp index 7d438ba3e..6fb5aa5b3 100644 --- a/src/BlockInfo.cpp +++ b/src/BlockInfo.cpp @@ -365,7 +365,7 @@ void cBlockInfo::Initialize(void) ms_Info[E_BLOCK_WOODEN_SLAB ].m_IsSolid = false; - // Torch placeable blocks: + // Blocks that fully occupy their voxel - used as a guide for torch placeable blocks, amongst other things: ms_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_BEDROCK ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_BLOCK_OF_COAL ].m_FullyOccupiesVoxel = true; @@ -397,6 +397,7 @@ void cBlockInfo::Initialize(void) ms_Info[E_BLOCK_HAY_BALE ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_ICE ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_IRON_BLOCK ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_IRON_ORE ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_JACK_O_LANTERN ].m_FullyOccupiesVoxel = true; diff --git a/src/BlockTracer.h b/src/BlockTracer.h index 40d80da1a..a18c8df4d 100644 --- a/src/BlockTracer.h +++ b/src/BlockTracer.h @@ -28,6 +28,9 @@ public: class cCallbacks abstract { public: + // Force a virtual destructor in descendants: + virtual ~cCallbacks() {} + /** Called on each block encountered along the path, including the first block (path start) When this callback returns true, the tracing is aborted. */ diff --git a/src/Blocks/BlockAnvil.h b/src/Blocks/BlockAnvil.h index 9f5f84be0..93a796ef7 100644 --- a/src/Blocks/BlockAnvil.h +++ b/src/Blocks/BlockAnvil.h @@ -18,11 +18,13 @@ public: { } + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { a_Pickups.push_back(cItem(E_BLOCK_ANVIL, 1, a_BlockMeta >> 2)); } + virtual bool GetPlacementBlockTypeMeta( cChunkInterface & a_ChunkInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, @@ -31,27 +33,23 @@ public: ) override { a_BlockType = m_BlockType; - - int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 0.5) & 0x3; - int RawMeta = a_BlockMeta >> 2; - - Direction++; - Direction %= 4; + NIBBLETYPE HighBits = a_BlockMeta & 0x0c; // Only highest two bits are preserved + int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 1.5) & 0x3; switch (Direction) { - case 0: a_BlockMeta = 0x2 | RawMeta << 2; break; - case 1: a_BlockMeta = 0x3 | RawMeta << 2; break; - case 2: a_BlockMeta = 0x0 | RawMeta << 2; break; - case 3: a_BlockMeta = 0x1 | RawMeta << 2; break; + case 0: a_BlockMeta = 0x2 | HighBits; break; + case 1: a_BlockMeta = 0x3 | HighBits; break; + case 2: a_BlockMeta = 0x0 | HighBits; break; + case 3: a_BlockMeta = 0x1 | HighBits; break; default: { return false; } } - return true; } + virtual bool IsUseable() override { return true; diff --git a/src/Blocks/BlockBed.h b/src/Blocks/BlockBed.h index 6daa94730..92804aaac 100644 --- a/src/Blocks/BlockBed.h +++ b/src/Blocks/BlockBed.h @@ -4,7 +4,7 @@ #include "BlockHandler.h" #include "ChunkInterface.h" #include "WorldInterface.h" -#include "MetaRotater.h" +#include "MetaRotator.h" #include "../Entities/Player.h" @@ -12,11 +12,11 @@ class cBlockBedHandler : - public cMetaRotater<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01, true> + public cMetaRotator<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01, true> { public: cBlockBedHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01,true>(a_BlockType) + : cMetaRotator<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01,true>(a_BlockType) { } diff --git a/src/Blocks/BlockBigFlower.h b/src/Blocks/BlockBigFlower.h new file mode 100644 index 000000000..39fd3cac8 --- /dev/null +++ b/src/Blocks/BlockBigFlower.h @@ -0,0 +1,131 @@ + +#pragma once + +#include "BlockHandler.h" + + + + + +class cBlockBigFlowerHandler : + public cBlockHandler +{ +public: + typedef cBlockHandler super; + + cBlockBigFlowerHandler(BLOCKTYPE a_BlockType) + : cBlockHandler(a_BlockType) + { + } + + + virtual void DropBlock(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_BlockPluginInterface, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ) override + { + NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); + if (Meta & 0x8) + { + super::DropBlock(a_ChunkInterface, a_WorldInterface, a_BlockPluginInterface, a_Digger, a_BlockX, a_BlockY - 1, a_BlockZ); + } + else + { + super::DropBlock(a_ChunkInterface, a_WorldInterface, a_BlockPluginInterface, a_Digger, a_BlockX, a_BlockY, a_BlockZ); + } + } + + + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override + { + NIBBLETYPE Meta = a_BlockMeta & 0x7; + + if ((Meta == 2) || (Meta == 3)) + { + return; + } + + a_Pickups.push_back(cItem(E_BLOCK_BIG_FLOWER, 1, Meta)); + } + + + virtual void OnDestroyedByPlayer(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override + { + NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); + if (Meta & 0x8) + { + Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY - 1, a_BlockZ); + } + + NIBBLETYPE FlowerMeta = Meta & 0x7; + if (!a_Player->IsGameModeCreative()) + { + if (((FlowerMeta == 2) || (FlowerMeta == 3)) && (a_Player->GetEquippedItem().m_ItemType == E_ITEM_SHEARS)) + { + MTRand r1; + if (r1.randInt(10) == 5) + { + cItems Pickups; + if (FlowerMeta == 2) + { + Pickups.Add(E_BLOCK_TALL_GRASS, 2, 1); + } + else if (FlowerMeta == 3) + { + Pickups.Add(E_BLOCK_TALL_GRASS, 2, 2); + } + a_WorldInterface.SpawnItemPickups(Pickups, a_BlockX, a_BlockY, a_BlockZ); + } + a_Player->UseEquippedItem(); + } + } + } + + + virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override + { + return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) != E_BLOCK_AIR) && (a_RelY < cChunkDef::Height) && ((a_Chunk.GetBlock(a_RelX, a_RelY + 1, a_RelZ) == E_BLOCK_AIR) || (a_Chunk.GetBlock(a_RelX, a_RelY + 1, a_RelZ) == E_BLOCK_BIG_FLOWER))); + } + + + virtual void OnPlacedByPlayer( + cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, + int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, + int a_CursorX, int a_CursorY, int a_CursorZ, + BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta + ) override + { + int Meta = (((int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 0.5) & 0x3) + 2) % 4; + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY + 1, a_BlockZ, m_BlockType, 0x8 | Meta); + } + + + virtual void OnDestroyed(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ) override + { + NIBBLETYPE OldMeta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); + + if (OldMeta & 0x8) + { + // Was upper part of flower + if (a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ) == m_BlockType) + { + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + } + } + else + { + // Was lower part + if (a_ChunkInterface.GetBlock(a_BlockX, a_BlockY + 1, a_BlockZ) == m_BlockType) + { + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY + 1, a_BlockZ, E_BLOCK_AIR, 0); + } + } + } + + + virtual const char * GetStepSound(void) override + { + return "step.grass"; + } +} ; + + + + diff --git a/src/Blocks/BlockButton.h b/src/Blocks/BlockButton.h index 740cbe3c4..4b2f6f618 100644 --- a/src/Blocks/BlockButton.h +++ b/src/Blocks/BlockButton.h @@ -2,17 +2,17 @@ #include "BlockHandler.h" #include "Chunk.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockButtonHandler : - public cMetaRotater<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true> + public cMetaRotator<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true> { public: cBlockButtonHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType) + : cMetaRotator<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType) { } diff --git a/src/Blocks/BlockCauldron.h b/src/Blocks/BlockCauldron.h index 2e1032d2b..41b79b6c3 100644 --- a/src/Blocks/BlockCauldron.h +++ b/src/Blocks/BlockCauldron.h @@ -23,7 +23,7 @@ public: virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override { - char Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); + NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); switch (a_Player->GetEquippedItem().m_ItemType) { case E_ITEM_WATER_BUCKET: diff --git a/src/Blocks/BlockChest.h b/src/Blocks/BlockChest.h index 30588d8fc..a1ded4c26 100644 --- a/src/Blocks/BlockChest.h +++ b/src/Blocks/BlockChest.h @@ -4,18 +4,18 @@ #include "BlockEntity.h" #include "../BlockArea.h" #include "../Entities/Player.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockChestHandler : - public cMetaRotater<cBlockEntityHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true> + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockChestHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockEntityHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType) + : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockComparator.h b/src/Blocks/BlockComparator.h index e570ff302..4dd05366d 100644 --- a/src/Blocks/BlockComparator.h +++ b/src/Blocks/BlockComparator.h @@ -3,18 +3,18 @@ #include "BlockHandler.h" #include "BlockRedstoneRepeater.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockComparatorHandler : - public cMetaRotater<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true> + public cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true> { public: cBlockComparatorHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType) + : cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType) { } diff --git a/src/Blocks/BlockCrops.h b/src/Blocks/BlockCrops.h index ffc2b3f8b..8606cf3f3 100644 --- a/src/Blocks/BlockCrops.h +++ b/src/Blocks/BlockCrops.h @@ -2,7 +2,7 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" +#include "../FastRandom.h" @@ -21,7 +21,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override { - MTRand rand; + cFastRandom rand; if (a_Meta == 0x7) { @@ -31,18 +31,18 @@ public: case E_BLOCK_CROPS: { a_Pickups.push_back(cItem(E_ITEM_WHEAT, 1, 0)); - a_Pickups.push_back(cItem(E_ITEM_SEEDS, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2 + a_Pickups.push_back(cItem(E_ITEM_SEEDS, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2 break; } case E_BLOCK_CARROTS: { - a_Pickups.push_back(cItem(E_ITEM_CARROT, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2 + a_Pickups.push_back(cItem(E_ITEM_CARROT, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2 break; } case E_BLOCK_POTATOES: { - a_Pickups.push_back(cItem(E_ITEM_POTATO, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2 - if (rand.randInt(20) == 0) + a_Pickups.push_back(cItem(E_ITEM_POTATO, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2 + if (rand.NextInt(21) == 0) { // With a 5% chance, drop a poisonous potato as well a_Pickups.push_back(cItem(E_ITEM_POISONOUS_POTATO, 1, 0)); diff --git a/src/Blocks/BlockDirt.h b/src/Blocks/BlockDirt.h index 544424a04..aa24b8668 100644 --- a/src/Blocks/BlockDirt.h +++ b/src/Blocks/BlockDirt.h @@ -2,7 +2,7 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" +#include "../FastRandom.h" @@ -44,12 +44,12 @@ public: } // Grass spreads to adjacent dirt blocks: - MTRand rand; // TODO: Replace with cFastRandom + cFastRandom rand; for (int i = 0; i < 2; i++) // Pick two blocks to grow to { - int OfsX = rand.randInt(2) - 1; // [-1 .. 1] - int OfsY = rand.randInt(4) - 3; // [-3 .. 1] - int OfsZ = rand.randInt(2) - 1; // [-1 .. 1] + int OfsX = rand.NextInt(3, a_RelX) - 1; // [-1 .. 1] + int OfsY = rand.NextInt(5, a_RelY) - 3; // [-3 .. 1] + int OfsZ = rand.NextInt(3, a_RelZ) - 1; // [-1 .. 1] BLOCKTYPE DestBlock; NIBBLETYPE DestMeta; @@ -79,7 +79,10 @@ public: Chunk->GetBlockTypeMeta(BlockX, BlockY + 1, BlockZ, AboveDest, AboveMeta); if ((cBlockInfo::IsOneHitDig(AboveDest) || cBlockInfo::IsTransparent(AboveDest)) && !IsBlockWater(AboveDest)) { - Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0); + if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, BlockX * cChunkDef::Width, BlockY, BlockZ * cChunkDef::Width, ssGrassSpread)) + { + Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0); + } } } // for i - repeat twice } diff --git a/src/Blocks/BlockDoor.cpp b/src/Blocks/BlockDoor.cpp index 4e38ef334..479c68153 100644 --- a/src/Blocks/BlockDoor.cpp +++ b/src/Blocks/BlockDoor.cpp @@ -110,3 +110,87 @@ const char * cBlockDoorHandler::GetStepSound(void) + +NIBBLETYPE cBlockDoorHandler::MetaRotateCCW(NIBBLETYPE a_Meta) +{ + if (a_Meta & 0x08) + { + return a_Meta; + } + else + { + return super::MetaRotateCCW(a_Meta); + } +} + + + +NIBBLETYPE cBlockDoorHandler::MetaRotateCW(NIBBLETYPE a_Meta) +{ + if (a_Meta & 0x08) + { + return a_Meta; + } + else + { + return super::MetaRotateCW(a_Meta); + } +} + + + +NIBBLETYPE cBlockDoorHandler::MetaMirrorXY(NIBBLETYPE a_Meta) +{ + // Top bit (0x08) contains door panel type (Top/Bottom panel) Only Bottom panels contain position data + // Return a_Meta if panel is a top panel (0x08 bit is set to 1) + + // Note: Currently, you can not properly mirror the hinges on a double door. The orientation of the door is stored + // in only the bottom tile while the hinge position is in the top tile. This function only operates on one tile at a time, + // so the function can only see either the hinge position or orientation, but not both, at any given time. The class itself + // needs extra datamembers. + if (a_Meta & 0x08) return a_Meta; + + // Holds open/closed meta data. 0x0C == 1100. + NIBBLETYPE OtherMeta = a_Meta & 0x0C; + + // Mirrors according to a table. 0x03 == 0011. + switch (a_Meta & 0x03) + { + case 0x03: return 0x01 + OtherMeta; // South -> North + case 0x01: return 0x03 + OtherMeta; // North -> South + } + + // Not Facing North or South; No change. + return a_Meta; +} + + + +NIBBLETYPE cBlockDoorHandler::MetaMirrorYZ(NIBBLETYPE a_Meta) +{ + // Top bit (0x08) contains door panel type (Top/Bottom panel) Only Bottom panels contain position data + // Return a_Meta if panel is a top panel (0x08 bit is set to 1) + + // Note: Currently, you can not properly mirror the hinges on a double door. The orientation of the door is stored + // in only the bottom tile while the hinge position is in the top tile. This function only operates on one tile at a time, + // so the function can only see either the hinge position or orientation, but not both, at any given time.The class itself + // needs extra datamembers. + + if (a_Meta & 0x08) return a_Meta; + + // Holds open/closed meta data. 0x0C == 1100. + NIBBLETYPE OtherMeta = a_Meta & 0x0C; + + // Mirrors according to a table. 0x03 == 0011. + switch (a_Meta & 0x03) + { + case 0x00: return 0x02 + OtherMeta; // West -> East + case 0x02: return 0x00 + OtherMeta; // East -> West + } + + // Not Facing North or South; No change. + return a_Meta; +} + + + diff --git a/src/Blocks/BlockDoor.h b/src/Blocks/BlockDoor.h index 981774c17..797fe484c 100644 --- a/src/Blocks/BlockDoor.h +++ b/src/Blocks/BlockDoor.h @@ -4,15 +4,15 @@ #include "BlockHandler.h" #include "../Entities/Player.h" #include "Chunk.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockDoorHandler : - public cMetaRotater<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> + public cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> { - typedef cMetaRotater<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> super; + typedef cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> super; public: cBlockDoorHandler(BLOCKTYPE a_BlockType); @@ -21,6 +21,10 @@ public: virtual void OnCancelRightClick(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override; virtual const char * GetStepSound(void) override; + virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override; + virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override; + virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override; + virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override; virtual bool GetPlacementBlockTypeMeta( cChunkInterface & a_ChunkInterface, cPlayer * a_Player, @@ -142,14 +146,14 @@ public: static void ChangeDoor(cChunkInterface & a_ChunkInterface, int a_X, int a_Y, int a_Z) { NIBBLETYPE OldMetaData = a_ChunkInterface.GetBlockMeta(a_X, a_Y, a_Z); - + a_ChunkInterface.SetBlockMeta(a_X, a_Y, a_Z, ChangeStateMetaData(OldMetaData)); - + if (OldMetaData & 8) { // Current block is top of the door BLOCKTYPE BottomBlock = a_ChunkInterface.GetBlock(a_X, a_Y - 1, a_Z); - NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z); + NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z); if (IsDoor(BottomBlock) && !(BottomMeta & 8)) { @@ -168,62 +172,6 @@ public: } } } - - - virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override - { - if (a_Meta & 0x08) - { - return a_Meta; - } - else - { - return super::MetaRotateCCW(a_Meta); - } - } - - - - virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override - { - if (a_Meta & 0x08) - { - return a_Meta; - } - else - { - return super::MetaRotateCW(a_Meta); - } - } - - - - virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override - { - if (a_Meta & 0x08) - { - return a_Meta; - } - else - { - return super::MetaMirrorXY(a_Meta); - } - } - - - - virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override - { - if (a_Meta & 0x08) - { - return a_Meta; - } - else - { - return super::MetaMirrorYZ(a_Meta); - } - } - } ; diff --git a/src/Blocks/BlockDropSpenser.h b/src/Blocks/BlockDropSpenser.h index 7e0ad0e55..88b61a418 100644 --- a/src/Blocks/BlockDropSpenser.h +++ b/src/Blocks/BlockDropSpenser.h @@ -6,18 +6,18 @@ #pragma once #include "../Piston.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockDropSpenserHandler : - public cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockDropSpenserHandler(BLOCKTYPE a_BlockType) : - cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) + cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockEnderchest.h b/src/Blocks/BlockEnderchest.h index 97cf484fb..67955f8ce 100644 --- a/src/Blocks/BlockEnderchest.h +++ b/src/Blocks/BlockEnderchest.h @@ -2,17 +2,17 @@ #pragma once #include "BlockEntity.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockEnderchestHandler : - public cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockEnderchestHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) + : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockFenceGate.h b/src/Blocks/BlockFenceGate.h index e3162bbd6..e202c6610 100644 --- a/src/Blocks/BlockFenceGate.h +++ b/src/Blocks/BlockFenceGate.h @@ -2,17 +2,17 @@ #pragma once #include "BlockHandler.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockFenceGateHandler : - public cMetaRotater<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true> + public cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true> { public: cBlockFenceGateHandler(BLOCKTYPE a_BlockType) : - cMetaRotater<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>(a_BlockType) + cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>(a_BlockType) { } diff --git a/src/Blocks/BlockFire.h b/src/Blocks/BlockFire.h index a25b87858..c8f158e7e 100644 --- a/src/Blocks/BlockFire.h +++ b/src/Blocks/BlockFire.h @@ -17,25 +17,27 @@ public: } /// Portal boundary and direction variables - int XZP, XZM, Dir; // For wont of a better name... + // 2014_03_30 _X: What are these used for? Why do we need extra variables? + int XZP, XZM; + NIBBLETYPE Dir; virtual void OnPlaced(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override { /* PORTAL FINDING ALGORITH ======================= - -Get clicked base block - -Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered. - Uses this value as a reference (the 'ceiling') - -For both directions (if one fails, try the other), BASE (clicked) block: - -Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1) - -If a border was encountered, go the other direction and repeat above - -Write borders to XZP and XZM, write direction portal faces to Dir - -Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir + - Get clicked base block + - Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered. + Uses this value as a reference (the 'ceiling') + - For both directions (if one fails, try the other), BASE (clicked) block: + - Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1) + - If a border was encountered, go the other direction and repeat above + - Write borders to XZP and XZM, write direction portal faces to Dir + - Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir */ a_BlockY--; // Because we want the block below the fire - FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface); // Brought to you by Aperture Science + FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface); } virtual void OnDigging(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override diff --git a/src/Blocks/BlockFluid.h b/src/Blocks/BlockFluid.h index 37885e4de..d486d642d 100644 --- a/src/Blocks/BlockFluid.h +++ b/src/Blocks/BlockFluid.h @@ -93,6 +93,7 @@ public: // Check if it's fuel: BLOCKTYPE BlockType; if ( + ((a_RelY + y < 0) || (a_RelY + y > cChunkDef::Height)) || !a_Chunk.UnboundedRelGetBlockType(a_RelX + x, a_RelY + y, a_RelZ + z, BlockType) || !cFireSimulator::IsFuel(BlockType) ) @@ -119,6 +120,7 @@ public: for (size_t i = 0; i < ARRAYCOUNT(CrossCoords); i++) { if ( + ((RelY + CrossCoords[i].y >= 0) && (RelY + CrossCoords[i].y <= cChunkDef::Height)) && a_Chunk.UnboundedRelGetBlockType(RelX + CrossCoords[i].x, RelY + CrossCoords[i].y, RelZ + CrossCoords[i].z, BlockType) && (BlockType == E_BLOCK_AIR) ) diff --git a/src/Blocks/BlockFurnace.h b/src/Blocks/BlockFurnace.h index 27ef2689f..a7a807957 100644 --- a/src/Blocks/BlockFurnace.h +++ b/src/Blocks/BlockFurnace.h @@ -4,17 +4,17 @@ #include "BlockEntity.h" #include "../World.h" #include "../Piston.h" - +#include "MetaRotator.h" class cBlockFurnaceHandler : - public cBlockEntityHandler + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: - cBlockFurnaceHandler(BLOCKTYPE a_BlockType) : - cBlockEntityHandler(a_BlockType) + cBlockFurnaceHandler(BLOCKTYPE a_BlockType) + : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockHandler.cpp b/src/Blocks/BlockHandler.cpp index 4f74e2f45..4a29ff628 100644 --- a/src/Blocks/BlockHandler.cpp +++ b/src/Blocks/BlockHandler.cpp @@ -8,6 +8,7 @@ #include "../Chunk.h" #include "BlockAnvil.h" #include "BlockBed.h" +#include "BlockBigFlower.h" #include "BlockBrewingStand.h" #include "BlockButton.h" #include "BlockCactus.h" @@ -41,6 +42,7 @@ #include "BlockIce.h" #include "BlockLadder.h" #include "BlockLeaves.h" +#include "BlockLilypad.h" #include "BlockNewLeaves.h" #include "BlockLever.h" #include "BlockMelon.h" @@ -89,6 +91,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_ACTIVATOR_RAIL: return new cBlockRailHandler (a_BlockType); case E_BLOCK_ANVIL: return new cBlockAnvilHandler (a_BlockType); case E_BLOCK_BED: return new cBlockBedHandler (a_BlockType); + case E_BLOCK_BIG_FLOWER: return new cBlockBigFlowerHandler (a_BlockType); case E_BLOCK_BIRCH_WOOD_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_BREWING_STAND: return new cBlockBrewingStandHandler (a_BlockType); case E_BLOCK_BRICK_STAIRS: return new cBlockStairsHandler (a_BlockType); @@ -142,6 +145,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_LAPIS_ORE: return new cBlockOreHandler (a_BlockType); case E_BLOCK_LAVA: return new cBlockLavaHandler (a_BlockType); case E_BLOCK_LEAVES: return new cBlockLeavesHandler (a_BlockType); + case E_BLOCK_LILY_PAD: return new cBlockLilypadHandler (a_BlockType); case E_BLOCK_LIT_FURNACE: return new cBlockFurnaceHandler (a_BlockType); case E_BLOCK_LOG: return new cBlockSidewaysHandler (a_BlockType); case E_BLOCK_MELON: return new cBlockMelonHandler (a_BlockType); diff --git a/src/Blocks/BlockHopper.h b/src/Blocks/BlockHopper.h index 59b84aa0e..a882bb077 100644 --- a/src/Blocks/BlockHopper.h +++ b/src/Blocks/BlockHopper.h @@ -3,16 +3,16 @@ // Declares the cBlockHopperHandler class representing the handler for the Hopper block - +#include "MetaRotator.h" class cBlockHopperHandler : - public cBlockEntityHandler + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockHopperHandler(BLOCKTYPE a_BlockType) - : cBlockEntityHandler(a_BlockType) + : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } @@ -39,6 +39,21 @@ public: } return true; } + + + virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag. Lowest three bits are position. 0x08 == 1000 + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Mirrors defined by by a table. (Source, mincraft.gamepedia.com) 0x07 == 0111 + switch (a_Meta & 0x07) + { + case 0x00: return 0x01 + OtherMeta; // Down -> Up + case 0x01: return 0x00 + OtherMeta; // Up -> Down + } + // Not Facing Up or Down; No change. + return a_Meta; + } } ; diff --git a/src/Blocks/BlockLadder.h b/src/Blocks/BlockLadder.h index a3e9edc6b..a605edf3f 100644 --- a/src/Blocks/BlockLadder.h +++ b/src/Blocks/BlockLadder.h @@ -9,11 +9,11 @@ class cBlockLadderHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockLadderHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockLeaves.h b/src/Blocks/BlockLeaves.h index a6d3373c1..8af14686e 100644 --- a/src/Blocks/BlockLeaves.h +++ b/src/Blocks/BlockLeaves.h @@ -1,6 +1,6 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" +#include "../FastRandom.h" #include "../World.h" #include "../BlockArea.h" @@ -37,16 +37,18 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - MTRand rand; + cFastRandom rand; // Only the first 2 bits contain the display information, the others are for growing - if (rand.randInt(5) == 0) + if (rand.NextInt(6) == 0) { a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, a_BlockMeta & 3)); } - if ((a_BlockMeta & 3) == E_META_SAPLING_APPLE) + + // 1 % chance of dropping an apple, if the leaves' type is Apple Leaves + if ((a_BlockMeta & 3) == E_META_LEAVES_APPLE) { - if (rand.rand(100) == 0) + if (rand.NextInt(101) == 0) { a_Pickups.push_back(cItem(E_ITEM_RED_APPLE, 1, 0)); } @@ -58,11 +60,10 @@ public: { cBlockHandler::OnDestroyed(a_ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ); - //0.5% chance of dropping an apple + // 0.5% chance of dropping an apple, if the leaves' type is Apple Leaves: NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); - //check if Oak (0x1 and 0x2 bit not set) - MTRand rand; - if(!(Meta & 3) && rand.randInt(200) == 100) + cFastRandom rand; + if (((Meta & 3) == E_META_LEAVES_APPLE) && (rand.NextInt(201) == 100)) { cItems Drops; Drops.push_back(cItem(E_ITEM_RED_APPLE, 1, 0)); diff --git a/src/Blocks/BlockLever.h b/src/Blocks/BlockLever.h index ef6e102cd..ad2ae29e5 100644 --- a/src/Blocks/BlockLever.h +++ b/src/Blocks/BlockLever.h @@ -1,17 +1,18 @@ #pragma once #include "BlockHandler.h" - +#include "MetaRotator.h" class cBlockLeverHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false> { + typedef cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false> super; public: cBlockLeverHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false>(a_BlockType) { } @@ -104,6 +105,36 @@ public: return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn); } + + + virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override + { + switch (a_Meta) + { + case 0x00: return 0x07; // Ceiling rotation + case 0x07: return 0x00; + + case 0x05: return 0x06; // Ground rotation + case 0x06: return 0x05; + + default: return super::MetaRotateCCW(a_Meta); // Wall Rotation + } + } + + + virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override + { + switch (a_Meta) + { + case 0x00: return 0x07; // Ceiling rotation + case 0x07: return 0x00; + + case 0x05: return 0x06; // Ground rotation + case 0x06: return 0x05; + + default: return super::MetaRotateCCW(a_Meta); // Wall Rotation + } + } } ; diff --git a/src/Blocks/BlockLilypad.h b/src/Blocks/BlockLilypad.h new file mode 100644 index 000000000..2dd4ec768 --- /dev/null +++ b/src/Blocks/BlockLilypad.h @@ -0,0 +1,28 @@ + +#pragma once + +#include "BlockHandler.h" +#include "Entities/Pickup.h" + + + + +class cBlockLilypadHandler : + public cBlockHandler +{ +public: + cBlockLilypadHandler(BLOCKTYPE a_BlockType) + : cBlockHandler(a_BlockType) + { + } + + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override + { + // Reset meta to zero + a_Pickups.push_back(cItem(E_BLOCK_LILY_PAD, 1, 0)); + } +}; + + + + diff --git a/src/Blocks/BlockMobHead.h b/src/Blocks/BlockMobHead.h index 2b128f13b..acd1c88fb 100644 --- a/src/Blocks/BlockMobHead.h +++ b/src/Blocks/BlockMobHead.h @@ -21,6 +21,103 @@ public: { a_Pickups.push_back(cItem(E_ITEM_HEAD, 1, 0)); } + + bool TrySpawnWither(cChunkInterface & a_ChunkInterface, cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ) + { + if (a_BlockY < 2) + { + return false; + } + + class cCallback : public cMobHeadCallback + { + bool m_IsWither; + + virtual bool Item (cMobHeadEntity * a_MobHeadEntity) + { + m_IsWither = (a_MobHeadEntity->GetType() == SKULL_TYPE_WITHER); + + return false; + } + + public: + cCallback () : m_IsWither(false) {} + + bool IsWither(void) const { return m_IsWither; } + + void Reset(void) { m_IsWither = false; } + } CallbackA, CallbackB; + + a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, CallbackA); + + if (!CallbackA.IsWither()) + { + return false; + } + + CallbackA.Reset(); + + BLOCKTYPE BlockY1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ); + BLOCKTYPE BlockY2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 2, a_BlockZ); + + if ((BlockY1 != E_BLOCK_SOULSAND) || (BlockY2 != E_BLOCK_SOULSAND)) + { + return false; + } + + a_World->DoWithMobHeadAt(a_BlockX - 1, a_BlockY, a_BlockZ, CallbackA); + a_World->DoWithMobHeadAt(a_BlockX + 1, a_BlockY, a_BlockZ, CallbackB); + + BLOCKTYPE Block1 = a_ChunkInterface.GetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ); + BLOCKTYPE Block2 = a_ChunkInterface.GetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ); + + if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither()) + { + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); + + // Block entities + a_World->SetBlock(a_BlockX + 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_World->SetBlock(a_BlockX - 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + + // Spawn the wither: + a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither); + + return true; + } + + CallbackA.Reset(); + CallbackB.Reset(); + + a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ - 1, CallbackA); + a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ + 1, CallbackB); + + Block1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1); + Block2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1); + + if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither()) + { + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); + + // Block entities + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ + 1, E_BLOCK_AIR, 0); + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ - 1, E_BLOCK_AIR, 0); + + // Spawn the wither: + a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither); + + return true; + } + + return false; + } virtual void OnPlacedByPlayer( cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, @@ -50,18 +147,37 @@ public: } public: - cCallback (cPlayer * a_Player, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) : - m_Player(a_Player), + cCallback (cPlayer * a_CBPlayer, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) : + m_Player(a_CBPlayer), m_OldBlockMeta(a_OldBlockMeta), m_NewBlockMeta(a_NewBlockMeta) {} }; cCallback Callback(a_Player, a_BlockMeta, static_cast<NIBBLETYPE>(a_BlockFace)); - a_BlockMeta = a_BlockFace; + a_BlockMeta = (NIBBLETYPE)a_BlockFace; cWorld * World = (cWorld *) &a_WorldInterface; World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, Callback); a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, a_BlockMeta); + + if (a_BlockMeta == SKULL_TYPE_WITHER) + { + static const Vector3i Coords[] = + { + Vector3i( 0, 0, 0), + Vector3i( 1, 0, 0), + Vector3i(-1, 0, 0), + Vector3i( 0, 0, 1), + Vector3i( 0, 0, -1), + }; + for (size_t i = 0; i < ARRAYCOUNT(Coords); ++i) + { + if (TrySpawnWither(a_ChunkInterface, World, a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z)) + { + break; + } + } // for i - Coords[] + } } } ; diff --git a/src/Blocks/BlockMushroom.h b/src/Blocks/BlockMushroom.h index c30c1a401..135d418d7 100644 --- a/src/Blocks/BlockMushroom.h +++ b/src/Blocks/BlockMushroom.h @@ -17,6 +17,9 @@ public: } + // TODO: Add Mushroom Spread + + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { // Reset meta to 0 diff --git a/src/Blocks/BlockMycelium.h b/src/Blocks/BlockMycelium.h index 7f897c72a..2a8ef5fca 100644 --- a/src/Blocks/BlockMycelium.h +++ b/src/Blocks/BlockMycelium.h @@ -16,6 +16,8 @@ public: { } + // TODO: Add Mycel Spread + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { a_Pickups.push_back(cItem(E_BLOCK_DIRT, 1, 0)); diff --git a/src/Blocks/BlockNetherWart.h b/src/Blocks/BlockNetherWart.h index 923180e19..812cf906f 100644 --- a/src/Blocks/BlockNetherWart.h +++ b/src/Blocks/BlockNetherWart.h @@ -2,14 +2,13 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" +#include "../FastRandom.h" #include "../World.h" -/// Common class that takes care of carrots, potatoes and wheat class cBlockNetherWartHandler : public cBlockHandler { @@ -22,12 +21,12 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override { - MTRand rand; + cFastRandom rand; if (a_Meta == 0x7) { - // Is fully grown, drop the entire produce: - a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); + // Fully grown, drop the entire produce: + a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, (char)(1 + (rand.NextInt(3) + rand.NextInt(3))) / 2, 0)); } else { @@ -35,18 +34,20 @@ public: } } + virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override { - NIBBLETYPE Meta = a_Chunk.GetMeta (a_RelX, a_RelY, a_RelZ); - + NIBBLETYPE Meta = a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ); if (Meta < 7) { a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_NETHER_WART, ++Meta); } } + virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { + // Needs to be placed on top of a Soulsand block: return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) == E_BLOCK_SOULSAND)); } } ; diff --git a/src/Blocks/BlockPluginInterface.h b/src/Blocks/BlockPluginInterface.h index 7428c9a7a..3a36c40b1 100644 --- a/src/Blocks/BlockPluginInterface.h +++ b/src/Blocks/BlockPluginInterface.h @@ -1,8 +1,14 @@ #pragma once +/** This interface is used to decouple block handlers from the cPluginManager dependancy through cWorld. +The block handlers call this interface, which is then implemented by the specific classes that +the caller provides. +*/ class cBlockPluginInterface { public: + virtual ~cBlockPluginInterface() {} + virtual bool CallHookBlockToPickups(cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0; }; diff --git a/src/Blocks/BlockPumpkin.h b/src/Blocks/BlockPumpkin.h index 349f52605..ac2b9817a 100644 --- a/src/Blocks/BlockPumpkin.h +++ b/src/Blocks/BlockPumpkin.h @@ -1,16 +1,16 @@ #pragma once #include "BlockHandler.h" - +#include "MetaRotator.h" class cBlockPumpkinHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false> { public: cBlockPumpkinHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false>(a_BlockType) { } diff --git a/src/Blocks/BlockRail.h b/src/Blocks/BlockRail.h index 07e9814cd..ad78d290a 100644 --- a/src/Blocks/BlockRail.h +++ b/src/Blocks/BlockRail.h @@ -431,9 +431,145 @@ public: } break; } + default: break; } return true; } + + + virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag when a_Meta is in the range 0x00--0x05 and 0x0A--0x0F. + // Bit 0x08 specifies direction when a_Meta is in the range 0x06-0x09. + if ((a_Meta < 0x06) || (a_Meta > 0x09)) + { + // Save powered rail flag. + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Rotates according to table; 0x07 == 0111. + // Rails can either be flat (North/South) or Ascending (Asc. East) + switch (a_Meta & 0x07) + { + case 0x00: return 0x01 + OtherMeta; // North/South -> East/West + case 0x01: return 0x00 + OtherMeta; // East/West -> North/South + + case 0x02: return 0x04 + OtherMeta; // Asc. East -> Asc. North + case 0x04: return 0x03 + OtherMeta; // Asc. North -> Asc. West + case 0x03: return 0x05 + OtherMeta; // Asc. West -> Asc. South + case 0x05: return 0x02 + OtherMeta; // Asc. South -> Asc. East + } + } + else + { + switch (a_Meta) + { + // Corner Directions + case 0x06: return 0x09; // Northwest Cnr. -> Southwest Cnr. + case 0x07: return 0x06; // Northeast Cnr. -> Northwest Cnr. + case 0x08: return 0x07; // Southeast Cnr. -> Northeast Cnr. + case 0x09: return 0x08; // Southwest Cnr. -> Southeast Cnr. + } + } + // To avoid a compiler warning; + return a_Meta; + } + + + virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09. + if ((a_Meta < 0x06) || (a_Meta > 0x09)) + { + // Save powered rail flag. + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Rotates according to table; 0x07 == 0111. + // Rails can either be flat (North/South) or Ascending (Asc. East) + switch (a_Meta & 0x07) + { + case 0x00: return 0x01 + OtherMeta; // North/South -> East/West + case 0x01: return 0x00 + OtherMeta; // East/West -> North/South + + case 0x02: return 0x05 + OtherMeta; // Asc. East -> Asc. South + case 0x05: return 0x03 + OtherMeta; // Asc. South -> Asc. West + case 0x03: return 0x04 + OtherMeta; // Asc. West -> Asc. North + case 0x04: return 0x02 + OtherMeta; // Asc. North -> Asc. East + } + } + else + { + switch (a_Meta) + { + // Corner Directions + case 0x06: return 0x07; // Northwest Cnr. -> Northeast Cnr. + case 0x07: return 0x08; // Northeast Cnr. -> Southeast Cnr. + case 0x08: return 0x09; // Southeast Cnr. -> Southwest Cnr. + case 0x09: return 0x06; // Southwest Cnr. -> Northwest Cnr. + } + } + // To avoid a compiler warning; + return a_Meta; + } + + + virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09. + if ((a_Meta < 0x06) || (a_Meta > 0x09)) + { + // Save powered rail flag. + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Mirrors according to table; 0x07 == 0111. + // Rails can either be flat (North/South) or Ascending (Asc. East) + switch (a_Meta & 0x07) + { + case 0x05: return 0x04 + OtherMeta; // Asc. South -> Asc. North + case 0x04: return 0x05 + OtherMeta; // Asc. North -> Asc. South + } + } + else + { + switch (a_Meta) + { + // Corner Directions + case 0x06: return 0x09; // Northwest Cnr. -> Southwest Cnr. + case 0x07: return 0x08; // Northeast Cnr. -> Southeast Cnr. + case 0x08: return 0x07; // Southeast Cnr. -> Northeast Cnr. + case 0x09: return 0x06; // Southwest Cnr. -> Northwest Cnr. + } + } + // To avoid a compiler warning; + return a_Meta; + } + + + virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09. + if ((a_Meta < 0x06) || (a_Meta > 0x09)) + { + // Save powered rail flag. + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Mirrors according to table; 0x07 == 0111. + // Rails can either be flat (North/South) or Ascending (Asc. East) + switch (a_Meta & 0x07) + { + case 0x02: return 0x03 + OtherMeta; // Asc. East -> Asc. West + case 0x03: return 0x02 + OtherMeta; // Asc. West -> Asc. East + } + } + else + { + switch (a_Meta) + { + // Corner Directions + case 0x06: return 0x07; // Northwest Cnr. -> Northeast Cnr. + case 0x07: return 0x06; // Northeast Cnr. -> Northwest Cnr. + case 0x08: return 0x09; // Southeast Cnr. -> Southwest Cnr. + case 0x09: return 0x08; // Southwest Cnr. -> Southeast Cnr. + } + } + // To avoid a compiler warning; + return a_Meta; + } } ; diff --git a/src/Blocks/BlockRedstoneRepeater.h b/src/Blocks/BlockRedstoneRepeater.h index 1e2a86949..fe6cd21b9 100644 --- a/src/Blocks/BlockRedstoneRepeater.h +++ b/src/Blocks/BlockRedstoneRepeater.h @@ -3,17 +3,17 @@ #include "BlockHandler.h" #include "Chunk.h" - +#include "MetaRotator.h" class cBlockRedstoneRepeaterHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true> { public: cBlockRedstoneRepeaterHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType) { } diff --git a/src/Blocks/BlockSideways.h b/src/Blocks/BlockSideways.h index 69c0a7230..d67c3aa24 100644 --- a/src/Blocks/BlockSideways.h +++ b/src/Blocks/BlockSideways.h @@ -29,7 +29,13 @@ public: return true; } - + + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override + { + a_Pickups.Add(m_BlockType, 1, a_BlockMeta & 0x3); + } + + inline static NIBBLETYPE BlockFaceToMetaData(eBlockFace a_BlockFace, NIBBLETYPE a_WoodMeta) { switch (a_BlockFace) diff --git a/src/Blocks/BlockSign.h b/src/Blocks/BlockSign.h index cd0c02a40..9d6fede21 100644 --- a/src/Blocks/BlockSign.h +++ b/src/Blocks/BlockSign.h @@ -31,7 +31,7 @@ public: } - static char RotationToMetaData(double a_Rotation) + static NIBBLETYPE RotationToMetaData(double a_Rotation) { a_Rotation += 180 + (180 / 16); // So it's not aligned with axis if (a_Rotation > 360) @@ -45,7 +45,7 @@ public: } - static char DirectionToMetaData(eBlockFace a_Direction) + static NIBBLETYPE DirectionToMetaData(eBlockFace a_Direction) { switch (a_Direction) { @@ -71,6 +71,37 @@ public: { a_Player->GetClientHandle()->SendEditSign(a_BlockX, a_BlockY, a_BlockZ); } + + + virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override + { + return (++a_Meta) & 0x0F; + } + + + virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override + { + return (--a_Meta) & 0x0F; + } + + virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override + { + // Mirrors signs over the XY plane (North-South Mirroring) + + // There are 16 meta values which correspond to different directions. + // These values are equated to angles on a circle; 0x08 = 180 degrees. + return (a_Meta < 0x08) ? 0x08 + a_Meta : 0x08 - a_Meta; + } + + + virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override + { + // Mirrors signs over the YZ plane (East-West Mirroring) + + // There are 16 meta values which correspond to different directions. + // These values are equated to angles on a circle; 0x10 = 360 degrees. + return 0x10 - a_Meta; + } } ; diff --git a/src/Blocks/BlockSlab.h b/src/Blocks/BlockSlab.h index 7cd2c97b2..76f5ed0e7 100644 --- a/src/Blocks/BlockSlab.h +++ b/src/Blocks/BlockSlab.h @@ -11,8 +11,7 @@ #include "BlockHandler.h" #include "../Items/ItemHandler.h" - - +#include "Root.h" @@ -40,41 +39,9 @@ public: ) override { a_BlockType = m_BlockType; - BLOCKTYPE Type = (BLOCKTYPE) (a_Player->GetEquippedItem().m_ItemType); NIBBLETYPE Meta = (NIBBLETYPE) a_Player->GetEquippedItem().m_ItemDamage; - // HandlePlaceBlock wants a cItemHandler pointer thing, so let's give it one - cItemHandler * ItemHandler = cItemHandler::GetItemHandler(GetDoubleSlabType(Type)); - - // Check if the block at the coordinates is a slab. Eligibility for combining has already been processed in ClientHandle - if (IsAnySlabType(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ))) - { - // Call the function in ClientHandle that places a block when the client sends the packet, - // so that plugins may interfere with the placement. - - if ((a_BlockFace == BLOCK_FACE_TOP) || (a_BlockFace == BLOCK_FACE_BOTTOM)) - { - // Top and bottom faces need no parameter modification - a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler); - } - else - { - // The other faces need to distinguish between top and bottom cursor positions - if (a_CursorY > 7) - { - // Edit the call to use BLOCK_FACE_BOTTOM, otherwise it places incorrectly - a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, BLOCK_FACE_TOP, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler); - } - else - { - // Edit the call to use BLOCK_FACE_TOP, otherwise it places incorrectly - a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, BLOCK_FACE_BOTTOM, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler); - } - } - return false; // Cancel the event, because dblslabs were already placed, nothing else needed - } - - // Place the single-slab with correct metas: + // Set the correct metadata based on player equipped item (i.e. a_BlockMeta not initialised yet) switch (a_BlockFace) { case BLOCK_FACE_TOP: @@ -105,7 +72,16 @@ public: a_BlockMeta = Meta & 0x7; break; } } + case BLOCK_FACE_NONE: return false; } // switch (a_BlockFace) + + // Check if the block at the coordinates is a single slab. Eligibility for combining has already been processed in ClientHandle + // Changed to-be-placed to a double slab if we are clicking on a single slab, as opposed to placing one for the first time + if (IsAnySlabType(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ))) + { + a_BlockType = GetDoubleSlabType(m_BlockType); + } + return true; } @@ -184,6 +160,15 @@ public: ASSERT(!"Unhandled double slab type!"); return ""; } + + + virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override + { + NIBBLETYPE OtherMeta = a_Meta & 0x07; // Contains unrelated meta data. + + // 8th bit is up/down. 1 right-side-up, 0 is up-side-down. + return (a_Meta & 0x08) ? 0x00 + OtherMeta : 0x01 + OtherMeta; + } } ; diff --git a/src/Blocks/BlockStairs.h b/src/Blocks/BlockStairs.h index ea8405597..09ff254a6 100644 --- a/src/Blocks/BlockStairs.h +++ b/src/Blocks/BlockStairs.h @@ -2,17 +2,17 @@ #pragma once #include "BlockHandler.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockStairsHandler : - public cMetaRotater<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true> + public cMetaRotator<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true> { public: cBlockStairsHandler(BLOCKTYPE a_BlockType) : - cMetaRotater<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>(a_BlockType) + cMetaRotator<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>(a_BlockType) { } @@ -30,9 +30,7 @@ public: UNUSED(a_BlockY); UNUSED(a_BlockZ); UNUSED(a_CursorX); - UNUSED(a_CursorY); UNUSED(a_CursorZ); - UNUSED(a_BlockMeta); a_BlockType = m_BlockType; a_BlockMeta = RotationToMetaData(a_Player->GetYaw()); switch (a_BlockFace) @@ -51,10 +49,12 @@ public: } break; } + case BLOCK_FACE_NONE: return false; } return true; } + virtual const char * GetStepSound(void) override { if ( diff --git a/src/Blocks/BlockStems.h b/src/Blocks/BlockStems.h index 705436345..b726a0901 100644 --- a/src/Blocks/BlockStems.h +++ b/src/Blocks/BlockStems.h @@ -17,9 +17,10 @@ public: { } + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - int ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS; + short ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS; a_Pickups.push_back(cItem(ItemType, 1, 0)); } diff --git a/src/Blocks/BlockTallGrass.h b/src/Blocks/BlockTallGrass.h index b8af1f1da..ba1f2e0f6 100644 --- a/src/Blocks/BlockTallGrass.h +++ b/src/Blocks/BlockTallGrass.h @@ -15,14 +15,14 @@ public: : cBlockHandler(a_BlockType) { } - - + + virtual bool DoesIgnoreBuildCollision(void) override { return true; } - - + + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { // Drop seeds, sometimes @@ -34,11 +34,25 @@ public: } + virtual void OnDestroyedByPlayer(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override + { + NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); + + if ((!a_Player->IsGameModeCreative()) && (a_Player->GetEquippedItem().m_ItemType == E_ITEM_SHEARS)) + { + cItems Pickups; + Pickups.Add(E_BLOCK_TALL_GRASS, 1, Meta); + a_WorldInterface.SpawnItemPickups(Pickups, a_BlockX, a_BlockY, a_BlockZ); + } + a_Player->UseEquippedItem(); + } + + virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) != E_BLOCK_AIR)); } - + virtual const char * GetStepSound(void) override { diff --git a/src/Blocks/BlockTorch.h b/src/Blocks/BlockTorch.h index d32c77629..8ddec8de1 100644 --- a/src/Blocks/BlockTorch.h +++ b/src/Blocks/BlockTorch.h @@ -2,17 +2,17 @@ #include "BlockHandler.h" #include "../Chunk.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockTorchHandler : - public cMetaRotater<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2> + public cMetaRotator<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2> { public: cBlockTorchHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>(a_BlockType) + : cMetaRotator<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>(a_BlockType) { } diff --git a/src/Blocks/BlockTrapdoor.h b/src/Blocks/BlockTrapdoor.h index 9bae92c4d..6a36ab874 100644 --- a/src/Blocks/BlockTrapdoor.h +++ b/src/Blocks/BlockTrapdoor.h @@ -2,17 +2,17 @@ #pragma once #include "BlockHandler.h" - +#include "MetaRotator.h" class cBlockTrapdoorHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x00, 0x03, false> { public: cBlockTrapdoorHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x00, 0x03, false>(a_BlockType) { } diff --git a/src/Blocks/BlockVine.h b/src/Blocks/BlockVine.h index 8041d9359..7bb9dc484 100644 --- a/src/Blocks/BlockVine.h +++ b/src/Blocks/BlockVine.h @@ -1,7 +1,7 @@ #pragma once #include "BlockHandler.h" -#include "MetaRotater.h" +#include "MetaRotator.h" @@ -83,7 +83,7 @@ public: static const struct { int x, z; - int Bit; + NIBBLETYPE Bit; } Coords[] = { { 0, 1, 1}, // south, ZP @@ -91,7 +91,7 @@ public: { 0, -1, 4}, // north, ZM { 1, 0, 8}, // east, XP } ; - int res = 0; + NIBBLETYPE res = 0; for (size_t i = 0; i < ARRAYCOUNT(Coords); i++) { BLOCKTYPE BlockType; @@ -175,7 +175,10 @@ public: a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY - 1, a_RelZ, Block); if (Block == E_BLOCK_AIR) { - a_Chunk.UnboundedRelSetBlock(a_RelX, a_RelY - 1, a_RelZ, E_BLOCK_VINES, a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ)); + if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, a_RelX * cChunkDef::Width, a_RelY - 1, a_RelZ * cChunkDef::Width, ssVineSpread)) + { + a_Chunk.UnboundedRelSetBlock(a_RelX, a_RelY - 1, a_RelZ, E_BLOCK_VINES, a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ)); + } } } @@ -194,14 +197,14 @@ public: virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override { // Bits 2 and 4 stay, bits 1 and 3 swap - return ((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2)); + return (NIBBLETYPE)((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2)); } virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override { // Bits 1 and 3 stay, bits 2 and 4 swap - return ((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2)); + return (NIBBLETYPE)((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2)); } } ; diff --git a/src/Blocks/BroadcastInterface.h b/src/Blocks/BroadcastInterface.h index 01966ffbd..b1b450690 100644 --- a/src/Blocks/BroadcastInterface.h +++ b/src/Blocks/BroadcastInterface.h @@ -4,7 +4,8 @@ class cBroadcastInterface { public: - + virtual ~cBroadcastInterface() {} + virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0; virtual void BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0; virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) = 0; diff --git a/src/Blocks/MetaRotater.h b/src/Blocks/MetaRotator.h index dde88e6db..899c583e1 100644 --- a/src/Blocks/MetaRotater.h +++ b/src/Blocks/MetaRotator.h @@ -1,4 +1,4 @@ -// MetaRotater.h +// MetaRotator.h // Provides a mixin for rotations and reflections @@ -21,15 +21,15 @@ Inherit from this class providing your base class as Base, the BitMask for the d */ template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched = false> -class cMetaRotater : public Base +class cMetaRotator : public Base { public: - cMetaRotater(BLOCKTYPE a_BlockType) : + cMetaRotator(BLOCKTYPE a_BlockType) : Base(a_BlockType) {} - virtual ~cMetaRotater() {} + virtual ~cMetaRotator() {} virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override; virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override; @@ -42,7 +42,7 @@ public: template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> -NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta) +NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); switch (a_Meta & BitMask) @@ -64,7 +64,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> -NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta) +NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); switch (a_Meta & BitMask) @@ -86,7 +86,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> -NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta) +NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); switch (a_Meta & BitMask) @@ -103,7 +103,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> -NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta) +NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); switch (a_Meta & BitMask) diff --git a/src/Blocks/WorldInterface.h b/src/Blocks/WorldInterface.h index 580339d32..bfbb053d9 100644 --- a/src/Blocks/WorldInterface.h +++ b/src/Blocks/WorldInterface.h @@ -9,7 +9,8 @@ class cItems; class cWorldInterface { public: - + virtual ~cWorldInterface() {} + virtual Int64 GetTimeOfDay(void) const = 0; virtual Int64 GetWorldAge(void) const = 0; diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt index 448dc4b70..30e9dbfd4 100644 --- a/src/CMakeLists.txt +++ b/src/CMakeLists.txt @@ -6,14 +6,14 @@ include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/jsoncpp/include") include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/polarssl/include") set(FOLDERS OSSupport HTTPServer Items Blocks Protocol Generating) -set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities) +set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities Generating/Prefabs) if (NOT MSVC) - #Bindings needs to reference other folders so are done here + # Bindings need to reference other folders, so they are done here instead - #lib dependecies are not included + # lib dependencies are not included set(BINDING_DEPENDECIES tolua @@ -104,7 +104,6 @@ if (NOT MSVC) Bindings/PluginLua Bindings/PluginManager Bindings/WebPlugin - Bindings/WebPlugin ) target_link_libraries(Bindings lua sqlite tolualib) @@ -138,6 +137,7 @@ if (NOT MSVC) else () + # MSVC-specific handling: Put all files into one project, separate by the folders: # Generate the Bindings if they don't exist: if (NOT EXISTS "${PROJECT_SOURCE_DIR}/Bindings/Bindings.cpp") @@ -149,6 +149,14 @@ else () ) endif() + # Get all files in this folder: + file(GLOB_RECURSE SOURCE + "*.cpp" + "*.h" + "*.pkg" + ) + source_group("" FILES ${SOURCE}) + # Add all subfolders as solution-folders: list(APPEND FOLDERS "Resources") list(APPEND FOLDERS "Bindings") @@ -159,23 +167,16 @@ else () "${PATH}/*.rc" "${PATH}/*.pkg" ) - source_group("${PATH}" FILES ${FOLDER_FILES}) + string(REPLACE "/" "\\" PROJECT_PATH ${PATH}) + source_group("${PROJECT_PATH}" FILES ${FOLDER_FILES}) endfunction(includefolder) foreach(folder ${FOLDERS}) includefolder(${folder}) endforeach(folder) - file(GLOB_RECURSE SOURCE - "*.cpp" - "*.h" - "*.pkg" - ) - include_directories("${PROJECT_SOURCE_DIR}") - source_group("" FILES ${SOURCE}) - # Precompiled headers (1st part) SET_SOURCE_FILES_PROPERTIES( Globals.cpp PROPERTIES COMPILE_FLAGS "/Yc\"Globals.h\"" @@ -231,7 +232,7 @@ endif () if (NOT MSVC) target_link_libraries(${EXECUTABLE} OSSupport HTTPServer Bindings Items Blocks) - target_link_libraries(${EXECUTABLE} Protocol Generating WorldStorage) + target_link_libraries(${EXECUTABLE} Protocol Generating Generating_Prefabs WorldStorage) target_link_libraries(${EXECUTABLE} Mobs Entities Simulator UI BlockEntities) endif () if (WIN32) diff --git a/src/Chunk.cpp b/src/Chunk.cpp index 957d7d575..22b33c595 100644 --- a/src/Chunk.cpp +++ b/src/Chunk.cpp @@ -884,7 +884,7 @@ void cChunk::ApplyWeatherToTop() FastSetBlock(X, Height, Z, E_BLOCK_SNOW, TopMeta - 1); } } - else if (cBlockInfo::IsSnowable(TopBlock)) + else if (cBlockInfo::IsSnowable(TopBlock) && (Height + 1 < cChunkDef::Height)) { SetBlock(X, Height + 1, Z, E_BLOCK_SNOW, 0); } @@ -2510,6 +2510,17 @@ cChunk * cChunk::GetNeighborChunk(int a_BlockX, int a_BlockZ) cChunk * cChunk::GetRelNeighborChunk(int a_RelX, int a_RelZ) { + // If the relative coords are too far away, use the parent's chunk lookup instead: + if ((a_RelX < 128) || (a_RelX > 128) || (a_RelZ < -128) || (a_RelZ > 128)) + { + int BlockX = m_PosX * cChunkDef::Width + a_RelX; + int BlockZ = m_PosZ * cChunkDef::Width + a_RelZ; + int BlockY, ChunkX, ChunkZ; + AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); + return m_ChunkMap->GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + } + + // Walk the neighbors: bool ReturnThis = true; if (a_RelX < 0) { diff --git a/src/ClientHandle.cpp b/src/ClientHandle.cpp index 46c10ae82..5876e55c7 100644 --- a/src/ClientHandle.cpp +++ b/src/ClientHandle.cpp @@ -941,6 +941,8 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e } return; } + + m_NumBlockChangeInteractionsThisTick++; if (!CheckBlockInteractionsRate()) { @@ -960,7 +962,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e ); // Let's send the current world block to the client, so that it can immediately "let the user know" that they haven't placed the block - if (a_BlockFace > -1) + if (a_BlockFace != BLOCK_FACE_NONE) { AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player); @@ -988,7 +990,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e cItemHandler * ItemHandler = cItemHandler::GetItemHandler(Equipped.m_ItemType); - if (ItemHandler->IsPlaceable() && (a_BlockFace > -1)) + if (ItemHandler->IsPlaceable() && (a_BlockFace != BLOCK_FACE_NONE)) { HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler); } @@ -1026,6 +1028,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler) { + BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType); if (a_BlockFace < 0) { // Clicked in air @@ -1036,7 +1039,6 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e BLOCKTYPE ClickedBlock; NIBBLETYPE ClickedBlockMeta; - BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType); NIBBLETYPE EquippedBlockDamage = (NIBBLETYPE)(m_Player->GetEquippedItem().m_ItemDamage); if ((a_BlockY < 0) || (a_BlockY >= cChunkDef::Height)) @@ -1053,8 +1055,8 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e cBlockSlabHandler::IsAnySlabType(EquippedBlock) && // Is the player placing another slab? ((ClickedBlockMeta & 0x07) == EquippedBlockDamage) && // Is it the same slab type? ( - (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab - (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab + (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab + (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab ) ) { @@ -1062,7 +1064,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e // If clicked top face and slab occupies the top voxel, we want a slab to be placed above it (therefore increment Y) // Else if clicked bottom face and slab occupies the bottom voxel, decrement Y for the same reason // Don't touch coordinates if anything else because a dblslab opportunity is present - if((ClickedBlockMeta & 0x08) && (a_BlockFace == BLOCK_FACE_TOP)) + if ((ClickedBlockMeta & 0x08) && (a_BlockFace == BLOCK_FACE_TOP)) { ++a_BlockY; } @@ -1138,7 +1140,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e // The actual block placement: World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, BlockType, BlockMeta); - if (m_Player->GetGameMode() != gmCreative) + if (!m_Player->IsGameModeCreative()) { m_Player->GetInventory().RemoveOneEquippedItem(); } @@ -1530,7 +1532,7 @@ void cClientHandle::HandleTabCompletion(const AString & a_Text) -void cClientHandle::SendData(const char * a_Data, int a_Size) +void cClientHandle::SendData(const char * a_Data, size_t a_Size) { if (m_HasSentDC) { @@ -1545,7 +1547,7 @@ void cClientHandle::SendData(const char * a_Data, int a_Size) if (m_OutgoingDataOverflow.empty()) { // No queued overflow data; if this packet fits into the ringbuffer, put it in, otherwise put it in the overflow buffer: - int CanFit = m_OutgoingData.GetFreeSpace(); + size_t CanFit = m_OutgoingData.GetFreeSpace(); if (CanFit > a_Size) { CanFit = a_Size; @@ -1606,10 +1608,8 @@ void cClientHandle::MoveToWorld(cWorld & a_World, bool a_SendRespawnPacket) m_Protocol->SendUnloadChunk(itr->m_ChunkX, itr->m_ChunkZ); } // for itr - Chunks[] - // Do NOT stream new chunks, the new world runs its own tick thread and may deadlock - // Instead, the chunks will be streamed when the client is moved to the new world's Tick list, - // by setting state to csAuthenticated - m_State = csAuthenticated; + // StreamChunks() called in cPlayer::MoveToWorld() after new world has been set + // Meanwhile here, we set last streamed values to bogus ones so everything is resent m_LastStreamedChunkX = 0x7fffffff; m_LastStreamedChunkZ = 0x7fffffff; m_HasSentPlayerChunk = false; @@ -2633,7 +2633,7 @@ void cClientHandle::PacketError(unsigned char a_PacketType) -void cClientHandle::DataReceived(const char * a_Data, int a_Size) +void cClientHandle::DataReceived(const char * a_Data, size_t a_Size) { // Data is received from the client, store it in the buffer to be processed by the Tick thread: m_TimeSinceLastPacket = 0; diff --git a/src/ClientHandle.h b/src/ClientHandle.h index 8366caa16..0c367ec7d 100644 --- a/src/ClientHandle.h +++ b/src/ClientHandle.h @@ -225,15 +225,15 @@ public: */ bool HandleLogin(int a_ProtocolVersion, const AString & a_Username); - void SendData(const char * a_Data, int a_Size); + void SendData(const char * a_Data, size_t a_Size); /** Called when the player moves into a different world; queues sreaming the new chunks */ void MoveToWorld(cWorld & a_World, bool a_SendRespawnPacket); +private: + /** Handles the block placing packet when it is a real block placement (not block-using, item-using or eating) */ void HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler); - -private: /** The type used for storing the names of registered plugin channels. */ typedef std::set<AString> cChannels; @@ -362,7 +362,7 @@ private: void HandleCommandBlockMessage(const char * a_Data, unsigned int a_Length); // cSocketThreads::cCallback overrides: - virtual void DataReceived (const char * a_Data, int a_Size) override; // Data is received from the client + virtual void DataReceived (const char * a_Data, size_t a_Size) override; // Data is received from the client virtual void GetOutgoingData(AString & a_Data) override; // Data can be sent to client virtual void SocketClosed (void) override; // The socket has been closed for any reason }; // tolua_export diff --git a/src/CompositeChat.cpp b/src/CompositeChat.cpp index a917ee70f..c70ef1070 100644 --- a/src/CompositeChat.cpp +++ b/src/CompositeChat.cpp @@ -112,8 +112,8 @@ cCompositeChat::cCompositeChat(void) : -cCompositeChat::cCompositeChat(const AString & a_ParseText) : - m_MessageType(mtCustom) +cCompositeChat::cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType) : + m_MessageType(a_MessageType) { ParseText(a_ParseText); } @@ -314,6 +314,58 @@ void cCompositeChat::UnderlineUrls(void) +AString cCompositeChat::ExtractText(void) const +{ + AString Msg; + for (cParts::const_iterator itr = m_Parts.begin(), end = m_Parts.end(); itr != end; ++itr) + { + switch ((*itr)->m_PartType) + { + case ptText: + case ptClientTranslated: + case ptRunCommand: + case ptSuggestCommand: + { + Msg.append((*itr)->m_Text); + break; + } + case ptUrl: + { + Msg.append(((cUrlPart *)(*itr))->m_Url); + break; + } + } // switch (PartType) + } // for itr - m_Parts[] + return Msg; +} + + + + + +cMCLogger::eLogLevel cCompositeChat::MessageTypeToLogLevel(eMessageType a_MessageType) +{ + switch (a_MessageType) + { + case mtCustom: return cMCLogger::llRegular; + case mtFailure: return cMCLogger::llWarning; + case mtInformation: return cMCLogger::llInfo; + case mtSuccess: return cMCLogger::llRegular; + case mtWarning: return cMCLogger::llWarning; + case mtFatal: return cMCLogger::llError; + case mtDeath: return cMCLogger::llRegular; + case mtPrivateMessage: return cMCLogger::llRegular; + case mtJoin: return cMCLogger::llRegular; + case mtLeave: return cMCLogger::llRegular; + } + ASSERT(!"Unhandled MessageType"); + return cMCLogger::llError; +} + + + + + void cCompositeChat::AddStyle(AString & a_Style, const AString & a_AddStyle) { if (a_AddStyle.empty()) diff --git a/src/CompositeChat.h b/src/CompositeChat.h index 27319490d..5b9c5f612 100644 --- a/src/CompositeChat.h +++ b/src/CompositeChat.h @@ -117,7 +117,7 @@ public: /** Creates a new chat message and parses the text into parts. Recognizes "http:" and "https:" links and @color-codes. Uses ParseText() for the actual parsing. */ - cCompositeChat(const AString & a_ParseText); + cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType = mtCustom); ~cCompositeChat(); @@ -164,10 +164,19 @@ public: /** Returns the message type set previously by SetMessageType(). */ eMessageType GetMessageType(void) const { return m_MessageType; } + /** Returns the text from the parts that comprises the human-readable data. + Used for older protocols that don't support composite chat + and for console-logging. */ + AString ExtractText(void) const; + // tolua_end const cParts & GetParts(void) const { return m_Parts; } + /** Converts the MessageType to a LogLevel value. + Used by the logging bindings when logging a cCompositeChat object. */ + static cMCLogger::eLogLevel MessageTypeToLogLevel(eMessageType a_MessageType); + protected: /** All the parts that */ cParts m_Parts; diff --git a/src/DeadlockDetect.cpp b/src/DeadlockDetect.cpp index 4dc7bfde6..322084dc4 100644 --- a/src/DeadlockDetect.cpp +++ b/src/DeadlockDetect.cpp @@ -7,7 +7,7 @@ #include "DeadlockDetect.h" #include "Root.h" #include "World.h" -# include <cstdlib> +#include <cstdlib> @@ -16,9 +16,6 @@ /// Number of milliseconds per cycle const int CYCLE_MILLISECONDS = 100; -/// When the number of cycles for the same world age hits this value, it is considered a deadlock -const int NUM_CYCLES_LIMIT = 200; // 200 = twenty seconds - diff --git a/src/Endianness.h b/src/Endianness.h index 86eb369f5..78f9a5d99 100644 --- a/src/Endianness.h +++ b/src/Endianness.h @@ -1,12 +1,14 @@ #pragma once +#define ntohll(x) ((((UInt64)ntohl((u_long)x)) << 32) + ntohl(x >> 32)) + // Changes endianness -inline unsigned long long HostToNetwork8(const void* a_Value ) +inline UInt64 HostToNetwork8(const void * a_Value) { unsigned long long __HostToNetwork8; memcpy( &__HostToNetwork8, a_Value, sizeof( __HostToNetwork8 ) ); @@ -18,7 +20,7 @@ inline unsigned long long HostToNetwork8(const void* a_Value ) -inline unsigned int HostToNetwork4(const void* a_Value ) +inline UInt32 HostToNetwork4(const void* a_Value ) { unsigned int __HostToNetwork4; memcpy( &__HostToNetwork4, a_Value, sizeof( __HostToNetwork4 ) ); @@ -30,11 +32,10 @@ inline unsigned int HostToNetwork4(const void* a_Value ) -inline double NetworkToHostDouble8(const void* a_Value ) +inline double NetworkToHostDouble8(const void * a_Value) { -#define ntohll(x) ((((unsigned long long)ntohl((u_long)x)) << 32) + ntohl(x >> 32)) - unsigned long long buf = 0;//(*(unsigned long long*)a_Value); - memcpy( &buf, a_Value, 8 ); + UInt64 buf = 0; + memcpy(&buf, a_Value, 8); buf = ntohll(buf); double x; memcpy(&x, &buf, sizeof(double)); @@ -45,23 +46,25 @@ inline double NetworkToHostDouble8(const void* a_Value ) -inline long long NetworkToHostLong8(const void * a_Value ) +inline Int64 NetworkToHostLong8(const void * a_Value) { - unsigned long long buf = *(unsigned long long*)a_Value; + UInt64 buf; + memcpy(&buf, a_Value, 8); buf = ntohll(buf); - return *reinterpret_cast<long long *>(&buf); + return *reinterpret_cast<Int64 *>(&buf); } -inline float NetworkToHostFloat4(const void* a_Value ) +inline float NetworkToHostFloat4(const void * a_Value) { - u_long buf = *(u_long*)a_Value; - buf = ntohl( buf ); - float x = 0; - memcpy( &x, &buf, sizeof(float) ); + UInt32 buf; + float x; + memcpy(&buf, a_Value, 4); + buf = ntohl(buf); + memcpy(&x, &buf, sizeof(float)); return x; } diff --git a/src/Entities/Boat.cpp b/src/Entities/Boat.cpp index 94b24c5af..921252253 100644 --- a/src/Entities/Boat.cpp +++ b/src/Entities/Boat.cpp @@ -122,5 +122,3 @@ void cBoat::HandleSpeedFromAttachee(float a_Forward, float a_Sideways) AddSpeed(ToAddSpeed); } - -
\ No newline at end of file diff --git a/src/Entities/Effects.h b/src/Entities/Effects.h index e7611847d..baf3302fb 100644 --- a/src/Entities/Effects.h +++ b/src/Entities/Effects.h @@ -27,4 +27,4 @@ enum ENUM_ENTITY_EFFECT E_EFFECT_ABSORPTION = 22, E_EFFECT_SATURATION = 23, } ; -// tolua_end
\ No newline at end of file +// tolua_end diff --git a/src/Entities/EnderCrystal.cpp b/src/Entities/EnderCrystal.cpp new file mode 100644 index 000000000..a640b236c --- /dev/null +++ b/src/Entities/EnderCrystal.cpp @@ -0,0 +1,56 @@ + +#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules + +#include "EnderCrystal.h" +#include "ClientHandle.h" +#include "Player.h" +#include "../Chunk.h" + + + + + +cEnderCrystal::cEnderCrystal(double a_X, double a_Y, double a_Z) + : cEntity(etEnderCrystal, a_X, a_Y, a_Z, 1.0, 1.0) +{ + SetMaxHealth(5); +} + + + + + +void cEnderCrystal::SpawnOn(cClientHandle & a_ClientHandle) +{ + a_ClientHandle.SendSpawnObject(*this, 51, 0, (Byte)GetYaw(), (Byte)GetPitch()); +} + + + + + +void cEnderCrystal::Tick(float a_Dt, cChunk & a_Chunk) +{ + UNUSED(a_Dt); + + a_Chunk.SetBlock(POSX_TOINT, POSY_TOINT, POSZ_TOINT, E_BLOCK_FIRE, 0); + + // No further processing (physics e.t.c.) is needed +} + + + + + +void cEnderCrystal::KilledBy(cEntity * a_Killer) +{ + super::KilledBy(a_Killer); + + m_World->DoExplosionAt(6.0, GetPosX(), GetPosY(), GetPosZ(), true, esEnderCrystal, this); + + Destroy(); +} + + + + diff --git a/src/Entities/EnderCrystal.h b/src/Entities/EnderCrystal.h new file mode 100644 index 000000000..5b86df987 --- /dev/null +++ b/src/Entities/EnderCrystal.h @@ -0,0 +1,33 @@ + +#pragma once + +#include "Entity.h" + + + + + +// tolua_begin +class cEnderCrystal : + public cEntity +{ + // tolua_end + typedef cEntity super; + +public: + CLASS_PROTODEF(cEnderCrystal); + + cEnderCrystal(double a_X, double a_Y, double a_Z); + +private: + + // cEntity overrides: + virtual void SpawnOn(cClientHandle & a_ClientHandle) override; + virtual void Tick(float a_Dt, cChunk & a_Chunk) override; + virtual void KilledBy(cEntity * a_Killer) override; + +}; // tolua_export + + + + diff --git a/src/Entities/Entity.cpp b/src/Entities/Entity.cpp index 221cbbea7..8ef45f1a5 100644 --- a/src/Entities/Entity.cpp +++ b/src/Entities/Entity.cpp @@ -1469,7 +1469,7 @@ void cEntity::SteerVehicle(float a_Forward, float a_Sideways) Vector3d cEntity::GetLookVector(void) const { Matrix4d m; - m.Init(Vector3f(), 0, m_Rot.x, -m_Rot.y); + m.Init(Vector3d(), 0, m_Rot.x, -m_Rot.y); Vector3d Look = m.Transform(Vector3d(0, 0, 1)); return Look; } diff --git a/src/Entities/Entity.h b/src/Entities/Entity.h index df80093e5..6e3f8292b 100644 --- a/src/Entities/Entity.h +++ b/src/Entities/Entity.h @@ -69,6 +69,7 @@ public: enum eEntityType { etEntity, // For all other types + etEnderCrystal, etPlayer, etPickup, etMonster, @@ -130,18 +131,19 @@ public: eEntityType GetEntityType(void) const { return m_EntityType; } - bool IsPlayer (void) const { return (m_EntityType == etPlayer); } - bool IsPickup (void) const { return (m_EntityType == etPickup); } - bool IsMob (void) const { return (m_EntityType == etMonster); } + bool IsEnderCrystal(void) const { return (m_EntityType == etEnderCrystal); } + bool IsPlayer (void) const { return (m_EntityType == etPlayer); } + bool IsPickup (void) const { return (m_EntityType == etPickup); } + bool IsMob (void) const { return (m_EntityType == etMonster); } bool IsFallingBlock(void) const { return (m_EntityType == etFallingBlock); } - bool IsMinecart (void) const { return (m_EntityType == etMinecart); } - bool IsBoat (void) const { return (m_EntityType == etBoat); } - bool IsTNT (void) const { return (m_EntityType == etTNT); } - bool IsProjectile (void) const { return (m_EntityType == etProjectile); } - bool IsExpOrb (void) const { return (m_EntityType == etExpOrb); } - bool IsFloater (void) const { return (m_EntityType == etFloater); } - bool IsItemFrame (void) const { return (m_EntityType == etItemFrame); } - bool IsPainting (void) const { return (m_EntityType == etPainting); } + bool IsMinecart (void) const { return (m_EntityType == etMinecart); } + bool IsBoat (void) const { return (m_EntityType == etBoat); } + bool IsTNT (void) const { return (m_EntityType == etTNT); } + bool IsProjectile (void) const { return (m_EntityType == etProjectile); } + bool IsExpOrb (void) const { return (m_EntityType == etExpOrb); } + bool IsFloater (void) const { return (m_EntityType == etFloater); } + bool IsItemFrame (void) const { return (m_EntityType == etItemFrame); } + bool IsPainting (void) const { return (m_EntityType == etPainting); } /// Returns true if the entity is of the specified class or a subclass (cPawn's IsA("cEntity") returns true) virtual bool IsA(const char * a_ClassName) const; @@ -157,7 +159,7 @@ public: cWorld * GetWorld(void) const { return m_World; } - double GetHeadYaw (void) const { return m_HeadYaw; } + double GetHeadYaw (void) const { return m_HeadYaw; } // In degrees double GetHeight (void) const { return m_Height; } double GetMass (void) const { return m_Mass; } const Vector3d & GetPosition (void) const { return m_Pos; } @@ -165,9 +167,9 @@ public: double GetPosY (void) const { return m_Pos.y; } double GetPosZ (void) const { return m_Pos.z; } const Vector3d & GetRot (void) const { return m_Rot; } // OBSOLETE, use individual GetYaw(), GetPitch, GetRoll() components - double GetYaw (void) const { return m_Rot.x; } - double GetPitch (void) const { return m_Rot.y; } - double GetRoll (void) const { return m_Rot.z; } + double GetYaw (void) const { return m_Rot.x; } // In degrees, [-180, +180) + double GetPitch (void) const { return m_Rot.y; } // In degrees, [-180, +180), but normal client clips to [-90, +90] + double GetRoll (void) const { return m_Rot.z; } // In degrees, unused in current client Vector3d GetLookVector(void) const; const Vector3d & GetSpeed (void) const { return m_Speed; } double GetSpeedX (void) const { return m_Speed.x; } @@ -187,9 +189,9 @@ public: void SetPosition(double a_PosX, double a_PosY, double a_PosZ); void SetPosition(const Vector3d & a_Pos) { SetPosition(a_Pos.x, a_Pos.y, a_Pos.z); } void SetRot (const Vector3f & a_Rot); // OBSOLETE, use individual SetYaw(), SetPitch(), SetRoll() components - void SetYaw (double a_Yaw); - void SetPitch (double a_Pitch); - void SetRoll (double a_Roll); + void SetYaw (double a_Yaw); // In degrees, normalizes to [-180, +180) + void SetPitch (double a_Pitch); // In degrees, normalizes to [-180, +180) + void SetRoll (double a_Roll); // In degrees, normalizes to [-180, +180) void SetSpeed (double a_SpeedX, double a_SpeedY, double a_SpeedZ); void SetSpeed (const Vector3d & a_Speed) { SetSpeed(a_Speed.x, a_Speed.y, a_Speed.z); } void SetSpeedX (double a_SpeedX); diff --git a/src/Entities/ExpOrb.h b/src/Entities/ExpOrb.h index c1150bd03..e76274ac9 100644 --- a/src/Entities/ExpOrb.h +++ b/src/Entities/ExpOrb.h @@ -42,4 +42,4 @@ protected: /** The number of ticks that the entity has existed / timer between collect and destroy; in msec */ float m_Timer; -} ; // tolua_export
\ No newline at end of file +} ; // tolua_export diff --git a/src/Entities/Floater.h b/src/Entities/Floater.h index f3b51d77b..547d503f1 100644 --- a/src/Entities/Floater.h +++ b/src/Entities/Floater.h @@ -43,4 +43,4 @@ protected: // Entity IDs int m_PlayerID; int m_AttachedMobID; -} ; // tolua_export
\ No newline at end of file +} ; // tolua_export diff --git a/src/Entities/Player.cpp b/src/Entities/Player.cpp index 863aaa799..7f2e5b4c2 100644 --- a/src/Entities/Player.cpp +++ b/src/Entities/Player.cpp @@ -1124,6 +1124,17 @@ void cPlayer::TeleportToCoords(double a_PosX, double a_PosY, double a_PosZ) +void cPlayer::SendRotation(double a_YawDegrees, double a_PitchDegrees) +{ + SetYaw(a_YawDegrees); + SetPitch(a_PitchDegrees); + m_ClientHandle->SendPlayerMoveLook(); +} + + + + + Vector3d cPlayer::GetThrowStartPos(void) const { Vector3d res = GetEyePosition(); @@ -1489,6 +1500,7 @@ bool cPlayer::MoveToWorld(const char * a_WorldName) // Add player to all the necessary parts of the new world SetWorld(World); + m_ClientHandle->StreamChunks(); World->AddEntity(this); World->AddPlayer(this); diff --git a/src/Entities/Player.h b/src/Entities/Player.h index ea32dbfb9..05377a117 100644 --- a/src/Entities/Player.h +++ b/src/Entities/Player.h @@ -129,6 +129,12 @@ public: // tolua_begin + /** Sends the "look" packet to the player, forcing them to set their rotation to the specified values. + a_YawDegrees is clipped to range [-180, +180), + a_PitchDegrees is clipped to range [-180, +180) but the client only uses [-90, +90] + */ + void SendRotation(double a_YawDegrees, double a_PitchDegrees); + /** Returns the position where projectiles thrown by this player should start, player eye position + adjustment */ Vector3d GetThrowStartPos(void) const; diff --git a/src/Entities/ProjectileEntity.cpp b/src/Entities/ProjectileEntity.cpp index f4ab825f2..e86bb48bd 100644 --- a/src/Entities/ProjectileEntity.cpp +++ b/src/Entities/ProjectileEntity.cpp @@ -4,6 +4,7 @@ // Implements the cProjectileEntity class representing the common base class for projectiles, as well as individual projectile types #include "Globals.h" +#include "../Bindings/PluginManager.h" #include "ProjectileEntity.h" #include "../ClientHandle.h" #include "Player.h" @@ -66,6 +67,11 @@ protected: eBlockFace Face; if (bb.CalcLineIntersection(Line1, Line2, LineCoeff, Face)) { + if (cPluginManager::Get()->CallHookProjectileHitBlock(*m_Projectile)) + { + return false; + } + Vector3d Intersection = Line1 + m_Projectile->GetSpeed() * LineCoeff; m_Projectile->OnHitSolidBlock(Intersection, Face); return true; @@ -147,7 +153,11 @@ public: } // TODO: Some entities don't interact with the projectiles (pickups, falling blocks) - // TODO: Allow plugins to interfere about which entities can be hit + if (cPluginManager::Get()->CallHookProjectileHitEntity(*m_Projectile, *a_Entity)) + { + // A plugin disagreed. + return false; + } if (LineCoeff < m_MinCoeff) { @@ -361,13 +371,14 @@ void cProjectileEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk) SetYawFromSpeed(); SetPitchFromSpeed(); - // DEBUG: + /* LOGD("Projectile %d: pos {%.02f, %.02f, %.02f}, speed {%.02f, %.02f, %.02f}, rot {%.02f, %.02f}", m_UniqueID, GetPosX(), GetPosY(), GetPosZ(), GetSpeedX(), GetSpeedY(), GetSpeedZ(), GetYaw(), GetPitch() ); + */ } diff --git a/src/ForEachChunkProvider.h b/src/ForEachChunkProvider.h index 6017173ee..7a6e8c5c6 100644 --- a/src/ForEachChunkProvider.h +++ b/src/ForEachChunkProvider.h @@ -24,6 +24,8 @@ class cBlockArea; class cForEachChunkProvider { public: + virtual ~cForEachChunkProvider() {} + /** Calls the callback for each chunk in the specified range. */ virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) = 0; diff --git a/src/Generating/BioGen.cpp b/src/Generating/BioGen.cpp index 967deba6a..32a687201 100644 --- a/src/Generating/BioGen.cpp +++ b/src/Generating/BioGen.cpp @@ -371,8 +371,8 @@ void cBioGenDistortedVoronoi::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::B Distort(BaseX + x * 4, BaseZ + z * 4, DistortX[4 * x][4 * z], DistortZ[4 * x][4 * z]); } - LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4); - LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4); + LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortX[0][0]); + LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortZ[0][0]); for (int z = 0; z < cChunkDef::Width; z++) { @@ -477,8 +477,8 @@ void cBioGenMultiStepMap::DecideOceanLandMushroom(int a_ChunkX, int a_ChunkZ, cC { Distort(BaseX + x * 4, BaseZ + z * 4, DistortX[4 * x][4 * z], DistortZ[4 * x][4 * z], DistortSize); } - LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4); - LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4); + LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortX[0][0]); + LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortZ[0][0]); // Prepare a 9x9 area of neighboring cell seeds // (assuming that 7x7 cell area is larger than a chunk being generated) @@ -651,8 +651,8 @@ void cBioGenMultiStepMap::BuildTemperatureHumidityMaps(int a_ChunkX, int a_Chunk HumidityMap[x + 17 * z] = NoiseH; } // for x } // for z - LinearUpscale2DArrayInPlace(TemperatureMap, 17, 17, 8, 8); - LinearUpscale2DArrayInPlace(HumidityMap, 17, 17, 8, 8); + LinearUpscale2DArrayInPlace<17, 17, 8, 8>(TemperatureMap); + LinearUpscale2DArrayInPlace<17, 17, 8, 8>(HumidityMap); // Re-map into integral values in [0 .. 255] range: for (size_t idx = 0; idx < ARRAYCOUNT(a_TemperatureMap); idx++) @@ -778,8 +778,8 @@ void cBioGenTwoLevel::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap DistortZ[4 * x][4 * z] = BlockZ + (int)(64 * NoiseZ); } - LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4); - LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4); + LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortX[0][0]); + LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortZ[0][0]); // Apply distortion to each block coord, then query the voronoi maps for biome group and biome index and choose biome based on that: for (int z = 0; z < cChunkDef::Width; z++) diff --git a/src/Generating/ChunkDesc.cpp b/src/Generating/ChunkDesc.cpp index 308fbe423..7711723fc 100644 --- a/src/Generating/ChunkDesc.cpp +++ b/src/Generating/ChunkDesc.cpp @@ -343,9 +343,9 @@ void cChunkDesc::ReadBlockArea(cBlockArea & a_Dest, int a_MinRelX, int a_MaxRelX int SizeY = a_MaxRelY - a_MinRelY; int SizeZ = a_MaxRelZ - a_MinRelZ; a_Dest.Clear(); - a_Dest.m_OriginX = m_ChunkX * cChunkDef::Width + a_MinRelX; - a_Dest.m_OriginY = a_MinRelY; - a_Dest.m_OriginZ = m_ChunkZ * cChunkDef::Width + a_MinRelZ; + a_Dest.m_Origin.x = m_ChunkX * cChunkDef::Width + a_MinRelX; + a_Dest.m_Origin.y = a_MinRelY; + a_Dest.m_Origin.z = m_ChunkZ * cChunkDef::Width + a_MinRelZ; a_Dest.SetSize(SizeX, SizeY, SizeZ, cBlockArea::baTypes | cBlockArea::baMetas); for (int y = 0; y < SizeY; y++) diff --git a/src/Generating/CompoGen.cpp b/src/Generating/CompoGen.cpp index 60356fe46..578bb2481 100644 --- a/src/Generating/CompoGen.cpp +++ b/src/Generating/CompoGen.cpp @@ -566,7 +566,7 @@ void cCompoGenNether::ComposeTerrain(cChunkDesc & a_ChunkDesc) m_Noise2.IntNoise3DInt(BaseX + INTERPOL_X * x, 0, BaseZ + INTERPOL_Z * z) / 256; } // for x, z - FloorLo[] - LinearUpscale2DArrayInPlace(FloorLo, 17, 17, INTERPOL_X, INTERPOL_Z); + LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorLo); // Interpolate segments: for (int Segment = 0; Segment < MaxHeight; Segment += SEGMENT_HEIGHT) @@ -579,7 +579,7 @@ void cCompoGenNether::ComposeTerrain(cChunkDesc & a_ChunkDesc) m_Noise2.IntNoise3DInt(BaseX + INTERPOL_Z * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) / 256; } // for x, z - FloorLo[] - LinearUpscale2DArrayInPlace(FloorHi, 17, 17, INTERPOL_X, INTERPOL_Z); + LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorHi); // Interpolate between FloorLo and FloorHi: for (int z = 0; z < 16; z++) for (int x = 0; x < 16; x++) diff --git a/src/Generating/ComposableGenerator.cpp b/src/Generating/ComposableGenerator.cpp index 6c00b5905..2e886336f 100644 --- a/src/Generating/ComposableGenerator.cpp +++ b/src/Generating/ComposableGenerator.cpp @@ -21,6 +21,7 @@ #include "DistortedHeightmap.h" #include "EndGen.h" #include "MineShafts.h" +#include "NetherFortGen.h" #include "Noise3DGenerator.h" #include "POCPieceGenerator.h" #include "Ravines.h" @@ -191,9 +192,11 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a m_HeightGen->GenHeightMap(a_ChunkX, a_ChunkZ, a_ChunkDesc.GetHeightMap()); } + bool ShouldUpdateHeightmap = false; if (a_ChunkDesc.IsUsingDefaultComposition()) { m_CompositionGen->ComposeTerrain(a_ChunkDesc); + ShouldUpdateHeightmap = true; } if (a_ChunkDesc.IsUsingDefaultFinish()) @@ -202,6 +205,12 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a { (*itr)->GenFinish(a_ChunkDesc); } // for itr - m_FinishGens[] + ShouldUpdateHeightmap = true; + } + + if (ShouldUpdateHeightmap) + { + a_ChunkDesc.UpdateHeightmap(); } } @@ -349,7 +358,7 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) int ChanceCrossing = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceCrossing", 200); int ChanceStaircase = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceStaircase", 200); m_FinishGens.push_back(new cStructGenMineShafts( - Seed, GridSize, MaxSystemSize, + Seed, GridSize, MaxSystemSize, ChanceCorridor, ChanceCrossing, ChanceStaircase )); } @@ -361,6 +370,12 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) { m_FinishGens.push_back(new cFinishGenNetherClumpFoliage(Seed)); } + else if (NoCaseCompare(*itr, "NetherForts") == 0) + { + int GridSize = a_IniFile.GetValueSetI("Generator", "NetherFortsGridSize", 512); + int MaxDepth = a_IniFile.GetValueSetI("Generator", "NetherFortsMaxDepth", 12); + m_FinishGens.push_back(new cNetherFortGen(Seed, GridSize, MaxDepth)); + } else if (NoCaseCompare(*itr, "OreNests") == 0) { m_FinishGens.push_back(new cStructGenOreNests(Seed)); diff --git a/src/Generating/HeiGen.cpp b/src/Generating/HeiGen.cpp index 10710b4a1..3621421c2 100644 --- a/src/Generating/HeiGen.cpp +++ b/src/Generating/HeiGen.cpp @@ -428,7 +428,7 @@ void cHeiGenBiomal::GenHeightMap(int a_ChunkX, int a_ChunkZ, cChunkDef::HeightMa Height[x + 17 * z] = GetHeightAt(x, z, a_ChunkX, a_ChunkZ, Biomes); } } - LinearUpscale2DArrayInPlace(Height, 17, 17, STEPX, STEPZ); + LinearUpscale2DArrayInPlace<17, 17, STEPX, STEPZ>(Height); // Copy into the heightmap for (int z = 0; z < cChunkDef::Width; z++) diff --git a/src/Generating/MineShafts.cpp b/src/Generating/MineShafts.cpp index 28dc37567..231295c3f 100644 --- a/src/Generating/MineShafts.cpp +++ b/src/Generating/MineShafts.cpp @@ -1340,7 +1340,7 @@ void cStructGenMineShafts::GetMineShaftSystemsForChunk( BaseX -= NEIGHBORHOOD_SIZE / 2; BaseZ -= NEIGHBORHOOD_SIZE / 2; - // Walk the cache, move each cave system that we want into a_Caves: + // Walk the cache, move each cave system that we want into a_Mineshafts: int StartX = BaseX * m_GridSize; int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize; int StartZ = BaseZ * m_GridSize; diff --git a/src/Generating/NetherFortGen.cpp b/src/Generating/NetherFortGen.cpp new file mode 100644 index 000000000..02779a8a3 --- /dev/null +++ b/src/Generating/NetherFortGen.cpp @@ -0,0 +1,275 @@ + +// NetherFortGen.cpp + +// Implements the cNetherFortGen class representing the nether fortress generator + +#include "Globals.h" +#include "NetherFortGen.h" +#include "Prefabs/NetherFortPrefabs.h" + + + + + +static const int NEIGHBORHOOD_SIZE = 3; + + + + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// cNetherFortGen::cNetherFort: + +class cNetherFortGen::cNetherFort +{ +public: + cNetherFortGen & m_ParentGen; + int m_BlockX, m_BlockZ; + int m_GridSize; + int m_Seed; + cPlacedPieces m_Pieces; + + + cNetherFort(cNetherFortGen & a_ParentGen, int a_BlockX, int a_BlockZ, int a_GridSize, int a_MaxDepth, int a_Seed) : + m_ParentGen(a_ParentGen), + m_BlockX(a_BlockX), + m_BlockZ(a_BlockZ), + m_GridSize(a_GridSize), + m_Seed(a_Seed) + { + // TODO: Proper Y-coord placement + int BlockY = 64; + + // Generate pieces: + for (int i = 0; m_Pieces.size() < (size_t)(a_MaxDepth * a_MaxDepth / 8 + a_MaxDepth); i++) + { + cBFSPieceGenerator pg(m_ParentGen, a_Seed + i); + pg.PlacePieces(a_BlockX, BlockY, a_BlockZ, a_MaxDepth, m_Pieces); + } + } + + + ~cNetherFort() + { + cPieceGenerator::FreePieces(m_Pieces); + } + + + /** Carves the system into the chunk data */ + void ProcessChunk(cChunkDesc & a_Chunk) + { + for (cPlacedPieces::const_iterator itr = m_Pieces.begin(), end = m_Pieces.end(); itr != end; ++itr) + { + const cPrefab & Prefab = (const cPrefab &)((*itr)->GetPiece()); + Prefab.Draw(a_Chunk, *itr); + } // for itr - m_PlacedPieces[] + } +}; + + + + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// cNetherFortGen: + +cNetherFortGen::cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth) : + m_Seed(a_Seed), + m_Noise(a_Seed), + m_GridSize(a_GridSize), + m_MaxDepth(a_MaxDepth) +{ + // Initialize the prefabs: + for (size_t i = 0; i < g_NetherFortPrefabs1Count; i++) + { + cPrefab * Prefab = new cPrefab(g_NetherFortPrefabs1[i]); + m_AllPieces.push_back(Prefab); + if (Prefab->HasConnectorType(0)) + { + m_OuterPieces.push_back(Prefab); + } + if (Prefab->HasConnectorType(1)) + { + m_InnerPieces.push_back(Prefab); + } + } + + // Initialize the starting piece prefabs: + for (size_t i = 0; i < g_NetherFortStartingPrefabs1Count; i++) + { + m_StartingPieces.push_back(new cPrefab(g_NetherFortStartingPrefabs1[i])); + } + + // DEBUG: Try one round of placement: + cPlacedPieces Pieces; + cBFSPieceGenerator pg(*this, a_Seed); + pg.PlacePieces(0, 64, 0, a_MaxDepth, Pieces); +} + + + + + +cNetherFortGen::~cNetherFortGen() +{ + ClearCache(); + for (cPieces::iterator itr = m_AllPieces.begin(), end = m_AllPieces.end(); itr != end; ++itr) + { + delete *itr; + } // for itr - m_AllPieces[] + m_AllPieces.clear(); +} + + + + + +void cNetherFortGen::ClearCache(void) +{ + // TODO +} + + + + + +void cNetherFortGen::GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts) +{ + int BaseX = a_ChunkX * cChunkDef::Width / m_GridSize; + int BaseZ = a_ChunkZ * cChunkDef::Width / m_GridSize; + if (BaseX < 0) + { + --BaseX; + } + if (BaseZ < 0) + { + --BaseZ; + } + BaseX -= NEIGHBORHOOD_SIZE / 2; + BaseZ -= NEIGHBORHOOD_SIZE / 2; + + // Walk the cache, move each cave system that we want into a_Forts: + int StartX = BaseX * m_GridSize; + int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize; + int StartZ = BaseZ * m_GridSize; + int EndZ = (BaseZ + NEIGHBORHOOD_SIZE + 1) * m_GridSize; + for (cNetherForts::iterator itr = m_Cache.begin(), end = m_Cache.end(); itr != end;) + { + if ( + ((*itr)->m_BlockX >= StartX) && ((*itr)->m_BlockX < EndX) && + ((*itr)->m_BlockZ >= StartZ) && ((*itr)->m_BlockZ < EndZ) + ) + { + // want + a_Forts.push_back(*itr); + itr = m_Cache.erase(itr); + } + else + { + // don't want + ++itr; + } + } // for itr - m_Cache[] + + // Create those forts that haven't been in the cache: + for (int x = 0; x < NEIGHBORHOOD_SIZE; x++) + { + int RealX = (BaseX + x) * m_GridSize; + for (int z = 0; z < NEIGHBORHOOD_SIZE; z++) + { + int RealZ = (BaseZ + z) * m_GridSize; + bool Found = false; + for (cNetherForts::const_iterator itr = a_Forts.begin(), end = a_Forts.end(); itr != end; ++itr) + { + if (((*itr)->m_BlockX == RealX) && ((*itr)->m_BlockZ == RealZ)) + { + Found = true; + break; + } + } // for itr - a_Mineshafts + if (!Found) + { + a_Forts.push_back(new cNetherFort(*this, RealX, RealZ, m_GridSize, m_MaxDepth, m_Seed)); + } + } // for z + } // for x + + // Copy a_Forts into m_Cache to the beginning: + cNetherForts FortsCopy (a_Forts); + m_Cache.splice(m_Cache.begin(), FortsCopy, FortsCopy.begin(), FortsCopy.end()); + + // Trim the cache if it's too long: + if (m_Cache.size() > 100) + { + cNetherForts::iterator itr = m_Cache.begin(); + std::advance(itr, 100); + for (cNetherForts::iterator end = m_Cache.end(); itr != end; ++itr) + { + delete *itr; + } + itr = m_Cache.begin(); + std::advance(itr, 100); + m_Cache.erase(itr, m_Cache.end()); + } +} + + + + + +void cNetherFortGen::GenFinish(cChunkDesc & a_ChunkDesc) +{ + int ChunkX = a_ChunkDesc.GetChunkX(); + int ChunkZ = a_ChunkDesc.GetChunkZ(); + cNetherForts Forts; + GetFortsForChunk(ChunkX, ChunkZ, Forts); + for (cNetherForts::const_iterator itr = Forts.begin(); itr != Forts.end(); ++itr) + { + (*itr)->ProcessChunk(a_ChunkDesc); + } // for itr - Forts[] +} + + + + + +cPieces cNetherFortGen::GetPiecesWithConnector(int a_ConnectorType) +{ + switch (a_ConnectorType) + { + case 0: return m_OuterPieces; + case 1: return m_InnerPieces; + default: return cPieces(); + } +} + + + + + +cPieces cNetherFortGen::GetStartingPieces(void) +{ + return m_StartingPieces; +} + + + + + +void cNetherFortGen::PiecePlaced(const cPiece & a_Piece) +{ + UNUSED(a_Piece); +} + + + + + +void cNetherFortGen::Reset(void) +{ + // Nothing needed +} + + + + diff --git a/src/Generating/NetherFortGen.h b/src/Generating/NetherFortGen.h new file mode 100644 index 000000000..10ba01396 --- /dev/null +++ b/src/Generating/NetherFortGen.h @@ -0,0 +1,86 @@ + +// NetherFortGen.h + +// Declares the cNetherFortGen class representing the nether fortress generator + + + + + +#pragma once + +#include "ComposableGenerator.h" +#include "PieceGenerator.h" + + + + + +class cNetherFortGen : + public cFinishGen, + public cPiecePool +{ +public: + cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth); + + virtual ~cNetherFortGen(); + +protected: + class cNetherFort; // fwd: NetherFortGen.cpp + typedef std::list<cNetherFort *> cNetherForts; + + + /** The seed used for generating*/ + int m_Seed; + + /** The noise used for generating */ + cNoise m_Noise; + + /** Average spacing between the fortresses*/ + int m_GridSize; + + /** Maximum depth of the piece-generator tree */ + int m_MaxDepth; + + /** Cache of the most recently used systems. MoveToFront used. */ + cNetherForts m_Cache; + + /** All the pieces that are allowed for building. + This is the list that's used for memory allocation and deallocation for the pieces. */ + cPieces m_AllPieces; + + /** The pieces that are used as starting pieces. + This list is not shared and the pieces need deallocation. */ + cPieces m_StartingPieces; + + /** The pieces that have an "outer" connector. + The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */ + cPieces m_OuterPieces; + + /** The pieces that have an "inner" connector. + The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */ + cPieces m_InnerPieces; + + + /** Clears everything from the cache. + Also invalidates the forst returned by GetFortsForChunk(). */ + void ClearCache(void); + + /** Returns all forts that *may* intersect the given chunk. + The returned forts live within m_Cache.They are valid until the next call + to this function (which may delete some of the pointers). */ + void GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts); + + // cFinishGen overrides: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; + + // cPiecePool overrides: + virtual cPieces GetPiecesWithConnector(int a_ConnectorType) override; + virtual cPieces GetStartingPieces(void) override; + virtual void PiecePlaced(const cPiece & a_Piece) override; + virtual void Reset(void) override; +} ; + + + + diff --git a/src/Generating/Noise3DGenerator.cpp b/src/Generating/Noise3DGenerator.cpp index afa40c647..15a588d45 100644 --- a/src/Generating/Noise3DGenerator.cpp +++ b/src/Generating/Noise3DGenerator.cpp @@ -420,7 +420,7 @@ void cNoise3DComposable::GenerateNoiseArrayIfNeeded(int a_ChunkX, int a_ChunkZ) } } // Linear-interpolate this XZ floor: - LinearUpscale2DArrayInPlace(CurFloor, 17, 17, UPSCALE_X, UPSCALE_Z); + LinearUpscale2DArrayInPlace<17, 17, UPSCALE_X, UPSCALE_Z>(CurFloor); } // Finish the 3D linear interpolation by interpolating between each XZ-floors on the Y axis diff --git a/src/Generating/Prefab.cpp b/src/Generating/Prefab.cpp new file mode 100644 index 000000000..131b6acb2 --- /dev/null +++ b/src/Generating/Prefab.cpp @@ -0,0 +1,316 @@ + +// Prefab.cpp + +/* +Implements the cPrefab class, representing a cPiece descendant for the cPieceGenerator that +uses a prefabricate in a cBlockArea for drawing itself. +*/ + +#include "Globals.h" +#include "Prefab.h" +#include "../WorldStorage/SchematicFileSerializer.h" +#include "ChunkDesc.h" + + + + + +#ifdef SELF_TEST + +// Create one static prefab to test the parser: +static const cPrefab::sDef g_TestPrefabDef = +{ + // Size: + 7, 6, 7, // SizeX = 7, SizeY = 6, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* 0 */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + + // Level 2 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 3 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 4 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 5 + "aabbbaa" + "a.....a" + "b.....b" + "b.....b" + "b.....b" + "a.....a" + "aabbbaa" + + // Level 6 + "aaaaaaa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "aaaaaaa", + + // Connections: + "0: 0, 3, 2: 4\n" + "0: 2, 3, 0: 2\n", + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msImprint +}; + +static cPrefab g_TestPrefab(g_TestPrefabDef); +#endif + + + + + +cPrefab::cPrefab(const cPrefab::sDef & a_Def) : + m_Size(a_Def.m_SizeX, a_Def.m_SizeY, a_Def.m_SizeZ), + m_HitBox(0, 0, 0, a_Def.m_SizeX - 1, a_Def.m_SizeY - 1, a_Def.m_SizeZ - 1), + m_AllowedRotations(a_Def.m_AllowedRotations), + m_MergeStrategy(a_Def.m_MergeStrategy) +{ + m_BlockArea[0].Create(m_Size); + CharMap cm; + ParseCharMap(cm, a_Def.m_CharMap); + ParseBlockImage(cm, a_Def.m_Image); + ParseConnectors(a_Def.m_Connectors); + + // 1 CCW rotation: + if ((m_AllowedRotations & 0x01) != 0) + { + m_BlockArea[1].CopyFrom(m_BlockArea[0]); + m_BlockArea[1].RotateCCW(); + } + + // 2 rotations are the same as mirroring twice; mirroring is faster because it has no reallocations + if ((m_AllowedRotations & 0x02) != 0) + { + m_BlockArea[2].CopyFrom(m_BlockArea[0]); + m_BlockArea[2].MirrorXY(); + m_BlockArea[2].MirrorYZ(); + } + + // 3 CCW rotations = 1 CW rotation: + if ((m_AllowedRotations & 0x04) != 0) + { + m_BlockArea[3].CopyFrom(m_BlockArea[0]); + m_BlockArea[3].RotateCW(); + } +} + + + + + +void cPrefab::Draw(cChunkDesc & a_Dest, const cPlacedPiece * a_Placement) const +{ + Vector3i Placement = a_Placement->GetCoords(); + int ChunkStartX = a_Dest.GetChunkX() * cChunkDef::Width; + int ChunkStartZ = a_Dest.GetChunkZ() * cChunkDef::Width; + Placement.Move(-ChunkStartX, 0, -ChunkStartZ); + a_Dest.WriteBlockArea(m_BlockArea[a_Placement->GetNumCCWRotations()], Placement.x, Placement.y, Placement.z, m_MergeStrategy); + +} + + + + + +bool cPrefab::HasConnectorType(int a_ConnectorType) const +{ + for (cConnectors::const_iterator itr = m_Connectors.begin(), end = m_Connectors.end(); itr != end; ++itr) + { + if (itr->m_Type == a_ConnectorType) + { + return true; + } + } // for itr - m_Connectors[] + return false; +} + + + + + +void cPrefab::ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef) +{ + ASSERT(a_CharMapDef != NULL); + + // Initialize the charmap to all-invalid values: + for (size_t i = 0; i < ARRAYCOUNT(a_CharMapOut); i++) + { + a_CharMapOut[i].m_BlockType = 0; + a_CharMapOut[i].m_BlockMeta = 16; // Mark unassigned entries with a meta that is impossible otherwise + } + + // Process the lines in the definition: + AStringVector Lines = StringSplitAndTrim(a_CharMapDef, "\n"); + for (AStringVector::const_iterator itr = Lines.begin(), end = Lines.end(); itr != end; ++itr) + { + AStringVector CharDef = StringSplitAndTrim(*itr, ":"); + size_t NumElements = CharDef.size(); + if ((NumElements < 2) || CharDef[0].empty() || CharDef[1].empty()) + { + LOGWARNING("Bad prefab CharMap definition line: \"%s\", skipping.", itr->c_str()); + continue; + } + unsigned char Src = (unsigned char)CharDef[0][0]; + ASSERT(a_CharMapOut[Src].m_BlockMeta == 16); // This letter has not been assigned yet? + a_CharMapOut[Src].m_BlockType = (BLOCKTYPE)atoi(CharDef[1].c_str()); + NIBBLETYPE BlockMeta = 0; + if ((NumElements >= 3) && !CharDef[2].empty()) + { + BlockMeta = (NIBBLETYPE)atoi(CharDef[2].c_str()); + ASSERT((BlockMeta >= 0) && (BlockMeta <= 15)); + } + a_CharMapOut[Src].m_BlockMeta = BlockMeta; + } // for itr - Lines[] +} + + + + + +void cPrefab::ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockImage) +{ + // Map each letter in the a_BlockImage (from the in-source definition) to real blocktype / blockmeta: + for (int y = 0; y < m_Size.y; y++) + { + for (int z = 0; z < m_Size.z; z++) + { + const unsigned char * BlockImage = (const unsigned char *)a_BlockImage + y * m_Size.x * m_Size.z + z * m_Size.x; + for (int x = 0; x < m_Size.x; x++) + { + const sBlockTypeDef & MappedValue = a_CharMap[BlockImage[x]]; + ASSERT(MappedValue.m_BlockMeta != 16); // Using a letter not defined in the CharMap? + m_BlockArea[0].SetRelBlockTypeMeta(x, y, z, MappedValue.m_BlockType, MappedValue.m_BlockMeta); + } + } + } +} + + + + + +void cPrefab::ParseConnectors(const char * a_ConnectorsDef) +{ + ASSERT(a_ConnectorsDef != NULL); + + AStringVector Lines = StringSplitAndTrim(a_ConnectorsDef, "\n"); + for (AStringVector::const_iterator itr = Lines.begin(), end = Lines.end(); itr != end; ++itr) + { + if (itr->empty()) + { + continue; + } + // Split into components: "Type: X, Y, Z: Face": + AStringVector Defs = StringSplitAndTrim(*itr, ":"); + if (Defs.size() != 3) + { + LOGWARNING("Bad prefab Connector definition line: \"%s\", skipping.", itr->c_str()); + continue; + } + AStringVector Coords = StringSplitAndTrim(Defs[1], ","); + if (Coords.size() != 3) + { + LOGWARNING("Bad prefab Connector coords definition: \"%s\", skipping.", Defs[1].c_str()); + continue; + } + + // Check that the BlockFace is within range: + int BlockFace = atoi(Defs[2].c_str()); + if ((BlockFace < 0) || (BlockFace >= 6)) + { + LOGWARNING("Bad prefab Connector Blockface: \"%s\", skipping.", Defs[2].c_str()); + continue; + } + + // Add the connector: + m_Connectors.push_back(cPiece::cConnector( + atoi(Coords[0].c_str()), atoi(Coords[1].c_str()), atoi(Coords[2].c_str()), // Connector pos + atoi(Defs[0].c_str()), // Connector type + (eBlockFace)BlockFace + )); + } // for itr - Lines[] +} + + + + + +cPiece::cConnectors cPrefab::GetConnectors(void) const +{ + return m_Connectors; +} + + + + + +Vector3i cPrefab::GetSize(void) const +{ + return m_Size; +} + + + + + +cCuboid cPrefab::GetHitBox(void) const +{ + return m_HitBox; +} + + + + + +bool cPrefab::CanRotateCCW(int a_NumRotations) const +{ + // Either zero rotations + // Or the proper bit in m_AllowedRotations is set + return (a_NumRotations == 0) || ((m_AllowedRotations & (1 << ((a_NumRotations + 3) % 4))) != 0); +} + + + + diff --git a/src/Generating/Prefab.h b/src/Generating/Prefab.h new file mode 100644 index 000000000..04c4f09da --- /dev/null +++ b/src/Generating/Prefab.h @@ -0,0 +1,105 @@ + +// Prefab.h + +/* +Declares the cPrefab class, representing a cPiece descendant for the cPieceGenerator that +uses a prefabricate in a cBlockArea for drawing itself. +The class can be constructed from data that is stored directly in the executable, in a sPrefabDef structure +declared in this file as well; the Gallery server exports areas in this format. +*/ + + + + + +#pragma once + +#include "PieceGenerator.h" +#include "../BlockArea.h" + + + + + +// fwd: +class cChunkDesc; + + + + + +class cPrefab : + public cPiece +{ +public: + struct sDef + { + int m_SizeX; + int m_SizeY; + int m_SizeZ; + const char * m_CharMap; + const char * m_Image; + const char * m_Connectors; + int m_AllowedRotations; + cBlockArea::eMergeStrategy m_MergeStrategy; + }; + + cPrefab(const sDef & a_Def); + + /** Draws the prefab into the specified chunk, according to the placement stored in the PlacedPiece. */ + void Draw(cChunkDesc & a_Dest, const cPlacedPiece * a_Placement) const; + + /** Returns true if the prefab has any connector of the specified type. */ + bool HasConnectorType(int a_ConnectorType) const; + +protected: + /** Packs complete definition of a single block, for per-letter assignment. */ + struct sBlockTypeDef + { + BLOCKTYPE m_BlockType; + NIBBLETYPE m_BlockMeta; + }; + + /** Maps letters in the sDef::m_Image onto a number, BlockType * 16 | BlockMeta */ + typedef sBlockTypeDef CharMap[256]; + + + /** The cBlockArea that contains the block definitions for the prefab. + The index identifies the number of CCW rotations applied (0 = no rotation, 1 = 1 CCW rotation, ...). */ + cBlockArea m_BlockArea[4]; + + /** The size of the prefab */ + Vector3i m_Size; + + /** The hitbox of the prefab. In first version is the same as the m_BlockArea dimensions */ + cCuboid m_HitBox; + + /** The connectors through which the piece connects to other pieces */ + cConnectors m_Connectors; + + /** Bitmask, bit N set -> N rotations CCW supported */ + int m_AllowedRotations; + + /** The merge strategy to use when drawing the prefab into a block area */ + cBlockArea::eMergeStrategy m_MergeStrategy; + + + // cPiece overrides: + virtual cConnectors GetConnectors(void) const override; + virtual Vector3i GetSize(void) const override; + virtual cCuboid GetHitBox(void) const override; + virtual bool CanRotateCCW(int a_NumRotations) const override; + + /** Parses the CharMap in the definition into a CharMap binary data used for translating the definition into BlockArea. */ + void ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef); + + /** Parses the Image in the definition into m_BlockArea[0]'s block types and metas, using the specified CharMap. */ + void ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockImage); + + /** Parses the connectors definition text into m_Connectors member. */ + void ParseConnectors(const char * a_ConnectorsDef); +}; + + + + diff --git a/src/Generating/Prefabs/CMakeLists.txt b/src/Generating/Prefabs/CMakeLists.txt new file mode 100644 index 000000000..1e60447e7 --- /dev/null +++ b/src/Generating/Prefabs/CMakeLists.txt @@ -0,0 +1,13 @@ + +cmake_minimum_required (VERSION 2.6) +project (MCServer) + +include_directories ("${PROJECT_SOURCE_DIR}/../../") + +file(GLOB SOURCE + "*.cpp" +) + +add_library(Generating_Prefabs ${SOURCE}) + +target_link_libraries(Generating_Prefabs OSSupport iniFile Blocks) diff --git a/src/Generating/Prefabs/NetherFortPrefabs.cpp b/src/Generating/Prefabs/NetherFortPrefabs.cpp new file mode 100644 index 000000000..5e8685e32 --- /dev/null +++ b/src/Generating/Prefabs/NetherFortPrefabs.cpp @@ -0,0 +1,2758 @@ + +// NetherFortPrefabs.cpp + +// Defines all the prefabs for nether forts + +#include "Globals.h" +#include "NetherFortPrefabs.h" + + + + + +/* +The nether fortress has two types of connectors, Outer and Inner. Outer is Type 0, Inner is Type 1. +*/ + + + + + +const cPrefab::sDef g_NetherFortPrefabs1[] = +{ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BalconyCorridor: + // The data has been exported from gallery Nether, area index 37, ID 288 + { + // Size: + 13, 7, 9, // SizeX = 13, SizeY = 7, SizeZ = 9 + + // Block definitions: + "a:112: 0\n" /* netherbrick */ + "b: 19: 0\n" /* sponge */ + "c:114: 4\n" /* netherbrickstairs */ + "d:114: 7\n" /* netherbrickstairs */ + "e:114: 5\n" /* netherbrickstairs */ + "f: 44: 6\n" /* step */ + "g:113: 0\n" /* netherbrickfence */ + "h:114: 2\n" /* netherbrickstairs */ + "i:114: 3\n" /* netherbrickstairs */ + "j:114: 0\n" /* netherbrickstairs */ + "k:114: 1\n" /* netherbrickstairs */ + ".: 0: 0\n" /* air */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "bbbbaaaaabbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + + // Level 2 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaa.aaa.aaaa" + "bbcdaaaaadebb" + "bbbcdddddebbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + + // Level 3 + "aaaaaaaaaaaaa" + "............." + "............." + "............." + "aaaa.fff.aaaa" + "bbaaaaaaaaabb" + "bbaaaaaaaaabb" + "bbaaaaaaaaabb" + "bbaaaaaaaaabb" + + // Level 4 + "agagagagagaga" + "............." + "............." + "............." + "agaa.....aaga" + "bbaaa...aaabb" + "bbg.......gbb" + "bbg.......gbb" + "bbgggggggggbb" + + // Level 5 + "agagagagagaga" + "............." + "............." + "............." + "agaa.....aaga" + "bbaaa...aaabb" + "bb.........bb" + "bb.........bb" + "bb.........bb" + + // Level 6 + "agagagagagaga" + "............." + "............." + "............." + "agaa.....aaga" + "bbaaa...aaabb" + "bb.........bb" + "bb.........bb" + "bb.........bb" + + // Level 7 + "hhhhhhhhhhhhh" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "iijaaaaaaaiii" + "bbjiiiiiiikbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb", + + // Connections: + "1: 0, 2, 2: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 2, 2: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BalconyCorridor + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BalconyTee2: + // The data has been exported from gallery Nether, area index 38, ID 289 + { + // Size: + 13, 7, 11, // SizeX = 13, SizeY = 7, SizeZ = 11 + + // Block definitions: + "a: 19: 0\n" /* sponge */ + "b:112: 0\n" /* netherbrick */ + "c:114: 4\n" /* netherbrickstairs */ + "d:114: 7\n" /* netherbrickstairs */ + "e:114: 5\n" /* netherbrickstairs */ + "f: 44: 6\n" /* step */ + "g:113: 0\n" /* netherbrickfence */ + "h:114: 0\n" /* netherbrickstairs */ + "i:114: 1\n" /* netherbrickstairs */ + "j:114: 2\n" /* netherbrickstairs */ + "k:114: 3\n" /* netherbrickstairs */ + ".: 0: 0\n" /* air */, + + // Block data: + // Level 1 + "aaaabbbbbaaaa" + "aaaabbbbbaaaa" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "aaaabbbbbaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "aaaabbbbbaaaa" + "aaaabbbbbaaaa" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbb.bbb.bbbb" + "aacdbbbbbdeaa" + "aaacdddddeaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 3 + "aaaab...baaaa" + "aaaab...baaaa" + "bbbbb...bbbbb" + "............." + "............." + "............." + "bbbb.fff.bbbb" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + + // Level 4 + "aaaab...baaaa" + "aaaag...gaaaa" + "bgbgb...bgbgb" + "............." + "............." + "............." + "bgbb.....bbgb" + "aabbb...bbbaa" + "aag.......gaa" + "aag.......gaa" + "aagggggggggaa" + + // Level 5 + "aaaab...baaaa" + "aaaag...gaaaa" + "bgbgb...bgbgb" + "............." + "............." + "............." + "bgbb.....bbgb" + "aabbb...bbbaa" + "aa.........aa" + "aa.........aa" + "aa.........aa" + + // Level 6 + "aaaab...baaaa" + "aaaag...gaaaa" + "bgbgb...bgbgb" + "............." + "............." + "............." + "bgbb.....bbgb" + "aabbb...bbbaa" + "aa.........aa" + "aa.........aa" + "aa.........aa" + + // Level 7 + "aaaahbbbiaaaa" + "aaaahbbbiaaaa" + "jjjjjbbbjjjjj" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "kkhbbbbbbbkkk" + "aahkkkkkkkiaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa", + + // Connections: + "1: 0, 2, 4: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 2, 4: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 6, 2, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BalconyTee2 + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BlazePlatform + // The data has been exported from gallery Nether, area index 26, ID 276 + { + // Size: + 10, 7, 7, // SizeX = 10, SizeY = 7, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b: 52: 0\n" /* mobspawner */ + "c:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + ".........." + "aaaaaaaaaa" + "aaaaaaaaaa" + "aaaaaaaaaa" + "aaaaaaaaaa" + "aaaaaaaaaa" + ".........." + + // Level 2 + ".........." + "aaaaaaaaaa" + "..aaaaaaaa" + "..aaaaaaaa" + "..aaaaaaaa" + "aaaaaaaaaa" + ".........." + + // Level 3 + "....aaaaaa" + "aaaaaaaaaa" + "...aaaaaaa" + "...aaaaaaa" + "...aaaaaaa" + "aaaaaaaaaa" + "....aaaaaa" + + // Level 4 + "....aaaaaa" + "..aaa....a" + ".........a" + "......b..a" + ".........a" + "..aaa....a" + "....aaaaaa" + + // Level 5 + "....cccccc" + "...cc....c" + ".........c" + ".........c" + ".........c" + "...cc....c" + "....cccccc" + + // Level 6 + ".........." + ".........c" + ".........c" + ".........c" + ".........c" + ".........c" + ".........." + + // Level 7 + ".........." + ".........." + ".........c" + ".........c" + ".........c" + ".........." + "..........", + + // Connections: + "0: 0, 1, 3: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BlazePlatform + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BlazePlatformOverhang: + // The data has been exported from gallery Nether, area index 20, ID 162 + { + // Size: + 14, 9, 7, // SizeX = 14, SizeY = 9, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c: 44:14\n" /* step */ + "d:114: 6\n" /* netherbrickstairs */ + "e:114: 7\n" /* netherbrickstairs */ + "f:114: 0\n" /* netherbrickstairs */ + "g:114: 4\n" /* netherbrickstairs */ + "h:113: 0\n" /* netherbrickfence */ + "i: 52: 0\n" /* mobspawner */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "aammmmmmmmmmmm" + "aammmmmmmmmmmm" + "aammmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + + // Level 2 + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "aabcmmmmmmmmmm" + "aabcmmmmmmmmmm" + "aabcmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + + // Level 3 + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "aaaaabmmmmmmmm" + "aaaaabmmmmmmmm" + "aaaaabmmmmmmmm" + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + + // Level 4 + "mmmmmmmmmmmmmm" + "dddddddmmmmmmm" + "aaaaaabmmmmmmm" + "aaaaaabmmmmmmm" + "aaaaaabmmmmmmm" + "eeeeeeemmmmmmm" + "mmmmmmmmmmmmmm" + + // Level 5 + "mmmmmmmmmmmmmm" + "aaaaaaadmmmmmm" + "aaaaaaabmmmmmm" + "aaaaaaabmmmmmm" + "aaaaaaabmmmmmm" + "aaaaaaaemmmmmm" + "mmmmmmmmmmmmmm" + + // Level 6 + "mmmmmmmmmmmmmm" + "aaaaaaaabddddm" + "......faaaaabm" + "......faaaaabm" + "......faaaaabm" + "aaaaaaaaabeebm" + "mmmmmmmmmmmmmm" + + // Level 7 + "mmmmmmmmgdddbm" + "......aaaaaaad" + ".......faaaaab" + ".......faaaaab" + ".......faaaaab" + "......aaaaaaae" + "mmmmmmmmgeeebm" + + // Level 8 + "mmmmmmmmaaaaam" + "......haa...aa" + ".............a" + "..........i..a" + ".............a" + "......haa...aa" + "mmmmmmmmaaaaam" + + // Level 9 + "mmmmmmmmhhhhhm" + "......hhh...hh" + ".............h" + ".............h" + ".............h" + "......hhh...hh" + "mmmmmmmmhhhhhm", + + // Connections: + "0: 0, 5, 3: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BlazePlatformOverhang + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BridgeCrossing: + // The data has been exported from gallery Nether, area index 17, ID 159 + { + // Size: + 15, 8, 15, // SizeX = 15, SizeY = 8, SizeZ = 15 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 7\n" /* netherbrickstairs */ + "c:114: 5\n" /* netherbrickstairs */ + "d:114: 4\n" /* netherbrickstairs */ + "e:114: 6\n" /* netherbrickstairs */ + "f: 44:14\n" /* step */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 2 + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmbbbmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "aacmmmmmmmmmdaa" + "aacmmmmmmmmmdaa" + "aacmmmmmmmmmdaa" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmeeemmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 3 + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmbbbmmmmmm" + "mmmmmmfffmmmmmm" + "mmmmmmmmmmmmmmm" + "aaacfmmmmmfdaaa" + "aaacfmmmmmfdaaa" + "aaacfmmmmmfdaaa" + "mmmmmmmmmmmmmmm" + "mmmmmmfffmmmmmm" + "mmmmmmeeemmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 4 + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "eeeeeeaaaeeeeee" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "bbbbbdaaacbbbbb" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + + // Level 5 + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + + // Level 6 + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "aaaaaa...aaaaaa" + "..............." + "..............." + "..............." + "aaaaaa...aaaaaa" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + + // Level 7 + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "..............." + "..............." + "..............." + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + + // Level 8 + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "..............." + "..............." + "..............." + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm", + + // Connections: + "0: 0, 5, 7: 4\n" /* Type 0, BLOCK_FACE_XM */ + "0: 7, 5, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 14, 5, 7: 5\n" /* Type 0, BLOCK_FACE_XP */ + "0: 7, 5, 14: 3\n" /* Type 0, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeCrossing + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BridgeCrumble1: + // The data has been exported from gallery Nether, area index 19, ID 161 + { + // Size: + 9, 6, 5, // SizeX = 9, SizeY = 6, SizeZ = 5 + + // Block definitions: + ".: 19: 0\n" /* sponge */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c: 44:14\n" /* step */ + "d:114: 6\n" /* netherbrickstairs */ + "e:114: 7\n" /* netherbrickstairs */, + + // Block data: + // Level 1 + "........." + "aa......." + "aa......." + "aa......." + "........." + + // Level 2 + "........." + "aab......" + "aab......" + "aab......" + "........." + + // Level 3 + "........." + "aaabc...." + "aaabc...." + "aaabc...." + "........." + + // Level 4 + "ddddddd.." + "aaaaaaaa." + "aaaaaaaaa" + "aaaaaaa.." + "eeeee...." + + // Level 5 + "aaaaaaaaa" + "aaaaa...." + "aaaaaa..." + "aaaaaa..." + "aaaaaaaa." + + // Level 6 + "aaaaaa..." + "........." + "........." + "........." + "aaaaaaa..", + + // Connections: + "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeCrumble1 + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BridgeCrumble2 + // The data has been exported from gallery Nether, area index 18, ID 160 + { + // Size: + 13, 6, 5, // SizeX = 13, SizeY = 6, SizeZ = 5 + + // Block definitions: + ".: 19: 0\n" /* sponge */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c: 44:14\n" /* step */ + "d:114: 6\n" /* netherbrickstairs */ + "e:114: 7\n" /* netherbrickstairs */, + + // Block data: + // Level 1 + "............." + "aa..........." + "aa..........." + "aa..........." + "............." + + // Level 2 + "............." + "aab.........." + "aab.........." + "aab.........." + "............." + + // Level 3 + "............." + "aaabc........" + "aaabc........" + "aaabc........" + "............." + + // Level 4 + "ddddddddd...." + "aaaaaaaaaaaaa" + "aaaaaaaaa...." + "aaaaaaaaaaaa." + "eeeeeeeee...." + + // Level 5 + "aaaaaaaaaaaa." + "aaaaaaaaaa..." + "aaaaaaaaaaa.." + "aaaaaaaaa...." + "aaaaaaaaaaaaa" + + // Level 6 + "aaaaaaaaa...." + "............." + "............." + "............." + "aaaaaaaaaa...", + + // Connections: + "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeCrumble2 + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BridgeSegment: + // The data has been exported from gallery Nether, area index 16, ID 158 + { + // Size: + 15, 8, 5, // SizeX = 15, SizeY = 8, SizeZ = 5 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c:114: 4\n" /* netherbrickstairs */ + "d: 44:14\n" /* step */ + "e:114: 6\n" /* netherbrickstairs */ + "f:114: 7\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmmmmmmmmmmmm" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "mmmmmmmmmmmmmmm" + + // Level 2 + "mmmmmmmmmmmmmmm" + "aabmmmmmmmmmcaa" + "aabmmmmmmmmmcaa" + "aabmmmmmmmmmcaa" + "mmmmmmmmmmmmmmm" + + // Level 3 + "mmmmmmmmmmmmmmm" + "aaabdmmmmmdcaaa" + "aaabdmmmmmdcaaa" + "aaabdmmmmmdcaaa" + "mmmmmmmmmmmmmmm" + + // Level 4 + "eeeeeeeeeeeeeee" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "fffffffffffffff" + + // Level 5 + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + + // Level 6 + "aaaaaaaaaaaaaaa" + "..............." + "..............." + "..............." + "aaaaaaaaaaaaaaa" + + // Level 7 + "mmmmmmmmmmmmmmm" + "..............." + "..............." + "..............." + "mmmmmmmmmmmmmmm" + + // Level 8 + "mmmmmmmmmmmmmmm" + "..............." + "..............." + "..............." + "mmmmmmmmmmmmmmm", + + // Connections: + "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */ + "0: 14, 5, 2: 5\n" /* Type 0, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeSegment + + + // BridgeTee: + // The data has been exported from gallery Nether, area index 39, ID 290 + { + // Size: + 15, 8, 10, // SizeX = 15, SizeY = 8, SizeZ = 10 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c:114: 4\n" /* netherbrickstairs */ + "d:114: 6\n" /* netherbrickstairs */ + "e: 44:14\n" /* step */ + "f:114: 7\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmmmmmmmmmmmm" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 2 + "mmmmmmmmmmmmmmm" + "aabmmmmmmmmmcaa" + "aabmmmmmmmmmcaa" + "aabmmmmmmmmmcaa" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmdddmmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 3 + "mmmmmmmmmmmmmmm" + "aaabemmmmmecaaa" + "aaabemmmmmecaaa" + "aaabemmmmmecaaa" + "mmmmmmmmmmmmmmm" + "mmmmmmeeemmmmmm" + "mmmmmmdddmmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 4 + "ddddddddddddddd" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "fffffcaaabfffff" + "mmmmmcaaabmmmmm" + "mmmmmcaaabmmmmm" + "mmmmmcaaabmmmmm" + "mmmmmcaaabmmmmm" + "mmmmmcaaabmmmmm" + + // Level 5 + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + + // Level 6 + "aaaaaaaaaaaaaaa" + "..............." + "..............." + "..............." + "aaaaaa...aaaaaa" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + + // Level 7 + "mmmmmmmmmmmmmmm" + "..............." + "..............." + "..............." + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + + // Level 8 + "mmmmmmmmmmmmmmm" + "..............." + "..............." + "..............." + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm", + + // Connections: + "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */ + "0: 14, 5, 2: 5\n" /* Type 0, BLOCK_FACE_XP */ + "0: 7, 5, 9: 3\n" /* Type 0, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeTee + + + // Corridor11: + // The data has been exported from gallery Nether, area index 36, ID 287 + { + // Size: + 11, 6, 5, // SizeX = 11, SizeY = 6, SizeZ = 5 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 2\n" /* netherbrickstairs */ + "d:114: 3\n" /* netherbrickstairs */, + + // Block data: + // Level 1 + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + + // Level 2 + "aaaaaaaaaaa" + "..........." + "..........." + "..........." + "aaaaaaaaaaa" + + // Level 3 + "abababababa" + "..........." + "..........." + "..........." + "abababababa" + + // Level 4 + "abababababa" + "..........." + "..........." + "..........." + "abababababa" + + // Level 5 + "abababababa" + "..........." + "..........." + "..........." + "abababababa" + + // Level 6 + "ccccccccccc" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "ddddddddddd", + + // Connections: + "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Corridor11 + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // Corridor13: + // The data has been exported from gallery Nether, area index 35, ID 286 + { + // Size: + 13, 6, 5, // SizeX = 13, SizeY = 6, SizeZ = 5 + + // Block definitions: + "a:112: 0\n" /* netherbrick */ + ".: 0: 0\n" /* air */ + "c:113: 0\n" /* netherbrickfence */ + "d:114: 2\n" /* netherbrickstairs */ + "e:114: 3\n" /* netherbrickstairs */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "aaaaaaaaaaaaa" + "............." + "............." + "............." + "aaaaaaaaaaaaa" + + // Level 3 + "acacacacacaca" + "............." + "............." + "............." + "acacacacacaca" + + // Level 4 + "acacacacacaca" + "............." + "............." + "............." + "acacacacacaca" + + // Level 5 + "acacacacacaca" + "............." + "............." + "............." + "acacacacacaca" + + // Level 6 + "ddddddddddddd" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "eeeeeeeeeeeee", + + // Connections: + "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Corridor13 + + + // CorridorCorner5: + // The data has been exported from gallery Nether, area index 10, ID 40 + { + // Size: + 11, 6, 11, // SizeX = 11, SizeY = 6, SizeZ = 11 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 2\n" /* netherbrickstairs */ + "d:114: 0\n" /* netherbrickstairs */ + "e:114: 3\n" /* netherbrickstairs */ + "f:114: 1\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + + // Level 2 + "aaaaaaaaaaa" + "a.........." + "a.........." + "a.........." + "a...aaaaaaa" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + + // Level 3 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 4 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 5 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 6 + "ccccccccccc" + "daaaaaaaaaa" + "daaaaaaaaaa" + "daaaaaaaaaa" + "daaaeeeeeee" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm", + + // Connections: + "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 2, 1, 10: 3\n" /* Type 1, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // CorridorCorner5 + + + // CorridorCorner5: + // The data has been exported from gallery Nether, area index 10, ID 40 + { + // Size: + 11, 6, 11, // SizeX = 11, SizeY = 6, SizeZ = 11 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 2\n" /* netherbrickstairs */ + "d:114: 0\n" /* netherbrickstairs */ + "e:114: 3\n" /* netherbrickstairs */ + "f:114: 1\n" /* netherbrickstairs */ + "g: 54: 5\n" /* chest */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + + // Level 2 + "aaaaaaaaaaa" + "ag........." + "a.........." + "a.........." + "a...aaaaaaa" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + + // Level 3 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 4 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 5 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 6 + "ccccccccccc" + "daaaaaaaaaa" + "daaaaaaaaaa" + "daaaaaaaaaa" + "daaaeeeeeee" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm", + + // Connections: + "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 2, 1, 10: 3\n" /* Type 1, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // CorridorCorner5Chest + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // CorridorStairs: + // The data has been exported from gallery Nether, area index 12, ID 42 + { + // Size: + 9, 13, 5, // SizeX = 9, SizeY = 13, SizeZ = 5 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 0\n" /* netherbrickstairs */ + "c:113: 0\n" /* netherbrickfence */ + "d:114: 2\n" /* netherbrickstairs */ + "e:114: 3\n" /* netherbrickstairs */ + "f: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaaaa" + "aaaaaaaaa" + "aaaaaaaaa" + "aaaaaaaaa" + "aaaaaaaaa" + + // Level 2 + "aaaaaaaaa" + ".baaaaaaa" + ".baaaaaaa" + ".baaaaaaa" + "aaaaaaaaa" + + // Level 3 + "acaaaaaaa" + "..baaaaaa" + "..baaaaaa" + "..baaaaaa" + "acaaaaaaa" + + // Level 4 + "acaaaaaaa" + "...baaaaa" + "...baaaaa" + "...baaaaa" + "acaaaaaaa" + + // Level 5 + "acacaaaaa" + "....baaaa" + "....baaaa" + "....baaaa" + "acacaaaaa" + + // Level 6 + "aaacaaaaa" + ".....baaa" + ".....baaa" + ".....baaa" + "aaacaaaaa" + + // Level 7 + "daacacaaa" + "a.....baa" + "a.....baa" + "a.....baa" + "eaacacaaa" + + // Level 8 + "fdaaacaaa" + "fa.....ba" + "fa.....ba" + "fa.....ba" + "feaaacaaa" + + // Level 9 + "ffdaacaca" + "ffa......" + "ffa......" + "ffa......" + "ffeaacaca" + + // Level 10 + "fffdaaaca" + "fffa....." + "fffa....." + "fffa....." + "fffeaaaca" + + // Level 11 + "ffffdaaca" + "ffffa...." + "ffffa...." + "ffffa...." + "ffffeaaca" + + // Level 12 + "fffffdaaa" + "fffffa..." + "fffffa..." + "fffffa..." + "fffffeaaa" + + // Level 13 + "ffffffddd" + "ffffffaaa" + "ffffffaaa" + "ffffffaaa" + "ffffffeee", + + // Connections: + "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 8, 8, 2: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // CorridorStairs + + + // LavaStaircase: + // The data has been exported from gallery Nether, area index 28, ID 278 + { + // Size: + 15, 11, 15, // SizeX = 15, SizeY = 11, SizeZ = 15 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c: 11: 0\n" /* lava */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + + // Level 2 + "aaaaaaaa...aaaa" + "aaaaa.........a" + "aaaaa.........a" + "aaaaab........a" + "accca...aaaa..a" + "accca...acca..a" + "acccaaaaacca..a" + "acccccccccca..a" + "acccaaaaacca..a" + "accca...acca..a" + "accca...aaaa..a" + "aaaaab........a" + "aaaaa.........a" + "aaaaa.........a" + "aaaaaaaa...aaaa" + + // Level 3 + "aaaaaaaa...aaaa" + "aaaa..........a" + "aaaa..........a" + "aaaabb........a" + "aaaa..........a" + "a.............a" + "a.............a" + "a.............a" + "a.............a" + "a.............a" + "aaaa..........a" + "aaaabb........a" + "aaaa..........a" + "aaaa..........a" + "aaaaaaaa...aaaa" + + // Level 4 + "aaaaaaaa...aaaa" + "a.............a" + "a.............a" + "a..bb.........a" + "aaaa..........a" + "aaaa..........a" + "a.............a" + "a.............a" + "a.............a" + "aaaa..........a" + "aaaa..........a" + "a..bb.........a" + "a.............a" + "a.............a" + "aaaaaaaa...aaaa" + + // Level 5 + "aaaaaaaabbbaaaa" + "a.............a" + "a.............a" + "a..b..........a" + "a..b..........a" + "aaaa..........a" + "aaaa..........a" + "a.............a" + "aaaa..........a" + "aaaa..........a" + "a..b..........a" + "a..b..........a" + "a.............a" + "a.............a" + "aaaaaaaabbbaaaa" + + // Level 6 + "aaaaaaaaaaaaaaa" + "a.............a" + "a.............a" + "a.............a" + "a..b..........a" + "a..b..........a" + "aaaa..........a" + "aaaa..........a" + "aaaa..........a" + "a..b..........a" + "a..b..........a" + "a.............a" + "a.............a" + "a.............a" + "aaaaaaaaaaaaaaa" + + // Level 7 + "aaaaaaaaaaaaaaa" + "a.............a" + "a.............a" + "a.............a" + "a.............a" + "a..b..........a" + "...b..........a" + "...b..........a" + "...b..........a" + "a..b..........a" + "a.............a" + "a.............a" + "a.............a" + "a.............a" + "aaaaaaaaaaaaaaa" + + // Level 8 + "aababababababaa" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "..............b" + "..............a" + "..............b" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "aababababababaa" + + // Level 9 + "aababababababaa" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "..............b" + "..............a" + "..............b" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "aababababababaa" + + // Level 10 + "aababababababaa" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "..............b" + "..............a" + "..............b" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "aababababababaa" + + // Level 11 + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa", + + // Connections: + "1: 0, 6, 7: 4\n" /* Type 1, BLOCK_FACE_XM */ + "0: 9, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 9, 1, 14: 3\n" /* Type 0, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // LavaStaircase + + + // LavaStaircaseBig: + // The data has been exported from gallery Nether, area index 31, ID 282 + { + // Size: + 12, 15, 15, // SizeX = 12, SizeY = 15, SizeZ = 15 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b: 10: 0\n" /* lava */ + "c:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 2 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "abbbbbaaaaaa" + "abbbbbbaaaaa" + "abbbbbba...." + "abbbbbba...." + "abbbbbba...." + "abbbbbbaaaaa" + "abbbbb.aaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 3 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "abbbbbaaaaaa" + "abbbbbba...a" + "abbbbbba...." + "abbbbbba...." + "abbbbbba...." + "abbbbbba...a" + "abbbbb.aaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 4 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "abbbbbaa...a" + "abbbbbba...a" + "abbbbbba...." + "abbbbbba...." + "abbbbbba...." + "abbbbbba...a" + "abbbbbaa...a" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 5 + "aaaaaaaaaaaa" + "aaaaa......a" + "aaaaa......a" + "aaaaacc....a" + "a.....cc...a" + "a......c...a" + "a......c...." + "a......c...." + "a......c...." + "a......c...a" + "a.....cc...a" + "aaaaacc....a" + "aaaaa......a" + "aaaaa......a" + "aaaaaaaaaaaa" + + // Level 6 + "aaaaaaaaaaaa" + "aaaa.......a" + "aaaa.......a" + "aaaacc.....a" + "aaaa.......a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaa.......a" + "aaaacc.....a" + "aaaa.......a" + "aaaa.......a" + "aaaaaaaaaaaa" + + // Level 7 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..cc......a" + "aaaa.......a" + "aaaa.......a" + "a..........a" + "a..........a" + "a..........a" + "aaaa.......a" + "aaaa.......a" + "a..cc......a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 8 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..c.......a" + "a..c.......a" + "aaaa.......a" + "aaaa.......a" + "a..........a" + "aaaa.......a" + "aaaa.......a" + "a..c.......a" + "a..c.......a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 9 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..c.......a" + "a..c.......a" + "aaaa.......a" + "aaaa.......a" + "aaaa.......a" + "a..c.......a" + "a..c.......a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 10 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..c.......a" + "...c.......a" + "...c.......a" + "...c.......a" + "a..c.......a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 11 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "...........a" + "...........a" + "...........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 12 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "...........a" + "...........a" + "...........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 13 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "...........a" + "...........a" + "...........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 14 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 15 + "aaaaaaaaaaaa" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "aaaaaaaaaaaa", + + // Connections: + "1: 0, 9, 7: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 11, 1, 7: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // LavaStaircaseBig + + + // MidStaircase: + // The data has been exported from gallery Nether, area index 23, ID 165 + { + // Size: + 13, 8, 13, // SizeX = 13, SizeY = 8, SizeZ = 13 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b: 88: 0\n" /* soulsand */ + "c:115: 7\n" /* netherwartblock */ + "d:114: 3\n" /* netherbrickstairs */ + "e:114: 0\n" /* netherbrickstairs */ + "f:114: 1\n" /* netherbrickstairs */ + "g:114: 2\n" /* netherbrickstairs */ + "h: 10: 0\n" /* lava */ + "i:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaabbbbbaaaa" + "aaaabbbbbaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaabbbbbaaaa" + "aaaabbbbbaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaacccccaaaa" + "addecccccfdda" + "...eaaaaad..." + "...eaaaaa...." + "...eaaaaag..." + "agggcccccfgga" + "aaaacccccaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 3 + "aaaaaaaaaaaaa" + "aha.......aha" + "aaa.......aaa" + "a...........a" + "a...........a" + "....eaaaa...." + "....eaaaa...." + "....eaaaa...." + "a...........a" + "a...........a" + "aaa.......aaa" + "aha.......aha" + "aaaaaaaaaaaaa" + + // Level 4 + "aaaiiaaaiiaaa" + "a...........a" + "a...........a" + "a...........a" + "a...........a" + ".....eaaa...." + ".....eaaa...." + ".....eaaa...." + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "aaaiiaaaiiaaa" + + // Level 5 + "aaaiiaaaiiaaa" + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "......eaa...." + "......eaa...." + "......eaa...." + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "aaaiiaaaiiaaa" + + // Level 6 + "aaaaaaaaaaaaa" + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "a......ea...a" + "a......ea...a" + "a......ea...a" + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "aaaaaaaaaaaaa" + + // Level 7 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaa....eaaaa" + "aaaa....eaaaa" + "aaaa....eaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 8 + "iaiaiaiaiaiai" + "a...........a" + "i...........i" + "a...........a" + "i...........i" + "a............" + "i............" + "a............" + "i...........i" + "a...........a" + "i...........i" + "a...........a" + "iaiaiaiaiaiai", + + // Connections: + "1: 0, 1, 6: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 1, 6: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 12, 7, 6: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // MidStaircase + + + // StairsToOpen1: + // The data has been exported from gallery Nether, area index 27, ID 277 + { + // Size: + 7, 10, 7, // SizeX = 7, SizeY = 10, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + + // Level 2 + "aa...aa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "aaaaaaa" + "aaaaaaa" + + // Level 3 + "aa...aa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a.aaaaa" + "aabaaba" + + // Level 4 + "aa...aa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a..aaaa" + "aabaaba" + + // Level 5 + "aabbbaa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a...aaa" + "aabaaba" + + // Level 6 + "aaaaaaa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "a....aa" + "aaaaaaa" + + // Level 7 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "a.....a" + "aaaaaaa" + + // Level 8 + "aaaaaaa" + "a.....a" + "a......" + "a......" + "a......" + "a.....a" + "aaaaaaa" + + // Level 9 + "mmmmmmm" + "m.....m" + "m......" + "m......" + "m......" + "m.....m" + "mmmmmmm" + + // Level 10 + "mmmmmmm" + "m.....m" + "m......" + "m......" + "m......" + "m.....m" + "mmmmmmm", + + // Connections: + "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 6, 7, 3: 5\n" /* Type 0, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // StairsToOpen1 + + + // StairsToOpen2: + // The data has been exported from gallery Nether, area index 8, ID 35 + { + // Size: + 7, 10, 7, // SizeX = 7, SizeY = 10, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + + // Level 2 + "aa...aa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "aaaaaaa" + "aaaaaaa" + + // Level 3 + "aa...aa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a.aaaaa" + "aabaaba" + + // Level 4 + "aa...aa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a..aaaa" + "aabaaba" + + // Level 5 + "aabbbaa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a...aaa" + "aabaaba" + + // Level 6 + "aaaaaaa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "a....aa" + "aaaaaaa" + + // Level 7 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "a.....a" + "aaaaaaa" + + // Level 8 + "aaaaaaa" + "a.....a" + "......a" + "......a" + "......a" + "a.....a" + "aaaaaaa" + + // Level 9 + "mmmmmmm" + "m.....m" + "......m" + "......m" + "......m" + "m.....m" + "mmmmmmm" + + // Level 10 + "mmmmmmm" + "m.....m" + "......m" + "......m" + "......m" + "m.....m" + "mmmmmmm", + + // Connections: + "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 0, 7, 3: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // StairsToOpen2 + + + // Tee2x4: + // The data has been exported from gallery Nether, area index 40, ID 291 + { + // Size: + 13, 6, 7, // SizeX = 13, SizeY = 6, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 0\n" /* netherbrickstairs */ + "d:114: 1\n" /* netherbrickstairs */ + "e:114: 2\n" /* netherbrickstairs */ + "f:114: 3\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmaaaaammmm" + "mmmmaaaaammmm" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "mmmma...ammmm" + "mmmma...ammmm" + "aaaaa...aaaaa" + "............." + "............." + "............." + "aaaaaaaaaaaaa" + + // Level 3 + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 4 + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 5 + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 6 + "mmmmcaaadmmmm" + "mmmmcaaadmmmm" + "eeeecaaadeeee" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "fffffffffffff", + + // Connections: + "1: 0, 1, 4: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 6, 1, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */ + "1: 12, 1, 4: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Tee2x4 + + + // Tee4x4: + // The data has been exported from gallery Nether, area index 41, ID 292 + { + // Size: + 13, 6, 9, // SizeX = 13, SizeY = 6, SizeZ = 9 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 0\n" /* netherbrickstairs */ + "d:114: 1\n" /* netherbrickstairs */ + "e:114: 2\n" /* netherbrickstairs */ + "f:114: 3\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmaaaaammmm" + "mmmmaaaaammmm" + "mmmmaaaaammmm" + "mmmmaaaaammmm" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "mmmma...ammmm" + "mmmma...ammmm" + "mmmma...ammmm" + "mmmma...ammmm" + "aaaaa...aaaaa" + "............." + "............." + "............." + "aaaaaaaaaaaaa" + + // Level 3 + "mmmma...ammmm" + "mmmmb...bmmmm" + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 4 + "mmmma...ammmm" + "mmmmb...bmmmm" + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 5 + "mmmma...ammmm" + "mmmmb...bmmmm" + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 6 + "mmmmcaaadmmmm" + "mmmmcaaadmmmm" + "mmmmcaaadmmmm" + "mmmmcaaadmmmm" + "eeeecaaadeeee" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "fffffffffffff", + + // Connections: + "1: 0, 1, 6: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 1, 6: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 6, 1, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Tee4x4 + + // Turret: + // The data has been exported from gallery Nether, area index 7, ID 34 + { + // Size: + 7, 6, 7, // SizeX = 7, SizeY = 6, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + + // Level 2 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 3 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 4 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 5 + "aabbbaa" + "a.....a" + "b.....b" + "b.....b" + "b.....b" + "a.....a" + "aabbbaa" + + // Level 6 + "aaaaaaa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "aaaaaaa", + + // Connections: + "0: 0, 1, 3: 4\n" /* Type 0, BLOCK_FACE_XM */ + "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 6, 1, 3: 5\n" /* Type 0, BLOCK_FACE_XP */ + "0: 3, 1, 6: 3\n" /* Type 0, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Turret + +} ; // g_NetherFortPrefabs1 + + + + + +const cPrefab::sDef g_NetherFortStartingPrefabs1[] = +{ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // CentralRoom: + // The data has been exported from gallery Nether, area index 22, ID 164 + { + // Size: + 13, 9, 13, // SizeX = 13, SizeY = 9, SizeZ = 13 + + // Block definitions: + "a:112: 0\n" /* netherbrick */ + "b: 0: 0\n" /* air */ + "c: 10: 0\n" /* lava */ + "d:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "aaaaabbbaaaaa" + "aaaaabbbaaaaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbaaabbbaa" + "aabbbacabbbaa" + "aabbbaaabbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aaaaabbbaaaaa" + "aaaaabbbaaaaa" + + // Level 3 + "aaaaabbbaaaaa" + "aaadabbbadaaa" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "aaadabbbadaaa" + "aaaaabbbaaaaa" + + // Level 4 + "aaaaabbbaaaaa" + "aaadabbbadaaa" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "aaadabbbadaaa" + "aaaaabbbaaaaa" + + // Level 5 + "adadadddadada" + "daaaabbbaaaad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "daaaabbbaaaad" + "adadabbbadada" + + // Level 6 + "adadaaaaadada" + "daaaaaaaaaaad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "daaaaaaaaaaad" + "adadaaaaadada" + + // Level 7 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 8 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 9 + "dadadadadadad" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dadadadadadad", + + // Connections: + "0: 6, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "1: 6, 1, 12: 3\n" /* Type 1, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, +} ; // g_NetherFortStartingPrefabs1 + +const size_t g_NetherFortPrefabs1Count = ARRAYCOUNT(g_NetherFortPrefabs1); +const size_t g_NetherFortStartingPrefabs1Count = ARRAYCOUNT(g_NetherFortStartingPrefabs1); + + + + diff --git a/src/Generating/Prefabs/NetherFortPrefabs.h b/src/Generating/Prefabs/NetherFortPrefabs.h new file mode 100644 index 000000000..37a91689d --- /dev/null +++ b/src/Generating/Prefabs/NetherFortPrefabs.h @@ -0,0 +1,15 @@ + +// NetherFortPrefabs.h + +// Declares the data used for nether fortress prefabs + +#include "../Prefab.h" + + + + + +extern const cPrefab::sDef g_NetherFortPrefabs1[]; +extern const cPrefab::sDef g_NetherFortStartingPrefabs1[]; +extern const size_t g_NetherFortPrefabs1Count; +extern const size_t g_NetherFortStartingPrefabs1Count; diff --git a/src/Generating/StructGen.cpp b/src/Generating/StructGen.cpp index 3cc8a09c3..db9d5578c 100644 --- a/src/Generating/StructGen.cpp +++ b/src/Generating/StructGen.cpp @@ -578,7 +578,7 @@ void cStructGenDirectOverhangs::GenFinish(cChunkDesc & a_ChunkDesc) m_Noise2.IntNoise3DInt(BaseX + INTERPOL_X * x, BaseY, BaseZ + INTERPOL_Z * z) / 256; } // for x, z - FloorLo[] - LinearUpscale2DArrayInPlace(FloorLo, 17, 17, INTERPOL_X, INTERPOL_Z); + LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorLo); // Interpolate segments: for (int Segment = BaseY; Segment < MaxHeight; Segment += SEGMENT_HEIGHT) @@ -591,7 +591,7 @@ void cStructGenDirectOverhangs::GenFinish(cChunkDesc & a_ChunkDesc) m_Noise2.IntNoise3DInt(BaseX + INTERPOL_Z * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) / 256; } // for x, z - FloorLo[] - LinearUpscale2DArrayInPlace(FloorHi, 17, 17, INTERPOL_X, INTERPOL_Z); + LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorHi); // Interpolate between FloorLo and FloorHi: for (int z = 0; z < 16; z++) for (int x = 0; x < 16; x++) diff --git a/src/Globals.h b/src/Globals.h index 3e62832b7..26a0d87a9 100644 --- a/src/Globals.h +++ b/src/Globals.h @@ -29,6 +29,9 @@ // Disabling this warning, because we know what we're doing when we're doing this: #pragma warning(disable: 4355) // 'this' used in initializer list + + // Disabled because it's useless: + #pragma warning(disable: 4512) // 'class': assignment operator could not be generated - reported for each class that has a reference-type member // 2014_01_06 xoft: Disabled this warning because MSVC is stupid and reports it in obviously wrong places // #pragma warning(3 : 4244) // Conversion from 'type1' to 'type2', possible loss of data @@ -264,11 +267,17 @@ template class SizeChecker<UInt16, 2>; #define assert_test(x) ( !!(x) || (assert(!#x), exit(1), 0)) #endif -/// A generic interface used mainly in ForEach() functions + + + + +/** A generic interface used mainly in ForEach() functions */ template <typename Type> class cItemCallback { public: - /// Called for each item in the internal list; return true to stop the loop, or false to continue enumerating + virtual ~cItemCallback() {} + + /** Called for each item in the internal list; return true to stop the loop, or false to continue enumerating */ virtual bool Item(Type * a_Type) = 0; } ; diff --git a/src/Group.cpp b/src/Group.cpp index 5f1f25782..9c2467144 100644 --- a/src/Group.cpp +++ b/src/Group.cpp @@ -38,4 +38,4 @@ void cGroup::InheritFrom( cGroup* a_Group ) void cGroup::ClearPermission() { m_Permissions.clear(); -}
\ No newline at end of file +} diff --git a/src/HTTPServer/EnvelopeParser.cpp b/src/HTTPServer/EnvelopeParser.cpp index 8dbe05f14..fd4f3836d 100644 --- a/src/HTTPServer/EnvelopeParser.cpp +++ b/src/HTTPServer/EnvelopeParser.cpp @@ -20,7 +20,7 @@ cEnvelopeParser::cEnvelopeParser(cCallbacks & a_Callbacks) : -int cEnvelopeParser::Parse(const char * a_Data, int a_Size) +size_t cEnvelopeParser::Parse(const char * a_Data, size_t a_Size) { if (!m_IsInHeaders) { @@ -55,7 +55,7 @@ int cEnvelopeParser::Parse(const char * a_Data, int a_Size) { // An error has occurred m_IsInHeaders = false; - return -1; + return AString::npos; } Last = idxCRLF + 2; idxCRLF = m_IncomingData.find("\r\n", idxCRLF + 2); diff --git a/src/HTTPServer/EnvelopeParser.h b/src/HTTPServer/EnvelopeParser.h index 6430fbebf..e96d80abe 100644 --- a/src/HTTPServer/EnvelopeParser.h +++ b/src/HTTPServer/EnvelopeParser.h @@ -19,7 +19,10 @@ public: class cCallbacks { public: - /// Called when a full header line is parsed + // Force a virtual destructor in descendants: + virtual ~cCallbacks() {} + + /** Called when a full header line is parsed */ virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) = 0; } ; @@ -27,40 +30,41 @@ public: cEnvelopeParser(cCallbacks & a_Callbacks); /** Parses the incoming data. - Returns the number of bytes consumed from the input. The bytes not consumed are not part of the envelope header + Returns the number of bytes consumed from the input. The bytes not consumed are not part of the envelope header. + Returns AString::npos on error */ - int Parse(const char * a_Data, int a_Size); + size_t Parse(const char * a_Data, size_t a_Size); - /// Makes the parser forget everything parsed so far, so that it can be reused for parsing another datastream + /** Makes the parser forget everything parsed so far, so that it can be reused for parsing another datastream */ void Reset(void); - /// Returns true if more input is expected for the envelope header + /** Returns true if more input is expected for the envelope header */ bool IsInHeaders(void) const { return m_IsInHeaders; } - /// Sets the IsInHeaders flag; used by cMultipartParser to simplify the parser initial conditions + /** Sets the IsInHeaders flag; used by cMultipartParser to simplify the parser initial conditions */ void SetIsInHeaders(bool a_IsInHeaders) { m_IsInHeaders = a_IsInHeaders; } public: - /// Callbacks to call for the various events + /** Callbacks to call for the various events */ cCallbacks & m_Callbacks; - /// Set to true while the parser is still parsing the envelope headers. Once set to true, the parser will not consume any more data. + /** Set to true while the parser is still parsing the envelope headers. Once set to true, the parser will not consume any more data. */ bool m_IsInHeaders; - /// Buffer for the incoming data until it is parsed + /** Buffer for the incoming data until it is parsed */ AString m_IncomingData; - /// Holds the last parsed key; used for line-wrapped values + /** Holds the last parsed key; used for line-wrapped values */ AString m_LastKey; - /// Holds the last parsed value; used for line-wrapped values + /** Holds the last parsed value; used for line-wrapped values */ AString m_LastValue; - /// Notifies the callback of the key/value stored in m_LastKey/m_LastValue, then erases them + /** Notifies the callback of the key/value stored in m_LastKey/m_LastValue, then erases them */ void NotifyLast(void); - /// Parses one line of header data. Returns true if successful + /** Parses one line of header data. Returns true if successful */ bool ParseLine(const char * a_Data, size_t a_Size); } ; diff --git a/src/HTTPServer/HTTPConnection.cpp b/src/HTTPServer/HTTPConnection.cpp index 78b7ce4d9..44a3d3f88 100644 --- a/src/HTTPServer/HTTPConnection.cpp +++ b/src/HTTPServer/HTTPConnection.cpp @@ -67,10 +67,10 @@ void cHTTPConnection::Send(const cHTTPResponse & a_Response) -void cHTTPConnection::Send(const void * a_Data, int a_Size) +void cHTTPConnection::Send(const void * a_Data, size_t a_Size) { ASSERT(m_State == wcsSendingResp); - AppendPrintf(m_OutgoingData, "%x\r\n", a_Size); + AppendPrintf(m_OutgoingData, SIZE_T_FMT "\r\n", a_Size); m_OutgoingData.append((const char *)a_Data, a_Size); m_OutgoingData.append("\r\n"); m_HTTPServer.NotifyConnectionWrite(*this); @@ -144,7 +144,7 @@ void cHTTPConnection::Terminate(void) -void cHTTPConnection::DataReceived(const char * a_Data, int a_Size) +void cHTTPConnection::DataReceived(const char * a_Data, size_t a_Size) { switch (m_State) { @@ -155,8 +155,8 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size) m_CurrentRequest = new cHTTPRequest; } - int BytesConsumed = m_CurrentRequest->ParseHeaders(a_Data, a_Size); - if (BytesConsumed < 0) + size_t BytesConsumed = m_CurrentRequest->ParseHeaders(a_Data, a_Size); + if (BytesConsumed == AString::npos) { delete m_CurrentRequest; m_CurrentRequest = NULL; @@ -174,7 +174,7 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size) m_State = wcsRecvBody; m_HTTPServer.NewRequest(*this, *m_CurrentRequest); m_CurrentRequestBodyRemaining = m_CurrentRequest->GetContentLength(); - if (m_CurrentRequestBodyRemaining < 0) + if (m_CurrentRequestBodyRemaining == AString::npos) { // The body length was not specified in the request, assume zero m_CurrentRequestBodyRemaining = 0; @@ -197,7 +197,7 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size) ASSERT(m_CurrentRequest != NULL); if (m_CurrentRequestBodyRemaining > 0) { - int BytesToConsume = std::min(m_CurrentRequestBodyRemaining, a_Size); + size_t BytesToConsume = std::min(m_CurrentRequestBodyRemaining, (size_t)a_Size); m_HTTPServer.RequestBody(*this, *m_CurrentRequest, a_Data, BytesToConsume); m_CurrentRequestBodyRemaining -= BytesToConsume; } diff --git a/src/HTTPServer/HTTPConnection.h b/src/HTTPServer/HTTPConnection.h index 5b8103554..fc11f1ba6 100644 --- a/src/HTTPServer/HTTPConnection.h +++ b/src/HTTPServer/HTTPConnection.h @@ -51,7 +51,7 @@ public: void Send(const cHTTPResponse & a_Response); /** Sends the data as the response (may be called multiple times) */ - void Send(const void * a_Data, int a_Size); + void Send(const void * a_Data, size_t a_Size); /** Sends the data as the response (may be called multiple times) */ void Send(const AString & a_Data) { Send(a_Data.data(), a_Data.size()); } @@ -87,11 +87,11 @@ protected: /** Number of bytes that remain to read for the complete body of the message to be received. Valid only in wcsRecvBody */ - int m_CurrentRequestBodyRemaining; + size_t m_CurrentRequestBodyRemaining; // cSocketThreads::cCallback overrides: - virtual void DataReceived (const char * a_Data, int a_Size) override; // Data is received from the client + virtual void DataReceived (const char * a_Data, size_t a_Size) override; // Data is received from the client virtual void GetOutgoingData(AString & a_Data) override; // Data can be sent to client virtual void SocketClosed (void) override; // The socket has been closed for any reason } ; diff --git a/src/HTTPServer/HTTPFormParser.cpp b/src/HTTPServer/HTTPFormParser.cpp index e661ea6f9..9ddfb82f1 100644 --- a/src/HTTPServer/HTTPFormParser.cpp +++ b/src/HTTPServer/HTTPFormParser.cpp @@ -52,7 +52,7 @@ cHTTPFormParser::cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callba -cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size, cCallbacks & a_Callbacks) : +cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, size_t a_Size, cCallbacks & a_Callbacks) : m_Callbacks(a_Callbacks), m_Kind(a_Kind), m_IsValid(true) @@ -64,7 +64,7 @@ cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size, -void cHTTPFormParser::Parse(const char * a_Data, int a_Size) +void cHTTPFormParser::Parse(const char * a_Data, size_t a_Size) { if (!m_IsValid) { @@ -243,7 +243,7 @@ void cHTTPFormParser::OnPartHeader(const AString & a_Key, const AString & a_Valu -void cHTTPFormParser::OnPartData(const char * a_Data, int a_Size) +void cHTTPFormParser::OnPartData(const char * a_Data, size_t a_Size) { if (m_CurrentPartName.empty()) { diff --git a/src/HTTPServer/HTTPFormParser.h b/src/HTTPServer/HTTPFormParser.h index a554ca5a4..edc6d2471 100644 --- a/src/HTTPServer/HTTPFormParser.h +++ b/src/HTTPServer/HTTPFormParser.h @@ -36,11 +36,14 @@ public: class cCallbacks { public: + // Force a virtual destructor in descendants: + virtual ~cCallbacks() {} + /// Called when a new file part is encountered in the form data virtual void OnFileStart(cHTTPFormParser & a_Parser, const AString & a_FileName) = 0; /// Called when more file data has come for the current file in the form data - virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, int a_Size) = 0; + virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, size_t a_Size) = 0; /// Called when the current file part has ended in the form data virtual void OnFileEnd(cHTTPFormParser & a_Parser) = 0; @@ -51,10 +54,10 @@ public: cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callbacks); /// Creates a parser with the specified content type that reads data from a string - cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size, cCallbacks & a_Callbacks); + cHTTPFormParser(eKind a_Kind, const char * a_Data, size_t a_Size, cCallbacks & a_Callbacks); /// Adds more data into the parser, as the request body is received - void Parse(const char * a_Data, int a_Size); + void Parse(const char * a_Data, size_t a_Size); /** Notifies that there's no more data incoming and the parser should finish its parsing. Returns true if parsing successful @@ -103,7 +106,7 @@ protected: // cMultipartParser::cCallbacks overrides: virtual void OnPartStart (void) override; virtual void OnPartHeader(const AString & a_Key, const AString & a_Value) override; - virtual void OnPartData (const char * a_Data, int a_Size) override; + virtual void OnPartData (const char * a_Data, size_t a_Size) override; virtual void OnPartEnd (void) override; } ; diff --git a/src/HTTPServer/HTTPMessage.cpp b/src/HTTPServer/HTTPMessage.cpp index 98627eb8e..4a3611050 100644 --- a/src/HTTPServer/HTTPMessage.cpp +++ b/src/HTTPServer/HTTPMessage.cpp @@ -25,7 +25,7 @@ cHTTPMessage::cHTTPMessage(eKind a_Kind) : m_Kind(a_Kind), - m_ContentLength(-1) + m_ContentLength(AString::npos) { } @@ -81,23 +81,23 @@ cHTTPRequest::cHTTPRequest(void) : -int cHTTPRequest::ParseHeaders(const char * a_Data, int a_Size) +size_t cHTTPRequest::ParseHeaders(const char * a_Data, size_t a_Size) { if (!m_IsValid) { - return -1; + return AString::npos; } if (m_Method.empty()) { // The first line hasn't been processed yet - int res = ParseRequestLine(a_Data, a_Size); - if ((res < 0) || (res == a_Size)) + size_t res = ParseRequestLine(a_Data, a_Size); + if ((res == AString::npos) || (res == a_Size)) { return res; } - int res2 = m_EnvelopeParser.Parse(a_Data + res, a_Size - res); - if (res2 < 0) + size_t res2 = m_EnvelopeParser.Parse(a_Data + res, a_Size - res); + if (res2 == AString::npos) { m_IsValid = false; return res2; @@ -107,8 +107,8 @@ int cHTTPRequest::ParseHeaders(const char * a_Data, int a_Size) if (m_EnvelopeParser.IsInHeaders()) { - int res = m_EnvelopeParser.Parse(a_Data, a_Size); - if (res < 0) + size_t res = m_EnvelopeParser.Parse(a_Data, a_Size); + if (res == AString::npos) { m_IsValid = false; } @@ -138,7 +138,7 @@ AString cHTTPRequest::GetBareURL(void) const -int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size) +size_t cHTTPRequest::ParseRequestLine(const char * a_Data, size_t a_Size) { m_IncomingHeaderData.append(a_Data, a_Size); size_t IdxEnd = m_IncomingHeaderData.size(); @@ -158,7 +158,7 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size) if (LineStart >= IdxEnd) { m_IsValid = false; - return -1; + return AString::npos; } int NumSpaces = 0; @@ -186,7 +186,7 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size) { // Too many spaces in the request m_IsValid = false; - return -1; + return AString::npos; } } NumSpaces += 1; @@ -198,13 +198,13 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size) { // LF too early, without a CR, without two preceeding spaces or too soon after the second space m_IsValid = false; - return -1; + return AString::npos; } // Check that there's HTTP/version at the end if (strncmp(a_Data + URLEnd + 1, "HTTP/1.", 7) != 0) { m_IsValid = false; - return -1; + return AString::npos; } m_Method = m_IncomingHeaderData.substr(LineStart, MethodEnd - LineStart); m_URL = m_IncomingHeaderData.substr(MethodEnd + 1, URLEnd - MethodEnd - 1); diff --git a/src/HTTPServer/HTTPMessage.h b/src/HTTPServer/HTTPMessage.h index ab3338db7..dab942136 100644 --- a/src/HTTPServer/HTTPMessage.h +++ b/src/HTTPServer/HTTPMessage.h @@ -39,10 +39,10 @@ public: void AddHeader(const AString & a_Key, const AString & a_Value); void SetContentType (const AString & a_ContentType) { m_ContentType = a_ContentType; } - void SetContentLength(int a_ContentLength) { m_ContentLength = a_ContentLength; } + void SetContentLength(size_t a_ContentLength) { m_ContentLength = a_ContentLength; } const AString & GetContentType (void) const { return m_ContentType; } - int GetContentLength(void) const { return m_ContentLength; } + size_t GetContentLength(void) const { return m_ContentLength; } protected: typedef std::map<AString, AString> cNameValueMap; @@ -54,8 +54,10 @@ protected: /** Type of the content; parsed by AddHeader(), set directly by SetContentLength() */ AString m_ContentType; - /** Length of the content that is to be received. -1 when the object is created, parsed by AddHeader() or set directly by SetContentLength() */ - int m_ContentLength; + /** Length of the content that is to be received. + AString::npos when the object is created. + Parsed by AddHeader() or set directly by SetContentLength() */ + size_t m_ContentLength; } ; @@ -72,12 +74,12 @@ public: cHTTPRequest(void); /** Parses the request line and then headers from the received data. - Returns the number of bytes consumed or a negative number for error + Returns the number of bytes consumed or AString::npos number for error */ - int ParseHeaders(const char * a_Data, int a_Size); + size_t ParseHeaders(const char * a_Data, size_t a_Size); /** Returns true if the request did contain a Content-Length header */ - bool HasReceivedContentLength(void) const { return (m_ContentLength >= 0); } + bool HasReceivedContentLength(void) const { return (m_ContentLength != AString::npos); } /** Returns the method used in the request */ const AString & GetMethod(void) const { return m_Method; } @@ -145,7 +147,7 @@ protected: /** Parses the incoming data for the first line (RequestLine) Returns the number of bytes consumed, or -1 for an error */ - int ParseRequestLine(const char * a_Data, int a_Size); + size_t ParseRequestLine(const char * a_Data, size_t a_Size); // cEnvelopeParser::cCallbacks overrides: virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) override; diff --git a/src/HTTPServer/HTTPServer.cpp b/src/HTTPServer/HTTPServer.cpp index 4e9195a00..eaf8405a3 100644 --- a/src/HTTPServer/HTTPServer.cpp +++ b/src/HTTPServer/HTTPServer.cpp @@ -38,7 +38,7 @@ class cDebugCallbacks : } - virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) override + virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) override { UNUSED(a_Connection); @@ -100,7 +100,7 @@ class cDebugCallbacks : } - virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, int a_Size) override + virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, size_t a_Size) override { // TODO } @@ -242,7 +242,7 @@ void cHTTPServer::NewRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Re -void cHTTPServer::RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) +void cHTTPServer::RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) { m_Callbacks->OnRequestBody(a_Connection, a_Request, a_Data, a_Size); } diff --git a/src/HTTPServer/HTTPServer.h b/src/HTTPServer/HTTPServer.h index 24baf8c95..8eff7d879 100644 --- a/src/HTTPServer/HTTPServer.h +++ b/src/HTTPServer/HTTPServer.h @@ -37,20 +37,23 @@ public: class cCallbacks { public: + virtual ~cCallbacks() {} + /** Called when a new request arrives over a connection and its headers have been parsed. The request body needn't have arrived yet. */ virtual void OnRequestBegun(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) = 0; - /// Called when another part of request body has arrived. - virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) = 0; + /** Called when another part of request body has arrived. + May be called multiple times for a single request. */ + virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) = 0; /// Called when the request body has been fully received in previous calls to OnRequestBody() virtual void OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) = 0; } ; cHTTPServer(void); - ~cHTTPServer(); + virtual ~cHTTPServer(); /// Initializes the server on the specified ports bool Initialize(const AString & a_PortsIPv4, const AString & a_PortsIPv6); @@ -88,8 +91,9 @@ protected: /// Called by cHTTPConnection when it finishes parsing the request header void NewRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Request); - /// Called by cHTTPConenction when it receives more data for the request body - void RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size); + /** Called by cHTTPConenction when it receives more data for the request body. + May be called multiple times for a single request. */ + void RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size); /// Called by cHTTPConnection when it detects that the request has finished (all of its body has been received) void RequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request); diff --git a/src/HTTPServer/MultipartParser.cpp b/src/HTTPServer/MultipartParser.cpp index 14c2c00fa..309495dd7 100644 --- a/src/HTTPServer/MultipartParser.cpp +++ b/src/HTTPServer/MultipartParser.cpp @@ -97,8 +97,6 @@ cMultipartParser::cMultipartParser(const AString & a_ContentType, cCallbacks & a m_EnvelopeParser(*this), m_HasHadData(false) { - static AString s_Multipart = "multipart/"; - // Check that the content type is multipart: AString ContentType(a_ContentType); if (strncmp(ContentType.c_str(), "multipart/", 10) != 0) @@ -146,7 +144,7 @@ cMultipartParser::cMultipartParser(const AString & a_ContentType, cCallbacks & a -void cMultipartParser::Parse(const char * a_Data, int a_Size) +void cMultipartParser::Parse(const char * a_Data, size_t a_Size) { // Skip parsing if invalid if (!m_IsValid) @@ -160,8 +158,8 @@ void cMultipartParser::Parse(const char * a_Data, int a_Size) { if (m_EnvelopeParser.IsInHeaders()) { - int BytesConsumed = m_EnvelopeParser.Parse(m_IncomingData.data(), m_IncomingData.size()); - if (BytesConsumed < 0) + size_t BytesConsumed = m_EnvelopeParser.Parse(m_IncomingData.data(), m_IncomingData.size()); + if (BytesConsumed == AString::npos) { m_IsValid = false; return; diff --git a/src/HTTPServer/MultipartParser.h b/src/HTTPServer/MultipartParser.h index d853929ed..ad76ad650 100644 --- a/src/HTTPServer/MultipartParser.h +++ b/src/HTTPServer/MultipartParser.h @@ -22,50 +22,53 @@ public: class cCallbacks { public: - /// Called when a new part starts + // Force a virtual destructor in descendants: + virtual ~cCallbacks() {} + + /** Called when a new part starts */ virtual void OnPartStart(void) = 0; - /// Called when a complete header line is received for a part + /** Called when a complete header line is received for a part */ virtual void OnPartHeader(const AString & a_Key, const AString & a_Value) = 0; - /// Called when body for a part is received - virtual void OnPartData(const char * a_Data, int a_Size) = 0; + /** Called when body for a part is received */ + virtual void OnPartData(const char * a_Data, size_t a_Size) = 0; - /// Called when the current part ends + /** Called when the current part ends */ virtual void OnPartEnd(void) = 0; } ; - /// Creates the parser, expects to find the boundary in a_ContentType + /** Creates the parser, expects to find the boundary in a_ContentType */ cMultipartParser(const AString & a_ContentType, cCallbacks & a_Callbacks); - /// Parses more incoming data - void Parse(const char * a_Data, int a_Size); + /** Parses more incoming data */ + void Parse(const char * a_Data, size_t a_Size); protected: - /// The callbacks to call for various parsing events + /** The callbacks to call for various parsing events */ cCallbacks & m_Callbacks; - /// True if the data parsed so far is valid; if false, further parsing is skipped + /** True if the data parsed so far is valid; if false, further parsing is skipped */ bool m_IsValid; - /// Parser for each part's envelope + /** Parser for each part's envelope */ cEnvelopeParser m_EnvelopeParser; - /// Buffer for the incoming data until it is parsed + /** Buffer for the incoming data until it is parsed */ AString m_IncomingData; - /// The boundary, excluding both the initial "--" and the terminating CRLF + /** The boundary, excluding both the initial "--" and the terminating CRLF */ AString m_Boundary; - /// Set to true if some data for the current part has already been signalized to m_Callbacks. Used for proper CRLF inserting. + /** Set to true if some data for the current part has already been signalized to m_Callbacks. Used for proper CRLF inserting. */ bool m_HasHadData; - /// Parse one line of incoming data. The CRLF has already been stripped from a_Data / a_Size - void ParseLine(const char * a_Data, int a_Size); + /** Parse one line of incoming data. The CRLF has already been stripped from a_Data / a_Size */ + void ParseLine(const char * a_Data, size_t a_Size); - /// Parse one line of incoming data in the headers section of a part. The CRLF has already been stripped from a_Data / a_Size - void ParseHeaderLine(const char * a_Data, int a_Size); + /** Parse one line of incoming data in the headers section of a part. The CRLF has already been stripped from a_Data / a_Size */ + void ParseHeaderLine(const char * a_Data, size_t a_Size); // cEnvelopeParser overrides: virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) override; diff --git a/src/HTTPServer/NameValueParser.cpp b/src/HTTPServer/NameValueParser.cpp index 9ea8594ae..3f6c17dda 100644 --- a/src/HTTPServer/NameValueParser.cpp +++ b/src/HTTPServer/NameValueParser.cpp @@ -24,7 +24,7 @@ public: // Now try parsing char-by-char, to debug transitions across datachunk boundaries: cNameValueParser Parser2; - for (int i = 0; i < sizeof(Data) - 1; i++) + for (size_t i = 0; i < sizeof(Data) - 1; i++) { Parser2.Parse(Data + i, 1); } @@ -82,7 +82,7 @@ cNameValueParser::cNameValueParser(bool a_AllowsKeyOnly) : -cNameValueParser::cNameValueParser(const char * a_Data, int a_Size, bool a_AllowsKeyOnly) : +cNameValueParser::cNameValueParser(const char * a_Data, size_t a_Size, bool a_AllowsKeyOnly) : m_State(psKeySpace), m_AllowsKeyOnly(a_AllowsKeyOnly) { @@ -93,12 +93,12 @@ cNameValueParser::cNameValueParser(const char * a_Data, int a_Size, bool a_Allow -void cNameValueParser::Parse(const char * a_Data, int a_Size) +void cNameValueParser::Parse(const char * a_Data, size_t a_Size) { ASSERT(m_State != psFinished); // Calling Parse() after Finish() is wrong! int Last = 0; - for (int i = 0; i < a_Size;) + for (size_t i = 0; i < a_Size;) { switch (m_State) { diff --git a/src/HTTPServer/NameValueParser.h b/src/HTTPServer/NameValueParser.h index 07dc0b942..9794614fa 100644 --- a/src/HTTPServer/NameValueParser.h +++ b/src/HTTPServer/NameValueParser.h @@ -21,10 +21,10 @@ public: cNameValueParser(bool a_AllowsKeyOnly = true); /// Creates an empty parser, then parses the data given. Doesn't call Finish(), so more data can be parsed later - cNameValueParser(const char * a_Data, int a_Size, bool a_AllowsKeyOnly = true); + cNameValueParser(const char * a_Data, size_t a_Size, bool a_AllowsKeyOnly = true); /// Parses the data given - void Parse(const char * a_Data, int a_Size); + void Parse(const char * a_Data, size_t a_Size); /// Notifies the parser that no more data will be coming. Returns true if the parser state is valid bool Finish(void); diff --git a/src/Inventory.h b/src/Inventory.h index fd2089a13..1ad7c4776 100644 --- a/src/Inventory.h +++ b/src/Inventory.h @@ -52,6 +52,8 @@ public: cInventory(cPlayer & a_Owner); + virtual ~cInventory() {} + // tolua_begin /// Removes all items from the entire inventory diff --git a/src/Item.h b/src/Item.h index 4bdfb12dd..910ecb382 100644 --- a/src/Item.h +++ b/src/Item.h @@ -209,7 +209,7 @@ public: void Add (const cItem & a_Item) {push_back(a_Item); } void Delete(int a_Idx); void Clear (void) {clear(); } - int Size (void) {return size(); } + size_t Size (void) {return size(); } void Set (int a_Idx, short a_ItemType, char a_ItemCount, short a_ItemDamage); void Add (short a_ItemType, char a_ItemCount, short a_ItemDamage) diff --git a/src/ItemGrid.h b/src/ItemGrid.h index b344e3daf..c34d5e9e2 100644 --- a/src/ItemGrid.h +++ b/src/ItemGrid.h @@ -20,11 +20,13 @@ class cItemGrid public: // tolua_end - /// This class is used as a callback for when a slot changes + /** This class is used as a callback for when a slot changes */ class cListener { public: - /// Called whenever a slot changes + virtual ~cListener() {} + + /** Called whenever a slot changes */ virtual void OnSlotChanged(cItemGrid * a_ItemGrid, int a_SlotNum) = 0; } ; typedef std::vector<cListener *> cListeners; @@ -38,12 +40,12 @@ public: int GetHeight (void) const { return m_Height; } int GetNumSlots(void) const { return m_NumSlots; } - /// Converts XY coords into slot number; returns -1 on invalid coords + /** Converts XY coords into slot number; returns -1 on invalid coords */ int GetSlotNum(int a_X, int a_Y) const; // tolua_end - /// Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp + /** Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp */ void GetSlotCoords(int a_SlotNum, int & a_X, int & a_Y) const; // tolua_begin @@ -62,16 +64,16 @@ public: void EmptySlot(int a_X, int a_Y); void EmptySlot(int a_SlotNum); - /// Returns true if the specified slot is empty or the slot doesn't exist + /** Returns true if the specified slot is empty or the slot doesn't exist */ bool IsSlotEmpty(int a_SlotNum) const; - /// Returns true if the specified slot is empty or the slot doesn't exist + /** Returns true if the specified slot is empty or the slot doesn't exist */ bool IsSlotEmpty(int a_X, int a_Y) const; - /// Sets all items as empty + /** Sets all items as empty */ void Clear(void); - /// Returns number of items out of a_ItemStack that can fit in the storage + /** Returns number of items out of a_ItemStack that can fit in the storage */ int HowManyCanFit(const cItem & a_ItemStack, bool a_AllowNewStacks = true); /** Adds as many items out of a_ItemStack as can fit. @@ -117,37 +119,37 @@ public: */ cItem RemoveOneItem(int a_X, int a_Y); - /// Returns the number of items of type a_Item that are stored + /** Returns the number of items of type a_Item that are stored */ int HowManyItems(const cItem & a_Item); - /// Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack + /** Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack */ bool HasItems(const cItem & a_ItemStack); - /// Returns the index of the first empty slot; -1 if all full + /** Returns the index of the first empty slot; -1 if all full */ int GetFirstEmptySlot(void) const; - /// Returns the index of the first non-empty slot; -1 if all empty + /** Returns the index of the first non-empty slot; -1 if all empty */ int GetFirstUsedSlot(void) const; - /// Returns the index of the last empty slot; -1 if all full + /** Returns the index of the last empty slot; -1 if all full */ int GetLastEmptySlot(void) const; - /// Returns the index of the last used slot; -1 if all empty + /** Returns the index of the last used slot; -1 if all empty */ int GetLastUsedSlot(void) const; - /// Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked) + /** Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked) */ int GetNextEmptySlot(int a_StartFrom) const; - /// Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked) + /** Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked) */ int GetNextUsedSlot(int a_StartFrom) const; - /// Copies the contents into a cItems object; preserves the original a_Items contents + /** Copies the contents into a cItems object; preserves the original a_Items contents */ void CopyToItems(cItems & a_Items) const; - /// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) + /** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */ bool DamageItem(int a_SlotNum, short a_Amount); - /// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) + /** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */ bool DamageItem(int a_X, int a_Y, short a_Amount); // tolua_end @@ -159,10 +161,10 @@ public: */ void GenerateRandomLootWithBooks(const cLootProbab * a_LootProbabs, size_t a_CountLootProbabs, int a_NumSlots, int a_Seed); - /// Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback! + /** Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback! */ void AddListener(cListener & a_Listener); - /// Removes a slot-change-callback. Must not be called from within the listener callback! + /** Removes a slot-change-callback. Must not be called from within the listener callback! */ void RemoveListener(cListener & a_Listener); // tolua_begin @@ -177,7 +179,7 @@ protected: cCriticalSection m_CSListeners; ///< CS that guards the m_Listeners against multi-thread access bool m_IsInTriggerListeners; ///< Set to true while TriggerListeners is running, to detect attempts to manipulate listener list while triggerring - /// Calls all m_Listeners for the specified slot number + /** Calls all m_Listeners for the specified slot number */ void TriggerListeners(int a_SlotNum); /** Adds up to a_Num items out of a_ItemStack, as many as can fit, in specified slot diff --git a/src/Items/ItemBoat.h b/src/Items/ItemBoat.h index a28ec8e22..42f4ffc8f 100644 --- a/src/Items/ItemBoat.h +++ b/src/Items/ItemBoat.h @@ -39,12 +39,20 @@ public: public cBlockTracer::cCallbacks { public: - Vector3d Pos; - virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override + Vector3d m_Pos; + bool m_HasFound; + + cCallbacks(void) : + m_HasFound(false) { - if (a_BlockType != E_BLOCK_AIR) + } + + virtual bool OnNextBlock(int a_CBBlockX, int a_CBBlockY, int a_CBBlockZ, BLOCKTYPE a_CBBlockType, NIBBLETYPE a_CBBlockMeta, char a_CBEntryFace) override + { + if (a_CBBlockType != E_BLOCK_AIR) { - Pos = Vector3d(a_BlockX, a_BlockY, a_BlockZ); + m_Pos.Set(a_CBBlockX, a_CBBlockY, a_CBBlockZ); + m_HasFound = true; return true; } return false; @@ -57,15 +65,15 @@ public: Tracer.Trace(Start.x, Start.y, Start.z, End.x, End.y, End.z); - double x = Callbacks.Pos.x; - double y = Callbacks.Pos.y; - double z = Callbacks.Pos.z; - - if ((x == 0) && (y == 0) && (z == 0)) + if (!Callbacks.m_HasFound) { return false; } + double x = Callbacks.m_Pos.x; + double y = Callbacks.m_Pos.y; + double z = Callbacks.m_Pos.z; + cBoat * Boat = new cBoat(x + 0.5, y + 1, z + 0.5); Boat->Initialize(a_World); diff --git a/src/Items/ItemBucket.h b/src/Items/ItemBucket.h index 72cb8fa0a..68c89dd85 100644 --- a/src/Items/ItemBucket.h +++ b/src/Items/ItemBucket.h @@ -172,12 +172,12 @@ public: virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override { - if (a_BlockMeta != 0) // Even if it was a water block it would not be a source. - { - return false; - } if (IsBlockWater(a_BlockType) || IsBlockLava(a_BlockType)) { + if (a_BlockMeta != 0) // GetBlockFromTrace is called for scooping up fluids; the hit block should be a source + { + return false; + } m_HasHitFluid = true; m_Pos.Set(a_BlockX, a_BlockY, a_BlockZ); return true; diff --git a/src/Items/ItemEmptyMap.h b/src/Items/ItemEmptyMap.h index f0b1e1424..953673382 100644 --- a/src/Items/ItemEmptyMap.h +++ b/src/Items/ItemEmptyMap.h @@ -55,7 +55,7 @@ public: return true; } - a_Player->GetInventory().AddItem(cItem(E_ITEM_MAP, 1, NewMap->GetID()), true, true); + a_Player->GetInventory().AddItem(cItem(E_ITEM_MAP, 1, (short)(NewMap->GetID() & 0x7fff)), true, true); return true; } diff --git a/src/Items/ItemFishingRod.h b/src/Items/ItemFishingRod.h index 15acbd9fe..0431b88b7 100644 --- a/src/Items/ItemFishingRod.h +++ b/src/Items/ItemFishingRod.h @@ -123,7 +123,7 @@ public: } case 2: { - Drops.Add(cItem(E_ITEM_FISHING_ROD, 1, a_World->GetTickRandomNumber(50))); // Fishing rod with durability. TODO: Enchantments on it + Drops.Add(cItem(E_ITEM_FISHING_ROD, 1, (short)a_World->GetTickRandomNumber(50))); // Fishing rod with durability. TODO: Enchantments on it break; } case 3: @@ -152,7 +152,7 @@ public: } else if (Junk <= 4) { - Drops.Add(cItem(E_ITEM_BOW, 1, a_World->GetTickRandomNumber(64))); + Drops.Add(cItem(E_ITEM_BOW, 1, (short)a_World->GetTickRandomNumber(64))); } else if (Junk <= 9) { diff --git a/src/Items/ItemHandler.cpp b/src/Items/ItemHandler.cpp index 454fabdd7..1e77717e3 100644 --- a/src/Items/ItemHandler.cpp +++ b/src/Items/ItemHandler.cpp @@ -27,6 +27,7 @@ #include "ItemHoe.h" #include "ItemLeaves.h" #include "ItemLighter.h" +#include "ItemLilypad.h" #include "ItemMap.h" #include "ItemMinecart.h" #include "ItemNetherWart.h" @@ -115,6 +116,7 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType) case E_ITEM_FISHING_ROD: return new cItemFishingRodHandler(a_ItemType); case E_ITEM_FLINT_AND_STEEL: return new cItemLighterHandler(a_ItemType); case E_ITEM_FLOWER_POT: return new cItemFlowerPotHandler(a_ItemType); + case E_BLOCK_LILY_PAD: return new cItemLilypadHandler(a_ItemType); case E_ITEM_MAP: return new cItemMapHandler(); case E_ITEM_ITEM_FRAME: return new cItemItemFrameHandler(a_ItemType); case E_ITEM_NETHER_WART: return new cItemNetherWartHandler(a_ItemType); @@ -504,13 +506,13 @@ bool cItemHandler::GetPlacementBlockTypeMeta( { ASSERT(m_ItemType < 256); // Items with IDs above 255 should all be handled by specific handlers - if (m_ItemType > 256) + if (m_ItemType >= 256) { - LOGERROR("%s: Item %d has no valid block!", __FUNCTION__, m_ItemType); + LOGERROR("%s: Item %d is not eligible for direct block placement!", __FUNCTION__, m_ItemType); return false; } - cBlockHandler * BlockH = BlockHandler(m_ItemType); + cBlockHandler * BlockH = BlockHandler((BLOCKTYPE)m_ItemType); cChunkInterface ChunkInterface(a_World->GetChunkMap()); return BlockH->GetPlacementBlockTypeMeta( ChunkInterface, a_Player, diff --git a/src/Items/ItemLilypad.h b/src/Items/ItemLilypad.h new file mode 100644 index 000000000..8fc1d8543 --- /dev/null +++ b/src/Items/ItemLilypad.h @@ -0,0 +1,110 @@ +#pragma once + +#include "ItemHandler.h" +#include "../Entities/Player.h" +#include "Vector3.h" +#include "../LineBlockTracer.h" +#include "BlockInfo.h" + + + + + +class cItemLilypadHandler : + public cItemHandler +{ + typedef cItemHandler super; + +public: + cItemLilypadHandler(int a_ItemType): + super(a_ItemType) + { + + } + + + virtual bool IsPlaceable(void) override + { + return false; // Set as not placeable so OnItemUse is called + } + + + virtual bool OnItemUse(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override + { + if (a_BlockFace > BLOCK_FACE_NONE) + { + // Clicked on the side of a submerged block; vanilla allows placement, so should we + AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_LILY_PAD, 0); + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + } + return true; + } + + class cCallbacks : + public cBlockTracer::cCallbacks + { + public: + cCallbacks(cWorld * a_CBWorld) : + m_HasHitFluid(false), + m_World(a_CBWorld) + { + } + + virtual bool OnNextBlock(int a_CBBlockX, int a_CBBlockY, int a_CBBlockZ, BLOCKTYPE a_CBBlockType, NIBBLETYPE a_CBBlockMeta, char a_CBEntryFace) override + { + if (IsBlockWater(a_CBBlockType)) + { + if ((a_CBBlockMeta != 0) || (a_CBEntryFace == BLOCK_FACE_NONE)) // The hit block should be a source. The FACE_NONE check is clicking whilst submerged + { + return false; + } + AddFaceDirection(a_CBBlockX, a_CBBlockY, a_CBBlockZ, BLOCK_FACE_YP); // Always place pad at top of water block + BLOCKTYPE Block = m_World->GetBlock(a_CBBlockX, a_CBBlockY, a_CBBlockZ); + if ( + !IsBlockWater(Block) && + cBlockInfo::FullyOccupiesVoxel(Block) + ) + { + // Can't place lilypad on air/in another block! + return true; + } + m_HasHitFluid = true; + m_Pos.Set(a_CBBlockX, a_CBBlockY, a_CBBlockZ); + return true; + } + return false; + } + + Vector3i m_Pos; + bool m_HasHitFluid; + cWorld * m_World; + + }; + + cCallbacks Callbacks(a_World); + cLineBlockTracer Tracer(*a_Player->GetWorld(), Callbacks); + Vector3d Start(a_Player->GetEyePosition() + a_Player->GetLookVector()); + Vector3d End(a_Player->GetEyePosition() + a_Player->GetLookVector() * 5); + + Tracer.Trace(Start.x, Start.y, Start.z, End.x, End.y, End.z); + + if (Callbacks.m_HasHitFluid) + { + a_World->SetBlock(Callbacks.m_Pos.x, Callbacks.m_Pos.y, Callbacks.m_Pos.z, E_BLOCK_LILY_PAD, 0); + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + } + return true; + } + + return false; + } +}; + + + + diff --git a/src/Items/ItemMap.h b/src/Items/ItemMap.h index e8ff9da88..056fe0fe7 100644 --- a/src/Items/ItemMap.h +++ b/src/Items/ItemMap.h @@ -29,7 +29,7 @@ public: virtual void OnUpdate(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item) { - cMap * Map = a_World->GetMapManager().GetMapData(a_Item.m_ItemDamage); + cMap * Map = a_World->GetMapManager().GetMapData((unsigned)a_Item.m_ItemDamage); if (Map == NULL) { diff --git a/src/Items/ItemMinecart.h b/src/Items/ItemMinecart.h index bcaa5635a..25500aeb9 100644 --- a/src/Items/ItemMinecart.h +++ b/src/Items/ItemMinecart.h @@ -1,4 +1,3 @@ - // ItemMinecart.h // Declares the various minecart ItemHandlers @@ -72,6 +71,11 @@ public: } } // switch (m_ItemType) Minecart->Initialize(a_World); + + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + } return true; } diff --git a/src/LightingThread.h b/src/LightingThread.h index 198f27248..770ae809f 100644 --- a/src/LightingThread.h +++ b/src/LightingThread.h @@ -160,14 +160,12 @@ protected: inline void PropagateLight( NIBBLETYPE * a_Light, - int a_SrcIdx, int a_DstIdx, + unsigned int a_SrcIdx, unsigned int a_DstIdx, int & a_NumSeedsOut, unsigned char * a_IsSeedOut, unsigned int * a_SeedIdxOut ) { - ASSERT(a_SrcIdx >= 0); - ASSERT(a_SrcIdx < (int)ARRAYCOUNT(m_SkyLight)); - ASSERT(a_DstIdx >= 0); - ASSERT(a_DstIdx < (int)ARRAYCOUNT(m_BlockTypes)); + ASSERT(a_SrcIdx < ARRAYCOUNT(m_SkyLight)); + ASSERT(a_DstIdx < ARRAYCOUNT(m_BlockTypes)); if (a_Light[a_SrcIdx] <= a_Light[a_DstIdx] + cBlockInfo::GetSpreadLightFalloff(m_BlockTypes[a_DstIdx])) { diff --git a/src/LinearUpscale.h b/src/LinearUpscale.h index b337b3219..0b04408cf 100644 --- a/src/LinearUpscale.h +++ b/src/LinearUpscale.h @@ -18,7 +18,7 @@ Therefore, there is no cpp file. InPlace upscaling works on a single array and assumes that the values to work on have already been interspersed into the array to the cell boundaries. -Specifically, a_Array[x * a_AnchorStepX + y * a_AnchorStepY] contains the anchor value. +Specifically, a_Array[x * AnchorStepX + y * AnchorStepY] contains the anchor value. Regular upscaling takes two arrays and "moves" the input from src to dst; src is expected packed. */ @@ -29,46 +29,48 @@ Regular upscaling takes two arrays and "moves" the input from src to dst; src is /** Linearly interpolates values in the array between the equidistant anchor points (upscales). Works in-place (input is already present at the correct output coords) +Uses templates to make it possible for the compiler to further optimizer the loops */ -template<typename TYPE> void LinearUpscale2DArrayInPlace( - TYPE * a_Array, - int a_SizeX, int a_SizeY, // Dimensions of the array - int a_AnchorStepX, int a_AnchorStepY // Distances between the anchor points in each direction -) +template< + int SizeX, int SizeY, // Dimensions of the array + int AnchorStepX, int AnchorStepY, + typename TYPE +> +void LinearUpscale2DArrayInPlace(TYPE * a_Array) { // First interpolate columns where the anchor points are: - int LastYCell = a_SizeY - a_AnchorStepY; - for (int y = 0; y < LastYCell; y += a_AnchorStepY) + int LastYCell = SizeY - AnchorStepY; + for (int y = 0; y < LastYCell; y += AnchorStepY) { - int Idx = a_SizeX * y; - for (int x = 0; x < a_SizeX; x += a_AnchorStepX) + int Idx = SizeX * y; + for (int x = 0; x < SizeX; x += AnchorStepX) { TYPE StartValue = a_Array[Idx]; - TYPE EndValue = a_Array[Idx + a_SizeX * a_AnchorStepY]; + TYPE EndValue = a_Array[Idx + SizeX * AnchorStepY]; TYPE Diff = EndValue - StartValue; - for (int CellY = 1; CellY < a_AnchorStepY; CellY++) + for (int CellY = 1; CellY < AnchorStepY; CellY++) { - a_Array[Idx + a_SizeX * CellY] = StartValue + Diff * CellY / a_AnchorStepY; + a_Array[Idx + SizeX * CellY] = StartValue + Diff * CellY / AnchorStepY; } // for CellY - Idx += a_AnchorStepX; + Idx += AnchorStepX; } // for x } // for y // Now interpolate in rows, each row has values in the anchor columns - int LastXCell = a_SizeX - a_AnchorStepX; - for (int y = 0; y < a_SizeY; y++) + int LastXCell = SizeX - AnchorStepX; + for (int y = 0; y < SizeY; y++) { - int Idx = a_SizeX * y; - for (int x = 0; x < LastXCell; x += a_AnchorStepX) + int Idx = SizeX * y; + for (int x = 0; x < LastXCell; x += AnchorStepX) { TYPE StartValue = a_Array[Idx]; - TYPE EndValue = a_Array[Idx + a_AnchorStepX]; + TYPE EndValue = a_Array[Idx + AnchorStepX]; TYPE Diff = EndValue - StartValue; - for (int CellX = 1; CellX < a_AnchorStepX; CellX++) + for (int CellX = 1; CellX < AnchorStepX; CellX++) { - a_Array[Idx + CellX] = StartValue + CellX * Diff / a_AnchorStepX; + a_Array[Idx + CellX] = StartValue + CellX * Diff / AnchorStepX; } // for CellY - Idx += a_AnchorStepX; + Idx += AnchorStepX; } } } diff --git a/src/MCLogger.cpp b/src/MCLogger.cpp index 4f3e5dc0f..80fa7b173 100644 --- a/src/MCLogger.cpp +++ b/src/MCLogger.cpp @@ -93,25 +93,30 @@ void cMCLogger::InitLog(const AString & a_FileName) -void cMCLogger::LogSimple(const char* a_Text, int a_LogType /* = 0 */ ) +void cMCLogger::LogSimple(const char * a_Text, eLogLevel a_LogLevel) { - switch( a_LogType ) + switch (a_LogLevel) { - case 0: + case llRegular: + { LOG("%s", a_Text); break; - case 1: + } + case llInfo: + { LOGINFO("%s", a_Text); break; - case 2: + } + case llWarning: + { LOGWARN("%s", a_Text); break; - case 3: + } + case llError: + { LOGERROR("%s", a_Text); break; - default: - LOG("(#%d#: %s", a_LogType, a_Text); - break; + } } } diff --git a/src/MCLogger.h b/src/MCLogger.h index 996e60329..c0150c124 100644 --- a/src/MCLogger.h +++ b/src/MCLogger.h @@ -10,25 +10,36 @@ class cLog; -class cMCLogger // tolua_export -{ // tolua_export -public: // tolua_export - /// Creates a logger with the default filename, "logs/LOG_<timestamp>.log" +// tolua_begin +class cMCLogger +{ +public: + enum eLogLevel + { + llRegular, + llInfo, + llWarning, + llError, + }; + // tolua_end + + /** Creates a logger with the default filename, "logs/LOG_<timestamp>.log" */ cMCLogger(void); - /// Creates a logger with the specified filename inside "logs" folder + /** Creates a logger with the specified filename inside "logs" folder */ cMCLogger(const AString & a_FileName); // tolua_export ~cMCLogger(); // tolua_export - void Log(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Info(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Warn(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Error(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0); + void Log (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); + void Info (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); + void Warn (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); + void Error(const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void LogSimple(const char* a_Text, int a_LogType = 0 ); // tolua_export + /** Logs the simple text message at the specified log level. */ + void LogSimple(const char * a_Text, eLogLevel a_LogLevel = llRegular); // tolua_export - static cMCLogger* GetInstance(); + static cMCLogger * GetInstance(); private: enum eColorScheme { diff --git a/src/MobSpawner.cpp b/src/MobSpawner.cpp index a0d0f5c54..05da5d01c 100644 --- a/src/MobSpawner.cpp +++ b/src/MobSpawner.cpp @@ -129,6 +129,11 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R BLOCKTYPE TargetBlock = E_BLOCK_AIR; if (m_AllowedTypes.find(a_MobType) != m_AllowedTypes.end() && a_Chunk->UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, TargetBlock)) { + if ((a_RelY + 1 > cChunkDef::Height) || (a_RelY - 1 < 0)) + { + return false; + } + NIBBLETYPE BlockLight = a_Chunk->GetBlockLight(a_RelX, a_RelY, a_RelZ); NIBBLETYPE SkyLight = a_Chunk->GetSkyLight(a_RelX, a_RelY, a_RelZ); BLOCKTYPE BlockAbove = a_Chunk->GetBlock(a_RelX, a_RelY + 1, a_RelZ); @@ -200,7 +205,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R case cMonster::mtSpider: { bool CanSpawn = true; - bool HaveFloor = false; + bool HasFloor = false; for (int x = 0; x < 2; ++x) { for(int z = 0; z < 2; ++z) @@ -211,8 +216,8 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R { return false; } - HaveFloor = ( - HaveFloor || + HasFloor = ( + HasFloor || ( a_Chunk->UnboundedRelGetBlockType(a_RelX + x, a_RelY - 1, a_RelZ + z, TargetBlock) && !cBlockInfo::IsTransparent(TargetBlock) @@ -220,7 +225,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R ); } } - return CanSpawn && HaveFloor && (SkyLight <= 7) && (BlockLight <= 7); + return CanSpawn && HasFloor && (SkyLight <= 7) && (BlockLight <= 7); } case cMonster::mtCreeper: diff --git a/src/Mobs/Blaze.cpp b/src/Mobs/Blaze.cpp index ac42cf40b..84ff8929b 100644 --- a/src/Mobs/Blaze.cpp +++ b/src/Mobs/Blaze.cpp @@ -53,4 +53,4 @@ void cBlaze::Attack(float a_Dt) m_AttackInterval = 0.0; // ToDo: Shoot 3 fireballs instead of 1. } -}
\ No newline at end of file +} diff --git a/src/Mobs/Blaze.h b/src/Mobs/Blaze.h index cdb3a1306..5970451c7 100644 --- a/src/Mobs/Blaze.h +++ b/src/Mobs/Blaze.h @@ -20,7 +20,3 @@ public: virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override; virtual void Attack(float a_Dt) override; } ; - - - - diff --git a/src/Mobs/Monster.cpp b/src/Mobs/Monster.cpp index 16d6aed1f..aa6071515 100644 --- a/src/Mobs/Monster.cpp +++ b/src/Mobs/Monster.cpp @@ -111,9 +111,9 @@ void cMonster::SpawnOn(cClientHandle & a_Client) void cMonster::TickPathFinding() { - int PosX = (int)floor(GetPosX()); - int PosY = (int)floor(GetPosY()); - int PosZ = (int)floor(GetPosZ()); + const int PosX = (int)floor(GetPosX()); + const int PosY = (int)floor(GetPosY()); + const int PosZ = (int)floor(GetPosZ()); m_FinalDestination.y = (double)FindFirstNonAirBlockPosition(m_FinalDestination.x, m_FinalDestination.z); @@ -130,14 +130,16 @@ void cMonster::TickPathFinding() { 0, 1}, { 0,-1}, } ; + + if ((PosY - 1 < 0) || (PosY + 2 > cChunkDef::Height) /* PosY + 1 will never be true if PosY + 2 is not */) + { + // Too low/high, can't really do anything + FinishPathFinding(); + return; + } for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) { - if ((gCrossCoords[i].x + PosX == PosX) && (gCrossCoords[i].z + PosZ == PosZ)) - { - continue; - } - if (IsCoordinateInTraversedList(Vector3i(gCrossCoords[i].x + PosX, PosY, gCrossCoords[i].z + PosZ))) { continue; @@ -758,6 +760,7 @@ cMonster::eFamily cMonster::FamilyFromType(eType a_Type) case mtSquid: return mfWater; case mtVillager: return mfPassive; case mtWitch: return mfHostile; + case mtWither: return mfHostile; case mtWolf: return mfHostile; case mtZombie: return mfHostile; case mtZombiePigman: return mfHostile; diff --git a/src/Mobs/Skeleton.cpp b/src/Mobs/Skeleton.cpp index 47fcdbb26..1685f40c5 100644 --- a/src/Mobs/Skeleton.cpp +++ b/src/Mobs/Skeleton.cpp @@ -88,4 +88,4 @@ void cSkeleton::Attack(float a_Dt) m_World->BroadcastSpawnEntity(*Arrow); m_AttackInterval = 0.0; } -}
\ No newline at end of file +} diff --git a/src/Mobs/Villager.h b/src/Mobs/Villager.h index b99ae876f..5bba4d4ba 100644 --- a/src/Mobs/Villager.h +++ b/src/Mobs/Villager.h @@ -29,7 +29,7 @@ public: CLASS_PROTODEF(cVillager); - // Override functions + // cEntity overrides virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override; virtual void Tick (float a_Dt, cChunk & a_Chunk) override; diff --git a/src/Mobs/Wither.cpp b/src/Mobs/Wither.cpp index c46e0beab..8f5d28b68 100644 --- a/src/Mobs/Wither.cpp +++ b/src/Mobs/Wither.cpp @@ -2,14 +2,90 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "Wither.h" +#include "../World.h" cWither::cWither(void) : - super("Wither", mtWither, "mob.wither.hurt", "mob.wither.death", 0.9, 4.0) + super("Wither", mtWither, "mob.wither.hurt", "mob.wither.death", 0.9, 4.0), + m_InvulnerableTicks(220) { + SetMaxHealth(300); +} + + + + + +bool cWither::IsArmored(void) const +{ + return GetHealth() <= (GetMaxHealth() / 2); +} + + + + + +bool cWither::Initialize(cWorld * a_World) +{ + // Set health before BroadcastSpawnEntity() + SetHealth(GetMaxHealth() / 3); + + return super::Initialize(a_World); +} + + + + + +void cWither::DoTakeDamage(TakeDamageInfo & a_TDI) +{ + if (a_TDI.DamageType == dtDrowning) + { + return; + } + + if (m_InvulnerableTicks > 0) + { + return; + } + + if (IsArmored() && (a_TDI.DamageType == dtRangedAttack)) + { + return; + } + + super::DoTakeDamage(a_TDI); +} + + + + + +void cWither::Tick(float a_Dt, cChunk & a_Chunk) +{ + super::Tick(a_Dt, a_Chunk); + + if (m_InvulnerableTicks > 0) + { + unsigned int NewTicks = m_InvulnerableTicks - 1; + + if (NewTicks == 0) + { + m_World->DoExplosionAt(7.0, GetPosX(), GetPosY(), GetPosZ(), false, esWitherBirth, this); + } + + m_InvulnerableTicks = NewTicks; + + if ((NewTicks % 10) == 0) + { + Heal(10); + } + } + + m_World->BroadcastEntityMetadata(*this); } diff --git a/src/Mobs/Wither.h b/src/Mobs/Wither.h index 56effc6bb..bc78bfaad 100644 --- a/src/Mobs/Wither.h +++ b/src/Mobs/Wither.h @@ -16,8 +16,25 @@ public: cWither(void); CLASS_PROTODEF(cWither); + + unsigned int GetNumInvulnerableTicks(void) const { return m_InvulnerableTicks; } + + void SetNumInvulnerableTicks(unsigned int a_Ticks) { m_InvulnerableTicks = a_Ticks; } + + /** Returns whether the wither is invulnerable to arrows. */ + bool IsArmored(void) const; + // cEntity overrides + virtual bool Initialize(cWorld * a_World) override; virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override; + virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override; + virtual void Tick(float a_Dt, cChunk & a_Chunk) override; + +private: + + /** The number of ticks of invulnerability left after being initially created. Zero once invulnerability has expired. */ + unsigned int m_InvulnerableTicks; + } ; diff --git a/src/Noise.cpp b/src/Noise.cpp index a97ea70c6..32922c8f3 100644 --- a/src/Noise.cpp +++ b/src/Noise.cpp @@ -425,7 +425,7 @@ void cCubicCell3D::Move(int a_NewFloorX, int a_NewFloorY, int a_NewFloorZ) /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cNoise: -cNoise::cNoise(unsigned int a_Seed) : +cNoise::cNoise(int a_Seed) : m_Seed(a_Seed) { } diff --git a/src/Noise.h b/src/Noise.h index ea72c64e9..62004503f 100644 --- a/src/Noise.h +++ b/src/Noise.h @@ -25,7 +25,7 @@ class cNoise { public: - cNoise(unsigned int a_Seed); + cNoise(int a_Seed); cNoise(const cNoise & a_Noise); // The following functions, if not marked INLINE, are about 20 % slower @@ -47,14 +47,14 @@ public: NOISE_DATATYPE CubicNoise3D (NOISE_DATATYPE a_X, NOISE_DATATYPE a_Y, NOISE_DATATYPE a_Z) const; - void SetSeed(unsigned int a_Seed) { m_Seed = a_Seed; } + void SetSeed(int a_Seed) { m_Seed = a_Seed; } INLINE static NOISE_DATATYPE CubicInterpolate (NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_C, NOISE_DATATYPE a_D, NOISE_DATATYPE a_Pct); INLINE static NOISE_DATATYPE CosineInterpolate(NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_Pct); INLINE static NOISE_DATATYPE LinearInterpolate(NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_Pct); private: - unsigned int m_Seed; + int m_Seed; } ; diff --git a/src/OSSupport/Errors.cpp b/src/OSSupport/Errors.cpp index 2e05f1df1..6072b6ac6 100644 --- a/src/OSSupport/Errors.cpp +++ b/src/OSSupport/Errors.cpp @@ -22,7 +22,7 @@ AString GetOSErrorString( int a_ErrNo ) // According to http://linux.die.net/man/3/strerror_r there are two versions of strerror_r(): - #if ( _GNU_SOURCE ) && !defined(ANDROID_NDK) // GNU version of strerror_r() + #if !defined(__APPLE__) && ( _GNU_SOURCE ) && !defined(ANDROID_NDK) // GNU version of strerror_r() char * res = strerror_r( errno, buffer, ARRAYCOUNT(buffer) ); if( res != NULL ) diff --git a/src/OSSupport/File.cpp b/src/OSSupport/File.cpp index 17070030f..7f0f0ad2f 100644 --- a/src/OSSupport/File.cpp +++ b/src/OSSupport/File.cpp @@ -152,7 +152,7 @@ int cFile::Read (void * iBuffer, int iNumBytes) return -1; } - return fread(iBuffer, 1, iNumBytes, m_File); // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count + return (int)fread(iBuffer, 1, (size_t)iNumBytes, m_File); // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count } @@ -168,7 +168,7 @@ int cFile::Write(const void * iBuffer, int iNumBytes) return -1; } - int res = fwrite(iBuffer, 1, iNumBytes, m_File); // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count + int res = (int)fwrite(iBuffer, 1, (size_t)iNumBytes, m_File); // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count return res; } @@ -189,7 +189,7 @@ int cFile::Seek (int iPosition) { return -1; } - return ftell(m_File); + return (int)ftell(m_File); } @@ -206,7 +206,7 @@ int cFile::Tell (void) const return -1; } - return ftell(m_File); + return (int)ftell(m_File); } @@ -222,7 +222,7 @@ int cFile::GetSize(void) const return -1; } - int CurPos = ftell(m_File); + int CurPos = Tell(); if (CurPos < 0) { return -1; @@ -231,8 +231,8 @@ int cFile::GetSize(void) const { return -1; } - int res = ftell(m_File); - if (fseek(m_File, CurPos, SEEK_SET) != 0) + int res = Tell(); + if (fseek(m_File, (long)CurPos, SEEK_SET) != 0) { return -1; } @@ -255,7 +255,7 @@ int cFile::ReadRestOfFile(AString & a_Contents) int DataSize = GetSize() - Tell(); // HACK: This depends on the internal knowledge that AString's data() function returns the internal buffer directly - a_Contents.assign(DataSize, '\0'); + a_Contents.assign((size_t)DataSize, '\0'); return Read((void *)a_Contents.data(), DataSize); } @@ -350,7 +350,7 @@ int cFile::GetSize(const AString & a_FileName) struct stat st; if (stat(a_FileName.c_str(), &st) == 0) { - return st.st_size; + return (int)st.st_size; } return -1; } @@ -456,7 +456,7 @@ int cFile::Printf(const char * a_Fmt, ...) va_start(args, a_Fmt); AppendVPrintf(buf, a_Fmt, args); va_end(args); - return Write(buf.c_str(), buf.length()); + return Write(buf.c_str(), (int)buf.length()); } diff --git a/src/OSSupport/GZipFile.cpp b/src/OSSupport/GZipFile.cpp index b13e519e0..7a8433f4f 100644 --- a/src/OSSupport/GZipFile.cpp +++ b/src/OSSupport/GZipFile.cpp @@ -78,7 +78,7 @@ int cGZipFile::ReadRestOfFile(AString & a_Contents) while ((NumBytesRead = gzread(m_File, Buffer, sizeof(Buffer))) > 0) { TotalBytes += NumBytesRead; - a_Contents.append(Buffer, NumBytesRead); + a_Contents.append(Buffer, (size_t)NumBytesRead); } // NumBytesRead is < 0 on error return (NumBytesRead >= 0) ? TotalBytes : NumBytesRead; @@ -102,7 +102,7 @@ bool cGZipFile::Write(const char * a_Contents, int a_Size) return false; } - return (gzwrite(m_File, a_Contents, a_Size) != 0); + return (gzwrite(m_File, a_Contents, (unsigned int)a_Size) != 0); } diff --git a/src/OSSupport/ListenThread.h b/src/OSSupport/ListenThread.h index 4e337d814..b2d806c82 100644 --- a/src/OSSupport/ListenThread.h +++ b/src/OSSupport/ListenThread.h @@ -29,43 +29,45 @@ class cListenThread : typedef cIsThread super; public: - /// Used as the callback for connection events + /** Used as the callback for connection events */ class cCallback { public: - /// This callback is called whenever a socket connection is accepted + virtual ~cCallback() {} + + /** This callback is called whenever a socket connection is accepted */ virtual void OnConnectionAccepted(cSocket & a_Socket) = 0; } ; cListenThread(cCallback & a_Callback, cSocket::eFamily a_Family, const AString & a_ServiceName = ""); ~cListenThread(); - /// Creates all the sockets, returns trus if successful, false if not. + /** Creates all the sockets, returns trus if successful, false if not. */ bool Initialize(const AString & a_PortsString); bool Start(void); void Stop(void); - /// Call before Initialize() to set the "reuse" flag on the sockets + /** Call before Initialize() to set the "reuse" flag on the sockets */ void SetReuseAddr(bool a_Reuse = true); protected: typedef std::vector<cSocket> cSockets; - /// The callback which to notify of incoming connections + /** The callback which to notify of incoming connections */ cCallback & m_Callback; - /// Socket address family to use + /** Socket address family to use */ cSocket::eFamily m_Family; - /// Sockets that are being monitored + /** Sockets that are being monitored */ cSockets m_Sockets; - /// If set to true, the SO_REUSEADDR socket option is set to true + /** If set to true, the SO_REUSEADDR socket option is set to true */ bool m_ShouldReuseAddr; - /// Name of the service that's listening on the ports; for logging purposes only + /** Name of the service that's listening on the ports; for logging purposes only */ AString m_ServiceName; diff --git a/src/OSSupport/Sleep.h b/src/OSSupport/Sleep.h index 5298c15da..0ec0adf9d 100644 --- a/src/OSSupport/Sleep.h +++ b/src/OSSupport/Sleep.h @@ -4,4 +4,4 @@ class cSleep { public: static void MilliSleep( unsigned int a_MilliSeconds ); -};
\ No newline at end of file +}; diff --git a/src/OSSupport/SocketThreads.h b/src/OSSupport/SocketThreads.h index b2eb5950f..679e374e1 100644 --- a/src/OSSupport/SocketThreads.h +++ b/src/OSSupport/SocketThreads.h @@ -64,7 +64,7 @@ public: virtual ~cCallback() {} /** Called when data is received from the remote party */ - virtual void DataReceived(const char * a_Data, int a_Size) = 0; + virtual void DataReceived(const char * a_Data, size_t a_Size) = 0; /** Called when data can be sent to remote party The function is supposed to *set* outgoing data to a_Data (overwrite) */ diff --git a/src/OSSupport/Thread.h b/src/OSSupport/Thread.h index 3c9316424..4153b2427 100644 --- a/src/OSSupport/Thread.h +++ b/src/OSSupport/Thread.h @@ -23,4 +23,4 @@ private: cEvent* m_StopEvent; AString m_ThreadName; -};
\ No newline at end of file +}; diff --git a/src/Protocol/ChunkDataSerializer.cpp b/src/Protocol/ChunkDataSerializer.cpp index 78318a5ee..ebe61631b 100644 --- a/src/Protocol/ChunkDataSerializer.cpp +++ b/src/Protocol/ChunkDataSerializer.cpp @@ -105,7 +105,7 @@ void cChunkDataSerializer::Serialize29(AString & a_Data) a_Data.append((const char *)&BitMap1, sizeof(short)); a_Data.append((const char *)&BitMap2, sizeof(short)); - Int32 CompressedSizeBE = htonl(CompressedSize); + UInt32 CompressedSizeBE = htonl((UInt32)CompressedSize); a_Data.append((const char *)&CompressedSizeBE, sizeof(CompressedSizeBE)); Int32 UnusedInt32 = 0; @@ -163,7 +163,7 @@ void cChunkDataSerializer::Serialize39(AString & a_Data) a_Data.append((const char *)&BitMap1, sizeof(short)); a_Data.append((const char *)&BitMap2, sizeof(short)); - Int32 CompressedSizeBE = htonl(CompressedSize); + UInt32 CompressedSizeBE = htonl((UInt32)CompressedSize); a_Data.append((const char *)&CompressedSizeBE, sizeof(CompressedSizeBE)); // Unlike 29, 39 doesn't have the "unused" int diff --git a/src/Protocol/Protocol.h b/src/Protocol/Protocol.h index d3383bf0d..ae06f2f9e 100644 --- a/src/Protocol/Protocol.h +++ b/src/Protocol/Protocol.h @@ -132,7 +132,7 @@ protected: cCriticalSection m_CSPacket; //< Each SendXYZ() function must acquire this CS in order to send the whole packet at once /// A generic data-sending routine, all outgoing packet data needs to be routed through this so that descendants may override it - virtual void SendData(const char * a_Data, int a_Size) = 0; + virtual void SendData(const char * a_Data, size_t a_Size) = 0; /// Called after writing each packet, enables descendants to flush their buffers virtual void Flush(void) {}; @@ -143,10 +143,15 @@ protected: SendData((const char *)&a_Value, 1); } + void WriteChar(char a_Value) + { + SendData(&a_Value, 1); + } + void WriteShort(short a_Value) { - a_Value = htons(a_Value); - SendData((const char *)&a_Value, 2); + u_short Value = htons((u_short)a_Value); + SendData((const char *)&Value, 2); } /* @@ -159,8 +164,8 @@ protected: void WriteInt(int a_Value) { - a_Value = htonl(a_Value); - SendData((const char *)&a_Value, 4); + u_long Value = htonl((u_long)a_Value); + SendData((const char *)&Value, 4); } void WriteUInt(unsigned int a_Value) @@ -171,19 +176,19 @@ protected: void WriteInt64 (Int64 a_Value) { - a_Value = HostToNetwork8(&a_Value); - SendData((const char *)&a_Value, 8); + UInt64 Value = HostToNetwork8(&a_Value); + SendData((const char *)Value, 8); } void WriteFloat (float a_Value) { - unsigned int val = HostToNetwork4(&a_Value); + UInt32 val = HostToNetwork4(&a_Value); SendData((const char *)&val, 4); } void WriteDouble(double a_Value) { - unsigned long long val = HostToNetwork8(&a_Value); + UInt64 val = HostToNetwork8(&a_Value); SendData((const char *)&val, 8); } @@ -191,7 +196,7 @@ protected: { AString UTF16; UTF8ToRawBEUTF16(a_Value.c_str(), a_Value.length(), UTF16); - WriteShort((unsigned short)(UTF16.size() / 2)); + WriteShort((short)(UTF16.size() / 2)); SendData(UTF16.data(), UTF16.size()); } @@ -211,7 +216,7 @@ protected: { // A 32-bit integer can be encoded by at most 5 bytes: unsigned char b[5]; - int idx = 0; + size_t idx = 0; do { b[idx] = (a_Value & 0x7f) | ((a_Value > 0x7f) ? 0x80 : 0x00); @@ -224,7 +229,7 @@ protected: void WriteVarUTF8String(const AString & a_String) { - WriteVarInt(a_String.size()); + WriteVarInt((UInt32)a_String.size()); SendData(a_String.data(), a_String.size()); } } ; diff --git a/src/Protocol/Protocol125.cpp b/src/Protocol/Protocol125.cpp index 69f4934d8..bf946ef19 100644 --- a/src/Protocol/Protocol125.cpp +++ b/src/Protocol/Protocol125.cpp @@ -161,8 +161,8 @@ void cProtocol125::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, cha WriteInt (a_BlockX); WriteShort((short)a_BlockY); WriteInt (a_BlockZ); - WriteByte (a_Byte1); - WriteByte (a_Byte2); + WriteChar (a_Byte1); + WriteChar (a_Byte2); Flush(); } @@ -209,12 +209,12 @@ void cProtocol125::SendBlockChanges(int a_ChunkX, int a_ChunkZ, const sSetBlockV WriteByte (PACKET_MULTI_BLOCK); WriteInt (a_ChunkX); WriteInt (a_ChunkZ); - WriteShort((unsigned short)a_Changes.size()); - WriteUInt (sizeof(int) * a_Changes.size()); + WriteShort((short)a_Changes.size()); + WriteUInt ((UInt32)(4 * a_Changes.size())); for (sSetBlockVector::const_iterator itr = a_Changes.begin(), end = a_Changes.end(); itr != end; ++itr) { - unsigned int Coords = itr->y | (itr->z << 8) | (itr->x << 12); - unsigned int Blocks = itr->BlockMeta | (itr->BlockType << 4); + UInt32 Coords = ((UInt32)itr->y) | ((UInt32)(itr->z << 8)) | ((UInt32)(itr->x << 12)); + UInt32 Blocks = ((UInt32)itr->BlockMeta) | ((UInt32)(itr->BlockType << 4)); WriteUInt(Coords << 16 | Blocks); } Flush(); @@ -239,32 +239,11 @@ void cProtocol125::SendChat(const AString & a_Message) void cProtocol125::SendChat(const cCompositeChat & a_Message) { // This version doesn't support composite messages, just extract each part's text and use it: - AString Msg; - const cCompositeChat::cParts & Parts = a_Message.GetParts(); - for (cCompositeChat::cParts::const_iterator itr = Parts.begin(), end = Parts.end(); itr != end; ++itr) - { - switch ((*itr)->m_PartType) - { - case cCompositeChat::ptText: - case cCompositeChat::ptClientTranslated: - case cCompositeChat::ptRunCommand: - case cCompositeChat::ptSuggestCommand: - { - Msg.append((*itr)->m_Text); - break; - } - case cCompositeChat::ptUrl: - { - Msg.append(((cCompositeChat::cUrlPart *)(*itr))->m_Url); - break; - } - } // switch (PartType) - } // for itr - Parts[] // Send the message: cCSLock Lock(m_CSPacket); WriteByte (PACKET_CHAT); - WriteString(Msg); + WriteString(a_Message.ExtractText()); Flush(); } @@ -346,8 +325,8 @@ void cProtocol125::SendEntityEffect(const cEntity & a_Entity, int a_EffectID, in cCSLock Lock(m_CSPacket); WriteByte (PACKET_ENTITY_EFFECT); WriteInt (a_Entity.GetUniqueID()); - WriteByte (a_EffectID); - WriteByte (a_Amplifier); + WriteByte ((Byte)a_EffectID); + WriteByte ((Byte)a_Amplifier); WriteShort(a_Duration); Flush(); } @@ -378,7 +357,7 @@ void cProtocol125::SendEntityHeadLook(const cEntity & a_Entity) cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_HEAD_LOOK); WriteInt (a_Entity.GetUniqueID()); - WriteByte((char)((a_Entity.GetHeadYaw() / 360.f) * 256)); + WriteChar((char)((a_Entity.GetHeadYaw() / 360.f) * 256)); Flush(); } @@ -393,8 +372,8 @@ void cProtocol125::SendEntityLook(const cEntity & a_Entity) cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_LOOK); WriteInt (a_Entity.GetUniqueID()); - WriteByte((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteByte((char)((a_Entity.GetPitch() / 360.f) * 256)); + WriteChar((char)((a_Entity.GetYaw() / 360.f) * 256)); + WriteChar((char)((a_Entity.GetPitch() / 360.f) * 256)); Flush(); } @@ -442,9 +421,9 @@ void cProtocol125::SendEntityRelMove(const cEntity & a_Entity, char a_RelX, char cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_REL_MOVE); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_RelX); - WriteByte(a_RelY); - WriteByte(a_RelZ); + WriteChar(a_RelX); + WriteChar(a_RelY); + WriteChar(a_RelZ); Flush(); } @@ -459,11 +438,11 @@ void cProtocol125::SendEntityRelMoveLook(const cEntity & a_Entity, char a_RelX, cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_REL_MOVE_LOOK); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_RelX); - WriteByte(a_RelY); - WriteByte(a_RelZ); - WriteByte((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteByte((char)((a_Entity.GetPitch() / 360.f) * 256)); + WriteChar(a_RelX); + WriteChar(a_RelY); + WriteChar(a_RelZ); + WriteChar((char)((a_Entity.GetYaw() / 360.f) * 256)); + WriteChar((char)((a_Entity.GetPitch() / 360.f) * 256)); Flush(); } @@ -476,7 +455,7 @@ void cProtocol125::SendEntityStatus(const cEntity & a_Entity, char a_Status) cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_STATUS); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_Status); + WriteChar(a_Status); Flush(); } @@ -509,7 +488,7 @@ void cProtocol125::SendExplosion(double a_BlockX, double a_BlockY, double a_Bloc WriteDouble (a_BlockY); WriteDouble (a_BlockZ); WriteFloat (a_Radius); - WriteInt (a_BlocksAffected.size()); + WriteInt ((Int32)a_BlocksAffected.size()); int BlockX = (int)a_BlockX; int BlockY = (int)a_BlockY; int BlockZ = (int)a_BlockZ; @@ -534,7 +513,7 @@ void cProtocol125::SendGameMode(eGameMode a_GameMode) cCSLock Lock(m_CSPacket); WriteByte(PACKET_CHANGE_GAME_STATE); WriteByte(3); - WriteByte((char)a_GameMode); + WriteChar((char)a_GameMode); Flush(); } @@ -559,7 +538,7 @@ void cProtocol125::SendHealth(void) cCSLock Lock(m_CSPacket); WriteByte (PACKET_UPDATE_HEALTH); WriteShort((short)m_Client->GetPlayer()->GetHealth()); - WriteShort(m_Client->GetPlayer()->GetFoodLevel()); + WriteShort((short)m_Client->GetPlayer()->GetFoodLevel()); WriteFloat((float)m_Client->GetPlayer()->GetFoodSaturationLevel()); Flush(); } @@ -572,7 +551,7 @@ void cProtocol125::SendInventorySlot(char a_WindowID, short a_SlotNum, const cIt { cCSLock Lock(m_CSPacket); WriteByte (PACKET_INVENTORY_SLOT); - WriteByte (a_WindowID); + WriteChar (a_WindowID); WriteShort(a_SlotNum); WriteItem (a_Item); Flush(); @@ -621,17 +600,14 @@ void cProtocol125::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colo WriteByte (PACKET_ITEM_DATA); WriteShort(E_ITEM_MAP); - WriteShort(a_ID); - WriteShort(3 + a_Length); + WriteShort((short)a_ID); + WriteShort((short)(3 + a_Length)); WriteByte(0); - WriteByte(a_X); - WriteByte(a_Y); + WriteChar((char)a_X); + WriteChar((char)a_Y); - for (unsigned int i = 0; i < a_Length; ++i) - { - WriteByte(a_Colors[i]); - } + SendData((const char *)a_Colors, a_Length); Flush(); } @@ -646,16 +622,16 @@ void cProtocol125::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decor WriteByte (PACKET_ITEM_DATA); WriteShort(E_ITEM_MAP); - WriteShort(a_ID); - WriteShort(1 + (3 * a_Decorators.size())); + WriteShort((short)a_ID); + WriteShort((short)(1 + (3 * a_Decorators.size()))); WriteByte(1); for (cMapDecoratorList::const_iterator it = a_Decorators.begin(); it != a_Decorators.end(); ++it) { - WriteByte((it->GetType() << 4) | (it->GetRot() & 0xf)); - WriteByte(it->GetPixelX()); - WriteByte(it->GetPixelZ()); + WriteByte((Byte)(it->GetType() << 4) | (it->GetRot() & 0xf)); + WriteByte((Byte)it->GetPixelX()); + WriteByte((Byte)it->GetPixelZ()); } Flush(); @@ -672,7 +648,7 @@ void cProtocol125::SendPickupSpawn(const cPickup & a_Pickup) WriteByte (PACKET_PICKUP_SPAWN); WriteInt (a_Pickup.GetUniqueID()); WriteShort (a_Pickup.GetItem().m_ItemType); - WriteByte (a_Pickup.GetItem().m_ItemCount); + WriteChar (a_Pickup.GetItem().m_ItemCount); WriteShort (a_Pickup.GetItem().m_ItemDamage); WriteVectorI((Vector3i)(a_Pickup.GetPosition() * 32)); WriteByte ((char)(a_Pickup.GetSpeed().x * 8)); @@ -690,7 +666,7 @@ void cProtocol125::SendEntityAnimation(const cEntity & a_Entity, char a_Animatio cCSLock Lock(m_CSPacket); WriteByte(PACKET_ANIMATION); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_Animation); + WriteChar(a_Animation); Flush(); } @@ -784,8 +760,8 @@ void cProtocol125::SendPlayerSpawn(const cPlayer & a_Player) WriteInt ((int)(a_Player.GetPosX() * 32)); WriteInt ((int)(a_Player.GetPosY() * 32)); WriteInt ((int)(a_Player.GetPosZ() * 32)); - WriteByte ((char)((a_Player.GetYaw() / 360.f) * 256)); - WriteByte ((char)((a_Player.GetPitch() / 360.f) * 256)); + WriteChar ((char)((a_Player.GetYaw() / 360.f) * 256)); + WriteChar ((char)((a_Player.GetPitch() / 360.f) * 256)); WriteShort (HeldItem.IsEmpty() ? 0 : HeldItem.m_ItemType); Flush(); } @@ -811,9 +787,9 @@ void cProtocol125::SendPluginMessage(const AString & a_Channel, const AString & void cProtocol125::SendRemoveEntityEffect(const cEntity & a_Entity, int a_EffectID) { cCSLock Lock(m_CSPacket); - WriteByte (PACKET_REMOVE_ENTITY_EFFECT); - WriteInt (a_Entity.GetUniqueID()); - WriteByte (a_EffectID); + WriteByte(PACKET_REMOVE_ENTITY_EFFECT); + WriteInt (a_Entity.GetUniqueID()); + WriteChar((char)a_EffectID); Flush(); } @@ -827,7 +803,7 @@ void cProtocol125::SendRespawn(void) WriteByte (PACKET_RESPAWN); WriteInt ((int)(m_Client->GetPlayer()->GetWorld()->GetDimension())); WriteByte (2); // TODO: Difficulty; 2 = Normal - WriteByte ((char)m_Client->GetPlayer()->GetGameMode()); + WriteChar ((char)m_Client->GetPlayer()->GetGameMode()); WriteShort (256); // Current world height WriteString("default"); } @@ -858,7 +834,7 @@ void cProtocol125::SendExperienceOrb(const cExpOrb & a_ExpOrb) WriteInt((int) a_ExpOrb.GetPosX()); WriteInt((int) a_ExpOrb.GetPosY()); WriteInt((int) a_ExpOrb.GetPosZ()); - WriteShort(a_ExpOrb.GetReward()); + WriteShort((short)a_ExpOrb.GetReward()); Flush(); } @@ -899,7 +875,7 @@ void cProtocol125::SendSpawnMob(const cMonster & a_Mob) cCSLock Lock(m_CSPacket); WriteByte (PACKET_SPAWN_MOB); WriteInt (a_Mob.GetUniqueID()); - WriteByte (a_Mob.GetMobType()); + WriteByte ((Byte)a_Mob.GetMobType()); WriteVectorI((Vector3i)(a_Mob.GetPosition() * 32)); WriteByte (0); WriteByte (0); @@ -924,7 +900,7 @@ void cProtocol125::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType, cCSLock Lock(m_CSPacket); WriteByte(PACKET_SPAWN_OBJECT); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_ObjectType); + WriteChar(a_ObjectType); WriteInt ((int)(a_Entity.GetPosX() * 32)); WriteInt ((int)(a_Entity.GetPosY() * 32)); WriteInt ((int)(a_Entity.GetPosZ() * 32)); @@ -949,7 +925,7 @@ void cProtocol125::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleTyp cCSLock Lock(m_CSPacket); WriteByte (PACKET_SPAWN_OBJECT); WriteInt (a_Vehicle.GetUniqueID()); - WriteByte (a_VehicleType); + WriteChar (a_VehicleType); WriteInt ((int)(a_Vehicle.GetPosX() * 32)); WriteInt ((int)(a_Vehicle.GetPosY() * 32)); WriteInt ((int)(a_Vehicle.GetPosZ() * 32)); @@ -987,8 +963,8 @@ void cProtocol125::SendTeleportEntity(const cEntity & a_Entity) WriteInt ((int)(floor(a_Entity.GetPosX() * 32))); WriteInt ((int)(floor(a_Entity.GetPosY() * 32))); WriteInt ((int)(floor(a_Entity.GetPosZ() * 32))); - WriteByte ((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteByte ((char)((a_Entity.GetPitch() / 360.f) * 256)); + WriteChar ((char)((a_Entity.GetYaw() / 360.f) * 256)); + WriteChar ((char)((a_Entity.GetPitch() / 360.f) * 256)); Flush(); } @@ -1063,7 +1039,7 @@ void cProtocol125::SendUseBed(const cEntity & a_Entity, int a_BlockX, int a_Bloc WriteInt (a_Entity.GetUniqueID()); WriteByte(0); // Unknown byte only 0 has been observed WriteInt (a_BlockX); - WriteByte(a_BlockY); + WriteByte((Byte)a_BlockY); WriteInt (a_BlockZ); Flush(); } @@ -1107,7 +1083,7 @@ void cProtocol125::SendWholeInventory(const cWindow & a_Window) cCSLock Lock(m_CSPacket); cItems Slots; a_Window.GetSlots(*(m_Client->GetPlayer()), Slots); - SendWindowSlots(a_Window.GetWindowID(), Slots.size(), &(Slots[0])); + SendWindowSlots(a_Window.GetWindowID(), (int)Slots.size(), &(Slots[0])); } @@ -1124,7 +1100,7 @@ void cProtocol125::SendWindowClose(const cWindow & a_Window) cCSLock Lock(m_CSPacket); WriteByte(PACKET_WINDOW_CLOSE); - WriteByte(a_Window.GetWindowID()); + WriteChar(a_Window.GetWindowID()); Flush(); } @@ -1141,10 +1117,10 @@ void cProtocol125::SendWindowOpen(const cWindow & a_Window) } cCSLock Lock(m_CSPacket); WriteByte (PACKET_WINDOW_OPEN); - WriteByte (a_Window.GetWindowID()); - WriteByte (a_Window.GetWindowType()); + WriteChar (a_Window.GetWindowID()); + WriteByte ((Byte)a_Window.GetWindowType()); WriteString(a_Window.GetWindowTitle()); - WriteByte (a_Window.GetNumNonInventorySlots()); + WriteByte ((Byte)a_Window.GetNumNonInventorySlots()); Flush(); } @@ -1156,7 +1132,7 @@ void cProtocol125::SendWindowProperty(const cWindow & a_Window, short a_Property { cCSLock Lock(m_CSPacket); WriteByte (PACKET_WINDOW_PROPERTY); - WriteByte (a_Window.GetWindowID()); + WriteChar (a_Window.GetWindowID()); WriteShort(a_Property); WriteShort(a_Value); Flush(); @@ -1177,7 +1153,7 @@ AString cProtocol125::GetAuthServerID(void) -void cProtocol125::SendData(const char * a_Data, int a_Size) +void cProtocol125::SendData(const char * a_Data, size_t a_Size) { m_Client->SendData(a_Data, a_Size); } @@ -1548,7 +1524,7 @@ int cProtocol125::ParsePluginMessage(void) HANDLE_PACKET_READ(ReadBEUTF16String16, AString, ChannelName); HANDLE_PACKET_READ(ReadBEShort, short, Length); AString Data; - if (!m_ReceivedData.ReadString(Data, Length)) + if (!m_ReceivedData.ReadString(Data, (size_t)Length)) { m_ReceivedData.CheckValid(); return PARSE_INCOMPLETE; @@ -1709,7 +1685,7 @@ void cProtocol125::SendPreChunk(int a_ChunkX, int a_ChunkZ, bool a_ShouldLoad) void cProtocol125::SendWindowSlots(char a_WindowID, int a_NumItems, const cItem * a_Items) { WriteByte (PACKET_INVENTORY_WHOLE); - WriteByte (a_WindowID); + WriteChar (a_WindowID); WriteShort((short)a_NumItems); for (int j = 0; j < a_NumItems; j++) @@ -1739,7 +1715,7 @@ void cProtocol125::WriteItem(const cItem & a_Item) return; } - WriteByte (a_Item.m_ItemCount); + WriteChar (a_Item.m_ItemCount); WriteShort(a_Item.m_ItemDamage); if (cItem::IsEnchantable(a_Item.m_ItemType)) @@ -1786,7 +1762,7 @@ int cProtocol125::ParseItem(cItem & a_Item) } // TODO: Enchantment not implemented yet! - if (!m_ReceivedData.SkipRead(EnchantNumBytes)) + if (!m_ReceivedData.SkipRead((size_t)EnchantNumBytes)) { return PARSE_INCOMPLETE; } @@ -1871,7 +1847,7 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) case cMonster::mtCreeper: { WriteByte(0x10); - WriteByte(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); // Blowing up? + WriteChar(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); // Blowing up? WriteByte(0x11); WriteByte(((const cCreeper &)a_Mob).IsCharged() ? 1 : 0); // Lightning-charged? break; @@ -1941,9 +1917,9 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) WriteByte(0x10); Byte SheepMetadata = 0; - SheepMetadata = ((const cSheep &)a_Mob).GetFurColor(); // Fur colour + SheepMetadata = (Byte)((const cSheep &)a_Mob).GetFurColor(); - if (((const cSheep &)a_Mob).IsSheared()) // Is sheared? + if (((const cSheep &)a_Mob).IsSheared()) { SheepMetadata |= 0x16; } @@ -1972,17 +1948,25 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); // Aggravated? Doesn't seem to do anything break; } + case cMonster::mtWither: + { + WriteByte(0x54); // Int at index 20 + WriteInt((Int32)((const cWither &)a_Mob).GetNumInvulnerableTicks()); + WriteByte(0x66); // Float at index 6 + WriteFloat((float)(a_Mob.GetHealth())); + break; + } case cMonster::mtSlime: case cMonster::mtMagmaCube: { WriteByte(0x10); if (a_Mob.GetMobType() == cMonster::mtSlime) { - WriteByte(((const cSlime &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME + WriteByte((Byte)((const cSlime &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME } else { - WriteByte(((const cMagmaCube &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME + WriteByte((Byte)((const cMagmaCube &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME } break; } @@ -2021,7 +2005,7 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) WriteInt(Flags); WriteByte(0x13); - WriteByte(((const cHorse &)a_Mob).GetHorseType()); // Type of horse (donkey, chestnut, etc.) + WriteByte((Byte)((const cHorse &)a_Mob).GetHorseType()); // Type of horse (donkey, chestnut, etc.) WriteByte(0x54); int Appearance = 0; @@ -2033,6 +2017,10 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) WriteInt(((const cHorse &)a_Mob).GetHorseArmour()); // Horshey armour break; } + default: + { + break; + } } } diff --git a/src/Protocol/Protocol125.h b/src/Protocol/Protocol125.h index aca24c03a..08d3ebbe9 100644 --- a/src/Protocol/Protocol125.h +++ b/src/Protocol/Protocol125.h @@ -125,7 +125,7 @@ protected: AString m_Username; ///< Stored in ParseHandshake(), compared to Login username - virtual void SendData(const char * a_Data, int a_Size) override; + virtual void SendData(const char * a_Data, size_t a_Size) override; /// Sends the Handshake packet void SendHandshake(const AString & a_ConnectionHash); diff --git a/src/Protocol/Protocol132.cpp b/src/Protocol/Protocol132.cpp index be9c503ed..ce5942a5c 100644 --- a/src/Protocol/Protocol132.cpp +++ b/src/Protocol/Protocol132.cpp @@ -115,7 +115,7 @@ void cProtocol132::DataReceived(const char * a_Data, size_t a_Size) Byte Decrypted[512]; while (a_Size > 0) { - int NumBytes = (a_Size > (int)sizeof(Decrypted)) ? (int)sizeof(Decrypted) : a_Size; + size_t NumBytes = (a_Size > sizeof(Decrypted)) ? sizeof(Decrypted) : a_Size; m_Decryptor.ProcessData(Decrypted, (Byte *)a_Data, NumBytes); super::DataReceived((const char *)Decrypted, NumBytes); a_Size -= NumBytes; @@ -139,8 +139,8 @@ void cProtocol132::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, cha WriteInt (a_BlockX); WriteShort((short)a_BlockY); WriteInt (a_BlockZ); - WriteByte (a_Byte1); - WriteByte (a_Byte2); + WriteChar (a_Byte1); + WriteChar (a_Byte2); WriteShort(a_BlockType); Flush(); } @@ -157,7 +157,7 @@ void cProtocol132::SendBlockBreakAnim(int a_entityID, int a_BlockX, int a_BlockY WriteInt (a_BlockX); WriteInt (a_BlockY); WriteInt (a_BlockZ); - WriteByte (stage); + WriteChar (stage); Flush(); } @@ -259,7 +259,7 @@ void cProtocol132::SendLogin(const cPlayer & a_Player, const cWorld & a_World) WriteByte (PACKET_LOGIN); WriteInt (a_Player.GetUniqueID()); // EntityID of the player WriteString("default"); // Level type - WriteByte ((int)a_Player.GetGameMode()); + WriteByte ((Byte)a_Player.GetGameMode()); WriteByte ((Byte)(a_World.GetDimension())); WriteByte (2); // TODO: Difficulty WriteByte (0); // Unused, used to be world height @@ -283,8 +283,8 @@ void cProtocol132::SendPlayerSpawn(const cPlayer & a_Player) WriteInt ((int)(a_Player.GetPosX() * 32)); WriteInt ((int)(a_Player.GetPosY() * 32)); WriteInt ((int)(a_Player.GetPosZ() * 32)); - WriteByte ((char)((a_Player.GetYaw() / 360.f) * 256)); - WriteByte ((char)((a_Player.GetPitch() / 360.f) * 256)); + WriteChar ((char)((a_Player.GetYaw() / 360.f) * 256)); + WriteChar ((char)((a_Player.GetPitch() / 360.f) * 256)); WriteShort (HeldItem.IsEmpty() ? 0 : HeldItem.m_ItemType); // Player metadata: just use a default metadata value, since the client doesn't like starting without any metadata: WriteByte (0); // Index 0, byte (flags) @@ -306,7 +306,7 @@ void cProtocol132::SendSoundEffect(const AString & a_SoundName, int a_SrcX, int WriteInt (a_SrcY); WriteInt (a_SrcZ); WriteFloat (a_Volume); - WriteByte ((char)(a_Pitch * 63.0f)); + WriteChar ((char)(a_Pitch * 63.0f)); Flush(); } @@ -320,7 +320,7 @@ void cProtocol132::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_Src WriteByte(PACKET_SOUND_PARTICLE_EFFECT); WriteInt (a_EffectID); WriteInt (a_SrcX); - WriteByte(a_SrcY); + WriteByte((Byte)a_SrcY); WriteInt (a_SrcZ); WriteInt (a_Data); Flush(); @@ -335,7 +335,7 @@ void cProtocol132::SendSpawnMob(const cMonster & a_Mob) cCSLock Lock(m_CSPacket); WriteByte (PACKET_SPAWN_MOB); WriteInt (a_Mob.GetUniqueID()); - WriteByte (a_Mob.GetMobType()); + WriteByte ((Byte)a_Mob.GetMobType()); WriteVectorI((Vector3i)(a_Mob.GetPosition() * 32)); WriteByte ((Byte)((a_Mob.GetYaw() / 360.f) * 256)); WriteByte ((Byte)((a_Mob.GetPitch() / 360.f) * 256)); @@ -411,12 +411,12 @@ void cProtocol132::SendWholeInventory(const cWindow & a_Window) const cInventory & Inventory = m_Client->GetPlayer()->GetInventory(); int BaseOffset = a_Window.GetNumSlots() - (cInventory::invNumSlots - cInventory::invInventoryOffset); // Number of non-inventory slots char WindowID = a_Window.GetWindowID(); - for (int i = 0; i < cInventory::invInventoryCount; i++) + for (short i = 0; i < cInventory::invInventoryCount; i++) { SendInventorySlot(WindowID, BaseOffset + i, Inventory.GetInventorySlot(i)); } // for i - Inventory[] BaseOffset += cInventory::invInventoryCount; - for (int i = 0; i < cInventory::invHotbarCount; i++) + for (short i = 0; i < cInventory::invHotbarCount; i++) { SendInventorySlot(WindowID, BaseOffset + i, Inventory.GetHotbarSlot(i)); } // for i - Hotbar[] @@ -527,21 +527,30 @@ int cProtocol132::ParseClientStatuses(void) int cProtocol132::ParseEncryptionKeyResponse(void) { + // Read the encryption key: HANDLE_PACKET_READ(ReadBEShort, short, EncKeyLength); + if (EncKeyLength > MAX_ENC_LEN) + { + LOGD("Too long encryption key"); + m_Client->Kick("Hacked client"); + return PARSE_OK; + } AString EncKey; - if (!m_ReceivedData.ReadString(EncKey, EncKeyLength)) + if (!m_ReceivedData.ReadString(EncKey, (size_t)EncKeyLength)) { return PARSE_INCOMPLETE; } + + // Read the encryption nonce: HANDLE_PACKET_READ(ReadBEShort, short, EncNonceLength); AString EncNonce; - if (!m_ReceivedData.ReadString(EncNonce, EncNonceLength)) + if (!m_ReceivedData.ReadString(EncNonce, (size_t)EncNonceLength)) { return PARSE_INCOMPLETE; } - if ((EncKeyLength > MAX_ENC_LEN) || (EncNonceLength > MAX_ENC_LEN)) + if (EncNonceLength > MAX_ENC_LEN) { - LOGD("Too long encryption"); + LOGD("Too long encryption nonce"); m_Client->Kick("Hacked client"); return PARSE_OK; } @@ -605,7 +614,7 @@ int cProtocol132::ParseTabCompletion(void) -void cProtocol132::SendData(const char * a_Data, int a_Size) +void cProtocol132::SendData(const char * a_Data, size_t a_Size) { m_DataToSend.append(a_Data, a_Size); } @@ -623,23 +632,23 @@ void cProtocol132::Flush(void) LOGD("Flushing empty"); return; } - const char * a_Data = m_DataToSend.data(); - int a_Size = m_DataToSend.size(); + const char * Data = m_DataToSend.data(); + size_t Size = m_DataToSend.size(); if (m_IsEncrypted) { Byte Encrypted[8192]; // Larger buffer, we may be sending lots of data (chunks) - while (a_Size > 0) + while (Size > 0) { - int NumBytes = (a_Size > (int)sizeof(Encrypted)) ? (int)sizeof(Encrypted) : a_Size; - m_Encryptor.ProcessData(Encrypted, (Byte *)a_Data, NumBytes); + size_t NumBytes = (Size > sizeof(Encrypted)) ? sizeof(Encrypted) : Size; + m_Encryptor.ProcessData(Encrypted, (Byte *)Data, NumBytes); super::SendData((const char *)Encrypted, NumBytes); - a_Size -= NumBytes; - a_Data += NumBytes; + Size -= NumBytes; + Data += NumBytes; } } else { - super::SendData(a_Data, a_Size); + super::SendData(Data, Size); } m_DataToSend.clear(); } @@ -665,7 +674,7 @@ void cProtocol132::WriteItem(const cItem & a_Item) } WriteShort(ItemType); - WriteByte (a_Item.m_ItemCount); + WriteChar (a_Item.m_ItemCount); WriteShort(a_Item.m_ItemDamage); if (a_Item.m_Enchantments.IsEmpty()) @@ -681,7 +690,7 @@ void cProtocol132::WriteItem(const cItem & a_Item) Writer.Finish(); AString Compressed; CompressStringGZIP(Writer.GetResult().data(), Writer.GetResult().size(), Compressed); - WriteShort(Compressed.size()); + WriteShort((short)Compressed.size()); SendData(Compressed.data(), Compressed.size()); } @@ -717,8 +726,8 @@ int cProtocol132::ParseItem(cItem & a_Item) // Read the metadata AString Metadata; - Metadata.resize(MetadataLength); - if (!m_ReceivedData.ReadBuf((void *)Metadata.data(), MetadataLength)) + Metadata.resize((size_t)MetadataLength); + if (!m_ReceivedData.ReadBuf((void *)Metadata.data(), (size_t)MetadataLength)) { return PARSE_INCOMPLETE; } diff --git a/src/Protocol/Protocol132.h b/src/Protocol/Protocol132.h index 0702fbf5a..b280c8a41 100644 --- a/src/Protocol/Protocol132.h +++ b/src/Protocol/Protocol132.h @@ -87,7 +87,7 @@ protected: /// The ServerID used for session authentication; set in StartEncryption(), used in GetAuthServerID() AString m_AuthServerID; - virtual void SendData(const char * a_Data, int a_Size) override; + virtual void SendData(const char * a_Data, size_t a_Size) override; // DEBUG: virtual void Flush(void) override; diff --git a/src/Protocol/Protocol14x.cpp b/src/Protocol/Protocol14x.cpp index 232b2718e..f694af1eb 100644 --- a/src/Protocol/Protocol14x.cpp +++ b/src/Protocol/Protocol14x.cpp @@ -103,9 +103,9 @@ void cProtocol142::SendPickupSpawn(const cPickup & a_Pickup) WriteInt (a_Pickup.GetUniqueID()); WriteItem (a_Pickup.GetItem()); WriteVectorI((Vector3i)(a_Pickup.GetPosition() * 32)); - WriteByte ((char)(a_Pickup.GetSpeed().x * 8)); - WriteByte ((char)(a_Pickup.GetSpeed().y * 8)); - WriteByte ((char)(a_Pickup.GetSpeed().z * 8)); + WriteChar ((char)(a_Pickup.GetSpeed().x * 8)); + WriteChar ((char)(a_Pickup.GetSpeed().y * 8)); + WriteChar ((char)(a_Pickup.GetSpeed().z * 8)); Flush(); } @@ -119,7 +119,7 @@ void cProtocol142::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_Src WriteByte(PACKET_SOUND_PARTICLE_EFFECT); WriteInt (a_EffectID); WriteInt (a_SrcX); - WriteByte(a_SrcY); + WriteByte((Byte)a_SrcY); WriteInt (a_SrcZ); WriteInt (a_Data); WriteBool(0); @@ -218,7 +218,7 @@ void cProtocol146::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType, cCSLock Lock(m_CSPacket); WriteByte(PACKET_SPAWN_OBJECT); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_ObjectType); + WriteChar(a_ObjectType); WriteInt ((int)(a_Entity.GetPosX() * 32)); WriteInt ((int)(a_Entity.GetPosY() * 32)); WriteInt ((int)(a_Entity.GetPosZ() * 32)); @@ -243,7 +243,7 @@ void cProtocol146::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleTyp cCSLock Lock(m_CSPacket); WriteByte (PACKET_SPAWN_OBJECT); WriteInt (a_Vehicle.GetUniqueID()); - WriteByte (a_VehicleType); + WriteChar (a_VehicleType); WriteInt ((int)(a_Vehicle.GetPosX() * 32)); WriteInt ((int)(a_Vehicle.GetPosY() * 32)); WriteInt ((int)(a_Vehicle.GetPosZ() * 32)); diff --git a/src/Protocol/Protocol16x.cpp b/src/Protocol/Protocol16x.cpp index ecb24254f..bf7d9a0b1 100644 --- a/src/Protocol/Protocol16x.cpp +++ b/src/Protocol/Protocol16x.cpp @@ -119,7 +119,7 @@ void cProtocol161::SendHealth(void) cCSLock Lock(m_CSPacket); WriteByte (PACKET_UPDATE_HEALTH); WriteFloat((float)m_Client->GetPlayer()->GetHealth()); - WriteShort(m_Client->GetPlayer()->GetFoodLevel()); + WriteShort((short)m_Client->GetPlayer()->GetFoodLevel()); WriteFloat((float)m_Client->GetPlayer()->GetFoodSaturationLevel()); Flush(); } @@ -163,10 +163,10 @@ void cProtocol161::SendWindowOpen(const cWindow & a_Window) } cCSLock Lock(m_CSPacket); WriteByte (PACKET_WINDOW_OPEN); - WriteByte (a_Window.GetWindowID()); - WriteByte (a_Window.GetWindowType()); + WriteChar (a_Window.GetWindowID()); + WriteByte ((Byte)a_Window.GetWindowType()); WriteString(a_Window.GetWindowTitle()); - WriteByte (a_Window.GetNumNonInventorySlots()); + WriteByte ((Byte)a_Window.GetNumNonInventorySlots()); WriteByte (1); // Use title if (a_Window.GetWindowType() == cWindow::wtAnimalChest) { diff --git a/src/Protocol/Protocol17x.cpp b/src/Protocol/Protocol17x.cpp index 721ed349e..a4319df37 100644 --- a/src/Protocol/Protocol17x.cpp +++ b/src/Protocol/Protocol17x.cpp @@ -1236,7 +1236,7 @@ void cProtocol172::SendWindowProperty(const cWindow & a_Window, short a_Property -void cProtocol172::AddReceivedData(const char * a_Data, int a_Size) +void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) { // Write the incoming data into the comm log file: if (g_ShouldLogCommIn) @@ -1258,7 +1258,7 @@ void cProtocol172::AddReceivedData(const char * a_Data, int a_Size) AString Hex; CreateHexDump(Hex, a_Data, a_Size, 16); m_CommLogFile.Printf("Incoming data: %d (0x%x) bytes: \n%s\n", - a_Size, a_Size, Hex.c_str() + (unsigned)a_Size, (unsigned)a_Size, Hex.c_str() ); m_CommLogFile.Flush(); } @@ -1988,14 +1988,14 @@ void cProtocol172::WritePacket(cByteBuffer & a_Packet) -void cProtocol172::SendData(const char * a_Data, int a_Size) +void cProtocol172::SendData(const char * a_Data, size_t a_Size) { if (m_IsEncrypted) { Byte Encrypted[8192]; // Larger buffer, we may be sending lots of data (chunks) while (a_Size > 0) { - size_t NumBytes = ((size_t)a_Size > sizeof(Encrypted)) ? sizeof(Encrypted) : (size_t)a_Size; + size_t NumBytes = (a_Size > sizeof(Encrypted)) ? sizeof(Encrypted) : a_Size; m_Encryptor.ProcessData(Encrypted, (Byte *)a_Data, NumBytes); m_Client->SendData((const char *)Encrypted, NumBytes); a_Size -= NumBytes; @@ -2535,6 +2535,7 @@ void cProtocol172::cPacketizer::WriteEntityMetadata(const cEntity & a_Entity) WriteByte(Frame.GetRotation()); break; } + default: break; } } @@ -2659,6 +2660,15 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); break; } + + case cMonster::mtWither: + { + WriteByte(0x54); // Int at index 20 + WriteInt(((const cWither &)a_Mob).GetNumInvulnerableTicks()); + WriteByte(0x66); // Float at index 6 + WriteFloat((float)(a_Mob.GetHealth())); + break; + } case cMonster::mtSlime: { diff --git a/src/Protocol/Protocol17x.h b/src/Protocol/Protocol17x.h index 41163009e..91186b270 100644 --- a/src/Protocol/Protocol17x.h +++ b/src/Protocol/Protocol17x.h @@ -196,7 +196,7 @@ protected: m_Out.WriteVarUTF8String(a_Value); } - void WriteBuf(const char * a_Data, int a_Size) + void WriteBuf(const char * a_Data, size_t a_Size) { m_Out.Write(a_Data, a_Size); } @@ -243,7 +243,7 @@ protected: /** Adds the received (unencrypted) data to m_ReceivedData, parses complete packets */ - void AddReceivedData(const char * a_Data, int a_Size); + void AddReceivedData(const char * a_Data, size_t a_Size); /** Reads and handles the packet. The packet length and type have already been read. Returns true if the packet was understood, false if it was an unknown packet @@ -287,7 +287,7 @@ protected: void WritePacket(cByteBuffer & a_Packet); /** Sends the data to the client, encrypting them if needed. */ - virtual void SendData(const char * a_Data, int a_Size) override; + virtual void SendData(const char * a_Data, size_t a_Size) override; void SendCompass(const cWorld & a_World); diff --git a/src/Protocol/ProtocolRecognizer.cpp b/src/Protocol/ProtocolRecognizer.cpp index 3b9003e60..3f7d7b254 100644 --- a/src/Protocol/ProtocolRecognizer.cpp +++ b/src/Protocol/ProtocolRecognizer.cpp @@ -794,7 +794,7 @@ AString cProtocolRecognizer::GetAuthServerID(void) -void cProtocolRecognizer::SendData(const char * a_Data, int a_Size) +void cProtocolRecognizer::SendData(const char * a_Data, size_t a_Size) { // This is used only when handling the server ping m_Client->SendData(a_Data, a_Size); @@ -854,7 +854,7 @@ bool cProtocolRecognizer::TryRecognizeProtocol(void) // This must be a lengthed protocol, try if it has the entire initial handshake packet: m_Buffer.ResetRead(); UInt32 PacketLen; - UInt32 ReadSoFar = m_Buffer.GetReadableSpace(); + UInt32 ReadSoFar = (UInt32)m_Buffer.GetReadableSpace(); if (!m_Buffer.ReadVarInt(PacketLen)) { // Not enough bytes for the packet length, keep waiting @@ -931,7 +931,7 @@ bool cProtocolRecognizer::TryRecognizeLengthlessProtocol(void) bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRemaining) { UInt32 PacketType; - UInt32 NumBytesRead = m_Buffer.GetReadableSpace(); + UInt32 NumBytesRead = (UInt32)m_Buffer.GetReadableSpace(); if (!m_Buffer.ReadVarInt(PacketType)) { return false; @@ -962,7 +962,7 @@ bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRema m_Buffer.ReadBEShort(ServerPort); m_Buffer.ReadVarInt(NextState); m_Buffer.CommitRead(); - m_Protocol = new cProtocol172(m_Client, ServerAddress, ServerPort, NextState); + m_Protocol = new cProtocol172(m_Client, ServerAddress, (UInt16)ServerPort, NextState); return true; } } diff --git a/src/Protocol/ProtocolRecognizer.h b/src/Protocol/ProtocolRecognizer.h index d7fb8fad2..072d7c2d2 100644 --- a/src/Protocol/ProtocolRecognizer.h +++ b/src/Protocol/ProtocolRecognizer.h @@ -133,7 +133,7 @@ public: virtual AString GetAuthServerID(void) override; - virtual void SendData(const char * a_Data, int a_Size) override; + virtual void SendData(const char * a_Data, size_t a_Size) override; protected: cProtocol * m_Protocol; //< The recognized protocol diff --git a/src/RCONServer.cpp b/src/RCONServer.cpp index 72f2d9ba9..d7083ff2b 100644 --- a/src/RCONServer.cpp +++ b/src/RCONServer.cpp @@ -169,7 +169,7 @@ cRCONServer::cConnection::cConnection(cRCONServer & a_RCONServer, cSocket & a_So -void cRCONServer::cConnection::DataReceived(const char * a_Data, int a_Size) +void cRCONServer::cConnection::DataReceived(const char * a_Data, size_t a_Size) { // Append data to the buffer: m_Buffer.append(a_Data, a_Size); diff --git a/src/RCONServer.h b/src/RCONServer.h index 0e89800a2..b964852ab 100644 --- a/src/RCONServer.h +++ b/src/RCONServer.h @@ -29,7 +29,7 @@ class cRCONServer : { public: cRCONServer(cServer & a_Server); - ~cRCONServer(); + virtual ~cRCONServer(); void Initialize(cIniFile & a_IniFile); @@ -65,7 +65,7 @@ protected: // cSocketThreads::cCallback overrides: - virtual void DataReceived(const char * a_Data, int a_Size) override; + virtual void DataReceived(const char * a_Data, size_t a_Size) override; virtual void GetOutgoingData(AString & a_Data) override; virtual void SocketClosed(void) override; diff --git a/src/Root.cpp b/src/Root.cpp index 3555afb45..ba4398b35 100644 --- a/src/Root.cpp +++ b/src/Root.cpp @@ -304,6 +304,7 @@ void cRoot::LoadWorlds(cIniFile & IniFile) { if (IniFile.GetKeyComment("Worlds", 0) != " World=secondworld") { + IniFile.DeleteKeyComment("Worlds", 0); IniFile.AddKeyComment("Worlds", " World=secondworld"); } } diff --git a/src/Simulator/FireSimulator.cpp b/src/Simulator/FireSimulator.cpp index 26712e6e6..470dfc791 100644 --- a/src/Simulator/FireSimulator.cpp +++ b/src/Simulator/FireSimulator.cpp @@ -6,6 +6,8 @@ #include "../BlockID.h" #include "../Defines.h" #include "../Chunk.h" +#include "Root.h" +#include "../Bindings/PluginManager.h" @@ -315,9 +317,15 @@ void cFireSimulator::TrySpreadFire(cChunk * a_Chunk, int a_RelX, int a_RelY, int */ if (CanStartFireInBlock(a_Chunk, x, y, z)) { - FLOG("FS: Starting new fire at {%d, %d, %d}.", - x + a_Chunk->GetPosX() * cChunkDef::Width, y, z + a_Chunk->GetPosZ() * cChunkDef::Width - ); + int a_PosX = x + a_Chunk->GetPosX() * cChunkDef::Width; + int a_PosZ = z + a_Chunk->GetPosZ() * cChunkDef::Width; + + if (cRoot::Get()->GetPluginManager()->CallHookBlockSpread(&m_World, a_PosX, y, a_PosZ, ssFireSpread)) + { + return; + } + + FLOG("FS: Starting new fire at {%d, %d, %d}.", a_PosX, y, a_PosZ); a_Chunk->UnboundedRelSetBlock(x, y, z, E_BLOCK_FIRE, 0); } } // for y diff --git a/src/Simulator/FluidSimulator.cpp b/src/Simulator/FluidSimulator.cpp index 61c93ed73..7779573d7 100644 --- a/src/Simulator/FluidSimulator.cpp +++ b/src/Simulator/FluidSimulator.cpp @@ -36,6 +36,7 @@ bool cFluidSimulator::CanWashAway(BLOCKTYPE a_BlockType) case E_BLOCK_COBWEB: case E_BLOCK_CROPS: case E_BLOCK_DEAD_BUSH: + case E_BLOCK_LILY_PAD: case E_BLOCK_RAIL: case E_BLOCK_REDSTONE_TORCH_OFF: case E_BLOCK_REDSTONE_TORCH_ON: diff --git a/src/StringCompression.cpp b/src/StringCompression.cpp index 5b9a3bb0a..2a85649a1 100644 --- a/src/StringCompression.cpp +++ b/src/StringCompression.cpp @@ -53,7 +53,7 @@ int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed -int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed) +int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed) { // Compress a_Data into a_Compressed using GZIP; return Z_XXX error constants same as zlib's compress2() @@ -83,6 +83,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed { // Some data has been compressed. Consume the buffer and continue compressing a_Compressed.append(Buffer, sizeof(Buffer) - strm.avail_out); + strm.next_out = (Bytef *)Buffer; strm.avail_out = sizeof(Buffer); if (strm.avail_in == 0) { @@ -116,7 +117,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed -extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed) +extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed) { // Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib @@ -139,13 +140,14 @@ extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_U for (;;) { - res = inflate(&strm, Z_FINISH); + res = inflate(&strm, Z_NO_FLUSH); switch (res) { case Z_OK: { // Some data has been uncompressed. Consume the buffer and continue uncompressing a_Uncompressed.append(Buffer, sizeof(Buffer) - strm.avail_out); + strm.next_out = (Bytef *)Buffer; strm.avail_out = sizeof(Buffer); if (strm.avail_in == 0) { diff --git a/src/StringCompression.h b/src/StringCompression.h index 3f4e12d2d..c3a9eca91 100644 --- a/src/StringCompression.h +++ b/src/StringCompression.h @@ -16,10 +16,10 @@ extern int CompressString(const char * a_Data, int a_Length, AString & a_Compres extern int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed, int a_UncompressedSize); /// Compresses a_Data into a_Compressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib -extern int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed); +extern int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed); /// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib -extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed); +extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed); diff --git a/src/StringUtils.cpp b/src/StringUtils.cpp index ad622d707..33b04505f 100644 --- a/src/StringUtils.cpp +++ b/src/StringUtils.cpp @@ -531,32 +531,32 @@ AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a format binary data this way: 00001234: 31 32 33 34 35 36 37 38 39 30 61 62 63 64 65 66 1234567890abcdef */ -AString & CreateHexDump(AString & a_Out, const void * a_Data, int a_Size, int a_LineLength) +AString & CreateHexDump(AString & a_Out, const void * a_Data, size_t a_Size, size_t a_BytesPerLine) { - ASSERT(a_LineLength <= 120); // Due to using a fixed size line buffer; increase line[]'s size to lift this max + ASSERT(a_BytesPerLine <= 120); // Due to using a fixed size line buffer; increase line[]'s size to lift this max char line[512]; char * p; char * q; - a_Out.reserve(a_Size / a_LineLength * (18 + 6 * a_LineLength)); - for (int i = 0; i < a_Size; i += a_LineLength) + a_Out.reserve(a_Size / a_BytesPerLine * (18 + 6 * a_BytesPerLine)); + for (size_t i = 0; i < a_Size; i += a_BytesPerLine) { - int k = a_Size - i; - if (k > a_LineLength) + size_t k = a_Size - i; + if (k > a_BytesPerLine) { - k = a_LineLength; + k = a_BytesPerLine; } #ifdef _MSC_VER // MSVC provides a "secure" version of sprintf() - int Count = sprintf_s(line, sizeof(line), "%08x:", i); + int Count = sprintf_s(line, sizeof(line), "%08x:", (unsigned)i); #else - int Count = sprintf(line, "%08x:", i); + int Count = sprintf(line, "%08x:", (unsigned)i); #endif // Remove the terminating NULL / leftover garbage in line, after the sprintf-ed value memset(line + Count, 32, sizeof(line) - Count); p = line + 10; - q = p + 2 + a_LineLength * 3 + 1; - for (int j = 0; j < k; j++) + q = p + 2 + a_BytesPerLine * 3 + 1; + for (size_t j = 0; j < k; j++) { unsigned char c = ((unsigned char *)a_Data)[i + j]; p[0] = HEX(c >> 4); diff --git a/src/StringUtils.h b/src/StringUtils.h index 4feff7553..b69e47d3c 100644 --- a/src/StringUtils.h +++ b/src/StringUtils.h @@ -64,7 +64,7 @@ extern AString & RawBEToUTF8(const char * a_RawData, int a_NumShorts, AString & extern AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a_UTF16); /// Creates a nicely formatted HEX dump of the given memory block. Max a_BytesPerLine is 120 -extern AString & CreateHexDump(AString & a_Out, const void * a_Data, int a_Size, int a_BytesPerLine); +extern AString & CreateHexDump(AString & a_Out, const void * a_Data, size_t a_Size, size_t a_BytesPerLine); /// Returns a copy of a_Message with all quotes and backslashes escaped by a backslash extern AString EscapeString(const AString & a_Message); // tolua_export @@ -79,10 +79,10 @@ extern AString URLDecode(const AString & a_String); // Cannot export to Lua aut extern AString ReplaceAllCharOccurrences(const AString & a_String, char a_From, char a_To); // Needn't export to Lua, since Lua doesn't have chars anyway /// Decodes a Base64-encoded string into the raw data -extern AString Base64Decode(const AString & a_Base64String); +extern AString Base64Decode(const AString & a_Base64String); // Exported manually due to embedded NULs and extra parameter /// Encodes a string into Base64 -extern AString Base64Encode(const AString & a_Input); +extern AString Base64Encode(const AString & a_Input); // Exported manually due to embedded NULs and extra parameter /// Reads two bytes from the specified memory location and interprets them as BigEndian short extern short GetBEShort(const char * a_Mem); diff --git a/src/UI/WindowOwner.h b/src/UI/WindowOwner.h index d41abf66d..e3c73edc4 100644 --- a/src/UI/WindowOwner.h +++ b/src/UI/WindowOwner.h @@ -33,6 +33,10 @@ public: { } + virtual ~cWindowOwner() + { + } + void CloseWindow(void) { m_Window = NULL; diff --git a/src/Vector3.h b/src/Vector3.h index ba4abe3eb..a00e14508 100644 --- a/src/Vector3.h +++ b/src/Vector3.h @@ -121,6 +121,13 @@ public: z += a_Z; } + inline void Move(const Vector3<T> & a_Diff) + { + x += a_Diff.x; + y += a_Diff.y; + z += a_Diff.z; + } + // tolua_end inline void operator += (const Vector3<T> & a_Rhs) diff --git a/src/WebAdmin.cpp b/src/WebAdmin.cpp index 402cd3035..cd141f7eb 100644 --- a/src/WebAdmin.cpp +++ b/src/WebAdmin.cpp @@ -490,7 +490,7 @@ void cWebAdmin::OnRequestBegun(cHTTPConnection & a_Connection, cHTTPRequest & a_ -void cWebAdmin::OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) +void cWebAdmin::OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) { UNUSED(a_Connection); cRequestData * Data = (cRequestData *)(a_Request.GetUserData()); @@ -537,7 +537,7 @@ void cWebAdmin::OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cWebAdmin::cWebadminRequestData -void cWebAdmin::cWebadminRequestData::OnBody(const char * a_Data, int a_Size) +void cWebAdmin::cWebadminRequestData::OnBody(const char * a_Data, size_t a_Size) { m_Form.Parse(a_Data, a_Size); } diff --git a/src/WebAdmin.h b/src/WebAdmin.h index a2a07a543..d5e45828f 100644 --- a/src/WebAdmin.h +++ b/src/WebAdmin.h @@ -151,7 +151,7 @@ protected: virtual ~cRequestData() {} // Force a virtual destructor in all descendants /** Called when a new chunk of body data is received */ - virtual void OnBody(const char * a_Data, int a_Size) = 0; + virtual void OnBody(const char * a_Data, size_t a_Size) = 0; } ; /** The body handler for requests in the "/webadmin" and "/~webadmin" paths */ @@ -169,14 +169,14 @@ protected: } // cRequestData overrides: - virtual void OnBody(const char * a_Data, int a_Size) override; + virtual void OnBody(const char * a_Data, size_t a_Size) override; // cHTTPFormParser::cCallbacks overrides. Files are ignored: - virtual void OnFileStart(cHTTPFormParser &, const AString & a_FileName) override + virtual void OnFileStart(cHTTPFormParser &, const AString & a_FileName) override { UNUSED(a_FileName); } - virtual void OnFileData(cHTTPFormParser &, const char * a_Data, int a_Size) override + virtual void OnFileData(cHTTPFormParser &, const char * a_Data, size_t a_Size) override { UNUSED(a_Data); UNUSED(a_Size); @@ -216,7 +216,7 @@ protected: // cHTTPServer::cCallbacks overrides: virtual void OnRequestBegun (cHTTPConnection & a_Connection, cHTTPRequest & a_Request) override; - virtual void OnRequestBody (cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) override; + virtual void OnRequestBody (cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) override; virtual void OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) override; } ; // tolua_export diff --git a/src/World.cpp b/src/World.cpp index 3f157157a..c188fd522 100644 --- a/src/World.cpp +++ b/src/World.cpp @@ -60,9 +60,6 @@ -/// Up to this many m_SpreadQueue elements are handled each world tick -const int MAX_LIGHTING_SPREAD_PER_TICK = 10; - const int TIME_SUNSET = 12000; const int TIME_NIGHT_START = 13187; const int TIME_NIGHT_END = 22812; @@ -2996,7 +2993,6 @@ int cWorld::CreateProjectile(double a_PosX, double a_PosY, double a_PosZ, cProje delete Projectile; return -1; } - BroadcastSpawnEntity(*Projectile); return Projectile->GetUniqueID(); } diff --git a/src/World.h b/src/World.h index b85171e4e..e08ef7f53 100644 --- a/src/World.h +++ b/src/World.h @@ -497,16 +497,16 @@ public: /** Does an explosion with the specified strength at the specified coordinate a_SourceData exact type depends on the a_Source: - | esOther | void * | - | esPrimedTNT | cTNTEntity * | - | esMonster | cMonster * | - | esBed | cVector3i * | - | esEnderCrystal | Vector3i * | - | esGhastFireball | cGhastFireball * | - | esWitherSkullBlack | TBD | - | esWitherSkullBlue | TBD | - | esWitherBirth | TBD | - | esPlugin | void * | + | esOther | void * | + | esPrimedTNT | cTNTEntity * | + | esMonster | cMonster * | + | esBed | cVector3i * | + | esEnderCrystal | Vector3i * | + | esGhastFireball | cGhastFireball * | + | esWitherSkullBlack | TBD | + | esWitherSkullBlue | TBD | + | esWitherBirth | cMonster * | + | esPlugin | void * | */ virtual void DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_BlockY, double a_BlockZ, bool a_CanCauseFire, eExplosionSource a_Source, void * a_SourceData) override; // tolua_export @@ -646,9 +646,9 @@ public: // Various queues length queries (cannot be const, they lock their CS): inline int GetGeneratorQueueLength (void) { return m_Generator.GetQueueLength(); } // tolua_export - inline int GetLightingQueueLength (void) { return m_Lighting.GetQueueLength(); } // tolua_export - inline int GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); } // tolua_export - inline int GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); } // tolua_export + inline size_t GetLightingQueueLength (void) { return m_Lighting.GetQueueLength(); } // tolua_export + inline size_t GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); } // tolua_export + inline size_t GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); } // tolua_export void InitializeSpawn(void); diff --git a/src/WorldStorage/FastNBT.h b/src/WorldStorage/FastNBT.h index 1b8b09c21..5e5af3ca3 100644 --- a/src/WorldStorage/FastNBT.h +++ b/src/WorldStorage/FastNBT.h @@ -122,33 +122,33 @@ public: int GetRoot(void) const {return 0; } /** Returns the first child of the specified tag, or -1 if none / not applicable. */ - int GetFirstChild (int a_Tag) const { return m_Tags[a_Tag].m_FirstChild; } + int GetFirstChild (int a_Tag) const { return m_Tags[(size_t)a_Tag].m_FirstChild; } /** Returns the last child of the specified tag, or -1 if none / not applicable. */ - int GetLastChild (int a_Tag) const { return m_Tags[a_Tag].m_LastChild; } + int GetLastChild (int a_Tag) const { return m_Tags[(size_t)a_Tag].m_LastChild; } /** Returns the next sibling of the specified tag, or -1 if none. */ - int GetNextSibling(int a_Tag) const { return m_Tags[a_Tag].m_NextSibling; } + int GetNextSibling(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_NextSibling; } /** Returns the previous sibling of the specified tag, or -1 if none. */ - int GetPrevSibling(int a_Tag) const { return m_Tags[a_Tag].m_PrevSibling; } + int GetPrevSibling(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_PrevSibling; } /** Returns the length of the tag's data, in bytes. Not valid for Compound or List tags! */ int GetDataLength (int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type != TAG_List); - ASSERT(m_Tags[a_Tag].m_Type != TAG_Compound); - return m_Tags[a_Tag].m_DataLength; + ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_List); + ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_Compound); + return m_Tags[(size_t)a_Tag].m_DataLength; } /** Returns the data stored in this tag. Not valid for Compound or List tags! */ const char * GetData(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type != TAG_List); - ASSERT(m_Tags[a_Tag].m_Type != TAG_Compound); - return m_Data + m_Tags[a_Tag].m_DataStart; + ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_List); + ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_Compound); + return m_Data + m_Tags[(size_t)a_Tag].m_DataStart; } /** Returns the direct child tag of the specified name, or -1 if no such tag. */ @@ -163,47 +163,47 @@ public: /** Returns the child tag of the specified path (Name1\Name2\Name3...), or -1 if no such tag. */ int FindTagByPath(int a_Tag, const AString & a_Path) const; - eTagType GetType(int a_Tag) const { return m_Tags[a_Tag].m_Type; } + eTagType GetType(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_Type; } /** Returns the children type for a List tag; undefined on other tags. If list empty, returns TAG_End. */ eTagType GetChildrenType(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_List); - return (m_Tags[a_Tag].m_FirstChild < 0) ? TAG_End : m_Tags[m_Tags[a_Tag].m_FirstChild].m_Type; + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_List); + return (m_Tags[(size_t)a_Tag].m_FirstChild < 0) ? TAG_End : m_Tags[(size_t)m_Tags[(size_t)a_Tag].m_FirstChild].m_Type; } /** Returns the value stored in a Byte tag. Not valid for any other tag type. */ inline unsigned char GetByte(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Byte); - return (unsigned char)(m_Data[m_Tags[a_Tag].m_DataStart]); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Byte); + return (unsigned char)(m_Data[(size_t)m_Tags[(size_t)a_Tag].m_DataStart]); } /** Returns the value stored in a Short tag. Not valid for any other tag type. */ inline Int16 GetShort(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Short); - return GetBEShort(m_Data + m_Tags[a_Tag].m_DataStart); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Short); + return GetBEShort(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); } /** Returns the value stored in an Int tag. Not valid for any other tag type. */ inline Int32 GetInt(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Int); - return GetBEInt(m_Data + m_Tags[a_Tag].m_DataStart); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Int); + return GetBEInt(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); } /** Returns the value stored in a Long tag. Not valid for any other tag type. */ inline Int64 GetLong(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Long); - return NetworkToHostLong8(m_Data + m_Tags[a_Tag].m_DataStart); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Long); + return NetworkToHostLong8(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); } /** Returns the value stored in a Float tag. Not valid for any other tag type. */ inline float GetFloat(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Float); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Float); // Cause a compile-time error if sizeof(float) != 4 // If your platform produces a compiler error here, you'll need to add code that manually decodes 32-bit floats @@ -212,7 +212,7 @@ public: UNUSED(Check1); UNUSED(Check2); - Int32 i = GetBEInt(m_Data + m_Tags[a_Tag].m_DataStart); + Int32 i = GetBEInt(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); float f; memcpy(&f, &i, sizeof(f)); return f; @@ -228,16 +228,16 @@ public: UNUSED(Check1); UNUSED(Check2); - ASSERT(m_Tags[a_Tag].m_Type == TAG_Double); - return NetworkToHostDouble8(m_Data + m_Tags[a_Tag].m_DataStart); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Double); + return NetworkToHostDouble8(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); } /** Returns the value stored in a String tag. Not valid for any other tag type. */ inline AString GetString(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_String); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_String); AString res; - res.assign(m_Data + m_Tags[a_Tag].m_DataStart, m_Tags[a_Tag].m_DataLength); + res.assign(m_Data + m_Tags[(size_t)a_Tag].m_DataStart, m_Tags[(size_t)a_Tag].m_DataLength); return res; } @@ -245,7 +245,7 @@ public: inline AString GetName(int a_Tag) const { AString res; - res.assign(m_Data + m_Tags[a_Tag].m_NameStart, m_Tags[a_Tag].m_NameLength); + res.assign(m_Data + m_Tags[(size_t)a_Tag].m_NameStart, m_Tags[(size_t)a_Tag].m_NameLength); return res; } diff --git a/src/WorldStorage/FireworksSerializer.h b/src/WorldStorage/FireworksSerializer.h index 5b87bafdb..cbc544a14 100644 --- a/src/WorldStorage/FireworksSerializer.h +++ b/src/WorldStorage/FireworksSerializer.h @@ -89,4 +89,4 @@ public: short m_FlightTimeInTicks; std::vector<int> m_Colours; std::vector<int> m_FadeColours; -};
\ No newline at end of file +}; diff --git a/src/WorldStorage/MapSerializer.cpp b/src/WorldStorage/MapSerializer.cpp index a4a0aab57..df72d1cc9 100644 --- a/src/WorldStorage/MapSerializer.cpp +++ b/src/WorldStorage/MapSerializer.cpp @@ -141,7 +141,11 @@ bool cMapSerializer::LoadMapFromNBT(const cParsedNBT & a_NBT) { eDimension Dimension = (eDimension) a_NBT.GetByte(CurrLine); - ASSERT(Dimension == m_Map->m_World->GetDimension()); + if (Dimension != m_Map->m_World->GetDimension()) + { + // TODO 2014-03-20 xdot: We should store nether maps in nether worlds, e.t.c. + return false; + } } CurrLine = a_NBT.FindChildByName(Data, "width"); diff --git a/src/WorldStorage/NBTChunkSerializer.cpp b/src/WorldStorage/NBTChunkSerializer.cpp index acca96ba8..415693ae2 100644 --- a/src/WorldStorage/NBTChunkSerializer.cpp +++ b/src/WorldStorage/NBTChunkSerializer.cpp @@ -23,6 +23,7 @@ #include "../BlockEntities/FlowerPotEntity.h" #include "../Entities/Entity.h" +#include "../Entities/EnderCrystal.h" #include "../Entities/FallingBlock.h" #include "../Entities/Boat.h" #include "../Entities/Minecart.h" @@ -43,6 +44,7 @@ #include "../Mobs/Slime.h" #include "../Mobs/Skeleton.h" #include "../Mobs/Villager.h" +#include "../Mobs/Wither.h" #include "../Mobs/Wolf.h" #include "../Mobs/Zombie.h" @@ -335,6 +337,17 @@ void cNBTChunkSerializer::AddBoatEntity(cBoat * a_Boat) +void cNBTChunkSerializer::AddEnderCrystalEntity(cEnderCrystal * a_EnderCrystal) +{ + m_Writer.BeginCompound(""); + AddBasicEntity(a_EnderCrystal, "EnderCrystal"); + m_Writer.EndCompound(); +} + + + + + void cNBTChunkSerializer::AddFallingBlockEntity(cFallingBlock * a_FallingBlock) { m_Writer.BeginCompound(""); @@ -422,7 +435,7 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster) case cMonster::mtSquid: EntityClass = "Squid"; break; case cMonster::mtVillager: EntityClass = "Villager"; break; case cMonster::mtWitch: EntityClass = "Witch"; break; - case cMonster::mtWither: EntityClass = "Wither"; break; + case cMonster::mtWither: EntityClass = "WitherBoss"; break; case cMonster::mtWolf: EntityClass = "Wolf"; break; case cMonster::mtZombie: EntityClass = "Zombie"; break; case cMonster::mtZombiePigman: EntityClass = "PigZombie"; break; @@ -501,6 +514,11 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster) m_Writer.AddInt("Profession", ((const cVillager *)a_Monster)->GetVilType()); break; } + case cMonster::mtWither: + { + m_Writer.AddInt("Invul", ((const cWither *)a_Monster)->GetNumInvulnerableTicks()); + break; + } case cMonster::mtWolf: { m_Writer.AddString("Owner", ((const cWolf *)a_Monster)->GetOwner()); @@ -729,6 +747,7 @@ void cNBTChunkSerializer::Entity(cEntity * a_Entity) switch (a_Entity->GetEntityType()) { case cEntity::etBoat: AddBoatEntity ((cBoat *) a_Entity); break; + case cEntity::etEnderCrystal: AddEnderCrystalEntity((cEnderCrystal *) a_Entity); break; case cEntity::etFallingBlock: AddFallingBlockEntity((cFallingBlock *) a_Entity); break; case cEntity::etMinecart: AddMinecartEntity ((cMinecart *) a_Entity); break; case cEntity::etMonster: AddMonsterEntity ((cMonster *) a_Entity); break; diff --git a/src/WorldStorage/NBTChunkSerializer.h b/src/WorldStorage/NBTChunkSerializer.h index c1134cd00..51d104970 100644 --- a/src/WorldStorage/NBTChunkSerializer.h +++ b/src/WorldStorage/NBTChunkSerializer.h @@ -24,6 +24,7 @@ class cChestEntity; class cCommandBlockEntity; class cDispenserEntity; class cDropperEntity; +class cEnderCrystal; class cFurnaceEntity; class cHopperEntity; class cJukeboxEntity; @@ -106,6 +107,7 @@ protected: // Entities: void AddBasicEntity (cEntity * a_Entity, const AString & a_ClassName); void AddBoatEntity (cBoat * a_Boat); + void AddEnderCrystalEntity(cEnderCrystal * a_EnderCrystal); void AddFallingBlockEntity(cFallingBlock * a_FallingBlock); void AddMinecartEntity (cMinecart * a_Minecart); void AddMonsterEntity (cMonster * a_Monster); diff --git a/src/WorldStorage/SchematicFileSerializer.cpp b/src/WorldStorage/SchematicFileSerializer.cpp index ef67fdb13..9d594a084 100644 --- a/src/WorldStorage/SchematicFileSerializer.cpp +++ b/src/WorldStorage/SchematicFileSerializer.cpp @@ -14,6 +14,39 @@ +#ifdef SELF_TEST + +static class cSchematicStringSelfTest +{ +public: + cSchematicStringSelfTest(void) + { + cBlockArea ba; + ba.Create(21, 256, 21); + ba.RelLine(0, 0, 0, 9, 8, 7, cBlockArea::baTypes | cBlockArea::baMetas, E_BLOCK_WOODEN_STAIRS, 1); + AString Schematic; + if (!cSchematicFileSerializer::SaveToSchematicString(ba, Schematic)) + { + assert_test(!"Schematic failed to save!"); + } + cBlockArea ba2; + if (!cSchematicFileSerializer::LoadFromSchematicString(ba2, Schematic)) + { + assert_test(!"Schematic failed to load!"); + } + } +} g_SelfTest; + +#endif + + + + + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// cSchematicFileSerializer: + bool cSchematicFileSerializer::LoadFromSchematicFile(cBlockArea & a_BlockArea, const AString & a_FileName) { // Un-GZip the contents: @@ -197,7 +230,7 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP } // Copy the block types and metas: - int NumBytes = a_BlockArea.m_SizeX * a_BlockArea.m_SizeY * a_BlockArea.m_SizeZ; + int NumBytes = a_BlockArea.GetBlockCount(); if (a_NBT.GetDataLength(TBlockTypes) < NumBytes) { LOG("BlockTypes truncated in the schematic file (exp %d, got %d bytes). Loading partial.", @@ -209,7 +242,7 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP if (AreMetasPresent) { - int NumBytes = a_BlockArea.m_SizeX * a_BlockArea.m_SizeY * a_BlockArea.m_SizeZ; + int NumBytes = a_BlockArea.GetBlockCount(); if (a_NBT.GetDataLength(TBlockMetas) < NumBytes) { LOG("BlockMetas truncated in the schematic file (exp %d, got %d bytes). Loading partial.", @@ -230,9 +263,9 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP AString cSchematicFileSerializer::SaveToSchematicNBT(const cBlockArea & a_BlockArea) { cFastNBTWriter Writer("Schematic"); - Writer.AddShort("Width", a_BlockArea.m_SizeX); - Writer.AddShort("Height", a_BlockArea.m_SizeY); - Writer.AddShort("Length", a_BlockArea.m_SizeZ); + Writer.AddShort("Width", a_BlockArea.m_Size.x); + Writer.AddShort("Height", a_BlockArea.m_Size.y); + Writer.AddShort("Length", a_BlockArea.m_Size.z); Writer.AddString("Materials", "Alpha"); if (a_BlockArea.HasBlockTypes()) { diff --git a/src/WorldStorage/WSSAnvil.cpp b/src/WorldStorage/WSSAnvil.cpp index 7a2366755..48934d074 100644 --- a/src/WorldStorage/WSSAnvil.cpp +++ b/src/WorldStorage/WSSAnvil.cpp @@ -32,6 +32,7 @@ #include "../Mobs/IncludeAllMonsters.h" #include "../Entities/Boat.h" +#include "../Entities/EnderCrystal.h" #include "../Entities/FallingBlock.h" #include "../Entities/Minecart.h" #include "../Entities/Pickup.h" @@ -1057,6 +1058,10 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a { LoadBoatFromNBT(a_Entities, a_NBT, a_EntityTagIdx); } + else if (strncmp(a_IDTag, "EnderCrystal", a_IDTagLength) == 0) + { + LoadEnderCrystalFromNBT(a_Entities, a_NBT, a_EntityTagIdx); + } else if (strncmp(a_IDTag, "FallingBlock", a_IDTagLength) == 0) { LoadFallingBlockFromNBT(a_Entities, a_NBT, a_EntityTagIdx); @@ -1238,7 +1243,7 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a { LoadWitchFromNBT(a_Entities, a_NBT, a_EntityTagIdx); } - else if (strncmp(a_IDTag, "Wither", a_IDTagLength) == 0) + else if (strncmp(a_IDTag, "WitherBoss", a_IDTagLength) == 0) { LoadWitherFromNBT(a_Entities, a_NBT, a_EntityTagIdx); } @@ -1275,6 +1280,20 @@ void cWSSAnvil::LoadBoatFromNBT(cEntityList & a_Entities, const cParsedNBT & a_N +void cWSSAnvil::LoadEnderCrystalFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx) +{ + std::auto_ptr<cEnderCrystal> EnderCrystal(new cEnderCrystal(0, 0, 0)); + if (!LoadEntityBaseFromNBT(*EnderCrystal.get(), a_NBT, a_TagIdx)) + { + return; + } + a_Entities.push_back(EnderCrystal.release()); +} + + + + + void cWSSAnvil::LoadFallingBlockFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx) { int TypeIdx = a_NBT.FindChildByName(a_TagIdx, "TileID"); @@ -2250,6 +2269,12 @@ void cWSSAnvil::LoadWitherFromNBT(cEntityList & a_Entities, const cParsedNBT & a return; } + int CurrLine = a_NBT.FindChildByName(a_TagIdx, "Invul"); + if (CurrLine > 0) + { + Monster->SetNumInvulnerableTicks(a_NBT.GetInt(CurrLine)); + } + a_Entities.push_back(Monster.release()); } diff --git a/src/WorldStorage/WSSAnvil.h b/src/WorldStorage/WSSAnvil.h index 50d0e555e..1773ee882 100644 --- a/src/WorldStorage/WSSAnvil.h +++ b/src/WorldStorage/WSSAnvil.h @@ -148,6 +148,7 @@ protected: void LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_EntityTagIdx, const char * a_IDTag, int a_IDTagLength); void LoadBoatFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx); + void LoadEnderCrystalFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx); void LoadFallingBlockFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx); void LoadPickupFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx); void LoadTNTFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx); |